diff --git a/index.html b/index.html
index 3138d1b4..6f932f7b 100644
--- a/index.html
+++ b/index.html
@@ -14445,7 +14445,7 @@ for (var k = 0; k < b0.split(" AND ").length; k++) {
         function loadFromFile() {
             var input = document.createElement("input");
             input.type = "file";
-            input.accept = ".sbxls,.json,.txt,text/*,application/json";
+            // input.accept = ".sbxls,.json,.txt,text/*,application/json";
             input.addEventListener("change", function(e) {
                 var file = e.target.files[0];
                 var reader = new FileReader();
@@ -15851,7 +15851,7 @@ Landmine, Grenade, Smoke Grenade">?</span> <input type="button" value="OFF" clas
         <!-- <p>If you'd like to support us, consider donating on <a href="https://www.paypal.com/donate/?hosted_button_id=GCX4VHQ7SZWTN" target="_blank">PayPal</a> or <a href="https://cash.app/$emojiartist" target="_blank" title="$emojiartist">CashApp</a>, or subscribing on Discord.</p> -->
         <p>Business inquiries? Education stories? Help needed? Email us at <a href="mailto:contact@r74n.com">contact@R74n.com</a>!</p>
         <p>More links: <a href="https://sandboxels.R74n.com/help" rel="help">Help</a> • <a href="https://sandboxels.R74n.com/tips">Tips</a> • <a href="https://sandboxels.R74n.com/mod-list">Mods</a> • <a href="https://sandboxels.R74n.com/mobile-use">Mobile</a> • <a href="https://sandboxels.R74n.com/offline-use">Offline</a> • <a href="https://R74n.com/privacy">Privacy</a></p>
-        <p>Thanks to: Serioustar, WeiChei, Midi_png, ggod, personman, Trent, u2ce</p>
+        <p>Thanks to: Serioustar, WeiChei, Midi_png, ggod, personman, fnl4y, PitsPower, Trent, u2ce</p>
         <p style="display:none" id="langCredit">Translation by R74n</p>
         <p>Sandboxels is developed by R74n. Check out <a href="https://R74n.com" rel="author" target="_blank">our other projects</a>!</p>
         <script>
diff --git a/mod-list.html b/mod-list.html
index 45665bb6..3f0838ce 100644
--- a/mod-list.html
+++ b/mod-list.html
@@ -112,11 +112,12 @@
 <tr><td>fools.js</td><td>Adds back FOOLS Mode</td><td><a href="https://R74n.com" class="R74nLink">R74n</a></td></tr>
 <tr><td>smooth_water.js</td><td>Changes water mechanics so that it flows in one direction until it bounces off of something</td><td><a href="https://R74n.com" class="R74nLink">R74n</a></td></tr>
 <tr><td>spring.js</td><td>Many nature elements, like sakura trees, butterflies, beehives, and more</td><td><a href="https://R74n.com" class="R74nLink">R74n</a></td></tr>
+<tr><td>survival.js</td><td>With limited resources, you must craft, sell, and buy to progress</td><td><a href="https://R74n.com" class="R74nLink">R74n</a></td></tr>
 <tr><td>velocity.js</td><td>Beta for explosion velocity, and later wind, which may come to the base game in the future</td><td><a href="https://R74n.com" class="R74nLink">R74n</a></td></tr>
 
 <!----><tr><td class="modCat" colspan="3">Tools & Settings</td></tr><!---->
 <tr><td>adjustablepixelsize.js</td><td>Allows you to set the pixelSize with a URL parameter</td><td>Alice</td></tr>
-<tr><td>betaworldgen.js</td><td>adds a more advanced world generation to the game</td><td>Alex</td></tr>
+<tr><td>betaworldgen.js</td><td>adds a more advanced world generation to the game</td><td>Adora</td></tr>
 <tr><td>betterModManager.js</td><td>Improvements to the Mod Manager</td><td>ggod</td></tr>
 <tr><td>betterSettings.js</td><td>Adds additional settings and functionality</td><td>ggod</td></tr>
 <tr><td>betterStats.js</td><td>Separate “real” and “set” TPS, meaning you can see what the TPS actually is, instead of only seeing what it’s set to</td><td>mollthecoder</td></tr>
@@ -167,7 +168,7 @@
 <tr><td>metals.js</td><td>Adds several metals</td><td>Alice</td></tr>
 <tr><td>mixture.js</td><td>Allows many chemicals to be mixed</td><td>lllllllllwith10ls</td></tr>
 <tr><td>more_gold.js</td><td>Adds Green Gold</td><td>pixelegend4</td></tr>
-<tr><td>morechemistry.js</td><td>Adds many new chemicals and compounds as well as some new machines</td><td>Alex</td></tr>
+<tr><td>morechemistry.js</td><td>Adds many new chemicals and compounds as well as some new machines</td><td>Adora</td></tr>
 <tr><td>moreliquids.js</td><td>Adds various liquids</td><td>te-agma-at</td></tr>
 <tr><td>nellfire.js</td><td>Adds a weird transforming flame and several rock types</td><td>Alice</td></tr>
 <tr><td>Neutronium Mod.js</td><td>Variety of scientific elements<br>Explosions</td><td>StellarX20</td></tr>
@@ -234,6 +235,7 @@
 <tr><td>nocancer2.js</td><td>Removes cancer from the game altogether. May be incompatible with other mods that spawn cancer</td><td>mollthecoder</td></tr>
 <tr><td>nograssgrow.js</td><td>Prevents Grass from growing</td><td>mollthecoder</td></tr>
 <tr><td>pizzasstuff.js</td><td>New animals, foods, and plants</td><td>_ilikepizza_</td></tr>
+<tr><td>plants.js</td><td>Adds a wide variety of new plants and fruits</td><td>Adora</td></tr>
 <tr><td>primordial_birthpool.js</td><td>A cross between Primordial Soup and Birthpool. Requires F&M</td><td>Alice</td></tr>
 <tr><td>spring.js</td><td>Many nature elements, like sakura trees, butterflies, beehives, and more</td><td><a href="https://R74n.com" class="R74nLink">R74n</a></td></tr>
 <tr><td>the_ground_og.js</td><td>Simplified and more stable version of the_ground.js</td><td>Alice</td></tr>
@@ -243,13 +245,11 @@
 
 <!----><tr><td class="modCat" colspan="3">Fun & Games</td></tr><!---->
 <tr><td>all_around_fillers.js</td><td>Adds directional Filler variants</td><td>idk73248</td></tr>
-<tr><td>allliquids.js</td><td>Made all elements liquids</td><td>Alex</td></tr>
+<tr><td>allliquids.js</td><td>Made all elements liquids</td><td>Adora</td></tr>
 <tr><td>amogus.js</td><td>Adds a small amogus structure</td><td>Alice</td></tr>
 <tr><td>collab_mod.js</td><td>Created by multiple people, adds random things</td><td>mrapple, ilikepizza, stefanblox</td></tr>
 <tr><td>elem3.js</td><td>Adds all elements and combinations from Elemental 3 [Very Large]</td><td>Sophie</td></tr>
 <tr><td>funny elements 2022-11-15.js</td><td>Adds a few curated randomly-generated elements</td><td>Alice</td></tr>
-<tr><td>funny_liquid_2.js</td><td>Adds urine</td><td>Alice</td></tr>
-<tr><td>funny_liquid_3.js</td><td>Adds vomit</td><td>Alice</td></tr>
 <tr><td>funny_solid.js</td><td>Adds feces</td><td>Alice</td></tr>
 <tr><td>haseulite.js</td><td>Adds Loona-related materials with various properties</td><td>Alice</td></tr>
 <tr><td>iean.js</td><td>Adds lean and its ingredients</td><td>Alice</td></tr>
diff --git a/mods/VCR_OSD_MONO.ttf b/mods/VCR_OSD_MONO.ttf
new file mode 100644
index 00000000..93228149
Binary files /dev/null and b/mods/VCR_OSD_MONO.ttf differ
diff --git a/mods/aChefsDream.js b/mods/aChefsDream.js
index 09ac248d..19a628b3 100644
--- a/mods/aChefsDream.js
+++ b/mods/aChefsDream.js
@@ -1,19 +1,33 @@
 /*
-Created by SquareScreamYT and RealerRaddler
-Thanks to Alice, nousernamefound and Fioushemastor for helping :)
+Created by SquareScreamYT <@918475812884344852> and RealerRaddler <@914371295561535508>
+Thanks to Alice <@697799964985786450>, nousernamefound <@316383921346707468>, Adora the Transfem <@778753696804765696> and Fioushemastor <@738828785482203189> for helping :)
+
+v1.6
+
+me trying to come up with stuff not in plants.js:
 
 Upcoming Features:
 - onions
 - spring onions
 - soy sauce
-- rice
+- rice and porridge (white rice noodles)
 - seaweed and agar
 - pigs, ham and bacon
 - garlic
 - msg
 - stainless steel
-
-v1.5
+- chili
+- pepper plants
+- pineapples
+- mint
+- vanilla
+- cocoa beans and hot chocolate
+- normal cookies and cookie dough
+- cows and beef
+- mangoes and passionfruits
+- celery
+- marshmallows, normal, cooked and burnt
+- broccoli
 
 Changelog (v1.0)
     - added chickens
@@ -218,6 +232,27 @@ Changelog (v1.5)
     - added cookies and cookie dough
     - replaced cooking oil with nut oil
     - added boba and boba dough
+
+
+
+Changelog (v1.6)
+    - added freeze and warm tool
+    - added olive seeds
+    - juice mixing functionality
+    - wine can now be made by mixing grape juice and alcohol
+    - added bananas and related stuff
+        - bananas
+        - hanging banana peduncle and banana peduncle
+        - banana stem and banana stem top
+        - banana leaves
+        - cut banana
+        - banana juice
+        - banana bread
+
+
+
+
+
 */
 
 /*
@@ -227,6 +262,19 @@ elements.test = {
 }
 */
 
+function interpolateRgb(rgb1, rgb2, ratio) {
+    const interpolatedRgb = {
+      r: Math.round(rgb1.r + (rgb2.r - rgb1.r) * ratio),
+      g: Math.round(rgb1.g + (rgb2.g - rgb1.g) * ratio),
+      b: Math.round(rgb1.b + (rgb2.b - rgb1.b) * ratio),
+    };
+    return interpolatedRgb;
+}
+function getRGB(rgb){
+    let rgb2 = rgb.replace(")", "").replace("rgb(", "").replace(/,/g, "r").split("r")
+    return { r: parseInt(rgb2[0]), g: parseInt(rgb2[1]), b: parseInt(rgb2[2]) };
+  }
+
 elements.knife = {
     color: "#adb5bd",
     // other needed properties
@@ -245,6 +293,8 @@ elements.knife = {
     desc: "Use on pixels to cut them, if possible."
 }
 
+eLists.JUICEMIXABLE = ["juice"];
+
 elements.chicken = {
     color: ["#c29046", "#f5d271", "#d4bd7d"],
     behavior: [
@@ -717,6 +767,53 @@ elements.olive = {
     density: 1050,
     isFood: false
 }
+
+elements.olive_seed = {
+    color: "#854610",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "olive_wood" : "olive_branch",pixel.x,pixel.y+1);
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"olive_wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+    behavior: [
+        "XX|XX|XX",
+        "XX|FX%10|XX",
+        "XX|M1|XX",
+    ],
+};
 /*
 elements.cooking_oil = {
     color: "#ffc844",
@@ -951,12 +1048,21 @@ elements.apple_juice = {
     density: 825,
     hidden: true,
     temp: 30,
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#ffde55")
+            }
+        }
+    },
     reactions: {
         "sugar": { elem1:"apple_jam", elem2:null, chance:0.35 },
         "yeast": { elem1:"apple_cider_vinegar", elem2:null, chance:0.35 }
     },
     tempLow: 0
 };
+eLists.JUICEMIXABLE.push("apple_juice");
 
 elements.apple_jam = {
     color: "#ebc034",
@@ -1251,6 +1357,14 @@ elements.orange_seed = {
 
 elements.orange_juice = {
     color: "#ffb326",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#ffde55")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -1264,6 +1378,7 @@ elements.orange_juice = {
     temp: 30,
     tempLow: 0
 };
+eLists.JUICEMIXABLE.push("orange_juice");
 
 elements.orange_peels = {
     color: "#d69c31",
@@ -1708,6 +1823,14 @@ elements.watermelon_flesh = {
 
 elements.watermelon_juice = {
     color: "#eb4034",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#eb4034")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -1721,6 +1844,7 @@ elements.watermelon_juice = {
     temp: 30,
     tempLow: 0
 };
+eLists.JUICEMIXABLE.push("watermelon_juice");
 
 elements.grape = {
     color: ["#b84b65","#a10e69","#a10e95","#8a3eab"],
@@ -1755,6 +1879,14 @@ elements.grape = {
 elements.grape_juice = {
     color: "#6d2282",
     behavior: behaviors.LIQUID,
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel, "#6d2282")
+            }
+        }
+    },
     reactions: {
         "dirt": { elem1: null, elem2: "mud" },
         "sand": { elem1: null, elem2: "wet_sand" },
@@ -1762,6 +1894,7 @@ elements.grape_juice = {
         "seltzer": { elem1: "soda", elem2: "foam" },
         "carbon_dioxide": { elem1: "soda", elem2: "foam" },
         "milk": { elem1: "fruit_milk", elem2: "fruit_milk" },
+        "alcohol": { elem1: "wine", elem2: "wine" },
         "yeast": { elem1: ["wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","cream_of_tartar"], elem2: null, chance:80 },
     },
     tempHigh: 160,
@@ -1774,6 +1907,7 @@ elements.grape_juice = {
     hidden: true,
     isFood: true
 };
+eLists.JUICEMIXABLE.push("grape_juice");
 
 elements.cream_of_tartar = {
     color: ["#EFEFEF", "#EBEBEB", "#D8D8D6"],
@@ -1817,6 +1951,14 @@ elements.wine = {
     behavior: behaviors.LIQUID,
     category: "liquids",
     state: "liquid",
+    /*onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel, "#6D0112")
+            }
+        }
+    },*/
     tempHigh: 100,
     stateHigh: "steam",
     isFood: true,
@@ -1824,6 +1966,7 @@ elements.wine = {
     hidden: true,
     tempLow: 0
 }
+//eLists.JUICEMIXABLE.push("wine");
 
 elements.shrimp = {
     color: ["#EE5422", "#E9683C", "#F3583F", "#EDA270"],
@@ -2118,6 +2261,14 @@ elements.cut_coconut = {
 
 elements.coconut_juice = {
     color: "#e9ebe4",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#e9ebe4")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     reactions: {
         "dirt": { elem1: null, elem2: "mud" },
@@ -2135,6 +2286,7 @@ elements.coconut_juice = {
     hidden: true,
     isFood: true
 }
+eLists.JUICEMIXABLE.push("coconut_juice");
 
 elements.lemon_wood = {
     color: "#786531",
@@ -2224,6 +2376,14 @@ elements.lemon = {
 
 elements.lemon_juice = {
     color: "#e0d358",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#e0d358")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -2241,9 +2401,18 @@ elements.lemon_juice = {
         "sugar": {elem1:"lemonade", elem2: "null", chance:0.35}
     }
 };
+eLists.JUICEMIXABLE.push("lemon_juice");
 
 elements.lemonade = {
     color: "#fff378",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#fff378")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -2259,6 +2428,8 @@ elements.lemonade = {
     tempLow: 0
 };
 
+eLists.JUICEMIXABLE.push("lemonade");
+
 elements.lemon_zest = {
     color: "#dbc535",
     behavior: behaviors.POWDER,
@@ -2444,6 +2615,14 @@ elements.carrot = {
 
 elements.carrot_juice = {
     color: "#f5a742",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#f5a742")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -2457,9 +2636,18 @@ elements.carrot_juice = {
     hidden: true,
     temp: 30,
 };
+eLists.JUICEMIXABLE.push("carrot_juice");
 
 elements.apple_cider_vinegar = {
     color: "#fffe75",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#fffe75")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -2473,6 +2661,7 @@ elements.apple_cider_vinegar = {
     temp: 30,
     tempLow: 0
 };
+eLists.JUICEMIXABLE.push("apple_cider_vinegar");
 
 elements.turnip_seed = {
     color: "#994828",
@@ -2593,6 +2782,14 @@ elements.turnip = {
 
 elements.turnip_juice = {
     color: "#700f5d",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#700f5d")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -2606,6 +2803,7 @@ elements.turnip_juice = {
     hidden: true,
     temp: 30,
 };
+eLists.JUICEMIXABLE.push("turnip_juice");
 
 elements.corn = {
     color: ["#f8d223","#d6ba2a","#f7f5ba","#dbd281","#cdb12d"],
@@ -2644,8 +2842,8 @@ elements.corn_starch = {
         "seltzer": { elem1: "dough", elem2: null },
         "pool_water": { elem1: "dough", elem2: null },
         "juice": { elem1: "dough", elem2: null },
-        "yolk": { elem1: "batter", elem2: null },
-        "yogurt": { elem1: "batter", elem2: null },
+        "yolk": { elem1: "cookie_dough", elem2: null, color1:"#dbd19a" },
+        "yogurt": { elem1: "cookie_dough", elem2: null, color1:"#dbd19a" },
         "broth": { elem1:"dough", elem2:null },
         "soda": { elem1:"dough", elem2:null },
         "tea": { elem1:"dough", elem2:null },
@@ -2941,6 +3139,14 @@ elements.strawberry = {
 }
 elements.strawberry_juice = {
     color: "#e03a3a",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#e03a3a")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -2957,6 +3163,7 @@ elements.strawberry_juice = {
         "sugar": { elem1:"strawberry_jam", elem2:null, chance:0.35 },
     },
 };
+eLists.JUICEMIXABLE.push("strawberry_juice");
 
 elements.cream = {
     color: "#f7f7f7",
@@ -3152,6 +3359,14 @@ elements.ginger_leaves = {
 }
 elements.ginger_juice = {
     color: "#ccc056",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#ccc056")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -3169,6 +3384,7 @@ elements.ginger_juice = {
         "bread": { elem1:"gingerbread", elem2:null },
     },
 };
+eLists.JUICEMIXABLE.push("ginger_juice");
 
 
 elements.blueberry_seed = {
@@ -3314,6 +3530,14 @@ elements.blueberry = {
 }
 elements.blueberry_juice = {
     color: "#5030a1",
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#5030a1")
+            }
+        }
+    },
     behavior: behaviors.LIQUID,
     category: "liquids",
     tempHigh: 100,
@@ -3331,6 +3555,8 @@ elements.blueberry_juice = {
         "milk": { elem1:"fruit_milk", elem2:null, chance:0.35, color1: "#995fb3" },
     },
 };
+
+eLists.JUICEMIXABLE.push("blueberry_juice");
 /*
 elements.fruit_slushie = {
     color: "#ffcc54",
@@ -3399,7 +3625,8 @@ elements.cut_blueberry = {
     burn:15,
     burnTime:60,
     burnInto: "dead_plant",
-    breakInto: "blueberry_juice",
+    breakInto: "juice",
+    breakIntoColor:"#add69a",
     state: "solid",
     density: 1050,
     hidden: true
@@ -3437,7 +3664,7 @@ elements.cookie_dough = {
     category: "food",
     tempHigh: 94,
     stateHigh: "cookie",
-    stateHighColorMultiplier: 0.8,
+    stateHighColorMultiplier: 1.1,
     burn:40,
     burnTime:25,
     burnInto:"ash",
@@ -3465,7 +3692,7 @@ elements.cookie = {
 
 elements.nut_oil.name = "cooking_oil"
 
-// elements.fire.temp = 130
+elements.fire.temp = 130
 
 elements.bread.behavior = behaviors.SUPPORT
 
@@ -3504,6 +3731,492 @@ elements.boba = {
     burnInto: ["smoke","smoke","smoke","ash"],
     breakIntoColor: "#7d6216",
     state: "solid",
-    density: 644,
+    density: 1500,
+    isFood: true
+}
+elements.caramel.density = 1500
+elements.freeze = {
+    color: ["#42cbf5", "#42cbf5", "#42cbf5", "#75d3f0", "#42cbf5"],
+    tool: function (pixel) {
+        if (!shiftDown) {
+            pixel.temp -= 0.2;
+            pixelTempCheck(pixel);
+        } else {
+            pixel.temp -= 200;
+            pixelTempCheck(pixel);
+        }
+    },
+    category: "energy",
+    canPlace: false,
+    excludeRandom: true,
+    desc: "Use on pixels to freeze them."
+};
+elements.warm = {
+    color: ["#c7634a", "#c7634a", "#c7634a", "#e38f7b", "#c7634a"],
+    tool: function (pixel) {
+        if (!shiftDown) {
+            pixel.temp += 0.2;
+            pixelTempCheck(pixel);
+        } else {
+            pixel.temp += 200;
+            pixelTempCheck(pixel);
+        }
+    },
+    category: "energy",
+    canPlace: false,
+    excludeRandom: true,
+    desc: "Use on pixels to warm them."
+};
+/*
+elements.pineapple_seed = {
+    color: "#695531",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (pixel.temp < 100 && pixel.temp > 20) {
+                if (Math.random() < 0.02 && pixel.age > 50) {
+                    if (!outOfBounds(pixel.x,pixel.y+1)) {
+                        var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                        if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                            changePixel(dirtPixel,"root");
+                            pixel.leaflength = pixel.leaflength+Math.round(Math.random())
+                        }
+                    }
+                    if (isEmpty(pixel.x,pixel.y-1) && pixel.leafgrown==false) {
+                        movePixel(pixel,pixel.x,pixel.y-1);
+                        createPixel("pineapple_leaves",pixel.x,pixel.y+1);
+                        if (isEmpty(pixel.x,pixel.y-1)) {
+                            createPixel("pineapple",pixel.x,pixel.y-1);
+                        }
+                        if (isEmpty(pixel.x+1,pixel.y) && Math.random() < 0.5) {
+                            createPixel("pineapple_leaves",pixel.x+1,pixel.y);
+                            if (isEmpty(pixel.x+2,pixel.y-1) && Math.random() < 0.5) {
+                                createPixel("pineapple_leaves",pixel.x+2,pixel.y-1);
+                                if (pixel.leaflength == 4 && isEmpty(pixel.x+3,pixel.y-2) && Math.random() < 0.5) {
+                                    createPixel("pineapple_leaves",pixel.x+3,pixel.y-2);
+                                    pixel.leafgrown = true
+                                }
+                            }
+                        }
+                        if (isEmpty(pixel.x-1,pixel.y) && Math.random() < 0.5) {
+                            createPixel("pineapple_leaves",pixel.x-1,pixel.y);
+                            if (isEmpty(pixel.x-2,pixel.y-1) && Math.random() < 0.5) {
+                                createPixel("pineapple_leaves",pixel.x-2,pixel.y-1);
+                                if (pixel.leaflength = 3) {
+                                    pixel.leafgrown = true
+                                }
+                                if (pixel.leaflength = 4 && isEmpty(pixel.x-3,pixel.y-2) && isEmpty(pixel.x+3,pixel.y-2) && Math.random() < 0.5) {
+                                    createPixel("pineapple_leaves",pixel.x-3,pixel.y-2);
+                                    createPixel("pineapple_leaves",pixel.x+3,pixel.y-2);
+                                    pixel.leafgrown = true
+                                }
+                            }
+                        }
+                    }
+                }
+                else if (pixel.age > 500 && leafgrown == true && Math.random() < 0.1) {
+                    changePixel(pixel,"pineapple_leaves");
+                }
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+        "leaflength":3,
+        "leafgrown":false,
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+    temp:25,
+    behavior: [
+        "XX|XX|XX",
+        "XX|FX%10|XX",
+        "XX|M1|XX",
+    ],
+};
+*//*
+function averageHexColor(color1, color2) {
+    const rgb1 = hexToRgb(color1);
+    const rgb2 = hexToRgb(color2);
+    const avgRed = Math.floor((rgb1[0] + rgb2[0]) / 2);
+    const avgGreen = Math.floor((rgb1[1] + rgb2[1]) / 2);
+    const avgBlue = Math.floor((rgb1[2] + rgb2[2]) / 2);
+    const avgHex = rgbToHex(avgRed, avgGreen, avgBlue);
+    return avgHex;
+}
+
+function hexToRgb(hex) {
+    hex = hex.replace(/^#/, '');
+    const r = parseInt(hex.substring(0, 2), 16);
+    const g = parseInt(hex.substring(2, 4), 16);
+    const b = parseInt(hex.substring(4, 6), 16);
+    return [r, g, b];
+}
+
+function rgbToHex(r, g, b) {
+    const rHex = r.toString(16).padStart(2, '0');
+    const gHex = g.toString(16).padStart(2, '0');
+    const bHex = b.toString(16).padStart(2, '0');
+    return `${rHex}${gHex}${bHex}`;
+}
+*/
+// test
+//var color1 = "#FF0000";
+//var color2 = "#0000FF";
+//var averageColor = averageHexColor(color1, color2);
+//console.log(averageColor)
+/*
+eLists.JUICEMIXABLE.forEach(function(element){
+    elements[element].onMix = function(pixel1,pixel2) {
+    if (shiftDown && eLists.JUICEMIXABLE.indexOf(pixel2.element) !== -1) {
+        if (Math.random() < 0.2) {
+            var hex1 = pixel1.color
+            var hex2 = pixel2.color
+            let rgb = pixel.color.replace("rgb(", "").replace(")", "").split(",");
+            let rgbObj = { r: parseInt(rgb[0]), g: parseInt(rgb[1]), b: parseInt(rgb[2]) } //use this as one of the rgb objects
+            var finalJuiceColor = interpolatedRgb(hex1,hex2,0.5)
+            changePixel(pixel1,"juice")
+            //pixel1.color = pixelColorPick(pixel,finalJuiceColor)
+            pixel1.color = rgb(rgbObj)
+        }
+    }
+}
+})*/
+elements.juice.onMix = function(pixel){
+    let num = Math.floor(Math.random() * 4);
+    let x = pixel.x + adjacentCoords[num][0];
+    let y = pixel.y + adjacentCoords[num][1];
+    if(!isEmpty(x,y) && !outOfBounds(x,y)){
+      let pixel2 = pixelMap[x][y];
+      if(pixel.color != pixel2.color && pixel2.element == "juice"){
+        let condition;
+        if(shiftDown == 0){
+          condition = (Math.floor(Math.random() * 2) == 1); 
+        } else {
+          condition = true; 
+        }
+        if(condition){
+          let newrgb = interpolateRgb(getRGB(pixel.color), getRGB(pixel2.color), 0.5);
+          pixel.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+          pixel2.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+        }
+      }
+    }
+  }
+
+elements.juice.stain = 0
+
+elements.banana_seed = {
+    color: "#594129",
+    tick: function(pixel) {
+            if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1) && pixel.height < 7) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel("banana_stem",pixel.x,pixel.y+1);
+                    
+                    pixel.height++
+                }
+            }
+            else if (pixel.age > 150 && pixel.height > 6 && Math.random() < 0.1) {
+                changePixel(pixel,"banana_tree_top");
+            }
+            pixel.age++;
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+        "height": 0
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+    behavior: [
+        "XX|XX|XX",
+        "XX|XX|XX",
+        "XX|M1|XX",
+    ],
+};
+elements.banana_stem = {
+    color: "#698215",
+    behavior: behaviors.WALL,
+    tempHigh: 400,
+    stateHigh: ["ember","charcoal","fire","fire","fire"],
+    category: "life",
+    burn: 5,
+    burnTime: 300,
+    burnInto: ["ember","charcoal","fire"],
+    state: "solid",
+    hardness: 0.15,
+    breakInto: "sawdust",
+    breakIntoColor: ["#dba66e","#cc8a64"],
+    hidden: true
+}
+elements.banana_tree_top = {
+    color: "#718a21",
+    behavior: behaviors.WALL,
+    tempHigh: 400,
+    stateHigh: ["ember","charcoal","fire","fire","fire"],
+    category: "life",
+    burn: 5,
+    burnTime: 300,
+    burnInto: ["ember","charcoal","fire"],
+    state: "solid",
+    hardness: 0.15,
+    breakInto: "sawdust",
+    breakIntoColor: ["#dba66e","#cc8a64"],
+    properties:{
+        "leftleaves": 0,
+        "rightleaves": 0,
+    },
+    hidden: true,
+    tick: function(pixel) {
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 0) {
+            if (isEmpty(pixel.x+1,pixel.y)) {
+                createPixel("banana_leaves",pixel.x+1,pixel.y);
+
+                pixel.rightleaves++
+            }
+        }
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 1) {
+            if (isEmpty(pixel.x+2,pixel.y)) {
+                createPixel("banana_leaves",pixel.x+2,pixel.y);
+
+                pixel.rightleaves++
+            }
+        }
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 2) {
+            if (isEmpty(pixel.x+3,pixel.y)) {
+                createPixel("banana_leaves",pixel.x+3,pixel.y);
+
+                pixel.rightleaves++
+            }
+        }
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 3) {
+            if (isEmpty(pixel.x+4,pixel.y+1)) {
+                createPixel("banana_leaves",pixel.x+4,pixel.y+1);
+
+                pixel.rightleaves++
+            }
+        }
+
+
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 0) {
+            if (isEmpty(pixel.x-1,pixel.y)) {
+                createPixel("banana_leaves",pixel.x-1,pixel.y);
+
+                pixel.leftleaves++
+            }
+        }
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 1) {
+            if (isEmpty(pixel.x-2,pixel.y)) {
+                createPixel("banana_leaves",pixel.x-2,pixel.y);
+
+                pixel.leftleaves++
+            }
+        }
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 2) {
+            if (isEmpty(pixel.x-3,pixel.y)) {
+                createPixel("banana_leaves",pixel.x-3,pixel.y);
+
+                pixel.leftleaves++
+            }
+        }
+        if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 3) {
+            if (isEmpty(pixel.x-4,pixel.y+1)) {
+                createPixel("banana_leaves",pixel.x-4,pixel.y+1);
+
+                pixel.leftleaves++
+            }
+        }
+
+
+        if (Math.random() < 0.1 && pixel.age > 70 && pixel.temp < 100 && pixel.leftleaves > 0 && pixel.rightleaves > 0) {
+            if (isEmpty(pixel.x+1,pixel.y+2)) {
+                createPixel("banana_peduncle",pixel.x+1,pixel.y+2);
+            }
+        }
+        if (Math.random() < 0.1 && pixel.age > 70 && pixel.temp < 100 && pixel.leftleaves > 0 && pixel.rightleaves > 0) {
+            if (isEmpty(pixel.x-1,pixel.y+2)) {
+                createPixel("banana_peduncle",pixel.x-1,pixel.y+2);
+            }
+        }
+        pixel.age++;
+    doDefaults(pixel);
+    },
+}
+elements.banana_leaves = {
+    color: ["#3da324","#3cbd1c"],
+    reactions: {
+        "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 },
+        "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 },
+        "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 },
+        "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }
+    },
+    category:"life",
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -1.66,
+    stateLow: "frozen_plant",
+    burn:65,
+    burnTime:60,
+    burnInto: "dead_plant",
+    breakInto: "dead_plant",
+    state: "solid",
+    density: 1050,
+    hidden: true
+}
+elements.banana_peduncle = {
+    color: "#8bb81a",
+    behavior: behaviors.WALL,
+    tempHigh: 400,
+    stateHigh: ["ember","charcoal","fire","fire","fire"],
+    category: "life",
+    burn: 5,
+    burnTime: 300,
+    burnInto: ["ember","charcoal","fire"],
+    state: "solid",
+    hardness: 0.15,
+    breakInto: "sawdust",
+    hidden: true,
+    tick: function(pixel) {
+        if (Math.random() < 0.1 && pixel.temp < 100) {
+            if (isEmpty(pixel.x+1,pixel.y+1)) {
+                createPixel("hanging_banana_peduncle",pixel.x+1,pixel.y+1);
+            }
+            if (isEmpty(pixel.x-1,pixel.y+1)) {
+                createPixel("hanging_banana_peduncle",pixel.x-1,pixel.y+1);
+            }
+            if (isEmpty(pixel.x+1,pixel.y+2)) {
+                createPixel("hanging_banana_peduncle",pixel.x+1,pixel.y+2);
+            }
+            if (isEmpty(pixel.x-1,pixel.y+2)) {
+                createPixel("hanging_banana_peduncle",pixel.x-1,pixel.y+2);
+            }
+        }
+        pixel.age++;
+    doDefaults(pixel);
+    },
+}
+elements.hanging_banana_peduncle = {
+    color: "#8bb81a",
+    behavior: [
+        "XX|XX|XX",
+        "CR:banana%0.2|XX|CR:banana%0.2",
+        "XX|XX|XX",
+    ],
+    tempHigh: 400,
+    stateHigh: ["ember","charcoal","fire","fire","fire"],
+    category: "life",
+    burn: 5,
+    burnTime: 300,
+    burnInto: ["ember","charcoal","fire"],
+    state: "solid",
+    hardness: 0.15,
+    breakInto: "sawdust",
+    hidden: true,
+}
+elements.banana = {
+    color: "#ebd834",
+    behavior: [
+        "XX|XX|XX",
+        "ST:hanging_banana_peduncle|XX|ST:hanging_banana_peduncle",
+        "XX|M1|XX",
+    ],
+    category:"food",
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    burn:15,
+    burnTime:60,
+    burnInto: "dead_plant",
+    breakInto: "banana_juice",
+    state: "solid",
+    density: 1050,
+    cutInto: "cut_banana"
+}
+elements.cut_banana = {
+    color: "#f2e56b",
+    behavior: [
+        "XX|XX|XX",
+        "XX|XX|XX",
+        "M2|M1|M2",
+    ],
+    category:"food",
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    burn:15,
+    burnTime:60,
+    burnInto: "dead_plant",
+    breakInto: "banana_juice",
+    state: "solid",
+    density: 1050,
+}
+elements.banana_juice = {
+    color: "#dbc440",
+    behavior: behaviors.LIQUID,
+    category: "liquids",
+    tempHigh: 100,
+    stateHigh: ["steam","sugar"],
+    burn: 70,
+    burnTime: 300,
+    burnInto: ["steam", "smoke"],
+    state: "liquid",
+    density: 825,
+    hidden: true,
+    temp: 30,
+    onMix: function(pixel) {
+        if (shiftDown) {
+            if (Math.random() < 0.2) {
+                changePixel(pixel,"juice")
+                pixel.color = pixelColorPick(pixel,"#dbc440")
+            }
+        }
+    },
+    reactions: {
+        "bread": { elem1:"banana_bread", elem2:null, chance:0.35 },
+    },
+    tempLow: 0
+};
+eLists.JUICEMIXABLE.push("banana_juice");
+
+elements.banana_bread = {
+    color: "#c2782f",
+    desc: "delicious banana bread",
+    behavior: behaviors.STURDYPOWDER,
+    tempHigh: 176,
+    stateHigh: "toast",
+    category: "food",
+    burn: 30,
+    burnTime: 200,
+    burnInto: ["smoke","smoke","smoke","ash"],
+    breakInto: "crumb",
+    state: "solid",
+    density: 233.96,
     isFood: true
 }
diff --git a/mods/a_mod_by_alice.js b/mods/a_mod_by_alice.js
index ddd46a35..873f89a3 100644
--- a/mods/a_mod_by_alice.js
+++ b/mods/a_mod_by_alice.js
@@ -1163,10 +1163,11 @@ try {
 			};
 
 			function convertHslObjects(color,outputType="rgb") {
+				if(color == null) { console.error("convertHslObjects: Color is null"); color = {h: 300, s: 100, l: 50} };
 				switch(outputType.toLowerCase()) {
 					//RGB cases
 					case "rgb":
-						color = hexToRGB(hslToHex(...Object.values(color))); //hsl to hex, hex to rgb_json, and rgb_json to rgb()
+						color = convertColorFormats(hslToHex(...Object.values(color)),"json"); //hsl to hex, hex to rgb_json, and rgb_json to rgb()
 						return `rgb(${color.r},${color.g},${color.b})`;
 						break;
 					case "hex":
@@ -1202,8 +1203,8 @@ try {
 						break;
 					default:
 						throw new Error("outputType must be \"rgb\", \"hex\", \"rgb_json\", \"rgb_array\", \"hsl\", \"hsl_json\", or \"hsl_array\"");
-				};
-			}
+				}
+			};
 
 			function changeSaturation(color,saturationChange,operationType="add",outputType="rgb",arrayType=null,doRounding=true) {
 				color = normalizeColorToHslObject(color,arrayType);
@@ -2094,13 +2095,15 @@ try {
 
 			//fix -1-caused ghost pixels
 			function deletePixel(x,y) {
+				if(isEmpty(x,y,true)) { return false };
 				// remove pixelMap[x][y] from currentPixels
 				var pixelIndex = currentPixels.indexOf(pixelMap[x][y]);
 				if(pixelIndex !== -1) {
 					currentPixels.splice(pixelIndex,1)
+					if (pixelMap[x][y]) { delete pixelMap[x][y] };
 				};
-				if (pixelMap[x][y]) {pixelMap[x][y].del = true}
-				if (pixelMap[x][y]) { delete pixelMap[x][y] };
+				//if (pixelMap[x][y]) {pixelMap[x][y].del = true}
+				//if (pixelMap[x][y]) { delete pixelMap[x][y] };
 				/*for (var i = 0; i < currentPixels.length; i++) {
 					if (currentPixels[i].x == x && currentPixels[i].y == y) {
 						currentPixels.splice(i, 1);
@@ -2133,9 +2136,9 @@ try {
 				};
 			};
 
-		function capitalizeFirstLetter(string,locale=null) {
-			return string[0][locale ? "toLocaleUpperCase" : "toUpperCase"](locale) + string.slice(1)
-		};
+			function capitalizeFirstLetter(string,locale=null) {
+				return string[0][locale ? "toLocaleUpperCase" : "toUpperCase"](locale) + string.slice(1)
+			};
 
 	//COLOR MANIPULATION TOOLS ##
 
@@ -3217,6 +3220,32 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 			}
 		};
 
+		//redefine mouseRange to support even sizes
+        function mouseRange(mouseX,mouseY,size) {
+            var coords = [];
+            size = size || mouseSize;
+            if (elements[currentElement].maxSize < mouseSize) {
+                var mouseOffset = Math.trunc(elements[currentElement].maxSize/2);
+            }
+            else {
+                var mouseOffset = Math.trunc(size/2);
+            }
+            var topLeft = [mouseX-mouseOffset,mouseY-mouseOffset];
+            var bottomRight = [mouseX+mouseOffset,mouseY+mouseOffset];
+			if(size % 2 == 0) {
+				bottomRight[0]--;
+				bottomRight[1]--;
+			};
+            // Starting at the top left, go through each pixel
+            for (var x = topLeft[0]; x <= bottomRight[0]; x++) {
+                for (var y = topLeft[1]; y <= bottomRight[1]; y++) {
+                    // If the pixel is empty, add it to coords
+                    coords.push([x,y]);
+                }
+            }
+            return coords;
+        };
+
 		//this part defines basically all of the keybinds
 		function addKeyboardListeners() {
 			document.addEventListener("keydown", function(e) {
@@ -3259,16 +3288,26 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 					}
 					return;
 				}
+				// If the user presses [ or -, decrease the mouse size by 2
 				if (e.keyCode == 219 || e.keyCode == 189) {
-					if (shiftDown) {mouseSize = 1}
+					//If a shift key is pressed, set to 1
+					if (shiftDown && shiftDown % 2 == 1) {mouseSize = 1}
+					//If an alt key is pressed, decrease by 1
+					else if (shiftDown && shiftDown % 2 == 0) { 
+						mouseSize--;
+						if (mouseSize < 1) { mouseSize = 1 }
+					}
 					else {
 						mouseSize -= 2;
-						if (mouseSize < 1) { mouseSize = 1; }
+						if (mouseSize < 1) { mouseSize = 1 }
 					}
 				}
 				// If the user presses ] or =, increase the mouse size by 2
 				if (e.keyCode == 221 || e.keyCode == 187) {
-					if (shiftDown) {mouseSize = (mouseSize+15)-((mouseSize+15) % 15)}
+					//If a shift key is pressed, increase by 15
+					if (shiftDown && shiftDown % 2 == 1) {mouseSize = (mouseSize+15)-((mouseSize+15) % 15)}
+					//If an alt key is pressed, increase by 1
+					else if (shiftDown && shiftDown % 2 == 0) {mouseSize++}
 					else {mouseSize += 2;}
 					// if height>width and mouseSize>height, set mouseSize to height, if width>height and mouseSize>width, set mouseSize to width
 					if (mouseSize > (height > width ? height : width)) { mouseSize = (height > width ? height : width); }
@@ -3607,6 +3646,11 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 		velocityBlacklist = [];
 
 		function explodeAtPlus(x,y,radius,firee="fire",smokee="smoke",beforeFunction=null,afterFunction=null,changeTemp=true) {
+			var message = "Explosion ";
+			var pixel = pixelMap[x]?.[y];
+			if(pixel) { message += `of ${pixel.element} ` };
+			message += `with radius ${radius} at (${x},${y})`;
+			
 			// if fire contains , split it into an array
 			if(firee !== null) {
 				if (firee.indexOf(",") !== -1) {
@@ -3730,6 +3774,15 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 		};
 
 		oldExplodeAt = explodeAt;
+		/*explodeAt = function(x,y,radius,fire="fire") {
+			var message = "Explosion ";
+			var pixel = pixelMap[x]?.[y];
+			if(pixel) { message += `of ${pixel.element} ` };
+			message += `with radius ${radius} with "${fire}" at (${x},${y})`;
+			console.log(message);
+			
+			oldExplodeAt(x,y,radius,fire="fire")
+		};*/
 		explodeAt = explodeAtPlus;
 
 	//MORE CONFIGURABLE REACTION TEMPERATURE CHANGES ##
@@ -5029,11 +5082,10 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 			if (pixel.charge && elementInfo.colorOn) {
 				customColor = elementInfo.colorOn;
 			}
-			if (customColor != null) {
+			if (customColor !== null) {
 				if (Array.isArray(customColor)) {
 					customColor = customColor[Math.floor(Math.random() * customColor.length)];
-				}
-				if (customColor.startsWith("#")) {
+				} else if (customColor.startsWith?.("#")) {
 					customColor = hexToRGB(customColor);
 				}
 				var rgb = customColor;
@@ -5224,7 +5276,7 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 				if (!settings["bg"]) {ctx.clearRect(0, 0, canvas.width, canvas.height)}
 				else {
 					if(settings["bg"] instanceof Array) {
-						settings.bgAngle ??= 0;
+						settings.bgAngle ??= 90;
 						var angle = (settings.bgAngle) * Math.PI / 180;
 						ctx.fillStyle = ctx.createLinearGradient(
 							0,
@@ -5560,6 +5612,10 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 				}
 				var topLeft = [mousePos.x-mouseOffset,mousePos.y-mouseOffset];
 				var bottomRight = [mousePos.x+mouseOffset,mousePos.y+mouseOffset];
+				if(mouseSize % 2 == 0) {
+					bottomRight[0]--;
+					bottomRight[1]--;
+				};
 				// Draw a square around the mouse
 				ctx.strokeStyle = "white";
 				ctx.strokeRect(topLeft[0]*pixelSize,topLeft[1]*pixelSize,(bottomRight[0]-topLeft[0]+1)*pixelSize,(bottomRight[1]-topLeft[1]+1)*pixelSize);
@@ -7930,7 +7986,7 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 					}
 					//1010 and 0101
 					if(pixel.dc1 && !pixel.dc2 && pixel.dc3 && !pixel.dc4) {
-						if(!pixel.changeTo) {
+						if(!pixel.changeTo) { //7989 yay soshi!
 							if(ggg < 1/2) {
 								pixel.changeTo = pixel.dc1
 							} else {
@@ -8069,7 +8125,7 @@ color1 and color2 spread through striped paint like dye does with itself. <u>col
 								if(isEmpty(pixel.x+1,pixel.y-1) && isEmpty(pixel.x+1,pixel.y-2) && !outOfBounds(pixel.x+1,pixel.y-1) && !outOfBounds(pixel.x+1,pixel.y-2)) {
 									tryMove(pixelMap[pixel.x][pixel.y-1],pixel.x+1,pixel.y-1)
 									tryMove(pixelMap[pixel.x][pixel.y-2],pixel.x+1,pixel.y-2)
-								} //7989 yay soshi!
+								}
 							}
 						} else {
 							if(isEmpty(pixel.x+1,pixel.y-1) && !outOfBounds(pixel.x+1,pixel.y-1)) {
@@ -17191,9 +17247,9 @@ Pixel size (rendering only): <input id="pixelSize"> (Use if the save looks cut o
 		elements.electric_gas = {
 			color: ["#3693b3", "#246e64"],
 			behavior: [
-				"M2%33.3 AND CR:electric%1|M1%33.3 AND CR:electric%1|M2%33.3 AND CR:electric%1",
-				"M1%33.3 AND CR:electric%1|XX%0000000000000000000000|M1%33.3 AND CR:electric%1",
-				"M2%33.3 AND CR:electric%1|M1%33.3 AND CR:electric%1|M2%33.3 AND CR:electric%1",
+				"M2%33.3 AND CR:electric%1 AND CR:lightning%0.005|M1%33.3 AND CR:electric%1 AND CR:lightning%0.005|M2%33.3 AND CR:electric%1 AND CR:lightning%0.005",
+				"M1%33.3 AND CR:electric%1 AND CR:lightning%0.005|XX%000000000000000000000000000000000000000000000|M1%33.3 AND CR:electric%1 AND CR:lightning%0.005",
+				"M2%33.3 AND CR:electric%1 AND CR:lightning%0.005|M1%33.3 AND CR:electric%1 AND CR:lightning%0.005|M2%33.3 AND CR:electric%1 AND CR:lightning%0.005",
 			],
 			hardness: 0.8,
 			reactions: {
@@ -17202,7 +17258,7 @@ Pixel size (rendering only): <input id="pixelSize"> (Use if the save looks cut o
 			},
 			category: "gases",
 			density: 1.225,
-			state: "gas",
+			state: "gas"
 		};
 
 		corrosiveGasMaxHardness = 0.6
@@ -19256,9 +19312,10 @@ Pixel size (rendering only): <input id="pixelSize"> (Use if the save looks cut o
 		*/
 
 		function heejinitoidTick(pixel) {
+			pixel.color ??= pixelColorPick(pixel);
 			if(pixel.oldColor === null) { pixel.oldColor = pixel.color };
 			if(pixel.oldColor === undefined) { pixel.oldColor = pixelColorPick(pixel) };
-			var color = rgbStringToHSL(convertColorFormats(pixel.oldColor,"rgb"),"json");
+			var color = rgbStringToHSL((convertColorFormats(pixel.oldColor,"rgb") ?? pixelColorPick(pixel)),"json");
 			var heejiniteHueSpread = 30 + (pixel.temp/9.25)
 			var hueOffset = (Math.sin(pixelTicks / 11) * heejiniteHueSpread) + 15; color.h += hueOffset;
 			var color = convertHslObjects(color,"rgb");
@@ -26448,6 +26505,8 @@ Pixel size (rendering only): <input id="pixelSize"> (Use if the save looks cut o
 					elements.molten_copper ??= {}; elements.molten_copper.tempHigh = 4700;
 					elements.molten_alumina ??= {};
 					elements.molten_alumina.tempHigh = 5400;
+					elements.molten_alumina.state = "liquid";
+					elements.molten_alumina.autoType = "gas";
 					elements.molten_alumina.reactions ??= {};
 					elements.molten_alumina.reactions.iron_scrap = {elem1: "molten_sapphire", elem2: ["molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron",null] };
 					elements.molten_alumina.reactions.molten_iron = {elem1: "molten_sapphire", elem2: ["molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron",null] };
@@ -35842,7 +35901,7 @@ Make sure to save your command in a file if you want to add this preset again.`
 		};
 
 		elements.sponge.onTryMoveInto = function(pixel,otherPixel) {
-			var absorbedElements = Object.keys(pixel.absorbed);
+			var absorbedElements = Object.keys(pixel.absorbed ?? {});
 			if(absorbedElements.length == 0) {
 				return false;
 			};
@@ -36262,7 +36321,7 @@ Make sure to save your command in a file if you want to add this preset again.`
 									newPixel.vx ??= 0;
 									newPixel.vy ??= 0;
 									newPixel.vx += (pixel.direction * 5)
-									newPixel.vy += 3;
+									newPixel.vy -= 3;
 								};
 							};
 							pixel.fromX += pixel.direction
@@ -36347,7 +36406,7 @@ Make sure to save your command in a file if you want to add this preset again.`
 										newPixel.vx ??= 0;
 										newPixel.vy ??= 0;
 										newPixel.vx += (pixel.direction * 13)
-										newPixel.vy += 6;
+										newPixel.vy -= 6;
 									};
 								};
 								pixel.fromX += pixel.direction
@@ -36444,7 +36503,7 @@ Make sure to save your command in a file if you want to add this preset again.`
 									newPixel.vx ??= 0;
 									newPixel.vy ??= 0;
 									newPixel.vx += (pixel.direction * 6)
-									newPixel.vy += 3;
+									newPixel.vy -= 3;
 								};
 							};
 							pixel.fromX += pixel.direction
@@ -36539,7 +36598,7 @@ Make sure to save your command in a file if you want to add this preset again.`
 										newPixel.vx ??= 0;
 										newPixel.vy ??= 0;
 										newPixel.vx += (pixel.direction * 8)
-										newPixel.vy += 5;
+										newPixel.vy -= 5;
 									};
 								};
 								pixel.fromX += pixel.direction
@@ -45937,6 +45996,67 @@ maxPixels (default 1000): Maximum amount of pixels/changes (if xSpacing and ySpa
 		maxColorOffset: 0
 	};
 	
+	
+	runAfterLoad(function() {
+		//Emergency bug fix
+		elemfillerVar = null;
+		elements.element_filler = {
+			category: "special",
+			color: elements.filler.color,
+			state: "solid",
+			movable: "false",
+			onSelect: function() {
+				var answer6 = prompt("Please input the desired element of this filler. It will not work if you do multiple filter types while paused.",(elemfillerVar||undefined));
+				if (!answer6) { return }
+				elemfillerVar = answer6;
+			},
+			excludeRandom: true,
+			tick: function(pixel){
+				if(!(elementExists(elemfillerVar))) {
+					deletePixel(pixel.x,pixel.y);
+					return
+				};
+				var neighbors = 0;
+				if(!pixel.changeElem){
+					pixel.changeElem = elemfillerVar;
+				}
+				for (var i = 0; i < squareCoords.length; i++) {
+					var coord = squareCoords[i];
+					var x = pixel.x+coord[0];
+					var y = pixel.y+coord[1];
+					if (!isEmpty(x,y, true)) {
+						neighbors = neighbors + 1;
+					} else if (isEmpty(x, y)){
+						createPixel("element_filler", x, y)
+						pixelMap[x][y].changeElem = pixel.changeElem;
+					} else (
+						changePixel(pixel, pixel.changeElem)
+					)
+				}
+				if (neighbors >= 8){
+					changePixel(pixel, pixel.changeElem)
+				}
+			}
+		}
+
+		if(elementExists("ohio")) {
+			elements.ohio.excludeRandom = true
+		};
+		if(elementExists("rainbow_bomb")) {
+			elements.rainbow_bomb.excludeRandom = true
+		};
+		if(elementExists("fart")) {
+			elements.fart.excludeRandom = true
+		};
+		if(elementExists("dark_energy")) {
+			elements.dark_energy.excludeRandom = true
+		};
+		if(elementExists("rainbow_flash")) {
+			elements.rainbow_flash.excludeRandom = true;
+			delete elements.rainbow_flash.reactions.fire
+		};
+	})
+
 	//END ##
 } catch (error) {
 	alert(`Load failed (try reloading).\nThis is likely a sporadic failure caused by inconsistencies in how mods are loaded, and will likely fix itself in a refresh or two. If it persists, then it's an issue.\nError: ${error.stack}`);
diff --git a/mods/allliquids.js b/mods/allliquids.js
index ae92e535..80a6bfd1 100644
--- a/mods/allliquids.js
+++ b/mods/allliquids.js
@@ -1,21 +1,24 @@
+//This mod was made by Adora the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok.
 let liquid = [["XX", "XX", "XX"], ["M1", "XX", "M1"], ["M1", "M2", "M1"]]
-for (var element in elements){
-  
-  let a = elements[element].behavior;
-  console.log(a, elements[element], liquid)
-  if(a != undefined && typeof a != 'function'){
-    let i = 0;
-    while (i < a.length){
-      if(typeof a[i] == "string"){
-        a[i] = a[i].split("|");
-        i += 1;
-      } else {
-        i += 1;
+runAfterLoad(function(){
+  for (var element in elements){
+    elements[element].noMix = false;
+    let a = elements[element].behavior;
+    console.log(a, elements[element], liquid)
+    if(a != undefined && typeof a != 'function'){
+      let i = 0;
+      while (i < a.length){
+        if(typeof a[i] == "string"){
+          a[i] = a[i].split("|");
+          i += 1;
+        } else {
+          i += 1;
+        }
       }
+      elements[element].behavior = [[a[0][0], a[0][1], a[0][2]], [`${a[1][0]} AND M1`, a[1][1], `${a[1][2]} AND M1`], [`${a[2][0]} AND M1`, `${a[2][1]} AND M2`, `${a[2][2]} AND M1`]];
+    } else {
+      elements[element].behavior = liquid;
     }
-    elements[element].behavior = [[a[0][0], a[0][1], a[0][2]], [`${a[1][0]} AND M1`, a[1][1], `${a[1][2]} AND M1`], [`${a[2][0]} AND M1`, `${a[2][1]} AND M2`, `${a[2][2]} AND M1`]];
-  } else {
-    elements[element].behavior = liquid;
+
   }
-  
-}
+});
diff --git a/mods/elem3.js b/mods/elem3.js
index 08a385b9..95e6059d 100644
--- a/mods/elem3.js
+++ b/mods/elem3.js
@@ -170462,7 +170462,7 @@ elements.e15514 = {
     };
 
 elements.e15515 = {
-    name: "Niggah",
+    name: "No",
     behavior: behaviors.LIQUID,
     category: "elem3",
     state: "liquid",
@@ -218466,7 +218466,7 @@ elements.e19879 = {
     };
 
 elements.e19880 = {
-    name: "Nigga",
+    name: "No",
     behavior: behaviors.LIQUID,
     category: "elem3",
     state: "liquid",
diff --git a/mods/funny_liquid.js b/mods/funny_liquid.js
index 2afaed89..821ea0bd 100644
--- a/mods/funny_liquid.js
+++ b/mods/funny_liquid.js
@@ -1,3 +1,8 @@
+/*
+This mod has been moved.
+*/
+
+/*
 elements.cum = { 
 	name: "cum",
 	color: "#e6e1d5",
@@ -610,3 +615,4 @@ runAfterLoad(function() {
 		]
 	};
 });
+*/
\ No newline at end of file
diff --git a/mods/injector.js b/mods/injector.js
index b1697c3d..4c385004 100644
--- a/mods/injector.js
+++ b/mods/injector.js
@@ -4,7 +4,7 @@ var structureMod = "mods/structure_test.js";
 var rbtMod = "mods/randomness_but_tick.js";
 
 if(enabledMods.includes(libraryMod) && enabledMods.includes(structureMod) && enabledMods.includes(rbtMod)) { 
-	var injectorPoisonCategories = ["life","auto creepers","shit","cum","food","fantastic creatures","fey","auto_fey"];
+	var injectorPoisonCategories = ["life","auto creepers","food","fantastic creatures","fey","auto_fey"];
 	var injectorPoisonBlacklist = ["injector_poison","dead_matter","poisoned_dirt"];
 	var injectorPoisonWhitelist = ["blood","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"];
 	var injectorPoisonSubstitutions = {
diff --git a/mods/jaydstuff.js b/mods/jaydstuff.js
new file mode 100644
index 00000000..75c752bb
--- /dev/null
+++ b/mods/jaydstuff.js
@@ -0,0 +1,286 @@
+//jaydstuff
+elements.super_raincloud = {
+    color: "#0000ff",
+    behavior: [
+        "XX|M1%10|XX",
+        "M1%5|XX|M1%5",
+        "CR:water%40|CR:water%40|CR:water%40",
+    ],
+    category: "gases",
+    state: "gas",
+    density: 50,
+},
+elements.deuterium = {
+    color: "#558bcf",
+        behavior: behaviors.GAS,
+          reactions: {
+        "oxygen": { elem1:null, elem2:"heavy_steam", tempMin:500 },
+        "tritium": { elem1:"neutron", elem2:"helium", tempMin:100000000, temp1:150000000, temp2:150000000 },
+        "fire": { elem1:"explosion", chance:0.005 },
+    },
+    category: "gases",
+    burn: 100,
+    burnTime: 2,
+    burnInto: ["fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","heavy_steam"],
+    tempLow: -253,
+    stateLow: "liquid_deuterium",
+    state: "gas",
+    density: 0.180,
+    conduct: 0.02,
+    colorOn: "#d6462d"
+},
+elements.liquid_deuterium = {
+    color: "#97afcf",
+    behavior: behaviors.LIQUID,
+    reactions: {
+        "liquid_oxygen": { elem1:"heavy_ice", elem2:null },
+        "oxygen": { elem1:"ice", elem2:null }
+    },
+    category: "states",
+    burn: 100,
+    burnTime: 2,
+    temp: -255.879,
+    tempHigh: -252.879,
+    stateHigh: "hydrogen",
+    tempLow: -259.2,
+    state: "liquid",
+    density: 163.83,
+    hidden: true
+},
+elements.tritium = {
+    color: "#558bcf",
+        behavior: [
+                "M2|M1 AND CR:radiation%1|M2",
+                "M1|XX|M1",
+                "M2|M1 AND CR:radiation%0.5|M2",
+            ],
+          reactions: {
+        "oxygen": { elem1:null, elem2:"tritiated_steam", tempMin:500 },
+        "deuterium": { elem1:"neutron", elem2:"helium", tempMin:100000000, temp1:150000000, temp2:150000000 },
+        "fire": { elem1:"explosion", chance:0.005 },
+    },
+    category: "gases",
+    burn: 100,
+    burnTime: 2,
+    burnInto: ["fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","steam"],
+    tempLow: -253,
+    stateLow: "liquid_tritium",
+    state: "gas",
+    density: 0.269,
+    conduct: 0.02,
+    colorOn: "#d6462d"
+},
+elements.liquid_tritium = {
+    color: "#97afcf",
+    behavior: [
+        "XX|CR:radiation%1|XX",
+        "M2|XX|M2",
+        "M1|M1|M1",
+    ],
+    reactions: {
+        "liquid_oxygen": { elem1:"tritiated_ice", elem2:null },
+        "oxygen": { elem1:"ice", elem2:null }
+    },
+    category: "states",
+    burn: 100,
+    burnTime: 2,
+    temp: -255.879,
+    tempHigh: -252.879,
+    stateHigh: "tritium",
+    tempLow: -259.2,
+    state: "liquid",
+    density: 213,
+    hidden: true
+},
+elements.heavy_water = {
+    color: "#2167ff",
+    behavior: behaviors.LIQUID,
+    tempHigh: 101.4,
+    stateHigh: "heavy_steam",
+    tempLow: 0,
+    stateLow: "heavy_ice",
+    category: "liquids",
+    heatCapacity: 4.184,
+    reactions: {
+        // electrolysis:
+        "aluminum": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0025 },
+        "zinc": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.015 },
+        "steel": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 },
+        "iron": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 },
+        "tin": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.01 },
+        "brass": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 },
+        "bronze": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 },
+        "copper": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 },
+        "silver": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 },
+        "gold": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 },
+    },
+    state: "liquid",
+    density: 1107,
+    conduct: 0.02,
+    stain: -0.5,
+    extinguish: true
+},
+elements.heavy_steam = {
+    color: "#abd6ff",
+    behavior: behaviors.GAS,
+    reactions: {
+        "copper": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.01 },
+        "bronze": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.005 },
+        "iron": { elem1:"oxygen", elem2:"rust", chance:0.005 },
+        "steel": { elem1:"oxygen", elem2:"rust", chance:0.004 },
+    },
+    temp: 150,
+    tempLow: 95,
+    extraTempLow: {
+        0: "heavy_rime"
+    },
+    stateLow: "heavy_water",
+    category: "gases",
+    state: "gas",
+    density: 1,
+    conduct: 0.002,
+    stain: -0.05,
+    alias: "heavy water vapor",
+    extinguish: true
+},
+elements.heavy_ice = {
+    color: "#b2daeb",
+    behavior: behaviors.WALL,
+    temp: -5,
+    tempHigh: 5,
+    stateHigh: "heavy_water",
+    category: "solids",
+    state: "solid",
+    density: 1014.202,
+    breakInto: "heavy_snow"
+},
+elements.tritiated_water = {
+    color: "#2167ff",
+    behavior: [
+        "XX|CR:radiation%1|XX",
+        "M2|XX|M2",
+        "M1|M1|M1",
+    ],
+    tempHigh: 101.4,
+    stateHigh: "tritiated_steam",
+    tempLow: 0,
+    stateLow: "tritiated_ice",
+    category: "liquids",
+    heatCapacity: 4.184,
+    reactions: {
+        // electrolysis:
+        "aluminum": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0025 },
+        "zinc": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.015 },
+        "steel": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 },
+        "iron": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 },
+        "tin": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.01 },
+        "brass": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 },
+        "bronze": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 },
+        "copper": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 },
+        "silver": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 },
+        "gold": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 },
+    },
+    state: "liquid",
+    density: 1107,
+    conduct: 0.02,
+    stain: -0.5,
+    extinguish: true
+},
+elements.tritiated_steam = {
+    color: "#abd6ff",
+    behavior: [
+            "M2|M1 AND CR:radiation%1|M2",
+            "M1|XX|M1",
+            "M2|M1 AND CR:radiation%0.5|M2",
+        ],
+    reactions: {
+        "copper": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.01 },
+        "bronze": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.005 },
+        "iron": { elem1:"oxygen", elem2:"rust", chance:0.005 },
+        "steel": { elem1:"oxygen", elem2:"rust", chance:0.004 },
+    },
+    temp: 150,
+    tempLow: 95,
+    extraTempLow: {
+        0: "heavy_rime"
+    },
+    stateLow: "tritiated_water",
+    category: "gases",
+    state: "gas",
+    density: 0.6,
+    conduct: 0.002,
+    stain: -0.05,
+    alias: "tritiated water vapor",
+    extinguish: true
+},
+elements.tritiated_ice = {
+    color: "#b2daeb",
+    behavior: [
+        "XX|CR:radiation%0.25|XX",
+        "CR:radiation%0.25|XX|CR:radiation%0.25",
+        "XX|CR:radiation%0.25|XX",
+    ],
+    temp: -5,
+    tempHigh: 5,
+    stateHigh: "tritiated_water",
+    category: "solids",
+    state: "solid",
+    density: 1014.202,
+    breakInto: "tritiated_snow"
+},
+elements.fusion = {
+    color: "#ffffff",
+    tool: function(pixel) {
+        pixel.temp = 100000000;
+		pixelTempCheck(pixel)
+    },
+    category: "tools",
+},
+elements.meese = {
+    color: "#996515",
+    behavior: [
+        "XX|XX|XX",
+        "XX|FX%0.25|M2%0.5 AND BO",
+        "XX|M1|XX",
+    ],
+     category: "life"
+},
+elements.fluoroantimonic_acid = {
+        color: ["#b5cf91","#a1ff5e","#288f2a"],
+    behavior: [
+        "XX|DB%5|XX",
+        "DB%5 AND M2|XX|DB%5 AND M2",
+        "DB%5 AND M2|DB%10 AND M1|DB%5 AND M2",
+    ],
+    ignore: ["glass","rad_glass","glass_shard","rad_shard","stained_glass","baked_clay","acid_gas","neutral_acid","copper","gold","porcelain"],
+    category: "liquids",
+    state: "liquid",
+    density: 2885,
+    hidden: true,
+    stain: -0.1,
+},
+elements.tritium_ice = {
+    color: "#b5d2ff",
+    behavior: [
+        "XX|CR:radiation%0.25|XX",
+        "CR:radiation%0.25|XX|CR:radiation%0.25",
+        "XX|CR:radiation%0.25|XX",
+    ],
+    temp: -259,
+    tempHigh: -256,
+    stateHigh: "liquid_tritium",
+    category: "states",
+    state: "solid",
+    density: 258,
+},
+elements.unstain = {
+    category: "tools",
+    stain: -1,
+    tool: (pixel) => {
+        doStaining({
+            element: "unstain",
+            x: pixel.x,
+            y: pixel.y
+        })
+    }
+};
\ No newline at end of file
diff --git a/mods/life_eater.js b/mods/life_eater.js
index a7b7b07c..0ca0d1b1 100644
--- a/mods/life_eater.js
+++ b/mods/life_eater.js
@@ -7,7 +7,7 @@ if(!enabledMods.includes(fireMod)) {
 	alert(`The ${fireMod} mod is required and has been automatically inserted (reload for this to take effect).`);
 } else {
 
-	var lifeEaterCategories = ["life","auto creepers","shit","cum","food","fantastic creatures","fey","auto_fey"];
+	var lifeEaterCategories = ["life","auto creepers","food","fantastic creatures","fey","auto_fey"];
 	var lifeEaterBlacklist = ["life_eater_virus","life_eater_slurry","life_eater_infected_dirt"];
 	var lifeEaterWhitelist = ["blood","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"];
 	var lifeEaterSubstitutions = {
diff --git a/mods/moreViews.js b/mods/moreViews.js
new file mode 100644
index 00000000..33ab23d0
--- /dev/null
+++ b/mods/moreViews.js
@@ -0,0 +1,481 @@
+if (!enabledMods.includes("mods/betterSettings.js")) { enabledMods.unshift("mods/betterSettings.js"); localStorage.setItem("enabledMods", JSON.stringify(enabledMods)); alert("'betterSettings.js' is a dependency for 'moreViews.js' and has been added. Please reload for it to take effect.") }
+else {
+const views = [
+    // default sandboxels
+    "Default View",
+    "",
+    "Thermal View",
+    "Basic View",
+    "Smooth View",
+    // custom
+    "3D View",
+    "Inverted",
+    "Darker",
+    "Brighter",
+    "Gray scale",
+    "Sepia",
+    "Hue rotation 180°",
+    "Saturated",
+    "Time",
+    "Anaglyph",
+    "VHS (VCR)",
+    "Outline",
+    "Upside down",
+    "Vignette"
+];
+
+setView = (n) => {
+    if (n <= views.length - 1 && n > 1) {
+        view = n;
+    } else {
+        view = null;
+    }
+    setSetting('view', parseInt(view));
+    document.querySelector('span[setting="view"]').children[0].value = view ?? 0;
+}
+
+for (const i in views) {
+    if (i < 5) continue;
+    const option = document.createElement("option");
+    option.setAttribute("value", i);
+    option.innerText = views[i];
+    document.querySelector('.setting-span[setting="view"]').querySelector("select").appendChild(option);
+    viewKey[i] = views[i];
+}
+
+const vcrFont = new FontFace("VCR", "url(mods/VCR_OSD_MONO.ttf)");
+vcrFont.load().then(font => {
+    console.log(font);
+    document.fonts.add(font);
+})
+
+function blending(color, color2, t = 0.5) {
+    const [r, g, b] = parseColor(color).replace("#", "").match(/../g).map(a => parseInt(a, 16));
+    const [r2, g2, b2] = parseColor(color2).replace("#", "").match(/../g).map(a => parseInt(a, 16));
+    if ([r, g, b].includes(undefined) || [r, g, b, t].includes(NaN)) console.log([r, g, b, t], parseColor(color), color);
+    return `#${[
+        (1 - t) * r + t * r2,
+        (1 - t) * g + t * g2,
+        (1 - t) * b + t * b2
+    ].map(a => Math.floor(a).toString(16).padStart(2, "0")).join("")}`;
+}
+
+const cache = new Map();
+
+function mixColors(color, color2) {
+    if (cache.has(`${color}_${color2}`) || cache.has(`${color2}_${color}`)) return cache.get(`${color}_${color2}`) ?? cache.get(`${color2}_${color}`);
+    const [r, g, b] = parseColor(color).replace("#", "").match(/../g).map(a => parseInt(a, 16));
+    const [r2, g2, b2] = parseColor(color2).replace("#", "").match(/../g).map(a => parseInt(a, 16));
+    const res = [
+        Math.max(r, r2),
+        Math.max(g, g2),
+        Math.max(b, b2)
+    ];
+    cache.set(`${color}_${color2}`, `#${res.map(a => (Math.floor(a) % 256).toString(16).padStart(2, "0")).join("")}`);
+    return `#${res.map(a => (Math.floor(a) % 256).toString(16).padStart(2, "0")).join("")}`;
+}
+
+const parseColor = (colorString) => {
+    if (colorString instanceof Array) return parseColor(colorString[0]);
+    if (typeof colorString != "string") return "#ffffff";
+    if (colorString.startsWith("rgb(")) {
+        const color = colorString.replace("rgb(", "").replace(")", "");
+        return `#${color.split(",").map(a => parseInt(a).toString(16).length == 1 ? `0${parseInt(a).toString(16)}` : parseInt(a).toString(16)).join("")}`;
+    } else if (colorString.startsWith("rgba(")) {
+        const color = colorString.replace("rgba(", "").replace(")", "");
+        return `#${color.split(",").filter((_, i) => i <= 2).map(a => parseInt(a).toString(16).length == 1 ? `0${parseInt(a).toString(16)}` : parseInt(a).toString(16)).join("")}`;
+    } else {
+        if (colorString.startsWith("#")) {
+            const color = colorString.slice(1);
+            if (color.length == 3) return `#${color.split(a => a.repeat(2)).join()}`;
+            else if (color.length >= 6) return `#${color.slice(0, 6)}`;
+            else return `#${color}`;
+        }
+    }
+}
+
+const rgbToHsl = (r, g, b) => {
+    const r1 = r / 255;
+    const g1 = g / 255;
+    const b1 = b / 255;
+
+    const cmax = Math.max(r1, g1, b1);
+    const cmin = Math.min(r1, g1, b1);
+
+    const delta = cmax - cmin;
+    const l = (cmax + cmin) / 2;
+    const s = delta == 0 ? 0 : delta / (1 - Math.abs(2 * l - 1));
+    let h = 0;
+    if (delta != 0) {
+        switch (cmax) {
+            case r1:
+                h = 60 * (((g1 - b1) / delta) % 6);
+                break;
+            case g1:
+                h = 60 * ((b1 - r1) / delta + 2);
+                break;
+            default:
+                h = 60 * ((r1 - g1) / delta + 4);
+        }
+    }
+
+    return {h, s, l};
+}
+
+const thetaSetting = new Setting("3D View Angle (0-90)", "theta", settingType.NUMBER, false, parseFloat((Math.atan(2) * 180 / Math.PI).toPrecision(3)));
+
+const tab = new SettingsTab("moreViews.js");
+tab.registerSetting(thetaSetting);
+
+let maxDistance = -1;
+const colorCache = new Map();
+
+function getModeColor(color, distance = 0) {
+    if (!colorCache.has(view)) colorCache.set(view, new Map());
+    if (view == 18) {
+        if (colorCache.get(view).has(color) && colorCache.get(view).get(color).has(distance)) return colorCache.get(view).get(color).get(distance);
+    } else if (colorCache.get(view).has(color)) return colorCache.get(view).get(color);
+    switch (view) {
+        case 6: {
+            const newColor = "#" + (parseInt(`0x1${parseColor(color).slice(1)}`) ^ 0xffffff).toString(16).slice(1);
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 7: {
+            const newColor = blending(pixel.color, "#000000");
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 8: {
+            const newColor = blending(pixel.color, "#ffffff");
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 9: {
+            const [r, g, b] = parseColor(color).slice(1).match(/.{1,2}/g).map(a => parseInt(a, 16)).slice(0, 3);
+            const {h, l} = rgbToHsl(r, g, b);
+            const newColor = `hsl(${Math.round(h)}, 0%, ${Math.round(l * 100)}%)`;
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 10: {
+            const [r, g, b] = parseColor(color).replace("#", "").match(/../g).map(a => parseInt(a, 16));
+            const [r2, g2, b2] = [
+                Math.min(255, (r * 0.393) + (g * 0.769) + (b * 0.189)),
+                Math.min(255, (r * 0.349) + (g * 0.686) + (b * 0.168)),
+                Math.min(255, (r * 0.272) + (g * 0.534) + (b * 0.131))
+            ];
+            const newColor = `#${Math.floor(r2).toString(16).padStart(2, "0")}${Math.floor(g2).toString(16).padStart(2, "0")}${Math.floor(b2).toString(16).padStart(2, "0")}`;
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 11: {
+            const [r, g, b] = parseColor(color).slice(1).match(/.{1,2}/g).map(a => parseInt(a, 16)).slice(0, 3);
+            const {h, s, l} = rgbToHsl(r, g, b);
+            const newColor = `hsl(${(Math.round(h) + 180 % 360)}, ${Math.round(s * 100)}%, ${Math.round(l * 100)}%)`;
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 12: {
+            const [r, g, b] = parseColor(color).slice(1).match(/.{1,2}/g).map(a => parseInt(a, 16)).slice(0, 3);
+            const {h, s, l} = rgbToHsl(r, g, b);
+            const newColor = `hsl(${Math.round(h)}, ${Math.round(s * 100) * 4}%, ${Math.round(l * 100)}%)`;
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 15: {
+            const [r, g, b] = parseColor(color).replace("#", "").match(/../g);
+            const [r2, g2, b2] = [parseInt(r, 16) * 0.75, parseInt(g, 16) * 0.75, parseInt(b, 16) * 0.75];
+            const newColor = `rgb(${r2}, ${g2}, ${b2})`;
+            colorCache.get(view).set(color, newColor);
+            return newColor;
+        }
+        case 18: {
+            const newColor = blending(pixel.color, "#000000", (1 / maxDistance) * distance);
+            colorCache.get(view).has(color)
+                ? colorCache.get(view).get(color).set(distance, newColor)
+                : colorCache.get(view).set(color, new Map([[distance, newColor]]));
+            return newColor;
+        }
+    }
+    return color;
+}
+
+settingsManager.registerTab(tab);
+
+runAfterLoadList.push(() => drawPixels = (function() {
+    const oldDrawPixels = drawPixels;
+
+    return function(forceTick = false) {
+        if (view >= 5) {
+            if (maxDistance = -1) maxDistance = Math.sqrt((width / 2) ** 2 + (height / 2) ** 2) * 2;
+            
+            const canvas = document.getElementById("game");
+            const ctx = canvas.getContext("2d");
+            var newCurrentPixels = currentPixels.slice();
+            var pixelsFirst = [];
+            var pixelsLast = [];
+            if (!paused || forceTick) {
+                shuffleArray(newCurrentPixels);
+            }
+            
+            for (var i = 0; i < newCurrentPixels.length; i++) {
+                pixel = newCurrentPixels[i];
+                if (pixel.del) {continue}
+                if (!paused || forceTick) {
+                    if (elements[pixel.element].tick) {
+                        elements[pixel.element].tick(pixel);
+                    }
+                    if (pixel.del) {continue}
+                    if (elements[pixel.element].behavior) {
+                        pixelTick(pixel);
+                    }
+                };
+                if (pixel.con) { pixel = pixel.con }
+                if (elements[pixel.element].isGas || elements[pixel.element].glow) {
+                    pixelsLast.push(pixel);
+                }
+                else {
+                    pixelsFirst.push(pixel);
+                }
+            }
+            
+            if (hiding) {
+                if (ctx.globalAlpha < 1) {
+                    ctx.globalAlpha = 1;
+                }
+
+                if (elements[currentElement].maxSize < mouseSize) {
+                    var mouseOffset = Math.trunc(elements[currentElement].maxSize/2);
+                }
+                else {
+                    var mouseOffset = Math.trunc(mouseSize/2);
+                }
+                var topLeft = [mousePos.x-mouseOffset,mousePos.y-mouseOffset];
+                var bottomRight = [mousePos.x+mouseOffset,mousePos.y+mouseOffset];
+
+                ctx.strokeStyle = "white";
+                ctx.strokeRect(topLeft[0]*pixelSize,topLeft[1]*pixelSize,(bottomRight[0]-topLeft[0]+1)*pixelSize,(bottomRight[1]-topLeft[1]+1)*pixelSize);
+                
+                if (settings.precision) {
+                    ctx.fillStyle = "rgba(255,255,255,0.5)";
+                    ctx.fillRect(mousePos.x*pixelSize,mousePos.y*pixelSize,pixelSize,pixelSize);
+                }
+                if ((!paused) || forceTick) {pixelTicks++};
+                return;
+            }
+            
+            if (!settings["bg"]) {ctx.clearRect(0, 0, canvas.width, canvas.height)}
+            else {
+                ctx.fillStyle = settings["bg"];
+                ctx.fillRect(0, 0, canvas.width, canvas.height);
+            }
+            var pixelDrawList = pixelsFirst.concat(pixelsLast);
+            for (var i = 0; i < pixelDrawList.length; i++) {
+                pixel = pixelDrawList[i];
+                if (pixelMap[pixel.x][pixel.y] == undefined) {continue}
+                if (pixel.con) { pixel = pixel.con };
+                ctx.fillStyle = getModeColor(pixel.color, view == 18 ? Math.sqrt((width / 2 - pixel.x) ** 2 + (height / 2 - pixel.y) ** 2) : 0);
+                // 3D VIEW
+                if (view == 5) {
+                    const neighborRight = !outOfBounds(pixel.x + 1, pixel.y) && !!pixelMap[pixel.x + 1][pixel.y];
+                    const neighborUp = !outOfBounds(pixel.x, pixel.y - 1) && !!pixelMap[pixel.x][pixel.y - 1];
+                    const neighborUpRight = !outOfBounds(pixel.x + 1, pixel.y - 1) && !!pixelMap[pixel.x + 1][pixel.y - 1];
+                    let size = 0;
+                    let currentY = pixel.y;
+                    while (!outOfBounds(pixel.x, currentY) && pixelMap[pixel.x][currentY] && pixelMap[pixel.x][currentY].element == pixel.element) {
+                        currentY++;
+                        size++;
+                    }
+                    ctx.globalAlpha = 1;
+                    ctx.fillStyle = pixel.color;
+                    ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize);
+                    const px = pixel.x * pixelSize;
+                    const py = pixel.y * pixelSize;
+                    const theta = Math.max(Math.min(thetaSetting.get(), 90), 0) * Math.PI / 180;
+                    const a = Math.cos(theta);
+                    const b = Math.sin(theta);
+                    const w = pixelSize;
+                    const px2 = px + a * w;
+                    const py2 = py - b * w;
+                    const parts = [[[px, py], [[px2, py2], [px + w, py2], [px + w, py]], !neighborUp], [[px + w, py + w], [[px2 + w, py2 + w], [px2 + w, py], [px + w, py]], !neighborRight], [[px + w, py], [[px + w, py2], [px2 + w, py2], [px + w, py]], !neighborUp && !neighborUpRight], [[px + w, py], [[px2 + w, py2], [px2 + w, py], [px + w, py]], !neighborRight && !neighborUpRight]]
+                    for (const part of parts.filter(p => p[2])) {
+                        ctx.fillStyle = blending(pixel.color, "#000000");
+                        ctx.beginPath();
+                        ctx.moveTo(...part[0]);
+                        for (const v of part[1]) {
+                            ctx.lineTo(...v);
+                        }
+                        ctx.closePath();
+                        ctx.fill();
+                    }
+                } else if (view == 13) {
+                    const hue = 225 - (Math.log(pixel.start) / Math.log(pixelTicks)) * 225;
+                    ctx.globalAlpha = 1;
+                    ctx.fillStyle = `hsl(${Math.min(Math.round(hue), 250)}, 100%, 50%)`;
+                    ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize);
+                }  else if (view == 14) {
+                    ctx.globalAlpha = 1;
+                    ctx.fillStyle = pixel.color;
+                    ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize);
+                    
+                    if (outOfBounds(pixel.x - 1, pixel.y) || !pixelMap[pixel.x - 1][pixel.y]) {
+                        ctx.fillStyle = "#ff0000";
+                        ctx.globalAlpha = 0.5;
+                        ctx.fillRect(pixel.x * pixelSize - 0.5 * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize);
+                    }
+                    if (outOfBounds(pixel.x + 1, pixel.y) || !pixelMap[pixel.x + 1][pixel.y]) {
+                        ctx.fillStyle = "#00ffff";
+                        ctx.globalAlpha = 0.5;
+                        ctx.fillRect(pixel.x * pixelSize + 0.5 * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize);
+                    }
+                } else if (view == 15) {
+                    const [r, g, b] = parseColor(pixel.color).replace("#", "").match(/../g);
+                    const [r2, g2, b2] = [parseInt(r, 16) * 0.75, parseInt(g, 16) * 0.75, parseInt(b, 16) * 0.75]
+                    // scrolling effect
+                    const offset = (pixelTicks + 6) % height >= pixel.y && (pixelTicks - 3) % height <= pixel.y
+                        || (pixelTicks + 66) % height >= pixel.y && (pixelTicks - 57) % height <= pixel.y;
+                    if (!pixelMap[pixel.x - 1] || !pixelMap[pixel.x - 1][pixel.y]) {
+                        ctx.globalAlpha = 0.5;
+                        ctx.fillStyle = `#${r.padStart(2, "0")}0000`;
+                        ctx.fillRect(pixel.x * pixelSize - 0.75 * pixelSize - (offset ? 0.5 * pixelSize : 0) , pixel.y * pixelSize, pixelSize, pixelSize);
+                    }
+                    if (!pixelMap[pixel.x + 1] || !pixelMap[pixel.x + 1][pixel.y]) {
+                        ctx.globalAlpha = 0.5;
+                        ctx.fillStyle = `#0000${b.padStart(2, "0")}`;
+                        ctx.fillRect(pixel.x * pixelSize + 0.75 * pixelSize - (offset ? 0.5 * pixelSize : 0), pixel.y * pixelSize, pixelSize, pixelSize);
+                    }
+                    ctx.globalAlpha = 1;
+                    ctx.fillStyle = `rgb(${r2}, ${g2}, ${b2})`
+                    ctx.fillRect(pixel.x * pixelSize - (offset ? 0.5 * pixelSize : 0), pixel.y * pixelSize, pixelSize, pixelSize);
+                    ctx.globalAlpha = 1;
+                // i fucking hate it but at least it works
+                // and i dont feel like finding something that is fast and pretty
+                } else if (view == 16) {
+                    ctx.globalAlpha = 1;
+                    ctx.strokeStyle = pixel.color;
+                    ctx.lineWidth = 2;
+                    const cond1 = outOfBounds(pixel.x - 1, pixel.y)
+                        || !pixelMap[pixel.x - 1][pixel.y]
+                        || pixelMap[pixel.x - 1][pixel.y].element != pixel.element;
+                    const cond2 = outOfBounds(pixel.x + 1, pixel.y)
+                        || !pixelMap[pixel.x + 1][pixel.y]
+                        || pixelMap[pixel.x + 1][pixel.y].element != pixel.element;
+                    const cond3 = outOfBounds(pixel.x, pixel.y - 1)
+                        || !pixelMap[pixel.x][pixel.y - 1]
+                        || pixelMap[pixel.x][pixel.y - 1].element != pixel.element;
+                    const cond4 = outOfBounds(pixel.x, pixel.y + 1)
+                        || !pixelMap[pixel.x][pixel.y + 1]
+                        || pixelMap[pixel.x][pixel.y + 1].element != pixel.element;
+                    const cond5 = outOfBounds(pixel.x - 1, pixel.y - 1)
+                        || !pixelMap[pixel.x - 1][pixel.y - 1]
+                        || pixelMap[pixel.x - 1][pixel.y - 1].element != pixel.element;
+                    const cond6 = outOfBounds(pixel.x + 1, pixel.y - 1)
+                        || !pixelMap[pixel.x + 1][pixel.y - 1]
+                        || pixelMap[pixel.x + 1][pixel.y - 1].element != pixel.element;
+                    const cond7 = outOfBounds(pixel.x - 1, pixel.y + 1)
+                        || !pixelMap[pixel.x - 1][pixel.y + 1]
+                        || pixelMap[pixel.x - 1][pixel.y + 1].element != pixel.element;
+                    const cond8 = outOfBounds(pixel.x + 1, pixel.y + 1)
+                        || !pixelMap[pixel.x + 1][pixel.y + 1]
+                        || pixelMap[pixel.x + 1][pixel.y + 1].element != pixel.element;
+                    
+                    if (cond1) {
+                        ctx.beginPath();
+                        ctx.moveTo(pixel.x * pixelSize + ctx.lineWidth / 2, pixel.y * pixelSize);
+                        ctx.lineTo(pixel.x * pixelSize + ctx.lineWidth / 2, (pixel.y + 1) * pixelSize);
+                        ctx.stroke();
+                    }
+                    if (cond2) {
+                        ctx.beginPath();
+                        ctx.moveTo((pixel.x + 1) * pixelSize - ctx.lineWidth / 2, pixel.y * pixelSize);
+                        ctx.lineTo((pixel.x + 1) * pixelSize - ctx.lineWidth / 2, (pixel.y + 1) * pixelSize);
+                        ctx.stroke();
+                    }
+                    if (cond3) {
+                        ctx.beginPath();
+                        ctx.moveTo(pixel.x * pixelSize, pixel.y * pixelSize + ctx.lineWidth / 2);
+                        ctx.lineTo((pixel.x + 1) * pixelSize, pixel.y * pixelSize + ctx.lineWidth / 2);
+                        ctx.stroke();
+                    }
+                    if (cond4) {
+                        ctx.beginPath();
+                        ctx.moveTo(pixel.x * pixelSize, (pixel.y + 1) * pixelSize - ctx.lineWidth / 2);
+                        ctx.lineTo((pixel.x + 1) * pixelSize, (pixel.y + 1) * pixelSize - ctx.lineWidth / 2);
+                        ctx.stroke();
+                    }
+                    if (!cond2 && !cond4 && cond8) ctx.fillRect((pixel.x + 1) * pixelSize - ctx.lineWidth, (pixel.y + 1) * pixelSize - ctx.lineWidth, ctx.lineWidth, ctx.lineWidth);
+                    if (!cond2 && !cond3 && cond6) ctx.fillRect((pixel.x + 1) * pixelSize - ctx.lineWidth, pixel.y * pixelSize, ctx.lineWidth, ctx.lineWidth);
+                    if (!cond1 && !cond3 && cond5) ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, ctx.lineWidth, ctx.lineWidth);
+                    if (!cond1 && !cond4 && cond7) ctx.fillRect(pixel.x * pixelSize, (pixel.y + 1) * pixelSize - ctx.lineWidth, ctx.lineWidth, ctx.lineWidth);
+                } else if (view == 17) {
+                    ctx.fillRect(pixel.x * pixelSize, (height - pixel.y) * pixelSize, pixelSize, pixelSize);
+                } else {
+                    ctx.fillRect(pixel.x*pixelSize, pixel.y*pixelSize, pixelSize, pixelSize);
+                }
+                if (pixel.charge && view !== 2) { // Yellow glow on charge
+                    if (!elements[pixel.element].colorOn) {
+                        ctx.fillStyle = "rgba(255,255,0,0.5)";
+                        ctx.fillRect(pixel.x*pixelSize, pixel.y*pixelSize, pixelSize, pixelSize);
+                    }
+                }
+            }
+            if (view == 15) {
+                // TRACK READ NOISE
+                for (let n = 0; n < 3; n++) {
+                    const number = Math.floor(Math.random() * height);
+                    ctx.globalAlpha = Math.random();
+                    ctx.fillStyle = "#fff";
+                    ctx.fillRect(0, (number + 0.5) * pixelSize, width * pixelSize, 0.2);
+                    ctx.globalAlpha = 1;
+                }
+                const {font, textAlign} = ctx;
+                ctx.font = "30px VCR";
+                ctx.textAlign = "start";
+                ctx.fillText(paused ? "PAUSE" : "PLAY", (0.025 * width) * pixelSize, (0.025 * width) * pixelSize + 15);
+                if (paused) {
+                    ctx.fillRect((0.05 * width) * pixelSize + ctx.measureText("PAUSE").width, (0.025 * width) * pixelSize - 7.5, 5, 22.5);
+                    ctx.fillRect((0.05 * width) * pixelSize + ctx.measureText("PAUSE").width + 8, (0.025 * width) * pixelSize - 7.5, 5, 22.5);
+                } else {
+                    ctx.fillStyle = "#fff";
+                    ctx.beginPath();
+                    ctx.moveTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width, (0.025 * width) * pixelSize - 7.5);
+                    ctx.lineTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width, (0.025 * width) * pixelSize + 15);
+                    ctx.lineTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width + 17.5, (0.025 * width) * pixelSize + 3.75);
+                    ctx.lineTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width, (0.025 * width) * pixelSize - 7.5);
+                    ctx.fill();
+                }
+                const base = Math.floor(pixelTicks / tps);
+                const seconds = base % 60 + "";
+                const minutes = Math.floor(base / 60) % 60 + "";
+                const hours = Math.floor(base / 60 / 60) + "";
+                ctx.textAlign = "end";
+                ctx.fillText(`${hours.padStart(2, "0")}:${minutes.padStart(2, "0")}:${seconds.padStart(2, "0")}`, (0.975 * width) * pixelSize, (0.025 * width) * pixelSize + 15);
+                ctx.font = font;
+                ctx.textAlign = textAlign;
+            }
+            if (ctx.globalAlpha < 1) {
+                ctx.globalAlpha = 1;
+            }
+
+            if (elements[currentElement].maxSize < mouseSize) {
+                var mouseOffset = Math.trunc(elements[currentElement].maxSize/2);
+            }
+            else {
+                var mouseOffset = Math.trunc(mouseSize/2);
+            }
+            var topLeft = [mousePos.x-mouseOffset,mousePos.y-mouseOffset];
+            var bottomRight = [mousePos.x+mouseOffset,mousePos.y+mouseOffset];
+            // Draw a square around the mouse
+            ctx.strokeStyle = "white";
+            ctx.strokeRect(topLeft[0]*pixelSize,topLeft[1]*pixelSize,(bottomRight[0]-topLeft[0]+1)*pixelSize,(bottomRight[1]-topLeft[1]+1)*pixelSize);
+            // draw one transparent pixel in the center
+            if (settings.precision) {
+                ctx.fillStyle = "rgba(255,255,255,0.5)";
+                ctx.fillRect(mousePos.x*pixelSize,mousePos.y*pixelSize,pixelSize,pixelSize);
+            }
+            if ((!paused) || forceTick) {pixelTicks++};
+        } else oldDrawPixels.apply(this, arguments);
+    }
+}()));
+}
\ No newline at end of file
diff --git a/mods/morechemistry.js b/mods/morechemistry.js
index c220dfdf..3549e61b 100644
--- a/mods/morechemistry.js
+++ b/mods/morechemistry.js
@@ -1,4 +1,4 @@
-//This mod was made by Alex the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok.
+//This mod was made by Adora the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok.
 function pixelInRange(pixel, range){
   let i = 0;
   while (i < range.length) {
@@ -635,11 +635,6 @@ elements.potassiumhydroxidecrystals = {
     density: 2040,
     name: "PotassiumHydroxideCrystals",
 }
-elements.supercooler = {
-  name: "SuperCooler",
-  category: "machines"
-}
-elements.supercooler.behavior = [["XX","CO:10","XX"],["CO:10","XX","CO:10"],["XX","CO:10","XX"]]
 elements.iron_chloride = {
   color: ["#010014", "#a2ff94"],
   reactions: {
@@ -695,7 +690,7 @@ elements.kilonova = {
   temp: 100000000,
 }
 elements.supernova.behavior = [ ["XX", "XX", "XX"], [ "XX", "EX:80>plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,molten_iron,molten_uranium,oxygen,molten_sodium,sulfur_gas,neon,chlorine,molten_calcium,molten_nickel,molten_copper,molten_zinc,gallium_gas,hydrogen,hydrogen,hydrogen,hydrogen,helium,helium,helium AND CH:NeutronStar", "XX" ], ["XX", "XX", "XX"] ]
-elements.kilonova.behavior = [ ["XX", "XX", "XX"], [ "XX", "EX:200>plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,molten_iron,molten_uranium,molten_lead,oxygen,molten_sodium,molten_gold,molten_tungsten,sulfur_gas,neon,chlorine,molten_calcium,molten_nickel,molten_copper,molten_zinc,gallium_gas,hydrogen,hydrogen,hydrogen,hydrogen,hydrogen,helium,helium,helium,helium AND CH:void", "XX" ], ["XX", "XX", "XX"] ]
+elements.kilonova.behavior = [ ["XX", "XX", "XX"], [ "XX", "EX:200>plasma,plasma,plasma,plasma,plasma,plasma,molten_iron,molten_uranium,molten_lead,oxygen,molten_sodium,molten_gold,molten_tungsten,sulfur_gas,neon,chlorine,molten_calcium,molten_nickel,molten_copper,molten_zinc,gallium_gas,hydrogen,hydrogen,hydrogen,hydrogen,hydrogen,helium,helium,helium,helium AND CH:void", "XX" ], ["XX", "XX", "XX"] ]
 elements.NeutronStar = {
   behavior: [["XX", "XX", "XX"], ["CR:light", "XX", "CR:light"], ["XX", "XX", "XX"]],
   name: "NeutronStar",
@@ -1057,52 +1052,12 @@ elements.specialmixer = {
       mix(range, exclude);
     }
   }
+
 let num4 = 0;
 let exclude2 = [];
 let property1 = "";
 let value2 = "";
-elements.propmachine = {
-    name: "PropMachine",
-    behavior: behaviors.WALL,
-    category: "machines",
-    noMix: true,
-  onSelect: function(pixel) {
-    let item = prompt("enter range for prop changing.");
-    if(/^\d+$/.test(item)){
-      num4 = parseInt(item);
-    } else {
-      alert("that is not an integer.");
-    }
-    exclude2 = prompt("Enter elements to exclude, seperate them with commas.").replace(/\s/g, "").split(",");
-    exclude2.push("propmachine");
-    var answer1 = prompt("Warning - This tool may break the simulator if used incorrectly.\n\nEnter a pixel attribute to modify:",(currentProp||undefined));
-    if (!answer1) { return }
-    var answer2 = prompt("Now, enter a value for "+answer1+":",(currentPropValue||undefined));
-    if (!answer2) { return }
-    var valueL = answer2.toLowerCase();
-    if (valueL === "true") { answer2 = true }
-    else if (valueL === "false") { answer2 = false }
-    else if (valueL === "null") { answer2 = null }
-    else if (valueL === "undefined") { answer2 = undefined }
-    else if (answer1 === "color" && valueL[0] === "#") {
-        var rgb = hexToRGB(valueL);
-        answer2 = "rgb("+rgb.r+","+rgb.g+","+rgb.b+")";
-    }
-    currentProp = answer1;
-    var num = parseFloat(answer2);
-    if (!isNaN(num)) { answer2 = num }
-    currentPropValue = answer2;
-    logMessage("Prop: "+currentProp);
-    logMessage("Value: "+currentPropValue);
-  },
-    tick: function(pixel) {
-      if(pixel.start == pixelTicks) {
-        pixel.range = num4;
-      }
-      let range = mouseRange(pixel.x, pixel.y, pixel.range);
-      prop({ property: property1, value: value2 },range, exclude2);
-    }
-  }
+
 let item = "";
 elements.improvedsensor = {
   behavior: behaviors.WALL,
@@ -1196,30 +1151,111 @@ elements.incinerator = {
   color: 'rgb(255, 50, 0)',
   noMix: true,
 }
-function prop(obj, range, exclude = []){
+function conditionTrue(condition, pixel){
+  let p = pixel;
+  let string = "";
+  condition = condition.split("!OR").join("||").split("&AND").join("&&").split("\"").join("")
+
+  condition = eval(condition);
+  return condition;
+}
+let ifCondition = "";
+let currentProp = "";
+let currentPropValue = "";
+elements.propmachine = {
+  name: "PropMachine",
+  behavior: behaviors.WALL,
+  category: "machines",
+  noMix: true,
+onSelect: function(pixel) {
+
+  let item = prompt("enter range for prop changing.");
+  if(/^\d+$/.test(item)){
+    num4 = parseInt(item);
+  } else {
+    alert("that is not an integer.");
+  }
+  exclude2 = prompt("Enter elements to exclude, seperate them with commas. You can also enter !IF if you wish to enter conditions for it to change the property and add the exclude elements.").replace(/\s/g, "");
+  if(exclude2.includes("!IF")){
+    exclude2.split("!IF").join("");
+    ifCondition = prompt("Enter the condition for the property to change. A list of variables can be seen at the bottom of the page. you cannot use \"\" but you can use `` and ''.");
+  } else { ifCondition = '1 == 1'; }
+  exclude2.split(",");
+  if(exclude2.constructor == [].constructor){
+    exclude2.push("propmachine");
+  } else {
+    exclude2 += "propmachine";
+  }
+  var answer1 = prompt("Warning - This tool may break the simulator if used incorrectly.\n\nEnter a pixel attribute to modify:",(currentProp||undefined));
+  console.log(answer1)
+  if (!answer1) { return }
+  var answer2 = prompt("Now, enter a value for "+answer1+":",(currentPropValue||undefined));
+  if (!answer2) { return }
+  var valueL = answer2.toLowerCase();
+  if (valueL === "true") { answer2 = true }
+  else if (valueL === "false") { answer2 = false }
+  else if (valueL === "null") { answer2 = null }
+  else if (valueL === "undefined") { answer2 = undefined }
+  else if (answer1 === "color" && valueL[0] === "#") {
+      var rgb = hexToRGB(valueL);
+      answer2 = "rgb("+rgb.r+","+rgb.g+","+rgb.b+")";
+  }
+  currentProp = answer1;
+  currentPropValue = answer2;
+  console.log(answer1);
+  var num = parseFloat(answer2);
+  if (!isNaN(num)) { answer2 = num }
+  currentPropValue = answer2;
+  logMessage("Prop: "+currentProp);
+  logMessage("Value: "+currentPropValue);
+},
+  tick: function(pixel) {
+    if(pixel.start == pixelTicks) {
+      pixel.range = num4;
+      pixel.condition = ifCondition;
+      pixel.prop = currentProp;
+      pixel.val = currentPropValue;
+    }
+      let range = mouseRange(pixel.x, pixel.y, pixel.range);
+      prop({ property: pixel.prop, value: pixel.val },range, exclude2, pixel.condition);
+  }
+}
+function prop(obj, range, exclude = [], condition = ""){
+  let list = [];
   for (var i = 0; i < range.length; i++) {
-  if (!isEmpty(range[i][0], range[i][1], true)) {
-    var pixel = pixelMap[range[i][0]][range[i][1]];
-    if (!exclude.includes(pixel.element)){
+  var x = range[i][0];
+  var y = range[i][1];
+      if (!isEmpty(x,y,true)) {
+          var pixel = pixelMap[x][y];
+            list.push(pixel);
+      }
+  }
+  for (var i = 0; i < list.length; i++) {
+  if (!isEmpty(list[i].x, list[i].y, true)) {
+    var pixel = list[i];
+    if (!exclude.includes(pixel.element) && conditionTrue(condition, pixel)){
       if(/^\d+$/.test(obj.value)){
         obj.value = parseInt(obj.value);
       }
-      if (!currentProp) { return }
-      if (pixel[currentProp] !== undefined && typeof pixel[currentProp] !== typeof currentPropValue) {
-          logMessage("Error: "+currentProp+" type is "+typeof pixel[currentProp]+", not "+typeof currentPropValue+".");
-          currentProp = null;
-          currentPropValue = null;
+      if (!obj.property) { return }
+      if (pixel[obj.property] !== undefined && typeof pixel[obj.property] !== typeof obj.value) {
+          logMessage("Error: "+obj.property+" type is "+typeof pixel[obj.property]+", not "+typeof obj.value+".");
+          obj.property = null;
+          obj.value = null;
           return;
         }
-      if (currentProp === "element") {
-          changePixel(pixel, currentPropValue);
+      if (obj.property === "element") {
+          changePixel(pixel, obj.value);
+          list.splice(list.indexOf(pixel),1);
           return;
       }
-      if (currentProp === "burning" && currentPropValue === "true") {
+      if (obj.property === "burning" && obj.value === "true") {
           pixel.burnStart = pixelTicks;
+          list.splice(list.indexOf(pixel),1);
           return;
       }
-        pixel[currentProp] = currentPropValue;
+        pixel[obj.property] = obj.value;
+        list.splice(list.indexOf(pixel),1);
       }
     }
   }
@@ -1307,3 +1343,122 @@ function pull(range, pixel1, include = []){
       }
     }
   }
+
+let prevNum;
+elements.etemper = {
+  name: "E-Temper",
+  category: "machines",
+  conduct: 1,
+  insulate: true,
+  behavior: behaviors.WALL,
+  onSelect: function(pixel){
+    prevNum = parseInt(prompt("Enter the temperature you want it set to.", (prevNum || undefined)));
+  },
+  tick: function(pixel){
+    if(pixel.start === pixelTicks){
+        pixel.clone = `Temp: ${prevNum}`;
+        pixel.Temp = prevNum;
+    }
+      for (var i = 0; i < adjacentCoords.length; i++){
+      let x = pixel.x + adjacentCoords[i][0];
+      let y = pixel.y + adjacentCoords[i][1];
+      if(outOfBounds(x,y)){ continue; }
+      if(isEmpty(x,y)){ continue; }
+      let pixel2 = pixelMap[x][y];
+        
+      if (pixel2.temp < pixel.Temp && pixel.charge > 0 ){
+          pixel2.temp += pixel.Temp / 6;
+      }
+
+    }
+  },
+}
+let prevString;
+elements.sign = {
+  name: "Sign",
+  category: "machines",
+  onSelect: function(){
+    prevString = prompt("Enter the text you want it to say.", (prevString || undefined));
+  },
+  tick: function(pixel){
+    if(pixel.start == pixelTicks){
+      pixel.clone = prevString;
+    }
+  }
+}
+runAfterLoad(function(){
+  document.body.innerHTML += `
+  these are all properties of the pixel. another way to find pixel properties is using debug on a pixel, it will tell you the property and the value, like x and y, or, in plants.js, fruit.
+  <table id="variables">
+    <thead>
+      <tr class="bold">
+        <th>
+         Variable
+        </th>
+        <th>
+          Definition
+        </th>
+      </tr>
+    </thead>
+    <tbody><tr>
+      <th>
+        p.color
+      </th>
+      <th>
+        The color of the pixel. it is defined as an RGB value.
+      </th>
+    </tr>
+    <tr>
+      <th>
+        p.x and p.y
+      </th>
+      <th>
+        The x and y positions of the pixel.
+      </th>
+    </tr>
+    <tr>
+      <th>
+        p.element
+      </th>
+      <th>
+        The element of the pixel.
+      </th>
+    </tr>
+    <tr>
+      <th>
+        p.clone
+      </th>
+      <th>
+        Specific to cloners, specifies what the cloner clones.
+      </th>
+    </tr>
+    <tr>
+      <th>
+        wc and lc
+      </th>
+      <th>
+        Specific to saplings, specifies what colour the wood is (wc) and what colour the leaves are (lc).
+      </th>
+    </tr>
+    <tr>
+      <th>
+        p.start
+      </th>
+      <th>
+        The start tick of the pixel.
+      </th>
+    </tr>
+    <tr>
+      <th>
+        p.tick
+      </th>
+      <th>
+        the amount of ticks that have happened so far in the game.
+      </th>
+    </tr>
+  </tbody></table>
+  `
+  document.getElementById("extraInfo").innerHTML = `
+  <small><a href="https://sandboxels.r74n.com/changelog" id="changelogButton" target="_blank">Changelog<span style="color:red">(NEW)</span></a> • <a href="https://sandboxels.R74n.com/feedback" target="_blank" style="color:lime;">Feedback</a> • <a href="https://sandboxels.wiki.gg/" target="_blank" id="wikiButton" title="Official Sandboxels Wiki - wiki.gg" style="color:white;">Wiki</a> • <a id="moreSocial" href="https://reddit.com/r/Sandboxels" rel="me" target="_blank"><span style="color:#FF5700">Reddit</span></a> • <a href="https://discord.gg/ejUc6YPQuS" target="_blank" style="color:#2f60ff;">Discord</a><span id="install-button" style="display: inline-block;">&nbsp;• <a onclick="deferredPrompt.prompt(); return false" href="#" style="text-shadow: 0px 2px 10px #ff00ff; cursor:pointer">Install Offline</a> • <a href = "https://sandboxels.r74n.com/#variables">Variables</a></span><!--<br><br><a style="color:lime" target="_blank" href="https://docs.google.com/forms/d/e/1FAIpQLSf8pVMSdC6oSnBSaTpzjPQa8Ef-vxG_eXL99UITnMSQtJFTJA/viewform?usp=sf_link">FILL OUT THE CENSUS<span style="color:red">(NEW)</span></a>--></small><small><p>v1.9.3 • 559 elements, with <span id="hiddenCount">0</span> hidden.</p><p>©2021-2024. <a href="https://sandboxels.R74n.com/license.txt" rel="license" target="_blank">All Rights Reserved</a>. <a style="color:#00ffff" rel="author" href="https://r74n.com">R74n</a></p></small>
+  `
+});
diff --git a/mods/pizzasstuff.js b/mods/pizzasstuff.js
index 463e692b..7e4fb53b 100644
--- a/mods/pizzasstuff.js
+++ b/mods/pizzasstuff.js
@@ -1,3 +1,34 @@
+elements.freeze_ray = {
+	color: ["#9ae4f5","#84d6e8"],
+    tick: function(pixel) {
+        var x = pixel.x;
+        for (var y = pixel.y; y < height; y++) {
+            if (outOfBounds(x, y)) {
+                break;
+            }
+            if (isEmpty(x, y)) {
+                if (Math.random() > 0.05) { continue }
+                createPixel("flash", x, y);
+                pixelMap[x][y].color = "#aedbe6";
+                pixelMap[x][y].temp = -257;
+            }
+            else {
+                if (elements[pixelMap[x][y].element].isGas) { continue }
+                if (elements[pixelMap[x][y].element].id === elements.heat_ray.id) { break }
+                pixelMap[x][y].temp -= 100;
+                pixelTempCheck(pixelMap[x][y]);
+                break;
+            }
+        }
+        deletePixel(pixel.x, pixel.y);
+    },
+    temp: -257,
+    category: "energy",
+    state: "gas",
+    excludeRandom: true,
+    noMix: true
+};
+
 elements.beer = {
 	color: ["#ffc43d","#ffc43d"],
 	behavior: behaviors.LIQUID,
@@ -16,6 +47,9 @@ elements.root_beer = {
 
 elements.fruit_slushy = {
 	color: ["#d43968","#ec5885","#f57ca1","#fba9c2","#ffe3eb"],
+	stateLowColorMultiplier: 1.3,
+	stateLow: "slushy_ice",
+	tempLow: "-50",
 	behavior: behaviors.LIQUID,
 	category: "food",
 	state: "solid",
@@ -32,6 +66,9 @@ elements.mold = {
 
 elements.chocolate_slushy = {
 	color: ["#c3ae9a","#ae967f","#977b5f","#876b4f","#816346"],
+	stateLowColorMultiplier: 1.3,
+	tempLow: "-50",
+	stateLow: "slushy_ice",
 	behavior: behaviors.LIQUID,
 	category: "food",
 	state: "solid",
@@ -136,7 +173,7 @@ elements.fruit_yogurt = {
 
 elements.frozen_fruit_yogurt = {
 	color: ["#ffdfdf","#ffc0c0","#ff9b9b"],
-	stateLowColorMultiplier: 0.7,
+	stateHighColorMultiplier: 0.7,
 	behavior: behaviors.STURDYPOWDER,
 	category: "food",
 	state: "solid",
@@ -149,7 +186,7 @@ elements.frozen_fruit_yogurt = {
 
 elements.frozen_chocolate_yogurt = {
 	color: ["#a87848","#a57e57","#c1a07f","#e2c5ac","#efd0b1"],
-	stateLowColorMultiplier: 0.7,
+	stateHighColorMultiplier: 0.7,
 	behavior: behaviors.STURDYPOWDER,
 	category: "food",
 	state: "solid",
@@ -418,7 +455,7 @@ elements.moss = {
 };
 
 elements.moth = {
-	color: "#665233",
+	color: ["#df8830","#e9b477","#a1591a","#a87a46","#4e3212"],
 	behavior: behaviors.FLY,
 	category: "life",
 	state: "solid",
@@ -661,7 +698,6 @@ elements.banana = {
 	breakInto: "juice",
 	breakIntoColor: "#f0f060",
 	reactions: {
-        "steam": { elem1: "potassium", elem2: null },
 		"sugar": { elem1: "jelly", elem2: null, tempMin: 100, color1: ["#fdf8d6","#f9efa6"] },
 	}
 };
@@ -1074,14 +1110,6 @@ elements.eggplant = {
 	breakIntoColor: ["#674ea7","#351c75"],
 };
 
-elements.potassium = {
-	color: "#a3a333",
-	behavior: behaviors.POWDER,
-	category: "states",
-	state: "solid",
-	breakInto: "juice",
-};
-
 elements.onion = {
 	color: ["#62121b","#a92940","#c04b65","#d8699e"],
 	behavior: 
@@ -1282,7 +1310,7 @@ elements.legacy_rocket = {
         "XX|DL%1|XX",
         "CR:smoke|CR:fire|CR:smoke",
     ],
-    category: "special",
+    category: "legacy",
     hidden:true,
     state: "solid",
     temp:700,
@@ -1292,6 +1320,84 @@ elements.legacy_rocket = {
     stateHigh: "molten_steel"
 };
 
+elements.legacy_dough = {
+	color: "#bfac91",
+    behavior: behaviors.STURDYPOWDER,
+    onMix: function(dough,ingredient) {
+        if (elements[ingredient.element].isFood && elements[ingredient.element].id !== elements.dough.id && elements[ingredient.element].id !== elements.flour.id && elements[ingredient.element].id !== elements.batter.id && elements[ingredient.element].id !== elements.bread.id) {
+            var rgb1 = dough.color.match(/\d+/g);
+            var rgb2 = ingredient.color.match(/\d+/g);
+            // average the colors
+            var rgb = [
+                Math.round((parseInt(rgb1[0])+parseInt(rgb2[0]))/2),
+                Math.round((parseInt(rgb1[1])+parseInt(rgb2[1]))/2),
+                Math.round((parseInt(rgb1[2])+parseInt(rgb2[2]))/2)
+            ];
+            changePixel(ingredient, "dough")
+            // convert rgb to hex
+            var hex = RGBToHex(rgb);
+            dough.color = pixelColorPick(dough, hex);
+            // 50% change to delete ingredient
+            if (Math.random() < 0.5) { deletePixel(ingredient.x, ingredient.y); }
+            else {
+                ingredient.color = pixelColorPick(ingredient, hex);
+            }
+        }
+    },
+    reactions: {
+        "milk": { elem2:"broth", color2:"#ECC891", tempMin:70 },
+        "cream": { elem2:"broth", color2:"#ECC891", tempMin:70 },
+    },
+    category: "legacy",
+    tempHigh: 94,
+    stateHigh: "bread",
+    //stateHighColorMultiplier: 0.9,
+    burn:40,
+    burnTime:25,
+    burnInto:"ash",
+    state: "solid",
+    density: 526.9,
+    isFood: true
+};
+
+elements.legacy_batter = {
+	color: "#d4bc85",
+    behavior: behaviors.LIQUID,
+    onMix: function(batter,ingredient) {
+        if (elements[ingredient.element].isFood && elements[ingredient.element].id !== elements.batter.id && elements[ingredient.element].id !== elements.flour.id && elements[ingredient.element].id !== elements.yolk.id && elements[ingredient.element].id !== elements.dough.id && elements[ingredient.element].id !== elements.baked_batter.id) {
+            var rgb1 = batter.color.match(/\d+/g);
+            var rgb2 = ingredient.color.match(/\d+/g);
+            // average the colors
+            var rgb = [
+                Math.round((parseInt(rgb1[0])+parseInt(rgb2[0]))/2),
+                Math.round((parseInt(rgb1[1])+parseInt(rgb2[1]))/2),
+                Math.round((parseInt(rgb1[2])+parseInt(rgb2[2]))/2)
+            ];
+            changePixel(ingredient, "batter")
+            // convert rgb to hex
+            var hex = RGBToHex(rgb);
+            batter.color = pixelColorPick(batter, hex);
+            // 50% change to delete ingredient
+            if (Math.random() < 0.5) { deletePixel(ingredient.x, ingredient.y); }
+            else {
+                ingredient.color = pixelColorPick(ingredient, hex);
+            }
+        }
+    },
+    category: "legacy",
+    tempHigh: 94,
+    stateHigh: "baked_batter",
+    stateHighColorMultiplier: 0.9,
+    burn:40,
+    burnTime:25,
+    burnInto:"ash",
+    state: "liquid",
+    viscosity: 10000,
+    density: 1001,
+    hidden: true,
+    isFood: true
+};
+
 elements.legacy_lattice = {
 	color: "#cb4cd9",
     behavior: [
@@ -1300,7 +1406,7 @@ elements.legacy_lattice = {
         "CL|XX|CL",
     ],
     hidden: true,
-    category:"special",
+    category:"legacy",
     excludeRandom: true
 };
 
@@ -1352,6 +1458,37 @@ elements.left_lattice = {
     excludeRandom: true
 };
 
+elements.amethyst = {
+	color: ["#9868e0","#482888","#7848b8","#c898f0","#a878f0"],
+    behavior: behaviors.POWDER,
+    hidden: true,
+    category: "powders",
+};
+
+elements.quartz = {
+	color: ["#f6fff9","#f3f9f9","#f6fcf9","#fefefe","#fdfffe"],
+    behavior: behaviors.POWDER,
+    hidden: true,
+    category: "powders",
+	tempHigh: 1900,
+	stateHigh: "magma",
+	reactions: {
+		"molten_iron": { elem1: "amethyst", elem2: null },
+	}
+};
+
+elements.slushy_ice = {
+	color: ["#f6fff9","#f3f9f9","#f6fcf9","#fefefe","#fdfffe"],
+    behavior: behaviors.WALL,
+    temp: -5,
+    tempHigh: 5,
+    stateHigh: "smashed_ice",
+    category: "states",
+    state: "solid",
+    density: 917,
+    breakInto: "smashed_ice",
+};
+
 elements.toorhpaste = {
 	color: ["#31ffe0","#65ffe8","#97ffef","#c9fff7","#f3fffd"],
 	behavior: behaviors.LIQUID,
@@ -1428,10 +1565,17 @@ elements.algae.breakInto = "seafoam"
 
 elements.battery.breakInto = "battery_acid"
 
+elements.art.burn = 5
+elements.art.burnTime = 300
+elements.art.burnInto = ["ember","charcoal","fire"]
+
+
 elements.herb.breakInto = "seasoning"
 
 elements.chocolate.breakInto = "chocolate_sauce"
 
+elements.magma.stateLow = ["basalt","basalt","basalt","basalt","basalt","basalt","basalt","rock","quartz"]
+
 if (!elements.bless.reactions) elements.bless.reactions = {};
 elements.bless.reactions.mold = { elem2: null }
 
diff --git a/mods/plants.js b/mods/plants.js
new file mode 100644
index 00000000..23a68e1b
--- /dev/null
+++ b/mods/plants.js
@@ -0,0 +1,1081 @@
+//This mod was made by Adora the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok.
+let fruits = ["plum", "peach", "pear", "orange", "apple", "cherry", "mango"];
+let vineExclude = ["tomato", "grape", "fruit_vine", "kiwi"];
+let vines = ['tomato', 'grape', 'kiwi'];
+let bushes = ["blackberry", "blueberry", "raspberry"];
+let allFruits = fruits.concat(vines, bushes)
+function interpolateRgb(rgb1, rgb2, ratio) {
+  const interpolatedRgb = {
+    r: Math.round(rgb1.r + (rgb2.r - rgb1.r) * ratio),
+    g: Math.round(rgb1.g + (rgb2.g - rgb1.g) * ratio),
+    b: Math.round(rgb1.b + (rgb2.b - rgb1.b) * ratio),
+  };
+  return interpolatedRgb;
+}
+
+elements.fruit_branch = {
+    color: elements.tree_branch.color,
+    behavior: [
+        "CR:fruit_leaves,fruit_branch%2|CR:fruit_leaves,fruit_leaves,fruit_leaves,fruit_branch%2|CR:fruit_leaves,fruit_branch%2",
+        "XX|XX|XX",
+        "XX|XX|XX",
+    ],
+    tempHigh: 100,
+    stateHigh: "wood",
+    tempLow: -30,
+    stateLow: "wood",
+    category: "life",
+    burn: 40,
+    burnTime: 50,
+    burnInto: ["sap","ember","charcoal"],
+    hidden: true,
+    state: "solid",
+    density: 1500,
+    hardness: 0.15,
+    breakInto: ["sap","sawdust"],
+    seed: "apple_seed",
+  tick: function(pixel){
+    for(var i = 0; i < adjacentCoords.length; i++){
+      let x = pixel.x+adjacentCoords[i][0];
+      let y = pixel.y+adjacentCoords[i][1];
+      if(isEmpty(x, y) || outOfBounds(x, y)) { continue; }
+      let pixel2 = pixelMap[x][y];
+      if(pixel2.element == "fruit_branch" || pixel2.element == "fruit_leaves" || pixel2.element == "wood"){
+        if(pixel.fruit && !pixel2.fruit){
+          pixel2.fruit = pixel.fruit;
+        } else if (!pixel.fruit && pixel2.fruit){
+          pixel.fruit = pixel2.fruit;
+        }
+      }
+    }
+  }
+}
+elements.fruit_leaves = {
+    color: elements.plant.color,
+    behavior: [
+        "XX|XX|XX",
+        "XX|XX|XX",
+        "XX|XX|XX",
+    ],
+    reactions: {
+        "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 },
+        "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 },
+        "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 },
+        "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }
+    },
+    category:"life",
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -1.66,
+    stateLow: "frozen_plant",
+    burn:65,
+    burnTime:60,
+    burnInto: "dead_plant",
+    breakInto: "dead_plant",
+    state: "solid",
+    density: 1050,
+    hidden: true,
+    tick: function(pixel){
+      if(pixelTicks == pixel.start + 1 && pixel.blooming == undefined){
+        if(Math.floor(Math.random() * 3) == 2){
+          pixel.blooming = true;
+          pixel.color = "#FFE2E2";
+        } else {
+          pixel.blooming = false;
+        }
+      }
+      for(var i = 0; i < adjacentCoords.length; i++){
+        let x = pixel.x+adjacentCoords[i][0];
+        let y = pixel.y+adjacentCoords[i][1];
+        if(isEmpty(x, y) || outOfBounds(x, y)) { continue; }
+        let pixel2 = pixelMap[x][y];
+        if(pixel2.element == "fruit_branch" || pixel2.element == "fruit_leaves" || pixel2.element == "wood" || (elements[pixel2.element].properties && elements[pixel2.element].properties.type == "fruit")){
+            if(pixel.fruit && !pixel2.fruit){
+              pixel2.fruit = pixel.fruit;
+            } else if (!pixel.fruit && pixel2.fruit){
+              pixel.fruit = pixel2.fruit;
+          }
+        }
+      }
+      if(pixel.blooming){
+        if(pixelTicks > pixel.start + 150){
+          if(Math.floor(Math.random() * 400) == 3){
+            if(pixel.fruit){
+              if(pixel.fruit == "random"){
+                changePixel(pixel, fruits[Math.floor(Math.random() * fruits.length)]);
+              } else {
+                changePixel(pixel, pixel.fruit);
+              }
+            }
+          }
+        }
+      }
+  }
+}
+
+elements.apple_seed = {
+    color: "#1A0E00",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves" || pixelMap[pixel.x][pixel.y+1].element == "wood"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "apple";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"apple"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.apple = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: "#ff0004",
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#FF4747",
+  isFood: true,
+  properties: {
+    fruit: "apple",
+    type: "fruit",
+  }
+}
+elements.pear_seed = {
+    color: "#1A0E00",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "pear";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"pear"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.pear = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: "#97FF43",
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#ABFF8D",
+  isFood: true,
+  properties: {
+    fruit: "pear",
+    type: "fruit",
+  }
+}
+elements.cherry_seed = {
+    color: "#b56233",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "cherry";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"cherry"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.cherry = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: "#750000",
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#8a0000",
+  isFood: true,
+  properties: {
+    fruit: "cherry",
+    type: "fruit",
+  }
+}
+elements.milk = {
+  color: "#fafafa",
+  behavior: behaviors.LIQUID,
+  onMix: function(milk1, milk2) {
+    if (shiftDown && Math.random() < 0.01) {
+        changePixel(milk1,"butter")
+    }
+  },
+  reactions: {
+    "melted_chocolate": { elem1:"chocolate_milk", elem2:null },
+    "chocolate": { elem1:"chocolate_milk", elem2:"melted_chocolate", chance:0.05 },
+    "coffee_ground": { elem1:"chocolate_milk", chance:0.05 },
+    "juice": { elem1:"fruit_milk", elem2:null, chance:0.05, func: function(pixel1, pixel2){
+      let newrgb = interpolateRgb(getRGB('rgb(250,250,250)'), getRGB(pixel2.color), 0.25);
+      pixel1.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+    }},
+    "soda": { elem1:"pilk", elem2:null, chance:0.1 },
+    "yolk": { elem1:"eggnog", elem2:null, chance:0.1 },
+    "dirt": { elem1: null, elem2: "mud" },
+    "sand": { elem1: null, elem2: "wet_sand" },
+    "clay_soil": { elem1: null, elem2: "clay" },
+    "caramel": { color1:"#C8B39A", elem2:null, chance:0.05 },
+    "sugar": { elem2:null, chance:0.005},
+  },
+  tempLow: 0,
+  stateLow: "ice_cream",
+  stateLowColorMultiplier: [0.97,0.93,0.87],
+  tempHigh: 93,
+  stateHigh: "yogurt",
+  viscosity: 1.5,
+  category: "liquids",
+  state: "liquid",
+  density: 1036.86,
+  isFood: true
+}
+elements.cream = {
+  color: "#f7f7f7",
+  behavior: behaviors.LIQUID,
+  onMix: function(milk1, milk2) {
+      if ((shiftDown && Math.random() < 0.01) || (elements[milk2.element].id === elements.milk.id && Math.random() < 0.00025)) {
+          changePixel(milk1,"butter")
+      }
+  },
+  reactions: {
+      "dirt": { elem1: null, elem2: "mud" },
+      "sand": { elem1: null, elem2: "wet_sand" },
+      "clay_soil": { elem1: null, elem2: "clay" },
+      "melted_chocolate": { color1:"#664934", elem2:null },
+      "chocolate": { color1:"#664934", elem2:"melted_chocolate", chance:0.05 },
+      "juice": { elem1:"fruit_milk", elem2:null, chance:0.05, func: function(pixel1, pixel2){
+                 let newrgb = interpolateRgb(getRGB('rgb(250,250,250)'), getRGB(pixel2.color), 0.25);
+                 pixel1.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+               }},
+      "soda": { elem1:"pilk", elem2:null, chance:0.1 },
+      "yolk": { elem1:"#eggnog", elem2:null, chance:0.1 },
+      "caramel": { color1:"#C8B39A", chance:0.05 },
+      "sugar": { elem2:null, chance:0.005},
+  },
+  viscosity: 1.5,
+  tempHigh: 1000,
+  stateHigh: ["smoke","smoke","smoke","steam","steam","calcium"],
+  tempLow: 0,
+  stateLow: "ice_cream",
+  stateLowColorMultiplier: 0.97,
+  category: "liquids",
+  hidden: true,
+  isFood: true,
+  state: "liquid",
+  density: 959.97,
+}
+function getRGB(rgb){
+  let rgb2 = rgb.replace(")", "").replace("rgb(", "").replace(/,/g, "r").split("r")
+  return { r: parseInt(rgb2[0]), g: parseInt(rgb2[1]), b: parseInt(rgb2[2]) };
+}
+elements.peach = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: ["#ffb485", "#ffa770", "#ff7b61", "#ff512e", "#ff350d"],
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#ffa74f",
+  isFood: true,
+  properties: {
+    fruit: "peach",
+    type: "fruit",
+  }
+}
+elements.peach_seed = {
+    color: "#240c00",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "peach";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"peach"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.plum = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: "#1c0030",
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#d2880a",
+  isFood: true,
+  properties: {
+    fruit: "plum",
+    type: "fruit",
+  }
+}
+elements.plum_seed = {
+    color: "#240c00",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "plum";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"plum"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.juice.reactions.juice = {
+  func: function(pixel1, pixel2){
+    if(pixel1.color != pixel2.color){
+      if(Math.floor(Math.random() * 1000) == 1){
+      let newrgb = interpolateRgb(getRGB(pixel1.color), getRGB(pixel2.color), 0.5);
+      pixel1.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+      pixel2.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+      }
+    }
+  }
+}
+elements.juice.onMix = function(pixel){
+    let num = Math.floor(Math.random() * 4);
+    let x = pixel.x + adjacentCoords[num][0];
+    let y = pixel.y + adjacentCoords[num][1];
+    if(!isEmpty(x,y) && !outOfBounds(x,y)){
+      let pixel2 = pixelMap[x][y];
+      if(pixel.color != pixel2.color && pixel2.element == "juice"){
+        let condition;
+        if(shiftDown == 0){
+          condition = (Math.floor(Math.random() * 2) == 1); 
+        } else {
+          condition = true; 
+        }
+        if(condition){
+          let newrgb = interpolateRgb(getRGB(pixel.color), getRGB(pixel2.color), 0.5);
+          pixel.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+          pixel2.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`;
+        }
+      }
+    }
+  }
+elements.vine.behavior = [["XX", "ST:vine", "XX"],["ST:vine", "XX", "ST:vine"],["XX", "ST:vine AND M1", "XX"]]
+elements.apricot = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: ["#ffa100", "#FF5D00", "#FF7A00", "#FF9700"],
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#ffa836",
+  isFood: true,
+  properties: {
+    fruit: "apricot",
+    type: "fruit",
+  }
+}
+elements.apricot_seed = {
+    color: "#291300",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "apricot";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"apricot"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.orange = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: "#FFB400",
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#FFDB00",
+  isFood: true,
+  properties: {
+    fruit: "orange",
+    type: "fruit",
+  }
+}
+elements.orange_seed = {
+    color: "#291300",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "orange";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"orange"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.random_seed = {
+    color: "#291300",
+    tick: function(pixel) {
+      if(pixel.start == pixelTicks){
+        pixel.fruit = fruits[Math.floor(Math.random() * fruits.length)];
+      }
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = pixel.fruit;
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.multi_seed = {
+    color: "#291300",
+    tick: function(pixel) {
+      pixel.fruit = fruits[Math.floor(Math.random() * fruits.length)]
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "random";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.fruit_vine = {
+  category: "life",
+  color: elements.plant.color,
+  behavior: [["XX", "ST:fruit_vine AND ST:wood", "XX"], ["ST:fruit_vine AND ST:wood", "XX", "ST:fruit_vine AND ST:wood"], ["XX", "ST:fruit_vine AND M1 AND ST:wood", "XX"]],
+  properties: {
+    age: 0,
+  },
+  tick: function(pixel){
+    if(Math.floor(Math.random() * 100) == 1 && pixel.age > 25 && pixel.age < 500){
+      for(var i = 0; i < squareCoords.length; i++){
+        let x1 = pixel.x + squareCoords[i][0];
+        let y1 = pixel.y + squareCoords[i][1];
+        if(!isEmpty(x1,y1) && !outOfBounds(x1,y1) && !vineExclude.includes(pixelMap[x1][y1].element)){
+          let randomNum = Math.floor(Math.random() * 4);
+          let x2 = x1 + squareCoords[randomNum][0];
+          let y2 = y1 + squareCoords[randomNum][1];
+          if(isEmpty(x2,y2) && !outOfBounds(x2,y2)){
+            createPixel("fruit_vine", x2, y2);
+            pixelMap[x2][y2].fruit = pixel.fruit;
+          }
+        }
+      }
+    }
+    pixel.age += 1;
+    if(pixel.fruit){
+      for(var i = 0; i < adjacentCoords.length; i++){
+        let x = pixel.x + adjacentCoords[i][0];
+        let y = pixel.y + adjacentCoords[i][1];
+        if(isEmpty(x,y) && !outOfBounds(x,y) && Math.floor(Math.random() * 1000) == 5){
+          createPixel(pixel.fruit, x, y);
+        }
+      }
+    }
+    if(!pixel.fruit){
+      for(var i = 0; i < squareCoords.length; i++){
+        let x = pixel.x + squareCoords[i][0];
+        let y = pixel.y + squareCoords[i][1];
+        if(isEmpty(x,y) || outOfBounds(x,y)){ continue; }
+        let pixel2 = pixelMap[x][y];
+        if(pixel2.fruit){
+          pixel.fruit = pixel2.fruit;
+        } else { continue; }
+      }
+    }
+  }
+}
+elements.grape.behavior = [["XX", "ST:fruit_vine", "XX"], ["ST:fruit_vine", "XX", "ST:fruit_vine"], ["M2", "ST:fruit_vine AND M1", "M2"]];
+elements.tomato.behavior = elements.grape.behavior;
+elements.tomato_seed = {
+  color: "#FFFAAD",
+  category: "life",
+  behavior: behaviors.POWDER,
+  tick: function(pixel){
+    if(pixel.age > 40){
+      changePixel(pixel, "fruit_vine");
+      pixel.fruit = "tomato";
+    }
+    pixel.age += 1;
+  },
+  properties: {
+    age: 0,
+  },
+}
+elements.grape_seed = {
+  color: "#231A00",
+  category: "life",
+  behavior: behaviors.POWDER,
+  tick: function(pixel){
+    if(pixel.age > 40){
+      changePixel(pixel, "fruit_vine");
+      pixel.fruit = "grape";
+    }
+    pixel.age += 1;
+  },
+  properties: {
+    age: 0,
+  },
+}
+elements.kiwi = {
+  behavior: elements.grape.behavior,
+  color: "#403000",
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#21A800",
+  isFood: true,
+  properties: {
+    type: "fruit",
+  }
+}
+elements.kiwi_seed = {
+  color: "#231A00",
+  category: "life",
+  behavior: behaviors.POWDER,
+  tick: function(pixel){
+    if(pixel.age > 40){
+      changePixel(pixel, "fruit_vine");
+      pixel.fruit = "kiwi";
+    }
+    pixel.age += 1;
+  },
+  properties: {
+    age: 0,
+  },
+}
+elements.bush_base = {
+  color: elements.wood.color,
+  behavior: [
+    ["CR:bush_cane%25", "XX", "CR:bush_cane%25"],
+    ["XX", "XX", "XX"],
+    ["XX", "XX", "XX"]
+  ],
+  tempHigh: 100,
+  stateHigh: "dead_plant",
+  tempLow: -40,
+  stateLow: "frozen_plant",
+  burn: 65,
+  burnTime: 15,
+  category: "life",
+  state: "solid",
+  tick: function(pixel){
+    let caneCoords = [[-1,-1],[1,-1]];
+    for(var i = 0; i < caneCoords.length; i++){
+      let x = pixel.x + caneCoords[i][0];
+      let y = pixel.y + caneCoords[i][1];
+      if(!isEmpty(x,y) && !outOfBounds(x,y)){
+        let pixel2 = pixelMap[x][y];
+        if(pixel2.element == "bush_cane" && !pixel2.fruit){
+          pixel2.fruit = pixel.fruit;
+        }
+      } 
+    }
+  }
+};
+elements.bush_cane = {
+  color: elements.wood.color,
+  tick: function(pixel){
+    if(pixel.age < 200 && Math.floor(Math.random() * 40) == 1){
+      if(!outOfBounds(pixel.x,pixel.y-1)){
+        if(isEmpty(pixel.x,pixel.y-1)){
+          createPixel("bush_cane",pixel.x,pixel.y-1);
+          if(pixel.fruit){
+            let pixel2  = pixelMap[pixel.x][pixel.y-1];
+            pixel2.fruit = pixel.fruit;
+            pixel2.age = pixel.age;
+          }
+        }
+      }
+    }
+    if(pixel.fruit && Math.floor(Math.random() * 400) == 1 && pixel.age > 200){
+      for(var i = 0; i < adjacentCoords.length; i++){
+        let x = pixel.x + adjacentCoords[i][0];
+        let y = pixel.y + adjacentCoords[i][1];
+        if(isEmpty(x,y) && !outOfBounds(x,y)){
+          createPixel("fruit_leaves", x, y);
+          pixelMap[x][y].fruit = pixel.fruit;
+          pixel.blooming = trueFalse(1, 1)[Math.floor(Math.random() * 2)];
+        }
+      }
+    }
+    pixel.age += 1;
+  },
+  properties: {
+    age: 0,
+  },
+  category: "life",
+  tempLow: -2,
+  stateLow: "frozen_plant",
+}
+function trueFalse(numTrue, numFalse){
+  let list = [];
+  for(var i = 0; i < numTrue; i++){
+    list.push(true);
+  }
+  for(var i = 0; i < numFalse; i++){
+    list.push(false);
+  }
+  return list;
+}
+elements.raspberry_seed = {
+  color: "#ffe099",
+  behavior: behaviors.STURDYPOWDER,
+  category: "life",
+  properties: {
+    age: 0,
+  },
+  tick: function(pixel){
+    if(pixel.age > 40){
+      let x1 = pixel.x - 1;
+      let y = pixel.y;
+      let x2 = pixel.x + 1;
+      if(isEmpty(x1,y) && !outOfBounds(x1,y)){
+        createPixel("bush_base", x1, y);
+        pixelMap[x1][y].fruit = "raspberry";
+      }
+      if(isEmpty(x2,y) && !outOfBounds(x2,y)){
+        createPixel("bush_base", x2, y);
+        pixelMap[x2][y].fruit = "raspberry";
+      }
+      if(!isEmpty(x1, y) && !isEmpty(x2, y)){
+        deletePixel(pixel.x, pixel.y);
+      }
+    }
+     pixel.age += 1;
+  }
+}
+elements.raspberry = {
+  behavior: [["XX", "ST:bush_cane", "XX"],["ST:bush_cane", "XX", "ST:bush_cane"],["M2", "ST:bush_cane AND M1", "M2"]],
+  color: ["#b00009", "#bf000a", "#d10812", "#db1822"],
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#ff2b36",
+  isFood: true,
+  properties: {
+    fruit: "raspberry",
+    type: "fruit",
+  }
+}
+elements.blueberry_seed = {
+  color: "#ffe099",
+  behavior: behaviors.STURDYPOWDER,
+  category: "life",
+  properties: {
+    age: 0,
+  },
+  tick: function(pixel){
+    if(pixel.age > 40){
+      let x1 = pixel.x - 1;
+      let y = pixel.y;
+      let x2 = pixel.x + 1;
+      if(isEmpty(x1,y) && !outOfBounds(x1,y)){
+        createPixel("bush_base", x1, y);
+        pixelMap[x1][y].fruit = "blueberry";
+      }
+      if(isEmpty(x2,y) && !outOfBounds(x2,y)){
+        createPixel("bush_base", x2, y);
+        pixelMap[x2][y].fruit = "blueberry";
+      }
+      if(!isEmpty(x1, y) && !isEmpty(x2, y)){
+        deletePixel(pixel.x, pixel.y);
+      }
+    }
+     pixel.age += 1;
+  }
+}
+elements.blueberry = {
+  behavior: [["XX", "ST:bush_cane", "XX"],["ST:bush_cane", "XX", "ST:bush_cane"],["M2", "ST:bush_cane AND M1", "M2"]],
+  color: ["#01082b", "#060e3d", "#111b52", "#1e2866"],
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#726778",
+  isFood: true,
+  properties: {
+    fruit: "blueberry",
+    type: "fruit",
+  }
+}
+elements.blackberry_seed = {
+  color: "#ffe099",
+  behavior: behaviors.STURDYPOWDER,
+  category: "life",
+  properties: {
+    age: 0,
+  },
+  tick: function(pixel){
+    if(pixel.age > 40){
+      let x1 = pixel.x - 1;
+      let y = pixel.y;
+      let x2 = pixel.x + 1;
+      if(isEmpty(x1,y) && !outOfBounds(x1,y)){
+        createPixel("bush_base", x1, y);
+        pixelMap[x1][y].fruit = "blackberry";
+      }
+      if(isEmpty(x2,y) && !outOfBounds(x2,y)){
+        createPixel("bush_base", x2, y);
+        pixelMap[x2][y].fruit = "blackberry";
+      }
+      if(!isEmpty(x1, y) && !isEmpty(x2, y)){
+        deletePixel(pixel.x, pixel.y);
+      }
+    }
+     pixel.age += 1;
+  }
+}
+elements.blackberry = {
+  behavior: [["XX", "ST:bush_cane", "XX"],["ST:bush_cane", "XX", "ST:bush_cane"],["M2", "ST:bush_cane AND M1", "M2"]],
+  color: ["#0c0021", "#070014", "#080017", "#09001a"],
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#2e0000",
+  isFood: true,
+  properties: {
+    fruit: "blackberry",
+    type: "fruit",
+  }
+}
+elements.mango = {
+  behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]],
+  color: ["#d63a45", "#e97341", "#9d9f3e", "#e4791b"],
+  category: "food",
+  breakInto: "juice",
+  breakIntoColor: "#ffa300",
+  isFood: true,
+  properties: {
+    fruit: "mango",
+    type: "fruit",
+  }
+}
+elements.mango_seed = {
+    color: "#240c00",
+    tick: function(pixel) {
+        if (isEmpty(pixel.x,pixel.y+1)) {
+            movePixel(pixel,pixel.x,pixel.y+1);
+        }
+        else {
+            if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) {
+                if (!outOfBounds(pixel.x,pixel.y+1)) {
+                    var dirtPixel = pixelMap[pixel.x][pixel.y+1];
+                    if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") {
+                        changePixel(dirtPixel,"root");
+                    }
+                }
+                if (isEmpty(pixel.x,pixel.y-1)) {
+                    movePixel(pixel,pixel.x,pixel.y-1);
+                    createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1);
+                    if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){
+                      pixelMap[pixel.x][pixel.y+1].fruit = "mango";
+                    }
+                }
+            }
+            else if (pixel.age > 1000) {
+                changePixel(pixel,"wood");
+            }
+            pixel.age++;
+        }
+        doDefaults(pixel);
+    },
+    properties: {
+        "age":0,
+      fruit:"mango"
+    },
+    tempHigh: 100,
+    stateHigh: "dead_plant",
+    tempLow: -2,
+    stateLow: "frozen_plant",
+    burn: 65,
+    burnTime: 15,
+    category: "life",
+    state: "solid",
+    density: 1500,
+    cooldown: defaultCooldown,
+    seed: true,
+};
+elements.seed_maker = {
+  category: "machines",
+  behavior: behaviors.WALL,
+  tick: function(pixel){
+    for(var i = 0; i < adjacentCoords.length; i++){
+      let x = pixel.x + adjacentCoords[i][0];
+      let y = pixel.y + adjacentCoords[i][1]
+      if(!isEmpty(x,y) && !outOfBounds(x,y)){
+        let pixel2 = pixelMap[x][y];
+        if(allFruits.includes(pixel2.element)){
+          changePixel(pixel2, `${pixel2.element}_seed`)
+        }
+      }
+    }
+  }
+}
diff --git a/mods/save_loading.js b/mods/save_loading.js
index 8fcab069..5f5dad74 100644
--- a/mods/save_loading.js
+++ b/mods/save_loading.js
@@ -69,6 +69,7 @@ try {
 			width: width,
 			height: height,
 			pixelSize: pixelSize,
+			pixelTicks: pixelTicks,
 			settings: settings,
 			version: 1,
 			enabledMods: localStorage.enabledMods,
@@ -322,6 +323,7 @@ try {
 		width = json.width;
 		height = json.height;
 		pixelSize = json.pixelSize;
+		pixelTicks = (json.pixelTicks ?? 0);
 		//currentPixels = json.currentPixels;
 		for(i = 0; i < json.pixelMap.length; i++) {
 			json.pixelMap[i] = json.pixelMap[i].map(x => zeroToNull(x));
diff --git a/mods/sbstuff.js b/mods/sbstuff.js
index 596e6999..41ee6af0 100644
--- a/mods/sbstuff.js
+++ b/mods/sbstuff.js
@@ -3,7 +3,7 @@ elements.cooked_rice = {
 	tempMin: 20,
 	stateMin: "rice",
 	tempHigh: 500,
-	stateHigh: ["ash", "charcoal"],
+	stateHigh: "charcoal",
 	density: 699,
 	color: "#c2b6b6",
 	behavior: behaviors.LIQUID,
@@ -16,37 +16,39 @@ elements.cooked_rice = {
 
 elements.rice = {
 	breakInto: "flour",
-	viscosity: 10000,
 	isFood: true,
 	density: 696,
 	tempHigh: 232,
 	stateHigh: "cooked_rice",
 	color: "#c8c8c8",
-	behavior: behaviors.LIQUID,
+	behavior: behaviors.POWDER,
 	category: "food",
 	state: "liquid",
 };
 
 elements.moth = {
 	tempHigh: 500,
-	stateHigh: "ash",
+	stateHigh: "dead_bug",
+	breakInto: "dead_bug",
 	color: "#57381a",
 	behavior: behaviors.FLY,
 	category: "life",
-	state: "solid",
+	state: "liquid",
 };
 
 elements.cotton_candy = {
 	isFood: true,
-	tempHigh: 500,
-	stateHigh: "ash",
+	tempHigh: 200,
+	stateHigh: "sugar",
 	density: 1000,
-	color: "#b6c7e3",
+	color: ["#b6c7e3", "#c54b4b", "#e7769c"],
+	singleColor: true,
 	behavior: behaviors.POWDER,
 	category: "food",
 	state: "liquid",
 	reactions: {
-		"water": { elem1: "sugar", elem2: null },
+		"water": { elem1: "sugar", elem2: "water" },
+		"sugar_water": { elem1: "sugar", elem2:"sugar_water", chance: 10 }
 	}
 };
 
@@ -192,6 +194,8 @@ elements.green_berries = {
 elements.meth = {
 	hardness: 1,
 	tempHigh: 500,
+	tempLow: -50,
+	stateLowColorMultiplier: 0.9,
 	stateHigh: "melted_meth",
 	color: "#0affef",
 	behavior: behaviors.POWDER,
@@ -199,6 +203,18 @@ elements.meth = {
 	state: "liquid"
 };
 
+elements.melted_meth = {
+	viscosity: 1000,
+	tempHigh: 100000,
+	tempLow: -20,
+	stateHigh: "beans",
+	stateLow: "meth",
+	color: "#00a2ff",
+	behavior: behaviors.LIQUID,
+	category: "joke",
+	state: "solid",
+};
+
 elements.garlic = {
 	isFood: true,
 	tempHigh: 500,
@@ -217,7 +233,7 @@ elements.garlic_bread = {
 	breakInto: "crumb",
 	tempHigh: 500,
 	stateHigh: "ash",
-	color: ["#db9b56", "#288a0c", "#db9b56", "#db9b56", "#db9b56", "#db9b56"],
+	color: ["#e9be90", "#288a0c", "#e0c6aa", "#b49e85", "#b6926b", "#ccac8b"],
 	behavior: behaviors.STURDYPOWDER,
 	category: "food",
 	state: "solid",
@@ -249,6 +265,8 @@ elements.lemon = {
 elements.lemonade = {
 	isFood: true,
 	tempHigh: 500,
+	tempLow: -15,
+	tempLowColor: "#f8eb35",
 	stateHigh: "steam",
 	color: "#fff41c",
 	behavior: behaviors.LIQUID,
@@ -269,6 +287,18 @@ elements.poop = {
 	}
 };
 
+elements.diarrhea = {
+	hardness: 1,
+	viscosity: 10000,
+	tempHigh: 500,
+    stateHigh: ["ash", "ash", "ash", "ash", "ash", "ash", "ash", "steam",],
+    color: "#523718",
+    behavior: behaviors.LIQUID,
+    category: "joke",
+	state: "solid",
+	desc: "riddle me this, libshart, if theres liquid poop then wheres the solid piss?"
+};
+
 elements.marshmallow = {
 	isFood: true,
 	tempHigh: 50,
@@ -330,6 +360,7 @@ elements.cereal = {
 	behavior: behaviors.STURDYPOWDER,
 	category: "food",
 	state: "liquid",
+	stain: 0.005
 };
 
 elements.sushi = {
@@ -355,6 +386,7 @@ elements.diamond_ore = {
 elements.coca_cola = {
 	isFood: true,
 	tempHigh: 500,
+	tempLow: -10,
 	stateHigh: "steam",
 	color: "#381e13",
 	behavior: behaviors.LIQUID,
@@ -365,6 +397,7 @@ elements.coca_cola = {
 elements.pepsi = {
 	tempHigh: 500,
 	stateHigh: "steam",
+	tempLow: -10,
 	color: "#2b1717",
 	behavior: behaviors.LIQUID,
     category: "liquids",
@@ -374,6 +407,7 @@ elements.pepsi = {
 elements.piss = {
 	tempHigh: 500,
 	stateHigh: "steam",
+	tempLow: -10,
 	color: "#ffff00",
 	behavior: behaviors.LIQUID,
 	category: "joke",
@@ -405,17 +439,10 @@ elements.pastry = {
 	state: "solid",
 };
 
-elements.melted_meth = {
-	tempHigh: 100000,
-	stateHigh: "beans",
-	color: "#00a2ff",
-	behavior: behaviors.LIQUID,
-	category: "joke",
-	state: "solid",
-};
 
-elements.expired_milk = {
+elements.spoiled_milk = {
 	tempHigh: 500,
+	tempLow: -20,
 	stateHigh: "ash",
 	color: "#b8c2b4",
 	behavior: behaviors.LIQUID,
@@ -523,6 +550,8 @@ elements.mashed_pea = {
 elements.burnt_beans = {
 	tempHigh: 500,
 	stateHigh: "ash",
+	tempLow: -0,
+	stateLow: "beans",
 	isFood: true,
 	viscosity: 10000,
 	density: 721,
@@ -801,6 +830,7 @@ elements.barbecue_sauce = {
 	viscosity: 3000,
 	density: 1800,
 	tempHigh: 500,
+	tempLow: 0,
 	stateHigh: "steam",
 	color: "#420400",
 	behavior: behaviors.LIQUID,
@@ -907,6 +937,7 @@ elements.porridge = {
 	viscosity: 3000,
 	density: 500,
 	tempHigh: 500,
+	tempLow: -10,
 	stateHigh: "steam",
 	color: "#b8a254",
 	behavior: behaviors.LIQUID,
@@ -938,7 +969,7 @@ elements.chocolate_grape = {
 	viscosity: 10000,
 	tempHigh: 300,
 	stateHigh: "steam",
-	color: ["#9e3475", "#6e4d36"],
+	color: ["#7e600d", "#6e4d36"],
 	behavior: behaviors.LIQUID,
 	category: "food",
 	state: "liquid",
@@ -949,7 +980,7 @@ elements.sprinkles = {
 	stateHigh: "ash",
 	cooldown: 0.2,
 	color: ["#ff5e5e", "#ffea5e", "#73ff5e", "#5efcff", "#995eff", "#ff5ed1"],
-	behavior: behaviors.STURDYPOWDER,
+	behavior: behaviors.POWDER,
 	category: "powders",
 	state: "liquid",
 	maxSize: 1,
@@ -965,6 +996,7 @@ elements.incinerator = {
 	category: "machines",
 	state: "solid",
 	insulate: true,
+	excludeRandom: true,
 	reactions: {
 		"fart": { elem1: null, elem2: "ohio" },
 	}
@@ -1113,6 +1145,7 @@ elements.strawberry = {
 elements.beer = {
     tempHigh: 300,
     stateHigh: "steam",
+	tempLow: -10,
     color: "#b39329",
     behavior: behaviors.LIQUID,
     category: "liquids",
@@ -1140,8 +1173,10 @@ elements.carrot = {
 };
 
 elements.wine = {
+	hidden: true,
 	tempHigh: 400,
     stateHigh: "steam",
+	tempLow: -10,
     color: "#2e0206",
     behavior: behaviors.LIQUID,
     category: "liquids",
@@ -1173,6 +1208,7 @@ elements.dark_energy = {
 	 ],
     category: "special",
     state: "gas",
+	excludeRandom: true
 };
 
 elements.ohio = {
@@ -1189,6 +1225,7 @@ elements.ohio = {
 	category: "joke",
     state: "gas",
 	desc: "use at own risk",
+	excludeRandom: true
 };
 
 elements.papaya = {
@@ -1279,6 +1316,9 @@ elements.heavy_water = {
 	behavior: behaviors.LIQUID_OLD,
 	category: "liquids",
     state: "liquid",
+	reactions: {
+		"sand": { elem1: null, elem2: "quicksand" },
+	}
 };
 
 elements.blood_orange = {
@@ -1308,6 +1348,7 @@ elements.cranberry = {
 	hidden: true,
     tempHigh: 300,
     stateHigh: "steam",
+	tempLow: -15,
     color: "#ad2a1d",
     behavior: behaviors.LIQUID,
     category: "food",
@@ -1441,6 +1482,7 @@ elements.uraniumaniumaniumaniumanium_popcornicecream_plutoniumeptunium_238239 =
 elements.coffee_milk = {
 	tempHigh: 300,
     stateHigh: "steam",
+	tempLow: -30,
     color: "#5c4c42",
     behavior: behaviors.LIQUID,
     category: "liquids",
@@ -1565,6 +1607,7 @@ elements.electron = {
 };
 
 elements.sned = {
+	desc: "slowly expanding...",
 	color: "#dfe0d9",
 	behavior: [
 		"XX|XX AND CR:sned%1|XX",
@@ -1580,7 +1623,7 @@ elements.uranium_tea = {
 	temp: 60,
 	tempHigh: 400,
 	stateHigh: "molten_uranium",
-	color: ["#0f8b15", "#316624", "#59864b", "#502e0f"],
+	color: ["#526306", "#40530c", "#80320e", "#502e0f"],
 	behavior: behaviors.RADLIQUID,
 	category: "liquids",
 	state: "liquid"
@@ -1598,19 +1641,19 @@ elements.powerlaser = {
                 if (Math.random() > 0.05) { continue }
                 createPixel("flash", x, y);
                 pixelMap[x][y].color = "#b80ced";
-                pixelMap[x][y].temp = 1001000;
+                pixelMap[x][y].temp = 11000;
             }
             else {
                 if (elements[pixelMap[x][y].element].isGas) { continue }
                 if (elements[pixelMap[x][y].element].id === elements.heat_ray.id) { break }
-                pixelMap[x][y].temp += 901000;
+                pixelMap[x][y].temp += 9000;
                 pixelTempCheck(pixelMap[x][y]);
                 break;
             }
         }
         deletePixel(pixel.x, pixel.y);
     },
-    temp: 1000000,
+    temp: 10000,
     category: "energy",
     state: "gas",
     excludeRandom: true,
@@ -1629,6 +1672,70 @@ elements.magma_bomb = {
 	state: "liquid"
 };
 
+elements.quicksand = {
+	viscosity: 10000,
+	tempHigh: 1000,
+	stateHigh: ["molten_glass", "molten_glass", "molten_glass", "molten_glass", "steam"],
+	color: ["#b1873a", "#cea250"],
+	behavior: behaviors.LIQUID,
+    category: "land",
+    state: "liquid",
+	density: 1400,
+	stain: 0.02
+};
+
+elements.liquid_filler = {
+	color: "#ae00ff",
+	behavior: [
+		"XX|XX AND CR:liquid_filler%50|XX",
+		"M2 AND CR:liquid_filler%50|XX|M2 AND CR:liquid_filler%50",
+		"M1|M1 AND CH:liquid_filler%50|M1",
+	],
+	category: "special",
+    state: "liquid"
+};
+
+elements.antimony = {
+	color: ["#4b90b8", "#a3bfd8", "#89a0b6", "#8798a7", "#738092"],
+	behavior: behaviors.WALL,
+	category: "solids",
+	state: "solid",
+	density: 6697,
+	tempHigh: 630,
+	stateHigh: "melted_antimony",
+	alias: "...sb?!"
+};
+
+elements.melted_antimony = {
+	color: ["#8fb2c7", "#7494b1", "#72a1cc", "#a3aaaf", "#a4aab3"],
+	behavior: behaviors.LIQUID,
+	category: "liquids",
+	state: "liquid",
+	density: 6697,
+	stain: 0.1,
+	tempLow: -270,
+	stateLowName: "antimony_ice"
+};
+
+elements.unstain = {
+	color: "#729fff",
+	behavior: [
+		"XX|XX|XX",
+		"XX|XX|XX",
+		"XX|XX|XX"
+	],
+	stain: -1,
+    tool: (pixel) => {
+        doStaining({
+            element: "unstain",
+            x: pixel.x,
+            y: pixel.y
+        })
+    },
+	category: "tools",
+	state: "solid",
+};
+
 elements.incinerate.category = "tools",
 elements.cook.category = "tools",
 elements.room_temp.category = "tools",
@@ -1663,6 +1770,9 @@ elements.potato.reactions.steam = {elem1: "fries", tempMin: 100, chance:50}
 if (!elements.water.reactions) elements.water.reactions = {};
 elements.water.reactions.cocaine = { elem1: "solid_water", elem2: null }
 
+if (!elements.alcohol.reactions) elements.alcohol.reactions = {};
+elements.alcohol.reactions.juice = {elem1:"wine", elem2:null, chance:5}
+
 if (!elements.paper.reactions) elements.paper.reactions = {};
 elements.paper.reactions.bless = { elem1: "robux", elem2: null, chance: 0.0000001 }
 
diff --git a/mods/singleColor.js b/mods/singleColor.js
new file mode 100644
index 00000000..0fc8d32b
--- /dev/null
+++ b/mods/singleColor.js
@@ -0,0 +1 @@
+window.addEventListener('load', function() {for (var element in elements) {elements[element].singleColor = true;}});
diff --git a/mods/survival.js b/mods/survival.js
new file mode 100644
index 00000000..b8970545
--- /dev/null
+++ b/mods/survival.js
@@ -0,0 +1,517 @@
+if (!settings.survival) {
+    settings.survival = {
+        "wall": 999,
+        "dirt": 999,
+        "sapling": 1,
+        "seeds": 5,
+        "ice": 25,
+        "cloner": 1,
+    }
+}
+settings.survival.cloner = 1;
+settings.unhide = 0;
+// settings.survivalClone=null; settings.survival = null; saveSettings();
+
+survivalTimeout = null;
+function survivalSave() {
+    if (survivalTimeout) { clearTimeout(survivalTimeout); }
+    survivalTimeout = setTimeout(function(){
+        saveSettings();
+    },1000);
+}
+function survivalAdd(element,amount,skipSave) {
+    if (elements[element].category === "tools") { return }
+    if (settings.survival[element]) {
+        settings.survival[element] += amount;
+    }
+    else {
+        settings.survival[element] = amount;
+    }
+    survivalUpdate(element);
+    if (!skipSave) {survivalSave()}
+}
+function survivalRemove(element,amount,skipSave) {
+    if (elements[element].category === "tools") { return }
+    if (settings.survival[element]) {
+        settings.survival[element] -= amount;
+        survivalUpdate(element);
+    }
+    if (settings.survival[element] <= 0) {
+        delete settings.survival[element];
+        var btn = document.getElementById("elementButton-"+element);
+        if (btn) { btn.remove(); }
+        selectElement("unknown");
+    }
+    if (!skipSave) {survivalSave()}
+}
+function survivalCount(element) {
+    return settings.survival[element] || 0;
+}
+function survivalUpdate(element) {
+    if (element === "gold_coin") {
+        // if it is not an integer, round it to 0.1
+        if (settings.survival.gold_coin % 1 !== 0) {
+            settings.survival.gold_coin = Math.round(settings.survival.gold_coin*10)/10;
+        }
+        document.getElementById("coinCount").innerHTML = settings.survival.gold_coin||0;
+    }
+    var btn = document.getElementById("elementButton-"+element);
+    if (elements[element] && elements[element].category === "tools") { return }
+    if (btn) {
+        btn.innerHTML = btn.innerHTML.split("(")[0]+"("+settings.survival[element]+")";
+    }
+    else if (elements[element]) {
+        createElementButton(element);
+        document.getElementById("elementButton-"+element).innerHTML += "("+settings.survival[element]+")";
+    }
+}
+
+runAfterAutogen(function(){
+    elements.erase.name = "pick_up";
+    delete elements.paint.category;
+    delete elements.lookup.category;
+    delete elements.pick;
+    delete elements.prop;
+    elements.radiation.category = "tools";
+    for (var element in elements) {
+        if (elements[element].category !== "tools") {
+            elements[element].hidden = true;
+            elements[element].category = "inventory";
+        }
+    }
+    for (var element in settings.survival) {
+        if (!elements[element]) { continue; }
+        if (elements[element].category === "tools") { continue; }
+        createElementButton(element);
+        document.getElementById("elementButton-"+element).innerHTML += "("+settings.survival[element]+")";
+    }
+});
+
+delete elements.cloner.behavior;
+elements.cloner.tick = function(pixel) {
+    if (settings.survivalClone) {
+        if (Math.random() < 0.025) {
+            // 1 or -1
+            var x = pixel.x + (Math.random() < 0.5 ? 1 : -1);
+            var y = pixel.y + (Math.random() < 0.5 ? 1 : -1);
+            if (isEmpty(x,y)) {
+                createPixel(settings.survivalClone,x,y);
+            }
+        }
+    }
+    else {
+        for (var i = 0; i < adjacentCoords.length; i++) {
+            var coords = adjacentCoords[i];
+            var x = pixel.x + coords[0];
+            var y = pixel.y + coords[1];
+            if (!isEmpty(x,y,true)) {
+                if (pixelMap[x][y].clone) { pixel.clone = pixelMap[x][y].clone; break }
+                var element = pixelMap[x][y].element;
+                if (element === pixel.element || elements[pixel.element].ignore.indexOf(element) !== -1) { continue }
+                settings.survivalClone = element;
+                survivalSave();
+                break;
+            }
+        }
+    }
+};
+elements.cloner.ignore = elements.cloner.ignore.concat(["gold","gold_coin","molten_gold","sun","supernova","diamond"]);
+elements.cloner.desc = "You can only clone one element at a time!"
+
+elements.smash.tool = function(pixel) {
+    if (elements[pixel.element].seed === true) { return }
+    if (elements[pixel.element].breakInto !== undefined || (elements[pixel.element].seed !== undefined && elements[pixel.element].seed !== true)) {
+        // times 0.25 if not shiftDown else 1
+        if (Math.random() < (elements[pixel.element].hardness || 1) * (shiftDown ? 1 : 0.25)) {
+            var breakInto = elements[pixel.element].breakInto;
+            if (elements[pixel.element].seed && (!breakInto || Math.random() < 0.5)) {
+                if (Math.random() < 0.2) {
+                    breakInto = elements[pixel.element].seed;
+                }
+                else {
+                    breakInto = null;
+                }
+            }
+            // if breakInto is an array, pick one
+            if (Array.isArray(breakInto)) {
+                breakInto = breakInto[Math.floor(Math.random() * breakInto.length)];
+            }
+            if (breakInto === null) {
+                deletePixel(pixel.x,pixel.y);
+                return;
+            }
+            var oldelement = pixel.element;
+            changePixel(pixel,breakInto);
+            pixelTempCheck(pixel);
+            if (elements[oldelement].breakIntoColor) {
+                pixel.color = pixelColorPick(pixel, elements[oldelement].breakIntoColor);
+            }
+        }
+    }
+};
+
+elementWorth = {
+    "gold_coin": 1,
+    "diamond": 100,
+    "ketchup": 15,
+    "jelly": 10,
+    "soda": 10,
+    "toast": 10,
+    "oil": 10,
+    "bread": 3,
+    "glass": 5,
+    "rad_glass": 6,
+    "glass_shard": 2,
+    "rad_shard": 3,
+    "paper": 5,
+    "broth": 5,
+    "honey": 5,
+    "caramel": 5,
+    "sap": 4,
+    "candy": 5,
+    "popcorn": 2,
+    "flour": 2,
+    "lettuce": 2,
+    "sauce": 2,
+    "wood": 0.2,
+    "tree_branch": 0.1,
+    "plant": 0.1,
+    "mushroom_cap": 0.1,
+    "mushroom_gill": 0.3,
+    "vine": 0.1,
+    "cactus": 0.1,
+    "cloner": 0,
+    "wall": 0,
+    "fire": 0,
+    "smoke": 0,
+    "plasma": 0,
+    "light": 0,
+    "laser": 0,
+    "liquid_light": 0.1,
+    "flash": 0,
+    "radiation": 0,
+    "petal": -1,
+    "cell": -1,
+    "cancer": -1,
+    "foam": -1,
+}
+elements.sell = {
+    color: ["#fff0b5","#ffe680","#c48821","#986a1a","#eca832","#f0bb62"],
+    tool: function(pixel) {
+        if (elementWorth[pixel.element] === 0) { return; }
+        deletePixel(pixel.x,pixel.y);
+        if (elementWorth[pixel.element] === -1) { return; }
+        survivalAdd("gold_coin",elementWorth[pixel.element]||1);
+    },
+    category: "tools",
+    desc: "Exchanges pixels for their market value in Gold Coins"
+}
+elements.seeds.name = "seed";
+
+/*
+~Cloner
+~Sell
+Shop
+    Cloner Reset
+    ~Ammonia
+    ~Dirt
+    ~Water
+    ~Seeds
+    ~Sapling
+    ~Pinecone
+    ~Primordial Soup
+    ~Worm
+    ~Bee
+    ~Human
+    ~TNT
+    Seller (Runs Sell tool on pixels that touch it)
+    Buyer (Cloner but uses store price every time, prompt to select item on select)
+Prices tab
+*/
+survivalShop = {
+    "dirt*25": 25,
+    "water*25": 250,
+    "ammonia*25": 500,
+    "seeds*1": 500,
+    "sapling*1": 500,
+    "pinecone*1": 500,
+    "tnt*25": 1000,
+    "worm*1": 1000,
+    "bee*1": 5000,
+    "primordial_soup*5": 10000,
+    "human*1": 50000,
+    "sun*1": 500000,
+}
+function survivalBuy(element) {
+    var price = survivalShop[element];
+    if (!price) { alert("The shop isn't selling "+element+"!"); return }
+    if (!settings.survival.gold_coin || settings.survival.gold_coin < price) { alert("You can't afford that!"); return }
+    survivalRemove("gold_coin",price);
+    var amount = 1;
+    if (element.indexOf("*") !== -1) { amount = parseInt(element.split("*")[1]); element = element.split("*")[0]; }
+    survivalAdd(element,amount);
+    selectElement(element);
+}
+function survivalResetCloner() {
+    if (!settings.survival.gold_coin || settings.survival.gold_coin < 1000) { alert("You can't afford that!"); return }
+    survivalRemove("gold_coin",1000);
+    settings.survivalClone = null;
+    survivalSave();
+}
+
+worldgentypes = {}
+window.addEventListener("load",function(){
+    // move to start of tools
+    var erase = document.getElementById("elementButton-erase");
+    var sell = document.getElementById("elementButton-sell");
+    var parent = erase.parentElement;
+    parent.removeChild(sell);
+    parent.insertBefore(sell,parent.firstChild);
+    parent.removeChild(erase);
+    parent.insertBefore(erase,parent.firstChild);
+    document.getElementById("replaceButton").remove();
+    document.getElementById("savesButton").remove();
+    document.getElementById("elemSelectButton").remove();
+    doRandomEvents = function() {}
+    worldGen = function() {}
+    worldgentypes = {}
+    loadSave = function() {}
+    showSaves = function() {}
+    placeImage = function() {}
+    chooseElementPrompt = function() {}
+    document.getElementById("toolControls").insertAdjacentHTML("beforeend",`<button class="controlButton" title="Erases all survival.js data" onclick="if (confirm('THIS WILL ERASE ALL survival.js DATA!!! ARE YOU SURE?')) {settings.survivalClone=null; settings.survival = null; saveSettings(); location.reload()}">StartOver</button>`);
+    createCategoryDiv("shop");
+    var shopDiv = document.getElementById("category-shop");
+    shopDiv.style.display = "none";
+    shopDiv.insertAdjacentHTML("beforeend",`<p>You have $<span id="coinCount">${settings.survival.gold_coin||0}</span></p>`);
+    for (var element in survivalShop) {
+        var price = survivalShop[element];
+        var button = document.createElement("button");
+        var name = element;
+        var amount = 1;
+        if (element.indexOf("*") !== -1) { amount = parseInt(element.split("*")[1]); name = element.split("*")[0]; }
+        var elemname = name;
+        name = (elements[elemname].name||name).replace(/_/g, " ").replace(".","   ").replace(/\w\S*/g, function(txt){return txt.charAt(0).toUpperCase() + txt.substr(1).toLowerCase();}).replace("   ",".").replace(/ /g, "");
+        button.classList.add("elementButton");
+        button.setAttribute("element",element);
+        button.setAttribute("category","shop");
+        button.setAttribute("title",amount+" "+name+" for $"+price);
+        button.innerHTML = name+"<span style='font-family:Arial;font-size:1.15em'> ("+amount+" for $"+price+")</span>";
+        if (elements[elemname]) {
+            if (elements[elemname].color instanceof Array) {
+                button.style.backgroundImage = "linear-gradient(to bottom right, "+elements[elemname].color.join(", ")+")";
+                // choose the middlemost item in array
+                var colorObject = elements[elemname].colorObject[Math.floor(elements[elemname].colorObject.length/2)];
+                if (elements[elemname].darkText !== false && (elements[elemname].darkText || (colorObject.r+colorObject.g+colorObject.b)/3 > 200)) {
+                    button.className += " bright"
+                }
+            }
+            else {
+                button.style.background = elements[elemname].color;
+                var colorObject = elements[elemname].colorObject;
+                if (elements[elemname].darkText !== false && (elements[elemname].darkText || (colorObject.r+colorObject.g+colorObject.b)/3 > 200)) {
+                    button.className += " bright"
+                }
+            }
+        }
+        button.addEventListener("click",function(){
+            survivalBuy(this.getAttribute("element"));
+        });
+        shopDiv.appendChild(button);
+    }
+    shopDiv.insertAdjacentHTML("beforeend",`<p><button style="background-color:#dddd00" class="elementButton bright" title="Resets the cloner" onclick="survivalResetCloner()">ResetCloner<span style='font-family:Arial;font-size:1.15em'> ($1000)</span></button></p>`);
+
+    createCategoryDiv("prices");
+    var pricesDiv = document.getElementById("category-prices");
+    pricesDiv.style.display = "none";
+    for (var element in elementWorth) {
+        if (elementWorth[element] <= 0) { continue }
+        var name = (elements[element].name||element).replace(/_/g, " ").replace(".","   ").replace(/\w\S*/g, function(txt){return txt.charAt(0).toUpperCase() + txt.substr(1).toLowerCase();}).replace("   ",".");
+        // create text with the name of the element and its worth, separated by •
+        var text = name+"="+elementWorth[element] + " • ";
+        pricesDiv.insertAdjacentHTML("beforeend",`${text}`);
+    }
+    pricesDiv.innerHTML = pricesDiv.innerHTML.slice(0,-2);
+    pricesDiv.innerHTML = "<p style='font-family:Arial'>"+pricesDiv.innerHTML+"</p>";
+});
+runAfterLoad(function(){
+    checkUnlock = function(element) {
+        return;
+    }
+    oldClearAll = clearAll;
+    clearAll = function() {
+        if (currentPixels && currentPixels.length > 0) {
+            for (var i = 0; i < currentPixels.length; i++) {
+                var pixel = currentPixels[i];
+                if (pixel && pixel.element) {
+                    survivalAdd(pixel.element,1);
+                }
+            }
+        }
+        oldClearAll();
+    }
+    mouseAction = function(e,mouseX,mouseY,startPos) {
+        if (mouseType == "left") {
+            mouse1Action(e,mouseX,mouseY,startPos);
+        }
+        else if (mouseType == "right") { mouse2Action(e,mouseX,mouseY,startPos); }
+        else if (mouseType == "middle") { mouseMiddleAction(e,mouseX,mouseY); }
+    }
+    mouse1Action = function(e,mouseX=undefined,mouseY=undefined,startPos) {
+        if (currentElement === "erase") { mouse2Action(e,mouseX,mouseY); return; }
+        else if (currentElement === "pick") { mouseMiddleAction(e,mouseX,mouseY); return; }
+        // If x and y are undefined, get the mouse position
+        if (mouseX == undefined && mouseY == undefined) {
+            // var canvas = document.getElementById("game");
+            // var ctx = canvas.getContext("2d");
+            lastPos = mousePos;
+            mousePos = getMousePos(canvas, e);
+            var mouseX = mousePos.x;
+            var mouseY = mousePos.y;
+        }
+        var cooldowned = false;
+        if ((mouseSize===1 || elements[currentElement].maxSize===1) && elements[currentElement].cooldown) {
+            if (pixelTicks-lastPlace < elements[currentElement].cooldown) {
+                return;
+            }
+            cooldowned = true;
+        }
+        lastPlace = pixelTicks;
+        startPos = startPos || lastPos
+        if (!(isMobile || (cooldowned && startPos.x===lastPos.x && startPos.y===lastPos.y) || elements[currentElement].tool || elements[currentElement].category==="tools")) {
+            var coords = lineCoords(startPos.x,startPos.y,mouseX,mouseY);
+        }
+        else { var coords = mouseRange(mouseX,mouseY); }
+        var element = elements[currentElement];
+        var mixList = [];
+        // For each x,y in coords
+        for (var i = 0; i < coords.length; i++) {
+            var x = coords[i][0];
+            var y = coords[i][1];
+
+            if (currentElement === "mix") {
+                if (!isEmpty(x,y,true)) {
+                    var pixel = pixelMap[x][y];
+                    if (!(elements[pixel.element].movable !== true || elements[pixel.element].noMix === true) || shiftDown) {
+                        mixList.push(pixel);
+                    }
+                }
+            }
+            else if (currentElement === "shock") {
+                if (!isEmpty(x,y,true)) {
+                    // One loop that repeats 5 times if shiftDown else 1 time
+                    for (var j = 0; j < (shiftDown ? 5 : 1); j++) {
+                        var pixel = pixelMap[x][y];
+                        var con = elements[pixel.element].conduct;
+                        if (con == undefined) {continue}
+                        if (Math.random() < con) { // If random number is less than conductivity
+                            if (!pixel.charge && !pixel.chargeCD) {
+                                pixel.charge = 1;
+                                if (elements[pixel.element].colorOn) {
+                                    pixel.color = pixelColorPick(pixel);
+                                }
+                            }
+                        }
+                        else if (elements[pixel.element].insulate != true) { // Otherwise heat the pixel (Resistance simulation)
+                            pixel.temp += 0.25;
+                            pixelTempCheck(pixel);
+                        }
+                    }
+                }
+            }
+            else if (elements[currentElement].tool && !(elements[currentElement].canPlace && isEmpty(x,y))) {
+                // run the tool function on the pixel
+                if (!isEmpty(x,y,true)) {
+                    var pixel = pixelMap[x][y];
+                    // if the current element has an ignore property and the pixel's element is in the ignore property, don't do anything
+                    if (elements[currentElement].ignore && elements[currentElement].ignore.indexOf(pixel.element) != -1) {
+                        continue;
+                    }
+                    elements[currentElement].tool(pixel);
+                }
+            }
+            else if (isEmpty(x, y)) {
+                if (survivalCount(currentElement) < 1 && elements[currentElement].category !== "tools") {
+                    return;
+                }
+                currentPixels.push(new Pixel(x, y, currentElement));
+                if (elements[currentElement].customColor || elements[currentElement].singleColor) {
+                    pixelMap[x][y].color = pixelColorPick(currentElement,currentColor);
+                }
+                if (elements[currentElement].category !== "tools") { survivalRemove(currentElement,1); }
+            }
+        }
+        if (currentElement == "mix") {
+            for (var i = 0; i < mixList.length; i++) {
+                var pixel1 = mixList[Math.floor(Math.random()*mixList.length)];
+                var pixel2 = mixList[Math.floor(Math.random()*mixList.length)];
+                swapPixels(pixel1,pixel2);
+                mixList.splice(mixList.indexOf(pixel1),1);
+                mixList.splice(mixList.indexOf(pixel2),1);
+                if (elements[pixel1.element].onMix) {
+                    elements[pixel1.element].onMix(pixel1,pixel2);
+                }
+                if (elements[pixel2.element].onMix) {
+                    elements[pixel2.element].onMix(pixel2,pixel1);
+                }
+            }
+
+        }
+    }
+    mouse2Action = function(e,mouseX=undefined,mouseY=undefined,startPos) {
+        // Erase pixel at mouse position
+        if (mouseX == undefined && mouseY == undefined) {
+            // var canvas = document.getElementById("game");
+            // var ctx = canvas.getContext("2d");
+            lastPos = mousePos;
+            mousePos = getMousePos(canvas, e);
+            var mouseX = mousePos.x;
+            var mouseY = mousePos.y;
+        }
+        if (dragStart) {
+            dragStart = 0;
+            for (var i = 0; i < draggingPixels.length; i++) {
+                var pixel = draggingPixels[i];
+                delete pixel.drag;
+            }
+            draggingPixels = null;
+        }
+        // If the current element is "pick" or "lookup", coords = [mouseX,mouseY]
+        if (currentElement == "pick" || currentElement == "lookup") {
+            var coords = [[mouseX,mouseY]];
+        }
+        else if (!isMobile) {
+            startPos = startPos || lastPos
+            var coords = lineCoords(startPos.x,startPos.y,mouseX,mouseY);
+        }
+        else {
+            var coords = mouseRange(mouseX,mouseY);
+        }
+        // For each x,y in coords
+        for (var i = 0; i < coords.length; i++) {
+            var x = coords[i][0];
+            var y = coords[i][1];
+
+            if (!isEmpty(x, y)) {
+                if (outOfBounds(x,y)) {
+                    continue
+                }
+                var pixel = pixelMap[x][y];
+                survivalAdd(pixel.element,1);
+                delete pixelMap[x][y];
+                // Remove pixel from currentPixels
+                for (var j = 0; j < currentPixels.length; j++) {
+                    if (currentPixels[j].x == x && currentPixels[j].y == y) {
+                        currentPixels.splice(j, 1);
+                        break;
+                    }
+                }
+            }
+        }
+    }
+})
+
+window.addEventListener("beforeunload",function(){
+    clearAll();
+    saveSettings();
+});
\ No newline at end of file
diff --git a/mods/weapons.js b/mods/weapons.js
index 04ed8a20..deeae4e4 100644
--- a/mods/weapons.js
+++ b/mods/weapons.js
@@ -96,4 +96,67 @@ elements.right_missile = {
     category: "weapons",
     state: "solid",
     density: 1300,
+},
+    elements.RL_cluster_munition = {
+    color: "#444444",
+    behavior: [
+        "XX|XX|XX",
+        "CRcluster%20|XX|CR:cluster%20",
+        "M2|M1|M2",
+    ],
+    category: "weapons",
+    state: "solid",
+    density: 1300,
+},
+    elements.cluster = {
+    color: "#444444",
+    behavior: [
+        "XX|EX:10%10|XX",
+        "XX|XX|XX",
+        "M2|M1 AND EX:10%10|M2",
+    ],
+    category: "weapons",
+    state: "solid",
+    density: 1300,
+    hidden: true,
+},
+    elements.machine_gun_left = {
+    color: "#C0C0C0",
+    behavior: [
+        "XX|XX|XX",
+        "CR:left_bullet|XX|XX",
+        "XX|XX|XX",
+    ],
+    category: "weapons",
+    state: "solid",
+    density: 1300,
+},
+    elements.machine_gun_right = {
+    color: "#C0C0C0",
+    behavior: [
+        "XX|XX|XX",
+        "XX|XX|CR:right_bullet",
+        "XX|XX|XX",
+    ],
+    category: "weapons",
+    state: "solid",
+    density: 1300,
+},
+elements.left_bullet = {
+    color: "#4c4e42",
+    behavior: [
+        "M2|XX|XX",
+        "M1 AND EX:5|XX|XX",
+        "M2|XX|XX",
+    ],
+    category:"weapons",
+},
+    elements.right_bullet = {
+    color: "#4c4e42",
+    behavior: [
+        "XX|XX|M2",
+        "XX|XX|M1 AND EX:5",
+        "XX|XX|M2",
+    ],
+    category:"weapons",
 };
\ No newline at end of file