From 1b7c2068dc3be962a4781f5f826b62129253e848 Mon Sep 17 00:00:00 2001 From: An Orbit <68935009+orbit-loona@users.noreply.github.com> Date: Wed, 7 Feb 2024 11:01:55 -0500 Subject: [PATCH 01/53] bugfix: life eater and injector poison now penetrate skin --- mods/a_mod_by_alice.js | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/mods/a_mod_by_alice.js b/mods/a_mod_by_alice.js index 35568c78..ddd46a35 100644 --- a/mods/a_mod_by_alice.js +++ b/mods/a_mod_by_alice.js @@ -10839,7 +10839,7 @@ color1 and color2 spread through striped paint like dye does with itself. col var lifeEaterCategories = ["life","auto creepers","shit","cum","food","fantastic creatures","fey","auto_fey"]; var lifeEaterBlacklist = ["life_eater_virus","life_eater_slurry","life_eater_infected_dirt"]; - var lifeEaterWhitelist = ["blood","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"]; + var lifeEaterWhitelist = ["blood","skin","hair","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"]; var lifeEaterSubstitutions = { "dirt": "life_eater_infected_dirt", "crimsoil": "life_eater_infected_dirt", @@ -44364,7 +44364,7 @@ Make sure to save your command in a file if you want to add this preset again.` var injectorPoisonCategories = ["life","auto creepers","shit","cum","food","fantastic creatures","fey","auto_fey"]; var injectorPoisonBlacklist = ["injector_poison","dead_matter","poisoned_dirt"]; - var injectorPoisonWhitelist = ["blood","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"]; + var injectorPoisonWhitelist = ["blood","skin","hair","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"]; var injectorPoisonSubstitutions = { "dirt": "poisoned_dirt", "dry_dirt": "poisoned_dirt", From 40d5d050f31cc54e71d1345e3139f50c176988b7 Mon Sep 17 00:00:00 2001 From: quin2081 <141574668+quin2081@users.noreply.github.com> Date: Thu, 8 Feb 2024 21:30:30 -0600 Subject: [PATCH 02/53] Add files via upload --- mods/Mucho_frio_y_Calor.js | 16 ++++++++++++++++ 1 file changed, 16 insertions(+) create mode 100644 mods/Mucho_frio_y_Calor.js diff --git a/mods/Mucho_frio_y_Calor.js b/mods/Mucho_frio_y_Calor.js new file mode 100644 index 00000000..02872888 --- /dev/null +++ b/mods/Mucho_frio_y_Calor.js @@ -0,0 +1,16 @@ +elements.Calor = { + color: "#ff2f2f", + tool: function(pixel) { + pixel.temp += 500000000000000000000500000000000000000000; + pixelTempCheck(pixel) + }, + category: "tools", +}; +elements.Frio = { + color: "#2f2fff", + tool: function(pixel) { + pixel.temp += -500000000000000000000500000000000000000000; + pixelTempCheck(pixel) + }, + category: "tools", +}; \ No newline at end of file From ddddf66d34d0d3b1edac19de19085b907c227925 Mon Sep 17 00:00:00 2001 From: SquareScreamYT <134925668+SquareScreamYT@users.noreply.github.com> Date: Fri, 9 Feb 2024 12:47:26 +0800 Subject: [PATCH 03/53] A Chef's Dream 1.5 --- mods/aChefsDream.js | 453 +++++++++++++++++++++++++++++++++++++++----- 1 file changed, 406 insertions(+), 47 deletions(-) diff --git a/mods/aChefsDream.js b/mods/aChefsDream.js index 800c9e8a..09ac248d 100644 --- a/mods/aChefsDream.js +++ b/mods/aChefsDream.js @@ -2,7 +2,18 @@ Created by SquareScreamYT and RealerRaddler Thanks to Alice, nousernamefound and Fioushemastor for helping :) -v1.4 +Upcoming Features: +- onions +- spring onions +- soy sauce +- rice +- seaweed and agar +- pigs, ham and bacon +- garlic +- msg +- stainless steel + +v1.5 Changelog (v1.0) - added chickens @@ -192,6 +203,21 @@ Changelog (v1.4) - added ginger - added ginger juice - added ginger rhizomes, pseudostems and leaves + + + +Changelog (v1.5) + - added blueberries + - added blueberries + - added blueberry seeds, stem, and leaves + - added blueberry juice + - added strawberry and blueberry jam + - added cut blueberries + - added advanced dough + - added carbonic acid + - added cookies and cookie dough + - replaced cooking oil with nut oil + - added boba and boba dough */ /* @@ -536,7 +562,7 @@ elements.raw_chicken = { "smoke": {elem1: "smoked_chicken"}, "steam": {elem1: "steamed_chicken"}, "water": {elem1: "boiled_chicken", tempMin: 70}, - "cooking_oil": {elem1: "fried_chicken", tempMin: 70} + "nut_oil": {elem1: "fried_chicken", tempMin: 70} } }; @@ -575,7 +601,7 @@ elements.raw_chicken_nugget = { stateHigh: ["ash", "smoke"], hidden: true, reactions: { - "cooking_oil": {elem1: "chicken_nugget", tempMin: 70} + "nut_oil": {elem1: "chicken_nugget", tempMin: 70} } }; @@ -678,22 +704,20 @@ elements.olive = { "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }, - "rock": { elem1:"cooking_oil", elem2:"rock", chance:0.035 }, + "rock": { elem1:"nut_oil", elem2:"rock", chance:0.035, color1: "#ffc844" }, }, category:"food", tempHigh: 100, stateHigh: "dead_plant", - tempLow: -1.66, - stateLow: "frozen_plant", burn:65, burnTime:60, burnInto: "dead_plant", - breakInto: "cooking_oil", - state: "solid", + breakInto: "nut_oil", + breakIntoColor: "#ffc844", density: 1050, isFood: false } - +/* elements.cooking_oil = { color: "#ffc844", behavior: behaviors.LIQUID, @@ -711,7 +735,7 @@ elements.cooking_oil = { "peeled_potato": {elem2: "fried_potato", tempMin: 70} } }, - +*/ elements.pepper = { color: ["#1f190a", "#2b200d", "#362712", "#3b2211"], behavior: behaviors.POWDER, @@ -752,7 +776,7 @@ elements.peeled_potato = { stateHigh: "baked_potato", density: 1100, reactions: { - "cooking_oil": { elem1: "fried_potato", tempMin: 70 } + "nut_oil": { elem1: "fried_potato", tempMin: 70 } } } @@ -843,8 +867,6 @@ elements.apple = { category:"food", tempHigh: 100, stateHigh: "dead_plant", - tempLow: -1.66, - stateLow: "frozen_plant", burn:65, burnTime:60, burnInto: "dead_plant", @@ -1153,8 +1175,6 @@ elements.orange = { category:"food", tempHigh: 100, stateHigh: "dead_plant", - tempLow: -1.66, - stateLow: "frozen_plant", burn:65, burnTime:60, burnInto: "dead_plant", @@ -1436,7 +1456,7 @@ elements.raw_salmon = { "smoke": {elem1: "smoked_salmon"}, "steam": {elem1: "steamed_salmon"}, "water": {elem1: "boiled_salmon", tempMin: 70}, - "cooking_oil": {elem1: "fried_salmon", tempMin: 70} + "nut_oil": {elem1: "fried_salmon", tempMin: 70} } } @@ -1509,7 +1529,7 @@ elements.raw_tuna = { "smoke": {elem1: "smoked_tuna"}, "steam": {elem1: "steamed_tuna"}, "water": {elem1: "boiled_tuna", tempMin: 70}, - "cooking_oil": {elem1: "fried_tuna", tempMin: 70} + "nut_oil": {elem1: "fried_tuna", tempMin: 70} } } @@ -1662,8 +1682,6 @@ elements.watermelon = { category:"food", tempHigh: 100, stateHigh: "dead_plant", - tempLow: -1.66, - stateLow: "frozen_plant", burn:65, burnTime:60, burnInto: "dead_plant", @@ -1762,16 +1780,38 @@ elements.cream_of_tartar = { behavior: behaviors.POWDER, category: "food", state: "solid", - tempHigh: 200, - stateHigh: "caramel", density: 1500, isFood: true, hidden: true, - reaction: { - "sugar_water": {elem2: "corn_syrup", elem1: null, tempMin: 110} + reactions: { + "sugar_water": {elem2: "corn_syrup", elem1: null, tempMin: 80}, + "carbonic_acid": {elem1: null, elem2: "carbon_dioxide"} } } +elements.corn_syrup = { + color: ["#FFCD0C", "#E47F00", "#FEB003"], + behavior: behaviors.LIQUID, + category: "food", + state: "liquid", + tempHigh: 100, + stateHigh: "caramel", + isFood: true, + hidden: true, + viscosity: 10000 +} + +if (!elements.baking_soda.reactions) elements.baking_soda.reactions = {}; +elements.baking_soda.reactions.water = { elem1: "carbonic_acid", elem2: "carbonic_acid" } + +elements.carbonic_acid = { + color: ["#E0DEA5", "#DFDB9C", "#EBE8BC"], + behavior: behaviors.LIQUID, + category: "liquids", + state: "liquid", + hidden: true, +} + elements.wine = { color: ["#6F0013", "#6D0112"], behavior: behaviors.LIQUID, @@ -1785,18 +1825,6 @@ elements.wine = { tempLow: 0 } -elements.corn_syrup = { - color: ["#FFCD0C", "#E47F00", "#FEB003"], - behavior: behaviors.LIQUID, - category: "food", - state: "liquid", - tempHigh: 100, - stateHigh: "caramel", - isFood: true, - hidden: true, - viscosity: 10000 -} - elements.shrimp = { color: ["#EE5422", "#E9683C", "#F3583F", "#EDA270"], behavior: [ @@ -2024,8 +2052,6 @@ elements.coconut = { category:"food", tempHigh: 100, stateHigh: "dead_plant", - tempLow: -1.66, - stateLow: "frozen_plant", burn:65, burnTime:60, burnInto: "dead_plant", @@ -2058,7 +2084,7 @@ elements.coconut_milk = { viscosity: 1.5, category: "liquids", state: "liquid", - density: 1036.86, + density: 825, isFood: true } @@ -2081,8 +2107,6 @@ elements.cut_coconut = { category:"food", tempHigh: 100, stateHigh: "dead_plant", - tempLow: -1.66, - stateLow: "frozen_plant", burn:65, burnTime:60, burnInto: "dead_plant", @@ -2188,8 +2212,6 @@ elements.lemon = { category:"food", tempHigh: 100, stateHigh: "dead_plant", - tempLow: -1.66, - stateLow: "frozen_plant", burn:65, burnTime:60, burnInto: "dead_plant", @@ -2624,10 +2646,6 @@ elements.corn_starch = { "juice": { elem1: "dough", elem2: null }, "yolk": { elem1: "batter", elem2: null }, "yogurt": { elem1: "batter", elem2: null }, - "honey": { elem1:"gingerbread", elem2:null }, - "molasses": { elem1:"gingerbread", elem2:null }, - "sap": { elem1:"gingerbread", elem2:null }, - "caramel": { elem1:"gingerbread", elem2:null }, "broth": { elem1:"dough", elem2:null }, "soda": { elem1:"dough", elem2:null }, "tea": { elem1:"dough", elem2:null }, @@ -2934,7 +2952,10 @@ elements.strawberry_juice = { density: 825, hidden: true, temp: 30, - tempLow: 0 + tempLow: 0, + reactions: { + "sugar": { elem1:"strawberry_jam", elem2:null, chance:0.35 }, + }, }; elements.cream = { @@ -3148,3 +3169,341 @@ elements.ginger_juice = { "bread": { elem1:"gingerbread", elem2:null }, }, }; + + +elements.blueberry_seed = { + color: "#7a7133", + behavior: behaviors.STURDYPOWDER, + reactions: { + "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, + "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "mercury": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "stench": { elem2:null, chance:0.25 }, + }, + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(pixel,"blueberry_stem"); + } + } + } + pixel.age++; + } + doDefaults(pixel); + }, + category:"life", + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -1.66, + stateLow: "frozen_plant", + burn:15, + burnTime:60, + burnInto: "dead_plant", + breakInto: "dead_plant", + state: "solid", + density: 1050, + cooldown: defaultCooldown +} +elements.blueberry_stem = { + color: "#419c2f", + behavior: [ + "CR:blueberry_stem,blueberry_leaves,blueberry_leaves,blueberry_leaves,blueberry_leaves%3|CR:blueberry_stem,blueberry_leaves,blueberry_leaves,blueberry_leaves,blueberry_leaves%3|CR:blueberry_stem,blueberry_leaves,blueberry_leaves,blueberry_leaves,blueberry_leaves%3", + "CR:blueberry_stem,blueberry_leaves,blueberry_leaves,blueberry_leaves,blueberry_leaves%3|XX|CR:blueberry_stem,blueberry_leaves,blueberry_leaves,blueberry_leaves,blueberry_leaves%3", + "XX|M1|XX", + ], + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + } + pixel.age++; + } + doDefaults(pixel); + }, + reactions: { + "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, + "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "mercury": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "stench": { elem2:null, chance:0.25 }, + }, + properties: { + "age":0 + }, + category:"life", + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -1.66, + stateLow: "frozen_plant", + burn:15, + burnTime:60, + burnInto: "dead_plant", + breakInto: "dead_plant", + state: "solid", + density: 1050, +} +elements.blueberry_leaves = { + color: "#4bad37", + behavior: [ + "XX|CR:blueberry%2|XX", + "CR:blueberry%2|XX|CR:blueberry%2", + "M2|M1|M2", + ], + reactions: { + "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, + "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "mercury": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "stench": { elem2:null, chance:0.25 }, + }, + category:"life", + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -1.66, + stateLow: "frozen_plant", + burn:15, + burnTime:60, + burnInto: "dead_plant", + breakInto: "dead_plant", + state: "solid", + density: 1050 +} +elements.blueberry = { + color: "#5d4bc4", + behavior: [ + "XX|ST:blueberry_stem,blueberry_leaves|XX", + "ST:blueberry_stem,blueberry_leaves|XX|ST:blueberry_stem,blueberry_leaves", + "M2|M1|M2", + ], + reactions: { + "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, + "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "mercury": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "stench": { elem2:null, chance:0.25 }, + }, + category:"food", + tempHigh: 100, + stateHigh: "dead_plant", + burn:15, + burnTime:60, + burnInto: "dead_plant", + breakInto: "blueberry_juice", + state: "solid", + density: 1050, + cutInto: "cut_blueberry" +} +elements.blueberry_juice = { + color: "#5030a1", + behavior: behaviors.LIQUID, + category: "liquids", + tempHigh: 100, + stateHigh: ["steam","sugar"], + burn: 70, + burnTime: 300, + burnInto: ["steam", "smoke"], + state: "liquid", + density: 825, + hidden: true, + temp: 30, + tempLow: 0, + reactions: { + "sugar": { elem1:"blueberry_jam", elem2:null, chance:0.35 }, + "milk": { elem1:"fruit_milk", elem2:null, chance:0.35, color1: "#995fb3" }, + }, +}; +/* +elements.fruit_slushie = { + color: "#ffcc54", + behavior: behaviors.LIQUID, + reactions: { + "dirt": { elem1: null, elem2: "mud" }, + "sand": { elem1: null, elem2: "wet_sand" } + }, + temp: -5, + tempHigh: 18, + tempLow: -20, + stateLow: "ice", + stateHigh: "water", + category: "food", + state: "liquid", + density: 95, + viscosity: 100, + hidden: true +} +*/ + +elements.strawberry_jam = { + color: "#c73c3e", + behavior: behaviors.LIQUID, + category: "food", + tempHigh: 400, + stateHigh: ["sugar","smoke"], + burn: 70, + burnTime: 300, + viscosity: 750, + state: "liquid", + density: 825, + hidden: true +}; +elements.blueberry_jam = { + color: "#281C4B", + behavior: behaviors.LIQUID, + category: "food", + tempHigh: 400, + stateHigh: ["sugar","smoke"], + burn: 70, + burnTime: 300, + viscosity: 750, + state: "liquid", + density: 825, + hidden: true +}; +elements.cut_blueberry = { + color: "#d4ed8a", + behavior: [ + "XX|XX|XX", + "XX|XX|XX", + "M2|M1|M2", + ], + reactions: { + "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, + "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "mercury": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "stench": { elem2:null, chance:0.25 }, + }, + category:"food", + tempHigh: 100, + stateHigh: "dead_plant", + burn:15, + burnTime:60, + burnInto: "dead_plant", + breakInto: "blueberry_juice", + state: "solid", + density: 1050, + hidden: true +} + +if (!elements.yeast.reactions) elements.yeast.reactions = {}; +elements.yeast.reactions.flour = { elem1: "advanced_dough", elem2: null } + +elements.advanced_dough = { + color: "#c49f58", + behavior: behaviors.STURDYPOWDER, + reactions: { + "milk": { elem2:"broth", color2:"#ECC891", tempMin:70 }, + "cream": { elem2:"broth", color2:"#ECC891", tempMin:70 }, + }, + category: "food", + tempHigh: 94, + stateHigh: "bread", + stateHighColorMultiplier: 0.9, + burn:40, + burnTime:25, + burnInto:"ash", + state: "solid", + density: 526.9, + isFood: true, + hidden: true +} + +if (!elements.melted_chocolate.reactions) elements.melted_chocolate.reactions = {}; +elements.melted_chocolate.reactions.flour = { elem1: "cookie_dough", elem2: null } + +elements.cookie_dough = { + color: ["#946826","#9e783f","#8a6d41","#614925"], + behavior: behaviors.STURDYPOWDER, + category: "food", + tempHigh: 94, + stateHigh: "cookie", + stateHighColorMultiplier: 0.8, + burn:40, + burnTime:25, + burnInto:"ash", + state: "solid", + density: 526.9, + isFood: true, + hidden: true +} + +elements.cookie = { + color: "#7d5f2e", + behavior: behaviors.STURDYPOWDER, + tempHigh: 605, + stateHigh: "ash", + category: "food", + burn: 30, + burnTime: 200, + burnInto: ["smoke","smoke","smoke","ash"], + breakInto: "crumb", + breakIntoColor: "#7d6216", + state: "solid", + density: 233.96, + isFood: true +} + +elements.nut_oil.name = "cooking_oil" + +// elements.fire.temp = 130 + +elements.bread.behavior = behaviors.SUPPORT + +elements.toast.behavior = behaviors.SUPPORT + +if (!elements.caramel.reactions) elements.caramel.reactions = {}; +elements.caramel.reactions.corn_starch = { elem1: "boba_dough", elem2: null, chance: 0.35, tempMin: 70} + +elements.boba_dough = { + color: ["#4a2007","#2b1304"], + behavior: behaviors.STURDYPOWDER, + category: "food", + tempHigh: 400, + stateHigh: "ash", + stateHighColorMultiplier: 0.8, + burn:40, + burnTime:25, + burnInto:"ash", + state: "solid", + density: 526.9, + reactions: { + "water": { elem1:"boba", tempMin:60}, + }, + isFood: true, + hidden: true +} + +elements.boba = { + color: "#59290c", + behavior: behaviors.POWDER, + tempHigh: 300, + stateHigh: "fire", + category: "food", + burn: 30, + burnTime: 200, + burnInto: ["smoke","smoke","smoke","ash"], + breakIntoColor: "#7d6216", + state: "solid", + density: 644, + isFood: true +} From a4dbd49ded5c18d9d627412dbaa187aa6e9ba23f Mon Sep 17 00:00:00 2001 From: JustAGenericUsername Date: Fri, 9 Feb 2024 18:11:48 -0500 Subject: [PATCH 04/53] fix fillers? --- mods/nousersthings.js | 2 ++ 1 file changed, 2 insertions(+) diff --git a/mods/nousersthings.js b/mods/nousersthings.js index 5dc8b764..3a674500 100644 --- a/mods/nousersthings.js +++ b/mods/nousersthings.js @@ -2006,6 +2006,7 @@ elemfillerVar = 0; elements.element_filler = { category: "special", color: elements.filler.color, + excludeRandom: true, state: "solid", movable: "false", onSelect: function() { @@ -2040,6 +2041,7 @@ var outlinerVar = 0 elements.outliner = { color: elements.filler.color, category: elements.filler.category, + excludeRandom: true, onSelect: function() { var answerot = prompt("Please input the desired element of this outliner. It will not work if you do multiple filter types while paused.",(outlinerVar||undefined)); if (!answerot) { return } From 3f4b4a3868baf65596a462c5c6e1a608671d362c Mon Sep 17 00:00:00 2001 From: JustAGenericUsername Date: Fri, 9 Feb 2024 18:14:03 -0500 Subject: [PATCH 05/53] one color.js --- mods/onecolor.js | 44 ++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 44 insertions(+) create mode 100644 mods/onecolor.js diff --git a/mods/onecolor.js b/mods/onecolor.js new file mode 100644 index 00000000..f2eb1b50 --- /dev/null +++ b/mods/onecolor.js @@ -0,0 +1,44 @@ +function pixelColorPick(pixel,customColor=null) { + var element = pixel.element; + var elementInfo = elements[element]; + //if (elementInfo.behavior instanceof Array) { + + if (pixel.charge && elementInfo.colorOn) { + customColor = elementInfo.colorOn; + } + if (customColor != null) { + if (Array.isArray(customColor)) { + customColor = customColor[0]; + } + if (customColor.startsWith("#")) { + customColor = hexToRGB(customColor); + } + var rgb = customColor; + } + else { + var rgb = elements[element].colorObject; // {r, g, b} + // If rgb is an array, choose a random item + if (Array.isArray(rgb)) { + rgb = rgb[0]; + } + } + // Randomly darken or lighten the RGB color + var coloroffset = Math.floor(Math.random() * (Math.random() > 0.5 ? -1 : 1) * Math.random() * 15); + var r = rgb.r + coloroffset; + var g = rgb.g + coloroffset; + var b = rgb.b + coloroffset; + // Make sure the color is within the RGB range + r = Math.max(0, Math.min(255, r)); + g = Math.max(0, Math.min(255, g)); + b = Math.max(0, Math.min(255, b)); + var color = "rgb("+r+","+g+","+b+")"; + + /*} + else { + var color = elementInfo.color; + if (Array.isArray(color)) { + color = color[Math.floor(Math.random() * color.length)]; + } + }*/ + return color; +} \ No newline at end of file From 087647445733df1da10dd535661a7359c8d97544 Mon Sep 17 00:00:00 2001 From: JustAGenericUsername Date: Fri, 9 Feb 2024 18:32:33 -0500 Subject: [PATCH 06/53] the --- mods/onecolor.js | 89 +++++++++++++++++++++++++----------------------- 1 file changed, 46 insertions(+), 43 deletions(-) diff --git a/mods/onecolor.js b/mods/onecolor.js index f2eb1b50..2820328c 100644 --- a/mods/onecolor.js +++ b/mods/onecolor.js @@ -1,44 +1,47 @@ -function pixelColorPick(pixel,customColor=null) { - var element = pixel.element; - var elementInfo = elements[element]; - //if (elementInfo.behavior instanceof Array) { - - if (pixel.charge && elementInfo.colorOn) { - customColor = elementInfo.colorOn; +window.addEventListener('load', function() { + console.log("attempted override") + pixelColorPick = function(pixel,customColor=null) { + var element = pixel.element; + var elementInfo = elements[element]; + //if (elementInfo.behavior instanceof Array) { + + if (pixel.charge && elementInfo.colorOn) { + customColor = elementInfo.colorOn; + } + if (customColor != null) { + if (Array.isArray(customColor)) { + customColor = customColor[0]; + } + if (customColor.startsWith("#")) { + customColor = hexToRGB(customColor); + } + var rgb = customColor; + } + else { + var rgb = elements[element].colorObject; // {r, g, b} + // If rgb is an array, choose a random item + if (Array.isArray(rgb)) { + rgb = rgb[0]; + } + } + // Randomly darken or lighten the RGB color + var coloroffset = Math.floor(Math.random() * (Math.random() > 0.5 ? -1 : 1) * Math.random() * 15); + var r = rgb.r + 0; + var g = rgb.g + 0; + var b = rgb.b + 0; + // Make sure the color is within the RGB range + r = Math.max(0, Math.min(255, r)); + g = Math.max(0, Math.min(255, g)); + b = Math.max(0, Math.min(255, b)); + var color = "rgb("+r+","+g+","+b+")"; + + /*} + else { + var color = elementInfo.color; + if (Array.isArray(color)) { + color = color[Math.floor(Math.random() * color.length)]; + } + }*/ + return color; } - if (customColor != null) { - if (Array.isArray(customColor)) { - customColor = customColor[0]; - } - if (customColor.startsWith("#")) { - customColor = hexToRGB(customColor); - } - var rgb = customColor; - } - else { - var rgb = elements[element].colorObject; // {r, g, b} - // If rgb is an array, choose a random item - if (Array.isArray(rgb)) { - rgb = rgb[0]; - } - } - // Randomly darken or lighten the RGB color - var coloroffset = Math.floor(Math.random() * (Math.random() > 0.5 ? -1 : 1) * Math.random() * 15); - var r = rgb.r + coloroffset; - var g = rgb.g + coloroffset; - var b = rgb.b + coloroffset; - // Make sure the color is within the RGB range - r = Math.max(0, Math.min(255, r)); - g = Math.max(0, Math.min(255, g)); - b = Math.max(0, Math.min(255, b)); - var color = "rgb("+r+","+g+","+b+")"; - - /*} - else { - var color = elementInfo.color; - if (Array.isArray(color)) { - color = color[Math.floor(Math.random() * color.length)]; - } - }*/ - return color; -} \ No newline at end of file +}); From beac8d40c741d178b240d72db2af477ddfe6389e Mon Sep 17 00:00:00 2001 From: sb <155691462+stefanblox@users.noreply.github.com> Date: Fri, 9 Feb 2024 21:56:18 -0300 Subject: [PATCH 07/53] single color just like the skin element! --- mods/singleColor.js | 3 +++ 1 file changed, 3 insertions(+) create mode 100644 mods/singleColor.js diff --git a/mods/singleColor.js b/mods/singleColor.js new file mode 100644 index 00000000..7d6e23a4 --- /dev/null +++ b/mods/singleColor.js @@ -0,0 +1,3 @@ +for (var element in elements) { + elements[element].singleColor = true; +} \ No newline at end of file From 4796b15328147eaa707de05c7df5e8d9993fbb1f Mon Sep 17 00:00:00 2001 From: JustAGenericUsername Date: Fri, 9 Feb 2024 19:57:48 -0500 Subject: [PATCH 08/53] the nothing update --- mods/nousersthings.js | 19 +++++++++++++++++++ 1 file changed, 19 insertions(+) diff --git a/mods/nousersthings.js b/mods/nousersthings.js index 3a674500..9cb4cce2 100644 --- a/mods/nousersthings.js +++ b/mods/nousersthings.js @@ -2072,4 +2072,23 @@ elements.outliner = { changePixel(pixel, pixel.changeElem) } } +} +textures.transparency = [ + "wwwggg", + "wwwggg", + "wwwggg", + "gggwww", + "gggwww", + "gggwww" +] +elements.transparency = { + color: ["#d9d9d9", "#828282"], + colorPattern: textures.transparency, + colorKey: { + "g": "#D4D4D4", + "w": "#ffffff" + }, + behavior: behaviors.WALL, + category: "special", + state: "solid" } \ No newline at end of file From e6ef1e1eec0fca6b4c634f6eae0b7980ea161c65 Mon Sep 17 00:00:00 2001 From: JustAGenericUsername Date: Fri, 9 Feb 2024 19:59:12 -0500 Subject: [PATCH 09/53] adsadasd --- mods/nousersthings.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/mods/nousersthings.js b/mods/nousersthings.js index 9cb4cce2..003d7061 100644 --- a/mods/nousersthings.js +++ b/mods/nousersthings.js @@ -2082,7 +2082,7 @@ textures.transparency = [ "gggwww" ] elements.transparency = { - color: ["#d9d9d9", "#828282"], + color: ["#d4d4d4", "#ffffff"], colorPattern: textures.transparency, colorKey: { "g": "#D4D4D4", From 9ece7c832c8d5478998054e95f9c1e43e517a7cf Mon Sep 17 00:00:00 2001 From: Jayd-Rubies <155784127+Jayd-Rubies@users.noreply.github.com> Date: Sat, 10 Feb 2024 12:08:09 -0500 Subject: [PATCH 10/53] weapons.js update --- mods/weapons.js | 63 +++++++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 63 insertions(+) diff --git a/mods/weapons.js b/mods/weapons.js index 04ed8a20..deeae4e4 100644 --- a/mods/weapons.js +++ b/mods/weapons.js @@ -96,4 +96,67 @@ elements.right_missile = { category: "weapons", state: "solid", density: 1300, +}, + elements.RL_cluster_munition = { + color: "#444444", + behavior: [ + "XX|XX|XX", + "CRcluster%20|XX|CR:cluster%20", + "M2|M1|M2", + ], + category: "weapons", + state: "solid", + density: 1300, +}, + elements.cluster = { + color: "#444444", + behavior: [ + "XX|EX:10%10|XX", + "XX|XX|XX", + "M2|M1 AND EX:10%10|M2", + ], + category: "weapons", + state: "solid", + density: 1300, + hidden: true, +}, + elements.machine_gun_left = { + color: "#C0C0C0", + behavior: [ + "XX|XX|XX", + "CR:left_bullet|XX|XX", + "XX|XX|XX", + ], + category: "weapons", + state: "solid", + density: 1300, +}, + elements.machine_gun_right = { + color: "#C0C0C0", + behavior: [ + "XX|XX|XX", + "XX|XX|CR:right_bullet", + "XX|XX|XX", + ], + category: "weapons", + state: "solid", + density: 1300, +}, +elements.left_bullet = { + color: "#4c4e42", + behavior: [ + "M2|XX|XX", + "M1 AND EX:5|XX|XX", + "M2|XX|XX", + ], + category:"weapons", +}, + elements.right_bullet = { + color: "#4c4e42", + behavior: [ + "XX|XX|M2", + "XX|XX|M1 AND EX:5", + "XX|XX|M2", + ], + category:"weapons", }; \ No newline at end of file From d9e2d88323524b3edf8fdb13c459aa0bcac5be21 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sat, 10 Feb 2024 22:31:14 -0500 Subject: [PATCH 11/53] Create survival.js --- mods/survival.js | 329 +++++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 329 insertions(+) create mode 100644 mods/survival.js diff --git a/mods/survival.js b/mods/survival.js new file mode 100644 index 00000000..16a84345 --- /dev/null +++ b/mods/survival.js @@ -0,0 +1,329 @@ +if (!settings.survival) { + settings.survival = { + "wall": 999, + "dirt": 999, + "sapling": 1, + "seeds": 5, + "water": 25, + "cloner": 1, + } +} +settings.survival.cloner = 1; +// settings.survivalClone=null; settings.survival = null; saveSettings(); + +survivalTimeout = null; +function survivalSave() { + if (survivalTimeout) { clearTimeout(survivalTimeout); } + survivalTimeout = setTimeout(function(){ + saveSettings(); + },1000); +} +function survivalAdd(element,amount,skipSave) { + if (settings.survival[element]) { + settings.survival[element] += amount; + } + else { + settings.survival[element] = amount; + } + survivalUpdate(element); + if (!skipSave) {survivalSave()} +} +function survivalRemove(element,amount,skipSave) { + if (settings.survival[element]) { + settings.survival[element] -= amount; + survivalUpdate(element); + } + if (settings.survival[element] <= 0) { + delete settings.survival[element]; + var btn = document.getElementById("elementButton-"+element); + if (btn) { btn.remove(); } + } + if (!skipSave) {survivalSave()} +} +function survivalCount(element) { + return settings.survival[element] || 0; +} +function survivalUpdate(element) { + var btn = document.getElementById("elementButton-"+element); + if (btn) { + btn.innerHTML = btn.innerHTML.split("(")[0]+"("+settings.survival[element]+")"; + } + else if (elements[element]) { + createElementButton(element); + document.getElementById("elementButton-"+element).innerHTML += "("+settings.survival[element]+")"; + } +} + +runAfterAutogen(function(){ + elements.erase.name = "pick_up"; + delete elements.paint.category; + delete elements.pick; + for (var element in elements) { + if (elements[element].category !== "tools") { + elements[element].hidden = true; + elements[element].category = "survival"; + } + } + for (var element in settings.survival) { + if (!elements[element]) { continue; } + createElementButton(element); + document.getElementById("elementButton-"+element).innerHTML += "("+settings.survival[element]+")"; + } +}); + +/* +Cloner +Sell +*/ + +delete elements.cloner.behavior; +elements.cloner.tick = function(pixel) { + if (settings.survivalClone) { + if (Math.random() < 0.025) { + // 1 or -1 + var x = pixel.x + (Math.random() < 0.5 ? 1 : -1); + var y = pixel.y + (Math.random() < 0.5 ? 1 : -1); + if (isEmpty(x,y)) { + createPixel(settings.survivalClone,x,y); + } + } + } + else { + for (var i = 0; i < adjacentCoords.length; i++) { + var coords = adjacentCoords[i]; + var x = pixel.x + coords[0]; + var y = pixel.y + coords[1]; + if (!isEmpty(x,y,true)) { + if (pixelMap[x][y].clone) { pixel.clone = pixelMap[x][y].clone; break } + var element = pixelMap[x][y].element; + if (element === pixel.element || elements[pixel.element].ignore.indexOf(element) !== -1) { continue } + settings.survivalClone = element; + survivalSave(); + break; + } + } + } +}; + +elementWorth = { + "gold_coin": 1, + "diamond": 100, + "sap": 5, + "cloner": 0, + "wall": 0, +} +elements.sell = { + color: ["#fff0b5","#ffe680","#c48821","#986a1a","#eca832","#f0bb62"], + tool: function(pixel) { + if (elementWorth[pixel.element] === 0) { return; } + deletePixel(pixel.x,pixel.y); + survivalAdd("gold_coin",elementWorth[pixel.element]||1); + }, + category: "tools", +} + +window.addEventListener("load",function(){ + // move to start of tools + var erase = document.getElementById("elementButton-erase"); + var sell = document.getElementById("elementButton-sell"); + var parent = erase.parentElement; + parent.removeChild(sell); + parent.insertBefore(sell,parent.firstChild); + parent.removeChild(erase); + parent.insertBefore(erase,parent.firstChild); + document.getElementById("replaceButton").remove(); + document.getElementById("savesButton").remove(); + document.getElementById("elemSelectButton").remove(); + doRandomEvents = function() {} + worldGen = function() {} + loadSave = function() {} + showSaves = function() {} + placeImage = function() {} + chooseElementPrompt = function() {} +}); +runAfterLoad(function(){ + checkUnlock = function(element) { + return; + } + oldClearAll = clearAll; + clearAll = function() { + if (currentPixels && currentPixels.length > 0) { + for (var i = 0; i < currentPixels.length; i++) { + var pixel = currentPixels[i]; + if (pixel && pixel.element) { + survivalAdd(pixel.element,1); + } + } + } + oldClearAll(); + } + mouseAction = function(e,mouseX,mouseY,startPos) { + if (mouseType == "left") { + mouse1Action(e,mouseX,mouseY,startPos); + } + else if (mouseType == "right") { mouse2Action(e,mouseX,mouseY,startPos); } + else if (mouseType == "middle") { mouseMiddleAction(e,mouseX,mouseY); } + } + mouse1Action = function(e,mouseX=undefined,mouseY=undefined,startPos) { + if (currentElement === "erase") { mouse2Action(e,mouseX,mouseY); return; } + else if (currentElement === "pick") { mouseMiddleAction(e,mouseX,mouseY); return; } + // If x and y are undefined, get the mouse position + if (mouseX == undefined && mouseY == undefined) { + // var canvas = document.getElementById("game"); + // var ctx = canvas.getContext("2d"); + lastPos = mousePos; + mousePos = getMousePos(canvas, e); + var mouseX = mousePos.x; + var mouseY = mousePos.y; + } + var cooldowned = false; + if ((mouseSize===1 || elements[currentElement].maxSize===1) && elements[currentElement].cooldown) { + if (pixelTicks-lastPlace < elements[currentElement].cooldown) { + return; + } + cooldowned = true; + } + lastPlace = pixelTicks; + startPos = startPos || lastPos + if (!(isMobile || (cooldowned && startPos.x===lastPos.x && startPos.y===lastPos.y) || elements[currentElement].tool || elements[currentElement].category==="tools")) { + var coords = lineCoords(startPos.x,startPos.y,mouseX,mouseY); + } + else { var coords = mouseRange(mouseX,mouseY); } + var element = elements[currentElement]; + var mixList = []; + // For each x,y in coords + for (var i = 0; i < coords.length; i++) { + var x = coords[i][0]; + var y = coords[i][1]; + + if (currentElement === "mix") { + if (!isEmpty(x,y,true)) { + var pixel = pixelMap[x][y]; + if (!(elements[pixel.element].movable !== true || elements[pixel.element].noMix === true) || shiftDown) { + mixList.push(pixel); + } + } + } + else if (currentElement === "shock") { + if (!isEmpty(x,y,true)) { + // One loop that repeats 5 times if shiftDown else 1 time + for (var j = 0; j < (shiftDown ? 5 : 1); j++) { + var pixel = pixelMap[x][y]; + var con = elements[pixel.element].conduct; + if (con == undefined) {continue} + if (Math.random() < con) { // If random number is less than conductivity + if (!pixel.charge && !pixel.chargeCD) { + pixel.charge = 1; + if (elements[pixel.element].colorOn) { + pixel.color = pixelColorPick(pixel); + } + } + } + else if (elements[pixel.element].insulate != true) { // Otherwise heat the pixel (Resistance simulation) + pixel.temp += 0.25; + pixelTempCheck(pixel); + } + } + } + } + else if (elements[currentElement].tool && !(elements[currentElement].canPlace && isEmpty(x,y))) { + // run the tool function on the pixel + if (!isEmpty(x,y,true)) { + var pixel = pixelMap[x][y]; + // if the current element has an ignore property and the pixel's element is in the ignore property, don't do anything + if (elements[currentElement].ignore && elements[currentElement].ignore.indexOf(pixel.element) != -1) { + continue; + } + elements[currentElement].tool(pixel); + } + } + else if (isEmpty(x, y)) { + if (survivalCount(currentElement) < 1) { + return; + } + survivalRemove(currentElement,1); + currentPixels.push(new Pixel(x, y, currentElement)); + if (elements[currentElement].customColor || elements[currentElement].singleColor) { + pixelMap[x][y].color = pixelColorPick(currentElement,currentColor); + } + if (currentElementProp) { + for (var key in currentElementProp) { + pixelMap[x][y][key] = currentElementProp[key] + } + } + } + } + if (currentElement == "mix") { + for (var i = 0; i < mixList.length; i++) { + var pixel1 = mixList[Math.floor(Math.random()*mixList.length)]; + var pixel2 = mixList[Math.floor(Math.random()*mixList.length)]; + swapPixels(pixel1,pixel2); + mixList.splice(mixList.indexOf(pixel1),1); + mixList.splice(mixList.indexOf(pixel2),1); + if (elements[pixel1.element].onMix) { + elements[pixel1.element].onMix(pixel1,pixel2); + } + if (elements[pixel2.element].onMix) { + elements[pixel2.element].onMix(pixel2,pixel1); + } + } + + } + } + mouse2Action = function(e,mouseX=undefined,mouseY=undefined,startPos) { + // Erase pixel at mouse position + if (mouseX == undefined && mouseY == undefined) { + // var canvas = document.getElementById("game"); + // var ctx = canvas.getContext("2d"); + lastPos = mousePos; + mousePos = getMousePos(canvas, e); + var mouseX = mousePos.x; + var mouseY = mousePos.y; + } + if (dragStart) { + dragStart = 0; + for (var i = 0; i < draggingPixels.length; i++) { + var pixel = draggingPixels[i]; + delete pixel.drag; + } + draggingPixels = null; + } + // If the current element is "pick" or "lookup", coords = [mouseX,mouseY] + if (currentElement == "pick" || currentElement == "lookup") { + var coords = [[mouseX,mouseY]]; + } + else if (!isMobile) { + startPos = startPos || lastPos + var coords = lineCoords(startPos.x,startPos.y,mouseX,mouseY); + } + else { + var coords = mouseRange(mouseX,mouseY); + } + // For each x,y in coords + for (var i = 0; i < coords.length; i++) { + var x = coords[i][0]; + var y = coords[i][1]; + + if (!isEmpty(x, y)) { + if (outOfBounds(x,y)) { + continue + } + var pixel = pixelMap[x][y]; + survivalAdd(pixel.element,1); + delete pixelMap[x][y]; + // Remove pixel from currentPixels + for (var j = 0; j < currentPixels.length; j++) { + if (currentPixels[j].x == x && currentPixels[j].y == y) { + currentPixels.splice(j, 1); + break; + } + } + } + } + } +}) + +window.addEventListener("beforeunload",function(){ + clearAll(); + saveSettings(); +}); \ No newline at end of file From b638f12156c65891cf1afe04f3f7dedb758fa5e9 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sat, 10 Feb 2024 22:43:34 -0500 Subject: [PATCH 12/53] Update survival.js --- mods/survival.js | 2 ++ 1 file changed, 2 insertions(+) diff --git a/mods/survival.js b/mods/survival.js index 16a84345..676ae7d1 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -9,6 +9,7 @@ if (!settings.survival) { } } settings.survival.cloner = 1; +settings.unhide = 0; // settings.survivalClone=null; settings.survival = null; saveSettings(); survivalTimeout = null; @@ -140,6 +141,7 @@ window.addEventListener("load",function(){ showSaves = function() {} placeImage = function() {} chooseElementPrompt = function() {} + document.getElementById("toolControls").insertAdjacentHTML("beforeend",``); }); runAfterLoad(function(){ checkUnlock = function(element) { From 38c5e3ba4add8953a139c8d015dba36abd05e4a6 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sat, 10 Feb 2024 23:06:10 -0500 Subject: [PATCH 13/53] Update survival.js --- mods/survival.js | 49 ++++++++++++++++++++++++++++++++++++++++++++++-- 1 file changed, 47 insertions(+), 2 deletions(-) diff --git a/mods/survival.js b/mods/survival.js index 676ae7d1..8030a4da 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -46,6 +46,7 @@ function survivalCount(element) { } function survivalUpdate(element) { var btn = document.getElementById("elementButton-"+element); + if (elements[element] && elements[element].category === "tools") { return } if (btn) { btn.innerHTML = btn.innerHTML.split("(")[0]+"("+settings.survival[element]+")"; } @@ -58,7 +59,9 @@ function survivalUpdate(element) { runAfterAutogen(function(){ elements.erase.name = "pick_up"; delete elements.paint.category; + delete elements.lookup.category; delete elements.pick; + elements.radiation.category = "tools"; for (var element in elements) { if (elements[element].category !== "tools") { elements[element].hidden = true; @@ -105,6 +108,44 @@ elements.cloner.tick = function(pixel) { } } }; +elements.cloner.ignore = elements.cloner.ignore.concat(["gold","gold_coin","molten_gold"]); + +elements.smash.tool = function(pixel) { + if (elements[pixel.element].seed === true) { return } + if (elements[pixel.element].breakInto !== undefined || (elements[pixel.element].seed !== undefined && elements[pixel.element].seed !== true)) { + // times 0.25 if not shiftDown else 1 + if (Math.random() < (elements[pixel.element].hardness || 1) * (shiftDown ? 1 : 0.25)) { + var breakInto = elements[pixel.element].breakInto; + if (!breakInto && elements[pixel.element].seed) { + if (Math.random() < 0.1) { + breakInto = elements[pixel.element].seed; + } + else { + breakInto = null; + } + } + // if breakInto is an array, pick one + if (Array.isArray(breakInto)) { + breakInto = breakInto[Math.floor(Math.random() * breakInto.length)]; + } + if (breakInto === null) { + if (elements[pixel.element].seed) { + breakInto = elements[pixel.element].seed; + } + else { + deletePixel(pixel.x,pixel.y); + return; + } + } + var oldelement = pixel.element; + changePixel(pixel,breakInto); + pixelTempCheck(pixel); + if (elements[oldelement].breakIntoColor) { + pixel.color = pixelColorPick(pixel, elements[oldelement].breakIntoColor); + } + } + } +}; elementWorth = { "gold_coin": 1, @@ -112,12 +153,16 @@ elementWorth = { "sap": 5, "cloner": 0, "wall": 0, + "fire": 0, + "smoke": 0, + "plasma": 0, } elements.sell = { color: ["#fff0b5","#ffe680","#c48821","#986a1a","#eca832","#f0bb62"], tool: function(pixel) { if (elementWorth[pixel.element] === 0) { return; } deletePixel(pixel.x,pixel.y); + if (elementWorth[pixel.element] === -1) { return; } survivalAdd("gold_coin",elementWorth[pixel.element]||1); }, category: "tools", @@ -240,10 +285,10 @@ runAfterLoad(function(){ } } else if (isEmpty(x, y)) { - if (survivalCount(currentElement) < 1) { + if (survivalCount(currentElement) < 1 && elements[currentElement].category !== "tools") { return; } - survivalRemove(currentElement,1); + if (elements[currentElement].category !== "tools") { survivalRemove(currentElement,1); } currentPixels.push(new Pixel(x, y, currentElement)); if (elements[currentElement].customColor || elements[currentElement].singleColor) { pixelMap[x][y].color = pixelColorPick(currentElement,currentColor); From 1194d7ce455ea8deb900457816ff7643fcccce0d Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sat, 10 Feb 2024 23:15:05 -0500 Subject: [PATCH 14/53] Update survival.js --- mods/survival.js | 16 +++++++--------- 1 file changed, 7 insertions(+), 9 deletions(-) diff --git a/mods/survival.js b/mods/survival.js index 8030a4da..0efa5ced 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -20,6 +20,7 @@ function survivalSave() { },1000); } function survivalAdd(element,amount,skipSave) { + if (elements[element].category === "tools") { return } if (settings.survival[element]) { settings.survival[element] += amount; } @@ -30,6 +31,7 @@ function survivalAdd(element,amount,skipSave) { if (!skipSave) {survivalSave()} } function survivalRemove(element,amount,skipSave) { + if (elements[element].category === "tools") { return } if (settings.survival[element]) { settings.survival[element] -= amount; survivalUpdate(element); @@ -116,8 +118,8 @@ elements.smash.tool = function(pixel) { // times 0.25 if not shiftDown else 1 if (Math.random() < (elements[pixel.element].hardness || 1) * (shiftDown ? 1 : 0.25)) { var breakInto = elements[pixel.element].breakInto; - if (!breakInto && elements[pixel.element].seed) { - if (Math.random() < 0.1) { + if (elements[pixel.element].seed) { + if (Math.random() < 0.2) { breakInto = elements[pixel.element].seed; } else { @@ -129,13 +131,8 @@ elements.smash.tool = function(pixel) { breakInto = breakInto[Math.floor(Math.random() * breakInto.length)]; } if (breakInto === null) { - if (elements[pixel.element].seed) { - breakInto = elements[pixel.element].seed; - } - else { - deletePixel(pixel.x,pixel.y); - return; - } + deletePixel(pixel.x,pixel.y); + return; } var oldelement = pixel.element; changePixel(pixel,breakInto); @@ -156,6 +153,7 @@ elementWorth = { "fire": 0, "smoke": 0, "plasma": 0, + "petal": -1, } elements.sell = { color: ["#fff0b5","#ffe680","#c48821","#986a1a","#eca832","#f0bb62"], From dc0e58f946827d56aaff2e278465c104a93ff4fd Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sat, 10 Feb 2024 23:26:27 -0500 Subject: [PATCH 15/53] Update survival.js --- mods/survival.js | 1 + 1 file changed, 1 insertion(+) diff --git a/mods/survival.js b/mods/survival.js index 0efa5ced..7b21da4e 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -72,6 +72,7 @@ runAfterAutogen(function(){ } for (var element in settings.survival) { if (!elements[element]) { continue; } + if (elements[element].category === "tools") { continue; } createElementButton(element); document.getElementById("elementButton-"+element).innerHTML += "("+settings.survival[element]+")"; } From b47f718eebc9a4ec198aa61fdec51e03759c3f2a Mon Sep 17 00:00:00 2001 From: Ilikepizza2006 <146470829+Ilikepizza2006@users.noreply.github.com> Date: Sun, 11 Feb 2024 16:25:46 +0100 Subject: [PATCH 16/53] Update 1.9 --- mods/pizzasstuff.js | 172 ++++++++++++++++++++++++++++++++++++++++---- 1 file changed, 158 insertions(+), 14 deletions(-) diff --git a/mods/pizzasstuff.js b/mods/pizzasstuff.js index 463e692b..7e4fb53b 100644 --- a/mods/pizzasstuff.js +++ b/mods/pizzasstuff.js @@ -1,3 +1,34 @@ +elements.freeze_ray = { + color: ["#9ae4f5","#84d6e8"], + tick: function(pixel) { + var x = pixel.x; + for (var y = pixel.y; y < height; y++) { + if (outOfBounds(x, y)) { + break; + } + if (isEmpty(x, y)) { + if (Math.random() > 0.05) { continue } + createPixel("flash", x, y); + pixelMap[x][y].color = "#aedbe6"; + pixelMap[x][y].temp = -257; + } + else { + if (elements[pixelMap[x][y].element].isGas) { continue } + if (elements[pixelMap[x][y].element].id === elements.heat_ray.id) { break } + pixelMap[x][y].temp -= 100; + pixelTempCheck(pixelMap[x][y]); + break; + } + } + deletePixel(pixel.x, pixel.y); + }, + temp: -257, + category: "energy", + state: "gas", + excludeRandom: true, + noMix: true +}; + elements.beer = { color: ["#ffc43d","#ffc43d"], behavior: behaviors.LIQUID, @@ -16,6 +47,9 @@ elements.root_beer = { elements.fruit_slushy = { color: ["#d43968","#ec5885","#f57ca1","#fba9c2","#ffe3eb"], + stateLowColorMultiplier: 1.3, + stateLow: "slushy_ice", + tempLow: "-50", behavior: behaviors.LIQUID, category: "food", state: "solid", @@ -32,6 +66,9 @@ elements.mold = { elements.chocolate_slushy = { color: ["#c3ae9a","#ae967f","#977b5f","#876b4f","#816346"], + stateLowColorMultiplier: 1.3, + tempLow: "-50", + stateLow: "slushy_ice", behavior: behaviors.LIQUID, category: "food", state: "solid", @@ -136,7 +173,7 @@ elements.fruit_yogurt = { elements.frozen_fruit_yogurt = { color: ["#ffdfdf","#ffc0c0","#ff9b9b"], - stateLowColorMultiplier: 0.7, + stateHighColorMultiplier: 0.7, behavior: behaviors.STURDYPOWDER, category: "food", state: "solid", @@ -149,7 +186,7 @@ elements.frozen_fruit_yogurt = { elements.frozen_chocolate_yogurt = { color: ["#a87848","#a57e57","#c1a07f","#e2c5ac","#efd0b1"], - stateLowColorMultiplier: 0.7, + stateHighColorMultiplier: 0.7, behavior: behaviors.STURDYPOWDER, category: "food", state: "solid", @@ -418,7 +455,7 @@ elements.moss = { }; elements.moth = { - color: "#665233", + color: ["#df8830","#e9b477","#a1591a","#a87a46","#4e3212"], behavior: behaviors.FLY, category: "life", state: "solid", @@ -661,7 +698,6 @@ elements.banana = { breakInto: "juice", breakIntoColor: "#f0f060", reactions: { - "steam": { elem1: "potassium", elem2: null }, "sugar": { elem1: "jelly", elem2: null, tempMin: 100, color1: ["#fdf8d6","#f9efa6"] }, } }; @@ -1074,14 +1110,6 @@ elements.eggplant = { breakIntoColor: ["#674ea7","#351c75"], }; -elements.potassium = { - color: "#a3a333", - behavior: behaviors.POWDER, - category: "states", - state: "solid", - breakInto: "juice", -}; - elements.onion = { color: ["#62121b","#a92940","#c04b65","#d8699e"], behavior: @@ -1282,7 +1310,7 @@ elements.legacy_rocket = { "XX|DL%1|XX", "CR:smoke|CR:fire|CR:smoke", ], - category: "special", + category: "legacy", hidden:true, state: "solid", temp:700, @@ -1292,6 +1320,84 @@ elements.legacy_rocket = { stateHigh: "molten_steel" }; +elements.legacy_dough = { + color: "#bfac91", + behavior: behaviors.STURDYPOWDER, + onMix: function(dough,ingredient) { + if (elements[ingredient.element].isFood && elements[ingredient.element].id !== elements.dough.id && elements[ingredient.element].id !== elements.flour.id && elements[ingredient.element].id !== elements.batter.id && elements[ingredient.element].id !== elements.bread.id) { + var rgb1 = dough.color.match(/\d+/g); + var rgb2 = ingredient.color.match(/\d+/g); + // average the colors + var rgb = [ + Math.round((parseInt(rgb1[0])+parseInt(rgb2[0]))/2), + Math.round((parseInt(rgb1[1])+parseInt(rgb2[1]))/2), + Math.round((parseInt(rgb1[2])+parseInt(rgb2[2]))/2) + ]; + changePixel(ingredient, "dough") + // convert rgb to hex + var hex = RGBToHex(rgb); + dough.color = pixelColorPick(dough, hex); + // 50% change to delete ingredient + if (Math.random() < 0.5) { deletePixel(ingredient.x, ingredient.y); } + else { + ingredient.color = pixelColorPick(ingredient, hex); + } + } + }, + reactions: { + "milk": { elem2:"broth", color2:"#ECC891", tempMin:70 }, + "cream": { elem2:"broth", color2:"#ECC891", tempMin:70 }, + }, + category: "legacy", + tempHigh: 94, + stateHigh: "bread", + //stateHighColorMultiplier: 0.9, + burn:40, + burnTime:25, + burnInto:"ash", + state: "solid", + density: 526.9, + isFood: true +}; + +elements.legacy_batter = { + color: "#d4bc85", + behavior: behaviors.LIQUID, + onMix: function(batter,ingredient) { + if (elements[ingredient.element].isFood && elements[ingredient.element].id !== elements.batter.id && elements[ingredient.element].id !== elements.flour.id && elements[ingredient.element].id !== elements.yolk.id && elements[ingredient.element].id !== elements.dough.id && elements[ingredient.element].id !== elements.baked_batter.id) { + var rgb1 = batter.color.match(/\d+/g); + var rgb2 = ingredient.color.match(/\d+/g); + // average the colors + var rgb = [ + Math.round((parseInt(rgb1[0])+parseInt(rgb2[0]))/2), + Math.round((parseInt(rgb1[1])+parseInt(rgb2[1]))/2), + Math.round((parseInt(rgb1[2])+parseInt(rgb2[2]))/2) + ]; + changePixel(ingredient, "batter") + // convert rgb to hex + var hex = RGBToHex(rgb); + batter.color = pixelColorPick(batter, hex); + // 50% change to delete ingredient + if (Math.random() < 0.5) { deletePixel(ingredient.x, ingredient.y); } + else { + ingredient.color = pixelColorPick(ingredient, hex); + } + } + }, + category: "legacy", + tempHigh: 94, + stateHigh: "baked_batter", + stateHighColorMultiplier: 0.9, + burn:40, + burnTime:25, + burnInto:"ash", + state: "liquid", + viscosity: 10000, + density: 1001, + hidden: true, + isFood: true +}; + elements.legacy_lattice = { color: "#cb4cd9", behavior: [ @@ -1300,7 +1406,7 @@ elements.legacy_lattice = { "CL|XX|CL", ], hidden: true, - category:"special", + category:"legacy", excludeRandom: true }; @@ -1352,6 +1458,37 @@ elements.left_lattice = { excludeRandom: true }; +elements.amethyst = { + color: ["#9868e0","#482888","#7848b8","#c898f0","#a878f0"], + behavior: behaviors.POWDER, + hidden: true, + category: "powders", +}; + +elements.quartz = { + color: ["#f6fff9","#f3f9f9","#f6fcf9","#fefefe","#fdfffe"], + behavior: behaviors.POWDER, + hidden: true, + category: "powders", + tempHigh: 1900, + stateHigh: "magma", + reactions: { + "molten_iron": { elem1: "amethyst", elem2: null }, + } +}; + +elements.slushy_ice = { + color: ["#f6fff9","#f3f9f9","#f6fcf9","#fefefe","#fdfffe"], + behavior: behaviors.WALL, + temp: -5, + tempHigh: 5, + stateHigh: "smashed_ice", + category: "states", + state: "solid", + density: 917, + breakInto: "smashed_ice", +}; + elements.toorhpaste = { color: ["#31ffe0","#65ffe8","#97ffef","#c9fff7","#f3fffd"], behavior: behaviors.LIQUID, @@ -1428,10 +1565,17 @@ elements.algae.breakInto = "seafoam" elements.battery.breakInto = "battery_acid" +elements.art.burn = 5 +elements.art.burnTime = 300 +elements.art.burnInto = ["ember","charcoal","fire"] + + elements.herb.breakInto = "seasoning" elements.chocolate.breakInto = "chocolate_sauce" +elements.magma.stateLow = ["basalt","basalt","basalt","basalt","basalt","basalt","basalt","rock","quartz"] + if (!elements.bless.reactions) elements.bless.reactions = {}; elements.bless.reactions.mold = { elem2: null } From 98d69c2d855959d7422c6405fcb97fc3e539dfae Mon Sep 17 00:00:00 2001 From: An Orbit <68935009+orbit-loona@users.noreply.github.com> Date: Sun, 11 Feb 2024 12:04:27 -0500 Subject: [PATCH 17/53] even cursor sizes, electric gas lightning --- mods/a_mod_by_alice.js | 160 +++++++++++++++++++++++++++++++++++------ 1 file changed, 140 insertions(+), 20 deletions(-) diff --git a/mods/a_mod_by_alice.js b/mods/a_mod_by_alice.js index ddd46a35..804e1714 100644 --- a/mods/a_mod_by_alice.js +++ b/mods/a_mod_by_alice.js @@ -1163,10 +1163,11 @@ try { }; function convertHslObjects(color,outputType="rgb") { + if(color == null) { console.error("convertHslObjects: Color is null"); color = {h: 300, s: 100, l: 50} }; switch(outputType.toLowerCase()) { //RGB cases case "rgb": - color = hexToRGB(hslToHex(...Object.values(color))); //hsl to hex, hex to rgb_json, and rgb_json to rgb() + color = convertColorFormats(hslToHex(...Object.values(color)),"json"); //hsl to hex, hex to rgb_json, and rgb_json to rgb() return `rgb(${color.r},${color.g},${color.b})`; break; case "hex": @@ -1202,8 +1203,8 @@ try { break; default: throw new Error("outputType must be \"rgb\", \"hex\", \"rgb_json\", \"rgb_array\", \"hsl\", \"hsl_json\", or \"hsl_array\""); - }; - } + } + }; function changeSaturation(color,saturationChange,operationType="add",outputType="rgb",arrayType=null,doRounding=true) { color = normalizeColorToHslObject(color,arrayType); @@ -2094,13 +2095,15 @@ try { //fix -1-caused ghost pixels function deletePixel(x,y) { + if(isEmpty(x,y,true)) { return false }; // remove pixelMap[x][y] from currentPixels var pixelIndex = currentPixels.indexOf(pixelMap[x][y]); if(pixelIndex !== -1) { currentPixels.splice(pixelIndex,1) + if (pixelMap[x][y]) { delete pixelMap[x][y] }; }; - if (pixelMap[x][y]) {pixelMap[x][y].del = true} - if (pixelMap[x][y]) { delete pixelMap[x][y] }; + //if (pixelMap[x][y]) {pixelMap[x][y].del = true} + //if (pixelMap[x][y]) { delete pixelMap[x][y] }; /*for (var i = 0; i < currentPixels.length; i++) { if (currentPixels[i].x == x && currentPixels[i].y == y) { currentPixels.splice(i, 1); @@ -3217,6 +3220,32 @@ color1 and color2 spread through striped paint like dye does with itself. col } }; + //redefine mouseRange to support even sizes + function mouseRange(mouseX,mouseY,size) { + var coords = []; + size = size || mouseSize; + if (elements[currentElement].maxSize < mouseSize) { + var mouseOffset = Math.trunc(elements[currentElement].maxSize/2); + } + else { + var mouseOffset = Math.trunc(size/2); + } + var topLeft = [mouseX-mouseOffset,mouseY-mouseOffset]; + var bottomRight = [mouseX+mouseOffset,mouseY+mouseOffset]; + if(size % 2 == 0) { + bottomRight[0]--; + bottomRight[1]--; + }; + // Starting at the top left, go through each pixel + for (var x = topLeft[0]; x <= bottomRight[0]; x++) { + for (var y = topLeft[1]; y <= bottomRight[1]; y++) { + // If the pixel is empty, add it to coords + coords.push([x,y]); + } + } + return coords; + }; + //this part defines basically all of the keybinds function addKeyboardListeners() { document.addEventListener("keydown", function(e) { @@ -3259,16 +3288,26 @@ color1 and color2 spread through striped paint like dye does with itself. col } return; } + // If the user presses [ or -, decrease the mouse size by 2 if (e.keyCode == 219 || e.keyCode == 189) { - if (shiftDown) {mouseSize = 1} + //If a shift key is pressed, set to 1 + if (shiftDown && shiftDown % 2 == 1) {mouseSize = 1} + //If an alt key is pressed, decrease by 1 + else if (shiftDown && shiftDown % 2 == 0) { + mouseSize--; + if (mouseSize < 1) { mouseSize = 1 } + } else { mouseSize -= 2; - if (mouseSize < 1) { mouseSize = 1; } + if (mouseSize < 1) { mouseSize = 1 } } } // If the user presses ] or =, increase the mouse size by 2 if (e.keyCode == 221 || e.keyCode == 187) { - if (shiftDown) {mouseSize = (mouseSize+15)-((mouseSize+15) % 15)} + //If a shift key is pressed, increase by 15 + if (shiftDown && shiftDown % 2 == 1) {mouseSize = (mouseSize+15)-((mouseSize+15) % 15)} + //If an alt key is pressed, increase by 1 + else if (shiftDown && shiftDown % 2 == 0) {mouseSize++} else {mouseSize += 2;} // if height>width and mouseSize>height, set mouseSize to height, if width>height and mouseSize>width, set mouseSize to width if (mouseSize > (height > width ? height : width)) { mouseSize = (height > width ? height : width); } @@ -3607,6 +3646,11 @@ color1 and color2 spread through striped paint like dye does with itself. col velocityBlacklist = []; function explodeAtPlus(x,y,radius,firee="fire",smokee="smoke",beforeFunction=null,afterFunction=null,changeTemp=true) { + var message = "Explosion "; + var pixel = pixelMap[x]?.[y]; + if(pixel) { message += `of ${pixel.element} ` }; + message += `with radius ${radius} at (${x},${y})`; + // if fire contains , split it into an array if(firee !== null) { if (firee.indexOf(",") !== -1) { @@ -3730,6 +3774,15 @@ color1 and color2 spread through striped paint like dye does with itself. col }; oldExplodeAt = explodeAt; + /*explodeAt = function(x,y,radius,fire="fire") { + var message = "Explosion "; + var pixel = pixelMap[x]?.[y]; + if(pixel) { message += `of ${pixel.element} ` }; + message += `with radius ${radius} with "${fire}" at (${x},${y})`; + console.log(message); + + oldExplodeAt(x,y,radius,fire="fire") + };*/ explodeAt = explodeAtPlus; //MORE CONFIGURABLE REACTION TEMPERATURE CHANGES ## @@ -5029,11 +5082,10 @@ color1 and color2 spread through striped paint like dye does with itself. col if (pixel.charge && elementInfo.colorOn) { customColor = elementInfo.colorOn; } - if (customColor != null) { + if (customColor !== null) { if (Array.isArray(customColor)) { customColor = customColor[Math.floor(Math.random() * customColor.length)]; - } - if (customColor.startsWith("#")) { + } else if (customColor.startsWith?.("#")) { customColor = hexToRGB(customColor); } var rgb = customColor; @@ -5224,7 +5276,7 @@ color1 and color2 spread through striped paint like dye does with itself. col if (!settings["bg"]) {ctx.clearRect(0, 0, canvas.width, canvas.height)} else { if(settings["bg"] instanceof Array) { - settings.bgAngle ??= 0; + settings.bgAngle ??= 90; var angle = (settings.bgAngle) * Math.PI / 180; ctx.fillStyle = ctx.createLinearGradient( 0, @@ -5560,6 +5612,10 @@ color1 and color2 spread through striped paint like dye does with itself. col } var topLeft = [mousePos.x-mouseOffset,mousePos.y-mouseOffset]; var bottomRight = [mousePos.x+mouseOffset,mousePos.y+mouseOffset]; + if(mouseSize % 2 == 0) { + bottomRight[0]--; + bottomRight[1]--; + }; // Draw a square around the mouse ctx.strokeStyle = "white"; ctx.strokeRect(topLeft[0]*pixelSize,topLeft[1]*pixelSize,(bottomRight[0]-topLeft[0]+1)*pixelSize,(bottomRight[1]-topLeft[1]+1)*pixelSize); @@ -7930,7 +7986,7 @@ color1 and color2 spread through striped paint like dye does with itself. col } //1010 and 0101 if(pixel.dc1 && !pixel.dc2 && pixel.dc3 && !pixel.dc4) { - if(!pixel.changeTo) { + if(!pixel.changeTo) { //7989 yay soshi! if(ggg < 1/2) { pixel.changeTo = pixel.dc1 } else { @@ -8069,7 +8125,7 @@ color1 and color2 spread through striped paint like dye does with itself. col if(isEmpty(pixel.x+1,pixel.y-1) && isEmpty(pixel.x+1,pixel.y-2) && !outOfBounds(pixel.x+1,pixel.y-1) && !outOfBounds(pixel.x+1,pixel.y-2)) { tryMove(pixelMap[pixel.x][pixel.y-1],pixel.x+1,pixel.y-1) tryMove(pixelMap[pixel.x][pixel.y-2],pixel.x+1,pixel.y-2) - } //7989 yay soshi! + } } } else { if(isEmpty(pixel.x+1,pixel.y-1) && !outOfBounds(pixel.x+1,pixel.y-1)) { @@ -17191,9 +17247,9 @@ Pixel size (rendering only): (Use if the save looks cut o elements.electric_gas = { color: ["#3693b3", "#246e64"], behavior: [ - "M2%33.3 AND CR:electric%1|M1%33.3 AND CR:electric%1|M2%33.3 AND CR:electric%1", - "M1%33.3 AND CR:electric%1|XX%0000000000000000000000|M1%33.3 AND CR:electric%1", - "M2%33.3 AND CR:electric%1|M1%33.3 AND CR:electric%1|M2%33.3 AND CR:electric%1", + "M2%33.3 AND CR:electric%1 AND CR:lightning%0.005|M1%33.3 AND CR:electric%1 AND CR:lightning%0.005|M2%33.3 AND CR:electric%1 AND CR:lightning%0.005", + "M1%33.3 AND CR:electric%1 AND CR:lightning%0.005|XX%000000000000000000000000000000000000000000000|M1%33.3 AND CR:electric%1 AND CR:lightning%0.005", + "M2%33.3 AND CR:electric%1 AND CR:lightning%0.005|M1%33.3 AND CR:electric%1 AND CR:lightning%0.005|M2%33.3 AND CR:electric%1 AND CR:lightning%0.005", ], hardness: 0.8, reactions: { @@ -17202,7 +17258,7 @@ Pixel size (rendering only): (Use if the save looks cut o }, category: "gases", density: 1.225, - state: "gas", + state: "gas" }; corrosiveGasMaxHardness = 0.6 @@ -19256,9 +19312,10 @@ Pixel size (rendering only): (Use if the save looks cut o */ function heejinitoidTick(pixel) { + pixel.color ??= pixelColorPick(pixel); if(pixel.oldColor === null) { pixel.oldColor = pixel.color }; if(pixel.oldColor === undefined) { pixel.oldColor = pixelColorPick(pixel) }; - var color = rgbStringToHSL(convertColorFormats(pixel.oldColor,"rgb"),"json"); + var color = rgbStringToHSL((convertColorFormats(pixel.oldColor,"rgb") ?? pixelColorPick(pixel)),"json"); var heejiniteHueSpread = 30 + (pixel.temp/9.25) var hueOffset = (Math.sin(pixelTicks / 11) * heejiniteHueSpread) + 15; color.h += hueOffset; var color = convertHslObjects(color,"rgb"); @@ -26448,6 +26505,8 @@ Pixel size (rendering only): (Use if the save looks cut o elements.molten_copper ??= {}; elements.molten_copper.tempHigh = 4700; elements.molten_alumina ??= {}; elements.molten_alumina.tempHigh = 5400; + elements.molten_alumina.state = "liquid"; + elements.molten_alumina.autoType = "gas"; elements.molten_alumina.reactions ??= {}; elements.molten_alumina.reactions.iron_scrap = {elem1: "molten_sapphire", elem2: ["molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron",null] }; elements.molten_alumina.reactions.molten_iron = {elem1: "molten_sapphire", elem2: ["molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron","molten_iron",null] }; @@ -35842,7 +35901,7 @@ Make sure to save your command in a file if you want to add this preset again.` }; elements.sponge.onTryMoveInto = function(pixel,otherPixel) { - var absorbedElements = Object.keys(pixel.absorbed); + var absorbedElements = Object.keys(pixel.absorbed ?? {}); if(absorbedElements.length == 0) { return false; }; @@ -45937,6 +45996,67 @@ maxPixels (default 1000): Maximum amount of pixels/changes (if xSpacing and ySpa maxColorOffset: 0 }; + + runAfterLoad(function() { + //Emergency bug fix + elemfillerVar = null; + elements.element_filler = { + category: "special", + color: elements.filler.color, + state: "solid", + movable: "false", + onSelect: function() { + var answer6 = prompt("Please input the desired element of this filler. It will not work if you do multiple filter types while paused.",(elemfillerVar||undefined)); + if (!answer6) { return } + elemfillerVar = answer6; + }, + excludeRandom: true, + tick: function(pixel){ + if(!(elementExists(elemfillerVar))) { + deletePixel(pixel.x,pixel.y); + return + }; + var neighbors = 0; + if(!pixel.changeElem){ + pixel.changeElem = elemfillerVar; + } + for (var i = 0; i < squareCoords.length; i++) { + var coord = squareCoords[i]; + var x = pixel.x+coord[0]; + var y = pixel.y+coord[1]; + if (!isEmpty(x,y, true)) { + neighbors = neighbors + 1; + } else if (isEmpty(x, y)){ + createPixel("element_filler", x, y) + pixelMap[x][y].changeElem = pixel.changeElem; + } else ( + changePixel(pixel, pixel.changeElem) + ) + } + if (neighbors >= 8){ + changePixel(pixel, pixel.changeElem) + } + } + } + + if(elementExists("ohio")) { + elements.ohio.excludeRandom = true + }; + if(elementExists("rainbow_bomb")) { + elements.rainbow_bomb.excludeRandom = true + }; + if(elementExists("fart")) { + elements.fart.excludeRandom = true + }; + if(elementExists("dark_energy")) { + elements.dark_energy.excludeRandom = true + }; + if(elementExists("rainbow_flash")) { + elements.rainbow_flash.excludeRandom = true; + delete elements.rainbow_flash.reactions.fire + }; + }) + //END ## } catch (error) { alert(`Load failed (try reloading).\nThis is likely a sporadic failure caused by inconsistencies in how mods are loaded, and will likely fix itself in a refresh or two. If it persists, then it's an issue.\nError: ${error.stack}`); From 9b27bd9e0eab7fd31641807f01b0f7d907e835c1 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 13:05:26 -0500 Subject: [PATCH 18/53] Update survival.js --- mods/survival.js | 143 ++++++++++++++++++++++++++++++++++++++++++----- 1 file changed, 130 insertions(+), 13 deletions(-) diff --git a/mods/survival.js b/mods/survival.js index 7b21da4e..4ccccd72 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -4,7 +4,7 @@ if (!settings.survival) { "dirt": 999, "sapling": 1, "seeds": 5, - "water": 25, + "ice": 25, "cloner": 1, } } @@ -40,6 +40,7 @@ function survivalRemove(element,amount,skipSave) { delete settings.survival[element]; var btn = document.getElementById("elementButton-"+element); if (btn) { btn.remove(); } + selectElement("unknown"); } if (!skipSave) {survivalSave()} } @@ -47,6 +48,13 @@ function survivalCount(element) { return settings.survival[element] || 0; } function survivalUpdate(element) { + if (element === "gold_coin") { + // if it is not an integer, round it to 0.1 + if (settings.survival.gold_coin % 1 !== 0) { + settings.survival.gold_coin = Math.round(settings.survival.gold_coin*10)/10; + } + document.getElementById("coinCount").innerHTML = settings.survival.gold_coin||0; + } var btn = document.getElementById("elementButton-"+element); if (elements[element] && elements[element].category === "tools") { return } if (btn) { @@ -67,7 +75,7 @@ runAfterAutogen(function(){ for (var element in elements) { if (elements[element].category !== "tools") { elements[element].hidden = true; - elements[element].category = "survival"; + elements[element].category = "inventory"; } } for (var element in settings.survival) { @@ -78,11 +86,6 @@ runAfterAutogen(function(){ } }); -/* -Cloner -Sell -*/ - delete elements.cloner.behavior; elements.cloner.tick = function(pixel) { if (settings.survivalClone) { @@ -112,6 +115,7 @@ elements.cloner.tick = function(pixel) { } }; elements.cloner.ignore = elements.cloner.ignore.concat(["gold","gold_coin","molten_gold"]); +elements.cloner.desc = "You can only clone one element at a time!" elements.smash.tool = function(pixel) { if (elements[pixel.element].seed === true) { return } @@ -148,13 +152,38 @@ elements.smash.tool = function(pixel) { elementWorth = { "gold_coin": 1, "diamond": 100, + "ketchup": 15, + "jelly": 10, + "soda": 10, + "toast": 10, + "bread": 3, + "glass": 5, + "rad_glass": 6, + "glass_shard": 2, + "rad_shard": 3, + "paper": 5, + "broth": 5, "sap": 5, + "caramel": 5, + "candy": 5, + "popcorn": 2, + "flour": 2, + "lettuce": 2, + "sauce": 2, + "wood": 0.2, + "tree_branch": 0.1, + "plant": 0.1, + "mushroom_cap": 0.1, + "mushroom_gill": 0.3, + "vine": 0.1, "cloner": 0, "wall": 0, "fire": 0, "smoke": 0, "plasma": 0, "petal": -1, + "cell": -1, + "cancer": -1, } elements.sell = { color: ["#fff0b5","#ffe680","#c48821","#986a1a","#eca832","#f0bb62"], @@ -165,6 +194,59 @@ elements.sell = { survivalAdd("gold_coin",elementWorth[pixel.element]||1); }, category: "tools", + desc: "Exchanges pixels for their market value in Gold Coins" +} +elements.seeds.name = "seed"; + +/* +~Cloner +~Sell +Shop + Cloner Reset + ~Ammonia + ~Dirt + ~Water + ~Seeds + ~Sapling + ~Pinecone + ~Primordial Soup + ~Worm + ~Bee + ~Human + ~TNT + Seller (Runs Sell tool on pixels that touch it) + Buyer (Cloner but uses store price every time, prompt to select item on select) +Prices tab +*/ +survivalShop = { + "dirt*25": 25, + "water*25": 250, + "ammonia*25": 500, + "seeds*1": 500, + "sapling*1": 500, + "pinecone*1": 500, + "tnt*25": 1000, + "worm*1": 1000, + "bee*1": 5000, + "primordial_soup*5": 10000, + "human*1": 50000, + "sun*25": 500000, +} +function survivalBuy(element) { + var price = survivalShop[element]; + if (!price) { alert("The shop isn't selling "+element+"!"); return } + if (settings.survival.gold_coin < price) { alert("You can't afford that!"); return } + survivalRemove("gold_coin",price); + var amount = 1; + if (element.indexOf("*") !== -1) { amount = parseInt(element.split("*")[1]); element = element.split("*")[0]; } + survivalAdd(element,amount); + selectElement(element); +} +function survivalResetCloner() { + if (settings.survival.gold_coin < 1000) { alert("You can't afford that!"); return } + survivalRemove("gold_coin",1000); + settings.survivalClone = null; + survivalSave(); } window.addEventListener("load",function(){ @@ -186,6 +268,46 @@ window.addEventListener("load",function(){ placeImage = function() {} chooseElementPrompt = function() {} document.getElementById("toolControls").insertAdjacentHTML("beforeend",``); + createCategoryDiv("shop"); + var shopDiv = document.getElementById("category-shop"); + shopDiv.style.display = "none"; + shopDiv.insertAdjacentHTML("beforeend",`

You have $${settings.survival.gold_coin||0}

`); + for (var element in survivalShop) { + var price = survivalShop[element]; + var button = document.createElement("button"); + var name = element; + var amount = 1; + if (element.indexOf("*") !== -1) { amount = parseInt(element.split("*")[1]); name = element.split("*")[0]; } + var elemname = name; + name = (elements[elemname].name||name).replace(/_/g, " ").replace("."," ").replace(/\w\S*/g, function(txt){return txt.charAt(0).toUpperCase() + txt.substr(1).toLowerCase();}).replace(" ",".").replace(/ /g, ""); + button.classList.add("elementButton"); + button.setAttribute("element",element); + button.setAttribute("category","shop"); + button.setAttribute("title",amount+" "+name+" for $"+price); + button.innerHTML = name+" ("+amount+" for $"+price+")"; + if (elements[elemname]) { + if (elements[elemname].color instanceof Array) { + button.style.backgroundImage = "linear-gradient(to bottom right, "+elements[elemname].color.join(", ")+")"; + // choose the middlemost item in array + var colorObject = elements[elemname].colorObject[Math.floor(elements[elemname].colorObject.length/2)]; + if (elements[elemname].darkText !== false && (elements[elemname].darkText || (colorObject.r+colorObject.g+colorObject.b)/3 > 200)) { + button.className += " bright" + } + } + else { + button.style.background = elements[elemname].color; + var colorObject = elements[elemname].colorObject; + if (elements[elemname].darkText !== false && (elements[elemname].darkText || (colorObject.r+colorObject.g+colorObject.b)/3 > 200)) { + button.className += " bright" + } + } + } + button.addEventListener("click",function(){ + survivalBuy(this.getAttribute("element")); + }); + shopDiv.appendChild(button); + } + shopDiv.insertAdjacentHTML("beforeend",`

`); }); runAfterLoad(function(){ checkUnlock = function(element) { @@ -287,16 +409,11 @@ runAfterLoad(function(){ if (survivalCount(currentElement) < 1 && elements[currentElement].category !== "tools") { return; } - if (elements[currentElement].category !== "tools") { survivalRemove(currentElement,1); } currentPixels.push(new Pixel(x, y, currentElement)); if (elements[currentElement].customColor || elements[currentElement].singleColor) { pixelMap[x][y].color = pixelColorPick(currentElement,currentColor); } - if (currentElementProp) { - for (var key in currentElementProp) { - pixelMap[x][y][key] = currentElementProp[key] - } - } + if (elements[currentElement].category !== "tools") { survivalRemove(currentElement,1); } } } if (currentElement == "mix") { From c94fc64b8e30dccff3197abae5a3990b02572637 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 13:11:32 -0500 Subject: [PATCH 19/53] Update survival.js --- mods/survival.js | 12 ++++++++++++ 1 file changed, 12 insertions(+) diff --git a/mods/survival.js b/mods/survival.js index 4ccccd72..0a2e214b 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -308,6 +308,18 @@ window.addEventListener("load",function(){ shopDiv.appendChild(button); } shopDiv.insertAdjacentHTML("beforeend",`

`); + + createCategoryDiv("prices"); + var pricesDiv = document.getElementById("category-prices"); + pricesDiv.style.display = "none"; + for (var element in elementWorth) { + var name = (elements[element].name||element).replace(/_/g, " ").replace("."," ").replace(/\w\S*/g, function(txt){return txt.charAt(0).toUpperCase() + txt.substr(1).toLowerCase();}).replace(" ","."); + // create text with the name of the element and its worth, separated by • + var text = name+"="+elementWorth[element] + " • "; + pricesDiv.insertAdjacentHTML("beforeend",`${text}`); + } + pricesDiv.innerHTML = pricesDiv.innerHTML.slice(0,-2); + pricesDiv.innerHTML = "

"+pricesDiv.innerHTML+"

"; }); runAfterLoad(function(){ checkUnlock = function(element) { From 0440d37a21b870b2c1cc134877d8e13036719f7f Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 13:14:59 -0500 Subject: [PATCH 20/53] Update survival.js --- mods/survival.js | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/mods/survival.js b/mods/survival.js index 0a2e214b..6ff7e339 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -235,7 +235,7 @@ survivalShop = { function survivalBuy(element) { var price = survivalShop[element]; if (!price) { alert("The shop isn't selling "+element+"!"); return } - if (settings.survival.gold_coin < price) { alert("You can't afford that!"); return } + if (!settings.survival.gold_coin || settings.survival.gold_coin < price) { alert("You can't afford that!"); return } survivalRemove("gold_coin",price); var amount = 1; if (element.indexOf("*") !== -1) { amount = parseInt(element.split("*")[1]); element = element.split("*")[0]; } @@ -243,7 +243,7 @@ function survivalBuy(element) { selectElement(element); } function survivalResetCloner() { - if (settings.survival.gold_coin < 1000) { alert("You can't afford that!"); return } + if (!settings.survival.gold_coin || settings.survival.gold_coin < 1000) { alert("You can't afford that!"); return } survivalRemove("gold_coin",1000); settings.survivalClone = null; survivalSave(); From 4b663406993cf8adaf5cb6ddd4abeca35c061cf5 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 13:16:54 -0500 Subject: [PATCH 21/53] Update survival.js --- mods/survival.js | 1 + 1 file changed, 1 insertion(+) diff --git a/mods/survival.js b/mods/survival.js index 6ff7e339..e7010657 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -313,6 +313,7 @@ window.addEventListener("load",function(){ var pricesDiv = document.getElementById("category-prices"); pricesDiv.style.display = "none"; for (var element in elementWorth) { + if (elementWorth[element] <= 0) { continue } var name = (elements[element].name||element).replace(/_/g, " ").replace("."," ").replace(/\w\S*/g, function(txt){return txt.charAt(0).toUpperCase() + txt.substr(1).toLowerCase();}).replace(" ","."); // create text with the name of the element and its worth, separated by • var text = name+"="+elementWorth[element] + " • "; From 19eff2e9babd56b0cf18f6477365ba32dfd29056 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 14:08:15 -0500 Subject: [PATCH 22/53] Update survival.js --- mods/survival.js | 6 ++++-- 1 file changed, 4 insertions(+), 2 deletions(-) diff --git a/mods/survival.js b/mods/survival.js index e7010657..195aa814 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -71,6 +71,7 @@ runAfterAutogen(function(){ delete elements.paint.category; delete elements.lookup.category; delete elements.pick; + delete elements.prop; elements.radiation.category = "tools"; for (var element in elements) { if (elements[element].category !== "tools") { @@ -114,7 +115,7 @@ elements.cloner.tick = function(pixel) { } } }; -elements.cloner.ignore = elements.cloner.ignore.concat(["gold","gold_coin","molten_gold"]); +elements.cloner.ignore = elements.cloner.ignore.concat(["gold","gold_coin","molten_gold","sun","supernova"]); elements.cloner.desc = "You can only clone one element at a time!" elements.smash.tool = function(pixel) { @@ -123,7 +124,7 @@ elements.smash.tool = function(pixel) { // times 0.25 if not shiftDown else 1 if (Math.random() < (elements[pixel.element].hardness || 1) * (shiftDown ? 1 : 0.25)) { var breakInto = elements[pixel.element].breakInto; - if (elements[pixel.element].seed) { + if (elements[pixel.element].seed && (!breakInto || Math.random() < 0.5)) { if (Math.random() < 0.2) { breakInto = elements[pixel.element].seed; } @@ -181,6 +182,7 @@ elementWorth = { "fire": 0, "smoke": 0, "plasma": 0, + "light": 0, "petal": -1, "cell": -1, "cancer": -1, From ce7974b2d7f7f1e081ecf7d85bba36403cd975c7 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 14:09:08 -0500 Subject: [PATCH 23/53] Update survival.js --- mods/survival.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/mods/survival.js b/mods/survival.js index 195aa814..d23b2039 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -232,7 +232,7 @@ survivalShop = { "bee*1": 5000, "primordial_soup*5": 10000, "human*1": 50000, - "sun*25": 500000, + "sun*1": 500000, } function survivalBuy(element) { var price = survivalShop[element]; From a71cc0c237ef29ec5ec4893f0787fa1488fe7cc5 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 14:11:30 -0500 Subject: [PATCH 24/53] Update survival.js --- mods/survival.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/mods/survival.js b/mods/survival.js index d23b2039..933a2dae 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -152,7 +152,7 @@ elements.smash.tool = function(pixel) { elementWorth = { "gold_coin": 1, - "diamond": 100, + "diamond": 50, "ketchup": 15, "jelly": 10, "soda": 10, From ad597c16c0e51a62a681e6f67ede435f881652b5 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 14:22:07 -0500 Subject: [PATCH 25/53] Update survival.js --- mods/survival.js | 7 +++++-- 1 file changed, 5 insertions(+), 2 deletions(-) diff --git a/mods/survival.js b/mods/survival.js index 933a2dae..2667769a 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -115,7 +115,7 @@ elements.cloner.tick = function(pixel) { } } }; -elements.cloner.ignore = elements.cloner.ignore.concat(["gold","gold_coin","molten_gold","sun","supernova"]); +elements.cloner.ignore = elements.cloner.ignore.concat(["gold","gold_coin","molten_gold","sun","supernova","diamond"]); elements.cloner.desc = "You can only clone one element at a time!" elements.smash.tool = function(pixel) { @@ -152,7 +152,7 @@ elements.smash.tool = function(pixel) { elementWorth = { "gold_coin": 1, - "diamond": 50, + "diamond": 100, "ketchup": 15, "jelly": 10, "soda": 10, @@ -183,6 +183,9 @@ elementWorth = { "smoke": 0, "plasma": 0, "light": 0, + "laser": 0, + "liquid_light": 0.1, + "flash": 0, "petal": -1, "cell": -1, "cancer": -1, From c2069456801fcc7e8d90df03cdc313566e23c6c8 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 14:23:11 -0500 Subject: [PATCH 26/53] Update mod-list.html --- mod-list.html | 1 + 1 file changed, 1 insertion(+) diff --git a/mod-list.html b/mod-list.html index 45665bb6..ec35b37d 100644 --- a/mod-list.html +++ b/mod-list.html @@ -112,6 +112,7 @@ fools.jsAdds back FOOLS ModeR74n smooth_water.jsChanges water mechanics so that it flows in one direction until it bounces off of somethingR74n spring.jsMany nature elements, like sakura trees, butterflies, beehives, and moreR74n +survival.jsWith limited resources, you must craft, sell, and buy to progressR74n velocity.jsBeta for explosion velocity, and later wind, which may come to the base game in the futureR74n Tools & Settings From 76c8e9640f0b0a7514319e930bedbf574f0e9aa8 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 14:50:36 -0500 Subject: [PATCH 27/53] Update survival.js --- mods/survival.js | 4 +++- 1 file changed, 3 insertions(+), 1 deletion(-) diff --git a/mods/survival.js b/mods/survival.js index 2667769a..d8f50944 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -164,8 +164,9 @@ elementWorth = { "rad_shard": 3, "paper": 5, "broth": 5, - "sap": 5, + "honey": 5, "caramel": 5, + "sap": 4, "candy": 5, "popcorn": 2, "flour": 2, @@ -189,6 +190,7 @@ elementWorth = { "petal": -1, "cell": -1, "cancer": -1, + "foam": -1, } elements.sell = { color: ["#fff0b5","#ffe680","#c48821","#986a1a","#eca832","#f0bb62"], From fe4be34bbab27689cb66334161b55b112713e77f Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 15:17:37 -0500 Subject: [PATCH 28/53] Update survival.js --- mods/survival.js | 1 + 1 file changed, 1 insertion(+) diff --git a/mods/survival.js b/mods/survival.js index d8f50944..bbbdef5b 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -187,6 +187,7 @@ elementWorth = { "laser": 0, "liquid_light": 0.1, "flash": 0, + "radiation": 0, "petal": -1, "cell": -1, "cancer": -1, From 1df88511643783a621233622e7a982067e369498 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 15:25:25 -0500 Subject: [PATCH 29/53] Update survival.js --- mods/survival.js | 1 + 1 file changed, 1 insertion(+) diff --git a/mods/survival.js b/mods/survival.js index bbbdef5b..caedb84e 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -178,6 +178,7 @@ elementWorth = { "mushroom_cap": 0.1, "mushroom_gill": 0.3, "vine": 0.1, + "cactus": 0.1, "cloner": 0, "wall": 0, "fire": 0, From f340b0bed9f276e1af635ef6ea102da0bffeada1 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Sun, 11 Feb 2024 18:03:08 -0500 Subject: [PATCH 30/53] Update survival.js --- mods/survival.js | 1 + 1 file changed, 1 insertion(+) diff --git a/mods/survival.js b/mods/survival.js index caedb84e..3cc1949a 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -157,6 +157,7 @@ elementWorth = { "jelly": 10, "soda": 10, "toast": 10, + "oil": 10, "bread": 3, "glass": 5, "rad_glass": 6, From c989118971b98b03fdc20c147f1ea76a1de5ad34 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Mon, 12 Feb 2024 17:05:26 -0500 Subject: [PATCH 31/53] Update survival.js --- mods/survival.js | 2 ++ 1 file changed, 2 insertions(+) diff --git a/mods/survival.js b/mods/survival.js index 3cc1949a..b8970545 100644 --- a/mods/survival.js +++ b/mods/survival.js @@ -259,6 +259,7 @@ function survivalResetCloner() { survivalSave(); } +worldgentypes = {} window.addEventListener("load",function(){ // move to start of tools var erase = document.getElementById("elementButton-erase"); @@ -273,6 +274,7 @@ window.addEventListener("load",function(){ document.getElementById("elemSelectButton").remove(); doRandomEvents = function() {} worldGen = function() {} + worldgentypes = {} loadSave = function() {} showSaves = function() {} placeImage = function() {} From 650bfcdaaed1bf415fc65f13eb2da4d2c28a860e Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Mon, 12 Feb 2024 21:37:18 -0500 Subject: [PATCH 32/53] test --- index.html | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/index.html b/index.html index 3138d1b4..c1f843c9 100644 --- a/index.html +++ b/index.html @@ -14445,7 +14445,7 @@ for (var k = 0; k < b0.split(" AND ").length; k++) { function loadFromFile() { var input = document.createElement("input"); input.type = "file"; - input.accept = ".sbxls,.json,.txt,text/*,application/json"; + // input.accept = ".sbxls,.json,.txt,text/*,application/json"; input.addEventListener("change", function(e) { var file = e.target.files[0]; var reader = new FileReader(); From aee4b2444cc9f5156a662698ef48b01392b51b1f Mon Sep 17 00:00:00 2001 From: An Orbit <68935009+orbit-loona@users.noreply.github.com> Date: Tue, 13 Feb 2024 12:36:42 -0500 Subject: [PATCH 33/53] important bugfix fix save not including pixelTicks --- mods/save_loading.js | 2 ++ 1 file changed, 2 insertions(+) diff --git a/mods/save_loading.js b/mods/save_loading.js index 8fcab069..5f5dad74 100644 --- a/mods/save_loading.js +++ b/mods/save_loading.js @@ -69,6 +69,7 @@ try { width: width, height: height, pixelSize: pixelSize, + pixelTicks: pixelTicks, settings: settings, version: 1, enabledMods: localStorage.enabledMods, @@ -322,6 +323,7 @@ try { width = json.width; height = json.height; pixelSize = json.pixelSize; + pixelTicks = (json.pixelTicks ?? 0); //currentPixels = json.currentPixels; for(i = 0; i < json.pixelMap.length; i++) { json.pixelMap[i] = json.pixelMap[i].map(x => zeroToNull(x)); From a80db8fb8cd0d947c45d0ed5f801b4acebf58480 Mon Sep 17 00:00:00 2001 From: sb <155691462+stefanblox@users.noreply.github.com> Date: Tue, 13 Feb 2024 16:12:16 -0300 Subject: [PATCH 34/53] single color update 1 line mod holy piss --- mods/singleColor.js | 4 +--- 1 file changed, 1 insertion(+), 3 deletions(-) diff --git a/mods/singleColor.js b/mods/singleColor.js index 7d6e23a4..0fc8d32b 100644 --- a/mods/singleColor.js +++ b/mods/singleColor.js @@ -1,3 +1 @@ -for (var element in elements) { - elements[element].singleColor = true; -} \ No newline at end of file +window.addEventListener('load', function() {for (var element in elements) {elements[element].singleColor = true;}}); From 4e32e3774b754f20bcb46a751e4d3dbc2475d604 Mon Sep 17 00:00:00 2001 From: An Orbit <68935009+orbit-loona@users.noreply.github.com> Date: Tue, 13 Feb 2024 14:56:28 -0500 Subject: [PATCH 35/53] fix tsunami velocity --- mods/a_mod_by_alice.js | 14 +++++++------- 1 file changed, 7 insertions(+), 7 deletions(-) diff --git a/mods/a_mod_by_alice.js b/mods/a_mod_by_alice.js index 804e1714..873f89a3 100644 --- a/mods/a_mod_by_alice.js +++ b/mods/a_mod_by_alice.js @@ -2136,9 +2136,9 @@ try { }; }; - function capitalizeFirstLetter(string,locale=null) { - return string[0][locale ? "toLocaleUpperCase" : "toUpperCase"](locale) + string.slice(1) - }; + function capitalizeFirstLetter(string,locale=null) { + return string[0][locale ? "toLocaleUpperCase" : "toUpperCase"](locale) + string.slice(1) + }; //COLOR MANIPULATION TOOLS ## @@ -36321,7 +36321,7 @@ Make sure to save your command in a file if you want to add this preset again.` newPixel.vx ??= 0; newPixel.vy ??= 0; newPixel.vx += (pixel.direction * 5) - newPixel.vy += 3; + newPixel.vy -= 3; }; }; pixel.fromX += pixel.direction @@ -36406,7 +36406,7 @@ Make sure to save your command in a file if you want to add this preset again.` newPixel.vx ??= 0; newPixel.vy ??= 0; newPixel.vx += (pixel.direction * 13) - newPixel.vy += 6; + newPixel.vy -= 6; }; }; pixel.fromX += pixel.direction @@ -36503,7 +36503,7 @@ Make sure to save your command in a file if you want to add this preset again.` newPixel.vx ??= 0; newPixel.vy ??= 0; newPixel.vx += (pixel.direction * 6) - newPixel.vy += 3; + newPixel.vy -= 3; }; }; pixel.fromX += pixel.direction @@ -36598,7 +36598,7 @@ Make sure to save your command in a file if you want to add this preset again.` newPixel.vx ??= 0; newPixel.vy ??= 0; newPixel.vx += (pixel.direction * 8) - newPixel.vy += 5; + newPixel.vy -= 5; }; }; pixel.fromX += pixel.direction From bc362d38fdaf9a10c689ab6e2faf8b167d4c52c7 Mon Sep 17 00:00:00 2001 From: sb <155691462+stefanblox@users.noreply.github.com> Date: Tue, 13 Feb 2024 21:10:45 -0300 Subject: [PATCH 36/53] sbstuff 2.6 --- mods/sbstuff.js | 98 +++++++++++++++++++++++++++++++++++++++++-------- 1 file changed, 82 insertions(+), 16 deletions(-) diff --git a/mods/sbstuff.js b/mods/sbstuff.js index 596e6999..bf7f4d1e 100644 --- a/mods/sbstuff.js +++ b/mods/sbstuff.js @@ -192,6 +192,8 @@ elements.green_berries = { elements.meth = { hardness: 1, tempHigh: 500, + tempLow: -50, + stateLowColorMultiplier: 0.9, stateHigh: "melted_meth", color: "#0affef", behavior: behaviors.POWDER, @@ -199,6 +201,18 @@ elements.meth = { state: "liquid" }; +elements.melted_meth = { + viscosity: 1000, + tempHigh: 100000, + tempLow: -20, + stateHigh: "beans", + stateLow: "meth", + color: "#00a2ff", + behavior: behaviors.LIQUID, + category: "joke", + state: "solid", +}; + elements.garlic = { isFood: true, tempHigh: 500, @@ -217,7 +231,7 @@ elements.garlic_bread = { breakInto: "crumb", tempHigh: 500, stateHigh: "ash", - color: ["#db9b56", "#288a0c", "#db9b56", "#db9b56", "#db9b56", "#db9b56"], + color: ["#e9be90", "#288a0c", "#e0c6aa", "#b49e85", "#b6926b", "#ccac8b"], behavior: behaviors.STURDYPOWDER, category: "food", state: "solid", @@ -249,6 +263,8 @@ elements.lemon = { elements.lemonade = { isFood: true, tempHigh: 500, + tempLow: -15, + tempLowColor: "#f8eb35", stateHigh: "steam", color: "#fff41c", behavior: behaviors.LIQUID, @@ -269,6 +285,18 @@ elements.poop = { } }; +elements.diarrhea = { + hardness: 1, + viscosity: 10000, + tempHigh: 500, + stateHigh: ["ash", "ash", "ash", "ash", "ash", "ash", "ash", "steam",], + color: "#523718", + behavior: behaviors.LIQUID, + category: "joke", + state: "solid", + desc: "riddle me this, libshart, if theres liquid poop then wheres the solid piss?" +}; + elements.marshmallow = { isFood: true, tempHigh: 50, @@ -355,6 +383,7 @@ elements.diamond_ore = { elements.coca_cola = { isFood: true, tempHigh: 500, + tempLow: -10, stateHigh: "steam", color: "#381e13", behavior: behaviors.LIQUID, @@ -365,6 +394,7 @@ elements.coca_cola = { elements.pepsi = { tempHigh: 500, stateHigh: "steam", + tempLow: -10, color: "#2b1717", behavior: behaviors.LIQUID, category: "liquids", @@ -374,6 +404,7 @@ elements.pepsi = { elements.piss = { tempHigh: 500, stateHigh: "steam", + tempLow: -10, color: "#ffff00", behavior: behaviors.LIQUID, category: "joke", @@ -405,17 +436,10 @@ elements.pastry = { state: "solid", }; -elements.melted_meth = { - tempHigh: 100000, - stateHigh: "beans", - color: "#00a2ff", - behavior: behaviors.LIQUID, - category: "joke", - state: "solid", -}; -elements.expired_milk = { +elements.spoiled_milk = { tempHigh: 500, + tempLow: -20, stateHigh: "ash", color: "#b8c2b4", behavior: behaviors.LIQUID, @@ -523,6 +547,8 @@ elements.mashed_pea = { elements.burnt_beans = { tempHigh: 500, stateHigh: "ash", + tempLow: -0, + stateLow: "beans", isFood: true, viscosity: 10000, density: 721, @@ -801,6 +827,7 @@ elements.barbecue_sauce = { viscosity: 3000, density: 1800, tempHigh: 500, + tempLow: 0, stateHigh: "steam", color: "#420400", behavior: behaviors.LIQUID, @@ -907,6 +934,7 @@ elements.porridge = { viscosity: 3000, density: 500, tempHigh: 500, + tempLow: -10, stateHigh: "steam", color: "#b8a254", behavior: behaviors.LIQUID, @@ -938,7 +966,7 @@ elements.chocolate_grape = { viscosity: 10000, tempHigh: 300, stateHigh: "steam", - color: ["#9e3475", "#6e4d36"], + color: ["#7e600d", "#6e4d36"], behavior: behaviors.LIQUID, category: "food", state: "liquid", @@ -949,7 +977,7 @@ elements.sprinkles = { stateHigh: "ash", cooldown: 0.2, color: ["#ff5e5e", "#ffea5e", "#73ff5e", "#5efcff", "#995eff", "#ff5ed1"], - behavior: behaviors.STURDYPOWDER, + behavior: behaviors.POWDER, category: "powders", state: "liquid", maxSize: 1, @@ -965,6 +993,7 @@ elements.incinerator = { category: "machines", state: "solid", insulate: true, + excludeRandom: true, reactions: { "fart": { elem1: null, elem2: "ohio" }, } @@ -1113,6 +1142,7 @@ elements.strawberry = { elements.beer = { tempHigh: 300, stateHigh: "steam", + tempLow: -10, color: "#b39329", behavior: behaviors.LIQUID, category: "liquids", @@ -1140,8 +1170,10 @@ elements.carrot = { }; elements.wine = { + hidden: true, tempHigh: 400, stateHigh: "steam", + tempLow: -10, color: "#2e0206", behavior: behaviors.LIQUID, category: "liquids", @@ -1173,6 +1205,7 @@ elements.dark_energy = { ], category: "special", state: "gas", + excludeRandom: true }; elements.ohio = { @@ -1189,6 +1222,7 @@ elements.ohio = { category: "joke", state: "gas", desc: "use at own risk", + excludeRandom: true }; elements.papaya = { @@ -1279,6 +1313,9 @@ elements.heavy_water = { behavior: behaviors.LIQUID_OLD, category: "liquids", state: "liquid", + reactions: { + "sand": { elem1: null, elem2: "quicksand" }, + } }; elements.blood_orange = { @@ -1308,6 +1345,7 @@ elements.cranberry = { hidden: true, tempHigh: 300, stateHigh: "steam", + tempLow: -15, color: "#ad2a1d", behavior: behaviors.LIQUID, category: "food", @@ -1441,6 +1479,7 @@ elements.uraniumaniumaniumaniumanium_popcornicecream_plutoniumeptunium_238239 = elements.coffee_milk = { tempHigh: 300, stateHigh: "steam", + tempLow: -30, color: "#5c4c42", behavior: behaviors.LIQUID, category: "liquids", @@ -1565,6 +1604,7 @@ elements.electron = { }; elements.sned = { + desc: "slowly expanding...", color: "#dfe0d9", behavior: [ "XX|XX AND CR:sned%1|XX", @@ -1580,7 +1620,7 @@ elements.uranium_tea = { temp: 60, tempHigh: 400, stateHigh: "molten_uranium", - color: ["#0f8b15", "#316624", "#59864b", "#502e0f"], + color: ["#526306", "#40530c", "#80320e", "#502e0f"], behavior: behaviors.RADLIQUID, category: "liquids", state: "liquid" @@ -1598,19 +1638,19 @@ elements.powerlaser = { if (Math.random() > 0.05) { continue } createPixel("flash", x, y); pixelMap[x][y].color = "#b80ced"; - pixelMap[x][y].temp = 1001000; + pixelMap[x][y].temp = 11000; } else { if (elements[pixelMap[x][y].element].isGas) { continue } if (elements[pixelMap[x][y].element].id === elements.heat_ray.id) { break } - pixelMap[x][y].temp += 901000; + pixelMap[x][y].temp += 9000; pixelTempCheck(pixelMap[x][y]); break; } } deletePixel(pixel.x, pixel.y); }, - temp: 1000000, + temp: 10000, category: "energy", state: "gas", excludeRandom: true, @@ -1629,6 +1669,29 @@ elements.magma_bomb = { state: "liquid" }; +elements.quicksand = { + viscosity: 10000, + tempHigh: 1000, + stateHigh: ["molten_glass", "molten_glass", "molten_glass", "molten_glass", "steam"], + color: ["#b1873a", "#cea250"], + behavior: behaviors.LIQUID, + category: "land", + state: "liquid", + density: 1400, + stain: 0.02 +}; + +elements.liquid_filler = { + color: "#ae00ff", + behavior: [ + "XX|XX AND CR:liquid_filler%50|XX", + "M2 AND CR:liquid_filler%50|XX|M2 AND CR:liquid_filler%50", + "M1|M1 AND CH:liquid_filler%50|M1", + ], + category: "special", + state: "liquid" +}; + elements.incinerate.category = "tools", elements.cook.category = "tools", elements.room_temp.category = "tools", @@ -1663,6 +1726,9 @@ elements.potato.reactions.steam = {elem1: "fries", tempMin: 100, chance:50} if (!elements.water.reactions) elements.water.reactions = {}; elements.water.reactions.cocaine = { elem1: "solid_water", elem2: null } +if (!elements.alcohol.reactions) elements.alcohol.reactions = {}; +elements.alcohol.reactions.juice = {elem1:"wine", elem2:null, chance:5} + if (!elements.paper.reactions) elements.paper.reactions = {}; elements.paper.reactions.bless = { elem1: "robux", elem2: null, chance: 0.0000001 } From 7e33e67763e8108260df3544d36180710ee74ad6 Mon Sep 17 00:00:00 2001 From: SquareScreamYT <134925668+SquareScreamYT@users.noreply.github.com> Date: Wed, 14 Feb 2024 16:57:12 +0800 Subject: [PATCH 37/53] Meese lol --- mods/meese.js | 38 ++++++++++++++++++++++++++++++++++++++ 1 file changed, 38 insertions(+) create mode 100644 mods/meese.js diff --git a/mods/meese.js b/mods/meese.js new file mode 100644 index 00000000..d3bb3f6e --- /dev/null +++ b/mods/meese.js @@ -0,0 +1,38 @@ +// made by squarescreamyt + +elements.meese = { + color: "#6e4526", + state: "solid", + behavior: [ + "M2%1|M2%2|M2%1", + "M2%10|XX|M2%10", + "XX|M1|XX", + ], + reactions: { + "grass": { elem2:null, chance:0.2, func:behaviors.FEEDPIXEL }, + "plant": { elem2:null, chance:0.2, func:behaviors.FEEDPIXEL }, + "oxygen": { elem2:"carbon_dioxide", chance:0.3 }, + "mercury": { elem1:"rotten_meat", chance:0.1 }, + "bleach": { elem1:"rotten_meat", chance:0.1 }, + "infection": { elem1:"rotten_meat", chance:0.025 }, + "uranium": { elem1:"rotten_meat", chance:0.1 }, + "cyanide": { elem1:"rotten_meat", chance:0.1 }, + "chlorine": { elem1:"meat", chance:0.1 }, + "alcohol": { elem1:"meat", chance:0.025 }, + "dirty_water": { elem1:"rotten_meat", chance:0.0001 }, + }, + egg: "meese", + foodNeed: 10, + temp: 30, + tempHigh: 100, + stateHigh: "cooked_meat", + tempLow: -18, + stateLow: "frozen_meat", + category:"life", + breakInto: "rotten_meat", + burn:15, + burnTime:300, + state: "solid", + density: 1450, + conduct: 0.2 +}; From 91322418bce88eabcc2f2ad2483bf4802a4eaf15 Mon Sep 17 00:00:00 2001 From: SquareScreamYT <134925668+SquareScreamYT@users.noreply.github.com> Date: Thu, 15 Feb 2024 20:07:07 +0800 Subject: [PATCH 38/53] A Chef's Dream 1.7! --- mods/aChefsDream.js | 729 +++++++++++++++++++++++++++++++++++++++++++- 1 file changed, 718 insertions(+), 11 deletions(-) diff --git a/mods/aChefsDream.js b/mods/aChefsDream.js index 09ac248d..588fa84f 100644 --- a/mods/aChefsDream.js +++ b/mods/aChefsDream.js @@ -1,19 +1,33 @@ /* -Created by SquareScreamYT and RealerRaddler -Thanks to Alice, nousernamefound and Fioushemastor for helping :) +Created by SquareScreamYT <@918475812884344852> and RealerRaddler <@914371295561535508> +Thanks to Alice <@697799964985786450>, nousernamefound <@316383921346707468>, Adora the Transfem <@778753696804765696> and Fioushemastor <@738828785482203189> for helping :) + +v1.6 + +me trying to come up with stuff not in plants.js: Upcoming Features: - onions - spring onions - soy sauce -- rice +- rice and porridge (white rice noodles) - seaweed and agar - pigs, ham and bacon - garlic - msg - stainless steel - -v1.5 +- chili +- pepper plants +- pineapples +- mint +- vanilla +- cocoa beans and hot chocolate +- normal cookies and cookie dough +- cows and beef +- mangoes and passionfruits +- celery +- marshmallows, normal, cooked and burnt +- broccoli Changelog (v1.0) - added chickens @@ -218,6 +232,22 @@ Changelog (v1.5) - added cookies and cookie dough - replaced cooking oil with nut oil - added boba and boba dough + + + +Changelog (v1.6) + - added freeze and warm tool + - added olive seeds + - juice mixing functionality + - wine can now be made by mixing grape juice and alcohol + - added bananas and related stuff + - bananas + - hanging banana peduncle and banana peduncle + - banana stem and banana stem top + - banana leaves + - cut banana + - banana juice + - banana bread */ /* @@ -227,6 +257,19 @@ elements.test = { } */ +function interpolateRgb(rgb1, rgb2, ratio) { + const interpolatedRgb = { + r: Math.round(rgb1.r + (rgb2.r - rgb1.r) * ratio), + g: Math.round(rgb1.g + (rgb2.g - rgb1.g) * ratio), + b: Math.round(rgb1.b + (rgb2.b - rgb1.b) * ratio), + }; + return interpolatedRgb; +} +function getRGB(rgb){ + let rgb2 = rgb.replace(")", "").replace("rgb(", "").replace(/,/g, "r").split("r") + return { r: parseInt(rgb2[0]), g: parseInt(rgb2[1]), b: parseInt(rgb2[2]) }; + } + elements.knife = { color: "#adb5bd", // other needed properties @@ -245,6 +288,8 @@ elements.knife = { desc: "Use on pixels to cut them, if possible." } +eLists.JUICEMIXABLE = ["juice"]; + elements.chicken = { color: ["#c29046", "#f5d271", "#d4bd7d"], behavior: [ @@ -717,6 +762,53 @@ elements.olive = { density: 1050, isFood: false } + +elements.olive_seed = { + color: "#854610", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "olive_wood" : "olive_branch",pixel.x,pixel.y+1); + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"olive_wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0 + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, + behavior: [ + "XX|XX|XX", + "XX|FX%10|XX", + "XX|M1|XX", + ], +}; /* elements.cooking_oil = { color: "#ffc844", @@ -951,12 +1043,21 @@ elements.apple_juice = { density: 825, hidden: true, temp: 30, + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#ffde55") + } + } + }, reactions: { "sugar": { elem1:"apple_jam", elem2:null, chance:0.35 }, "yeast": { elem1:"apple_cider_vinegar", elem2:null, chance:0.35 } }, tempLow: 0 }; +eLists.JUICEMIXABLE.push("apple_juice"); elements.apple_jam = { color: "#ebc034", @@ -1251,6 +1352,14 @@ elements.orange_seed = { elements.orange_juice = { color: "#ffb326", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#ffde55") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -1264,6 +1373,7 @@ elements.orange_juice = { temp: 30, tempLow: 0 }; +eLists.JUICEMIXABLE.push("orange_juice"); elements.orange_peels = { color: "#d69c31", @@ -1708,6 +1818,14 @@ elements.watermelon_flesh = { elements.watermelon_juice = { color: "#eb4034", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#eb4034") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -1721,6 +1839,7 @@ elements.watermelon_juice = { temp: 30, tempLow: 0 }; +eLists.JUICEMIXABLE.push("watermelon_juice"); elements.grape = { color: ["#b84b65","#a10e69","#a10e95","#8a3eab"], @@ -1755,6 +1874,14 @@ elements.grape = { elements.grape_juice = { color: "#6d2282", behavior: behaviors.LIQUID, + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel, "#6d2282") + } + } + }, reactions: { "dirt": { elem1: null, elem2: "mud" }, "sand": { elem1: null, elem2: "wet_sand" }, @@ -1762,6 +1889,7 @@ elements.grape_juice = { "seltzer": { elem1: "soda", elem2: "foam" }, "carbon_dioxide": { elem1: "soda", elem2: "foam" }, "milk": { elem1: "fruit_milk", elem2: "fruit_milk" }, + "alcohol": { elem1: "wine", elem2: "wine" }, "yeast": { elem1: ["wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","wine","cream_of_tartar"], elem2: null, chance:80 }, }, tempHigh: 160, @@ -1774,6 +1902,7 @@ elements.grape_juice = { hidden: true, isFood: true }; +eLists.JUICEMIXABLE.push("grape_juice"); elements.cream_of_tartar = { color: ["#EFEFEF", "#EBEBEB", "#D8D8D6"], @@ -1817,6 +1946,14 @@ elements.wine = { behavior: behaviors.LIQUID, category: "liquids", state: "liquid", + /*onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel, "#6D0112") + } + } + },*/ tempHigh: 100, stateHigh: "steam", isFood: true, @@ -1824,6 +1961,7 @@ elements.wine = { hidden: true, tempLow: 0 } +//eLists.JUICEMIXABLE.push("wine"); elements.shrimp = { color: ["#EE5422", "#E9683C", "#F3583F", "#EDA270"], @@ -2118,6 +2256,14 @@ elements.cut_coconut = { elements.coconut_juice = { color: "#e9ebe4", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#e9ebe4") + } + } + }, behavior: behaviors.LIQUID, reactions: { "dirt": { elem1: null, elem2: "mud" }, @@ -2135,6 +2281,7 @@ elements.coconut_juice = { hidden: true, isFood: true } +eLists.JUICEMIXABLE.push("coconut_juice"); elements.lemon_wood = { color: "#786531", @@ -2224,6 +2371,14 @@ elements.lemon = { elements.lemon_juice = { color: "#e0d358", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#e0d358") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -2241,9 +2396,18 @@ elements.lemon_juice = { "sugar": {elem1:"lemonade", elem2: "null", chance:0.35} } }; +eLists.JUICEMIXABLE.push("lemon_juice"); elements.lemonade = { color: "#fff378", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#fff378") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -2259,6 +2423,8 @@ elements.lemonade = { tempLow: 0 }; +eLists.JUICEMIXABLE.push("lemonade"); + elements.lemon_zest = { color: "#dbc535", behavior: behaviors.POWDER, @@ -2444,6 +2610,14 @@ elements.carrot = { elements.carrot_juice = { color: "#f5a742", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#f5a742") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -2457,9 +2631,18 @@ elements.carrot_juice = { hidden: true, temp: 30, }; +eLists.JUICEMIXABLE.push("carrot_juice"); elements.apple_cider_vinegar = { color: "#fffe75", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#fffe75") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -2473,6 +2656,7 @@ elements.apple_cider_vinegar = { temp: 30, tempLow: 0 }; +eLists.JUICEMIXABLE.push("apple_cider_vinegar"); elements.turnip_seed = { color: "#994828", @@ -2593,6 +2777,14 @@ elements.turnip = { elements.turnip_juice = { color: "#700f5d", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#700f5d") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -2606,6 +2798,7 @@ elements.turnip_juice = { hidden: true, temp: 30, }; +eLists.JUICEMIXABLE.push("turnip_juice"); elements.corn = { color: ["#f8d223","#d6ba2a","#f7f5ba","#dbd281","#cdb12d"], @@ -2644,8 +2837,8 @@ elements.corn_starch = { "seltzer": { elem1: "dough", elem2: null }, "pool_water": { elem1: "dough", elem2: null }, "juice": { elem1: "dough", elem2: null }, - "yolk": { elem1: "batter", elem2: null }, - "yogurt": { elem1: "batter", elem2: null }, + "yolk": { elem1: "cookie_dough", elem2: null, color1:"#dbd19a" }, + "yogurt": { elem1: "cookie_dough", elem2: null, color1:"#dbd19a" }, "broth": { elem1:"dough", elem2:null }, "soda": { elem1:"dough", elem2:null }, "tea": { elem1:"dough", elem2:null }, @@ -2941,6 +3134,14 @@ elements.strawberry = { } elements.strawberry_juice = { color: "#e03a3a", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#e03a3a") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -2957,6 +3158,7 @@ elements.strawberry_juice = { "sugar": { elem1:"strawberry_jam", elem2:null, chance:0.35 }, }, }; +eLists.JUICEMIXABLE.push("strawberry_juice"); elements.cream = { color: "#f7f7f7", @@ -3152,6 +3354,14 @@ elements.ginger_leaves = { } elements.ginger_juice = { color: "#ccc056", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#ccc056") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -3169,6 +3379,7 @@ elements.ginger_juice = { "bread": { elem1:"gingerbread", elem2:null }, }, }; +eLists.JUICEMIXABLE.push("ginger_juice"); elements.blueberry_seed = { @@ -3314,6 +3525,14 @@ elements.blueberry = { } elements.blueberry_juice = { color: "#5030a1", + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#5030a1") + } + } + }, behavior: behaviors.LIQUID, category: "liquids", tempHigh: 100, @@ -3331,6 +3550,8 @@ elements.blueberry_juice = { "milk": { elem1:"fruit_milk", elem2:null, chance:0.35, color1: "#995fb3" }, }, }; + +eLists.JUICEMIXABLE.push("blueberry_juice"); /* elements.fruit_slushie = { color: "#ffcc54", @@ -3399,7 +3620,8 @@ elements.cut_blueberry = { burn:15, burnTime:60, burnInto: "dead_plant", - breakInto: "blueberry_juice", + breakInto: "juice", + breakIntoColor:"#add69a", state: "solid", density: 1050, hidden: true @@ -3437,7 +3659,7 @@ elements.cookie_dough = { category: "food", tempHigh: 94, stateHigh: "cookie", - stateHighColorMultiplier: 0.8, + stateHighColorMultiplier: 1.1, burn:40, burnTime:25, burnInto:"ash", @@ -3465,7 +3687,7 @@ elements.cookie = { elements.nut_oil.name = "cooking_oil" -// elements.fire.temp = 130 +elements.fire.temp = 130 elements.bread.behavior = behaviors.SUPPORT @@ -3504,6 +3726,491 @@ elements.boba = { burnInto: ["smoke","smoke","smoke","ash"], breakIntoColor: "#7d6216", state: "solid", - density: 644, + density: 1500, + isFood: true +} +elements.caramel.density = 1500 +elements.freeze = { + color: ["#42cbf5", "#42cbf5", "#42cbf5", "#75d3f0", "#42cbf5"], + tool: function (pixel) { + if (!shiftDown) { + pixel.temp -= 0.2; + pixelTempCheck(pixel); + } else { + pixel.temp -= 200; + pixelTempCheck(pixel); + } + }, + category: "energy", + canPlace: false, + excludeRandom: true, + desc: "Use on pixels to freeze them." +}; +elements.warm = { + color: ["#c7634a", "#c7634a", "#c7634a", "#e38f7b", "#c7634a"], + tool: function (pixel) { + if (!shiftDown) { + pixel.temp += 0.2; + pixelTempCheck(pixel); + } else { + pixel.temp += 200; + pixelTempCheck(pixel); + } + }, + category: "energy", + canPlace: false, + excludeRandom: true, + desc: "Use on pixels to warm them." +}; +/* +elements.pineapple_seed = { + color: "#695531", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (pixel.temp < 100 && pixel.temp > 20) { + if (Math.random() < 0.02 && pixel.age > 50) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + pixel.leaflength = pixel.leaflength+Math.round(Math.random()) + } + } + if (isEmpty(pixel.x,pixel.y-1) && pixel.leafgrown==false) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel("pineapple_leaves",pixel.x,pixel.y+1); + if (isEmpty(pixel.x,pixel.y-1)) { + createPixel("pineapple",pixel.x,pixel.y-1); + } + if (isEmpty(pixel.x+1,pixel.y) && Math.random() < 0.5) { + createPixel("pineapple_leaves",pixel.x+1,pixel.y); + if (isEmpty(pixel.x+2,pixel.y-1) && Math.random() < 0.5) { + createPixel("pineapple_leaves",pixel.x+2,pixel.y-1); + if (pixel.leaflength == 4 && isEmpty(pixel.x+3,pixel.y-2) && Math.random() < 0.5) { + createPixel("pineapple_leaves",pixel.x+3,pixel.y-2); + pixel.leafgrown = true + } + } + } + if (isEmpty(pixel.x-1,pixel.y) && Math.random() < 0.5) { + createPixel("pineapple_leaves",pixel.x-1,pixel.y); + if (isEmpty(pixel.x-2,pixel.y-1) && Math.random() < 0.5) { + createPixel("pineapple_leaves",pixel.x-2,pixel.y-1); + if (pixel.leaflength = 3) { + pixel.leafgrown = true + } + if (pixel.leaflength = 4 && isEmpty(pixel.x-3,pixel.y-2) && isEmpty(pixel.x+3,pixel.y-2) && Math.random() < 0.5) { + createPixel("pineapple_leaves",pixel.x-3,pixel.y-2); + createPixel("pineapple_leaves",pixel.x+3,pixel.y-2); + pixel.leafgrown = true + } + } + } + } + } + else if (pixel.age > 500 && leafgrown == true && Math.random() < 0.1) { + changePixel(pixel,"pineapple_leaves"); + } + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + "leaflength":3, + "leafgrown":false, + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, + temp:25, + behavior: [ + "XX|XX|XX", + "XX|FX%10|XX", + "XX|M1|XX", + ], +}; +*//* +function averageHexColor(color1, color2) { + const rgb1 = hexToRgb(color1); + const rgb2 = hexToRgb(color2); + const avgRed = Math.floor((rgb1[0] + rgb2[0]) / 2); + const avgGreen = Math.floor((rgb1[1] + rgb2[1]) / 2); + const avgBlue = Math.floor((rgb1[2] + rgb2[2]) / 2); + const avgHex = rgbToHex(avgRed, avgGreen, avgBlue); + return avgHex; +} + +function hexToRgb(hex) { + hex = hex.replace(/^#/, ''); + const r = parseInt(hex.substring(0, 2), 16); + const g = parseInt(hex.substring(2, 4), 16); + const b = parseInt(hex.substring(4, 6), 16); + return [r, g, b]; +} + +function rgbToHex(r, g, b) { + const rHex = r.toString(16).padStart(2, '0'); + const gHex = g.toString(16).padStart(2, '0'); + const bHex = b.toString(16).padStart(2, '0'); + return `${rHex}${gHex}${bHex}`; +} +*/ +// test +//var color1 = "#FF0000"; +//var color2 = "#0000FF"; +//var averageColor = averageHexColor(color1, color2); +//console.log(averageColor) +/* +eLists.JUICEMIXABLE.forEach(function(element){ + elements[element].onMix = function(pixel1,pixel2) { + if (shiftDown && eLists.JUICEMIXABLE.indexOf(pixel2.element) !== -1) { + if (Math.random() < 0.2) { + var hex1 = pixel1.color + var hex2 = pixel2.color + let rgb = pixel.color.replace("rgb(", "").replace(")", "").split(","); + let rgbObj = { r: parseInt(rgb[0]), g: parseInt(rgb[1]), b: parseInt(rgb[2]) } //use this as one of the rgb objects + var finalJuiceColor = interpolatedRgb(hex1,hex2,0.5) + changePixel(pixel1,"juice") + //pixel1.color = pixelColorPick(pixel,finalJuiceColor) + pixel1.color = rgb(rgbObj) + } + } +} +})*/ +elements.juice.onMix = function(pixel){ + let num = Math.floor(Math.random() * 4); + let x = pixel.x + adjacentCoords[num][0]; + let y = pixel.y + adjacentCoords[num][1]; + if(!isEmpty(x,y) && !outOfBounds(x,y)){ + let pixel2 = pixelMap[x][y]; + if(pixel.color != pixel2.color && pixel2.element == "juice"){ + let condition; + if(shiftDown == 0){ + condition = (Math.floor(Math.random() * 2) == 1); + } else { + condition = true; + } + if(condition){ + let newrgb = interpolateRgb(getRGB(pixel.color), getRGB(pixel2.color), 0.5); + pixel.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + pixel2.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + } + } + } + } + +elements.juice.stain = 0 + +elements.banana_seed = { + color: "#594129", + tick: function(pixel) { + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1) && pixel.height < 7) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel("banana_stem",pixel.x,pixel.y+1); + + pixel.height++ + } + } + else if (pixel.age > 150 && pixel.height > 6 && Math.random() < 0.1) { + changePixel(pixel,"banana_tree_top"); + } + pixel.age++; + doDefaults(pixel); + }, + properties: { + "age":0, + "height": 0 + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, + behavior: [ + "XX|XX|XX", + "XX|XX|XX", + "XX|M1|XX", + ], +}; +elements.banana_stem = { + color: "#698215", + behavior: behaviors.WALL, + tempHigh: 400, + stateHigh: ["ember","charcoal","fire","fire","fire"], + category: "life", + burn: 5, + burnTime: 300, + burnInto: ["ember","charcoal","fire"], + state: "solid", + hardness: 0.15, + breakInto: "sawdust", + breakIntoColor: ["#dba66e","#cc8a64"], + hidden: true +} +elements.banana_tree_top = { + color: "#718a21", + behavior: behaviors.WALL, + tempHigh: 400, + stateHigh: ["ember","charcoal","fire","fire","fire"], + category: "life", + burn: 5, + burnTime: 300, + burnInto: ["ember","charcoal","fire"], + state: "solid", + hardness: 0.15, + breakInto: "sawdust", + breakIntoColor: ["#dba66e","#cc8a64"], + properties:{ + "leftleaves": 0, + "rightleaves": 0, + }, + hidden: true, + tick: function(pixel) { + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 0) { + if (isEmpty(pixel.x+1,pixel.y)) { + createPixel("banana_leaves",pixel.x+1,pixel.y); + + pixel.rightleaves++ + } + } + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 1) { + if (isEmpty(pixel.x+2,pixel.y)) { + createPixel("banana_leaves",pixel.x+2,pixel.y); + + pixel.rightleaves++ + } + } + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 2) { + if (isEmpty(pixel.x+3,pixel.y)) { + createPixel("banana_leaves",pixel.x+3,pixel.y); + + pixel.rightleaves++ + } + } + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.rightleaves == 3) { + if (isEmpty(pixel.x+4,pixel.y+1)) { + createPixel("banana_leaves",pixel.x+4,pixel.y+1); + + pixel.rightleaves++ + } + } + + + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 0) { + if (isEmpty(pixel.x-1,pixel.y)) { + createPixel("banana_leaves",pixel.x-1,pixel.y); + + pixel.leftleaves++ + } + } + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 1) { + if (isEmpty(pixel.x-2,pixel.y)) { + createPixel("banana_leaves",pixel.x-2,pixel.y); + + pixel.leftleaves++ + } + } + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 2) { + if (isEmpty(pixel.x-3,pixel.y)) { + createPixel("banana_leaves",pixel.x-3,pixel.y); + + pixel.leftleaves++ + } + } + if (Math.random() < 0.1 && pixel.age > 50 && pixel.temp < 100 && pixel.leftleaves == 3) { + if (isEmpty(pixel.x-4,pixel.y+1)) { + createPixel("banana_leaves",pixel.x-4,pixel.y+1); + + pixel.leftleaves++ + } + } + + + if (Math.random() < 0.1 && pixel.age > 70 && pixel.temp < 100 && pixel.leftleaves > 0 && pixel.rightleaves > 0) { + if (isEmpty(pixel.x+1,pixel.y+2)) { + createPixel("banana_peduncle",pixel.x+1,pixel.y+2); + } + } + if (Math.random() < 0.1 && pixel.age > 70 && pixel.temp < 100 && pixel.leftleaves > 0 && pixel.rightleaves > 0) { + if (isEmpty(pixel.x-1,pixel.y+2)) { + createPixel("banana_peduncle",pixel.x-1,pixel.y+2); + } + } + pixel.age++; + doDefaults(pixel); + }, +} +elements.banana_leaves = { + color: ["#3da324","#3cbd1c"], + reactions: { + "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, + "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 } + }, + category:"life", + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -1.66, + stateLow: "frozen_plant", + burn:65, + burnTime:60, + burnInto: "dead_plant", + breakInto: "dead_plant", + state: "solid", + density: 1050, + hidden: true +} +elements.banana_peduncle = { + color: "#8bb81a", + behavior: behaviors.WALL, + tempHigh: 400, + stateHigh: ["ember","charcoal","fire","fire","fire"], + category: "life", + burn: 5, + burnTime: 300, + burnInto: ["ember","charcoal","fire"], + state: "solid", + hardness: 0.15, + breakInto: "sawdust", + hidden: true, + tick: function(pixel) { + if (Math.random() < 0.1 && pixel.temp < 100) { + if (isEmpty(pixel.x+1,pixel.y+1)) { + createPixel("hanging_banana_peduncle",pixel.x+1,pixel.y+1); + } + if (isEmpty(pixel.x-1,pixel.y+1)) { + createPixel("hanging_banana_peduncle",pixel.x-1,pixel.y+1); + } + if (isEmpty(pixel.x+1,pixel.y+2)) { + createPixel("hanging_banana_peduncle",pixel.x+1,pixel.y+2); + } + if (isEmpty(pixel.x-1,pixel.y+2)) { + createPixel("hanging_banana_peduncle",pixel.x-1,pixel.y+2); + } + } + pixel.age++; + doDefaults(pixel); + }, +} +elements.hanging_banana_peduncle = { + color: "#8bb81a", + behavior: [ + "XX|XX|XX", + "CR:banana%0.2|XX|CR:banana%0.2", + "XX|XX|XX", + ], + tempHigh: 400, + stateHigh: ["ember","charcoal","fire","fire","fire"], + category: "life", + burn: 5, + burnTime: 300, + burnInto: ["ember","charcoal","fire"], + state: "solid", + hardness: 0.15, + breakInto: "sawdust", + hidden: true, +} +elements.banana = { + color: "#ebd834", + behavior: [ + "XX|XX|XX", + "ST:hanging_banana_peduncle|XX|ST:hanging_banana_peduncle", + "XX|M1|XX", + ], + category:"food", + tempHigh: 100, + stateHigh: "dead_plant", + burn:15, + burnTime:60, + burnInto: "dead_plant", + breakInto: "banana_juice", + state: "solid", + density: 1050, + cutInto: "cut_banana" +} +elements.cut_banana = { + color: "#f2e56b", + behavior: [ + "XX|XX|XX", + "XX|XX|XX", + "M2|M1|M2", + ], + category:"food", + tempHigh: 100, + stateHigh: "dead_plant", + burn:15, + burnTime:60, + burnInto: "dead_plant", + breakInto: "banana_juice", + state: "solid", + density: 1050, +} +elements.banana_juice = { + color: "#dbc440", + behavior: behaviors.LIQUID, + category: "liquids", + tempHigh: 100, + stateHigh: ["steam","sugar"], + burn: 70, + burnTime: 300, + burnInto: ["steam", "smoke"], + state: "liquid", + density: 825, + hidden: true, + temp: 30, + onMix: function(pixel) { + if (shiftDown) { + if (Math.random() < 0.2) { + changePixel(pixel,"juice") + pixel.color = pixelColorPick(pixel,"#dbc440") + } + } + }, + reactions: { + "bread": { elem1:"banana_bread", elem2:null, chance:0.35 }, + }, + tempLow: 0 +}; +eLists.JUICEMIXABLE.push("banana_juice"); + +elements.banana_bread = { + color: "#c2782f", + behavior: behaviors.STURDYPOWDER, + tempHigh: 176, + stateHigh: "toast", + category: "food", + burn: 30, + burnTime: 200, + burnInto: ["smoke","smoke","smoke","ash"], + breakInto: "crumb", + state: "solid", + density: 233.96, isFood: true } From 1c7724834019f5af3218cfc85251c41af9ca4d10 Mon Sep 17 00:00:00 2001 From: SquareScreamYT <134925668+SquareScreamYT@users.noreply.github.com> Date: Thu, 15 Feb 2024 20:09:16 +0800 Subject: [PATCH 39/53] delete meese --- mods/meese.js | 38 -------------------------------------- 1 file changed, 38 deletions(-) delete mode 100644 mods/meese.js diff --git a/mods/meese.js b/mods/meese.js deleted file mode 100644 index d3bb3f6e..00000000 --- a/mods/meese.js +++ /dev/null @@ -1,38 +0,0 @@ -// made by squarescreamyt - -elements.meese = { - color: "#6e4526", - state: "solid", - behavior: [ - "M2%1|M2%2|M2%1", - "M2%10|XX|M2%10", - "XX|M1|XX", - ], - reactions: { - "grass": { elem2:null, chance:0.2, func:behaviors.FEEDPIXEL }, - "plant": { elem2:null, chance:0.2, func:behaviors.FEEDPIXEL }, - "oxygen": { elem2:"carbon_dioxide", chance:0.3 }, - "mercury": { elem1:"rotten_meat", chance:0.1 }, - "bleach": { elem1:"rotten_meat", chance:0.1 }, - "infection": { elem1:"rotten_meat", chance:0.025 }, - "uranium": { elem1:"rotten_meat", chance:0.1 }, - "cyanide": { elem1:"rotten_meat", chance:0.1 }, - "chlorine": { elem1:"meat", chance:0.1 }, - "alcohol": { elem1:"meat", chance:0.025 }, - "dirty_water": { elem1:"rotten_meat", chance:0.0001 }, - }, - egg: "meese", - foodNeed: 10, - temp: 30, - tempHigh: 100, - stateHigh: "cooked_meat", - tempLow: -18, - stateLow: "frozen_meat", - category:"life", - breakInto: "rotten_meat", - burn:15, - burnTime:300, - state: "solid", - density: 1450, - conduct: 0.2 -}; From af22d52bf43eb6695e5059e530c83843ac3be247 Mon Sep 17 00:00:00 2001 From: SquareScreamYT <134925668+SquareScreamYT@users.noreply.github.com> Date: Thu, 15 Feb 2024 20:09:54 +0800 Subject: [PATCH 40/53] 1.7 --- mods/aChefsDream.js | 5 +++++ 1 file changed, 5 insertions(+) diff --git a/mods/aChefsDream.js b/mods/aChefsDream.js index 588fa84f..507653fb 100644 --- a/mods/aChefsDream.js +++ b/mods/aChefsDream.js @@ -248,6 +248,11 @@ Changelog (v1.6) - cut banana - banana juice - banana bread + + + + + */ /* From 331fdf0f18f9fecfd75a5f5cff72109e90a27a85 Mon Sep 17 00:00:00 2001 From: SquareScreamYT <134925668+SquareScreamYT@users.noreply.github.com> Date: Thu, 15 Feb 2024 20:14:27 +0800 Subject: [PATCH 41/53] DELICIOUS BANANA BREAD --- mods/aChefsDream.js | 1 + 1 file changed, 1 insertion(+) diff --git a/mods/aChefsDream.js b/mods/aChefsDream.js index 507653fb..19a628b3 100644 --- a/mods/aChefsDream.js +++ b/mods/aChefsDream.js @@ -4207,6 +4207,7 @@ eLists.JUICEMIXABLE.push("banana_juice"); elements.banana_bread = { color: "#c2782f", + desc: "delicious banana bread", behavior: behaviors.STURDYPOWDER, tempHigh: 176, stateHigh: "toast", From 32cbd0e8052f40457ca2062ca199135b8b754d32 Mon Sep 17 00:00:00 2001 From: GGod <46885632+GGodPL@users.noreply.github.com> Date: Thu, 15 Feb 2024 21:14:20 +0100 Subject: [PATCH 42/53] add moreViews.js mod (without dynamic lights) --- mods/VCR_OSD_MONO.ttf | Bin 0 -> 22584 bytes mods/moreViews.js | 481 ++++++++++++++++++++++++++++++++++++++++++ 2 files changed, 481 insertions(+) create mode 100644 mods/VCR_OSD_MONO.ttf create mode 100644 mods/moreViews.js diff --git a/mods/VCR_OSD_MONO.ttf b/mods/VCR_OSD_MONO.ttf new file mode 100644 index 0000000000000000000000000000000000000000..9322814923c784c0ac4bcc12ff6c960d63931025 GIT binary patch literal 22584 zcmdU%dvsm(b?1NQo_i%fn|C)1j&-?7>ckkc+{m#(|NeE$CxG$t(eDh5|e=U0)dCvo^7hJpf zZP#dz{V5hb*WUP!o5GsV!~Un)UvceC@4o7}AARp}_7AZC(RbYR`b(Sl_fJ4#5Bs-_ z-7z};bANLCUx$#k`Mu`0(L2XE-p%#*v0iZ7jt^~{JobaXWb@-8T>r}Lt|KD%n z+(~|y-_C)a4_Chrz026&aQhv*_x$)X*Y0Kid44bL*flnK*_{Jl2%+mG_8-1ubkBHr zF8m_fTe-fmbM%hZ7w&lhS#O%;*k6qAx^wq`zxV3t5Z(=s%4Mb-`hDf2-@NKqm%aJr zuy_Hth442!K3KE$uGe0pb@f2EPE_3%Y;lhrX;;7E=kqh#)wI!$d=pu^{J?3;w0aA41~;8HMY%G#X)32t(g+8CYUnm!Nu} zc9`u(fVy9=wf~YS)@^>x&YzAa8zoI~Ui-S%j>YTk*sOc!qGdcXKG}Ny`@Z5dl8vGH zYBTm~qH7an%UA12GufzP$+1ov9oOlaWBHMG+_t;@{$vUcaleyJ=bm^uzs}=lxz|R9 z_N(!!Z1t;5Ufof)&aAsDTRBUB#ot=TLUJibKx$YUs>v$WZw41t_Ci<}?hT(0UkHB^ zz8nsOC&G8b{|%?odmC#S>l*7DuW7uovAMCY@x{ht1M3GKTwfo0eCWxcgG1jqb&7j+ zcOyI!{wVAZf6CpDhyN6w53g`{e`BrP{RZy-e7t+A0t4^I8h5KjI1si#E)byc2g26aWh+IXJ)TuUs=9N zBzKY77KDXiQCJ*$!jiC*yt+K}h83YNtPJ(ADy$Cuz3 zq41h;LHL>Q+VHdCLh{G!!bRcr;o@*fxHJrh%fbk{UlFbhZwPM;Z^D=VBD^L19C_fa z;i_%z~6>%%XEE#Zdn_VA8yV|ZtHSGb8h^zLwTcu&|Gekr^+{Bn3- z_?7Vf@T=jLFpB*5gx?7NGW=%vt?=>i$?#D4{qP6j55uRz!{O86v*9!0bNKtw@bAFP zK2Wnid@+0p?EEq4`P1-cU?7BFGy8_{AK88oE8iCWOV}BZKDFR)7p`3RGYhXlf8`)W25$;i}iHdi$zhU-js!_No_GFJFD- z>i4dGVD&fpL;qX)@9lr8|CKdYtr=hQ*)`u@bMljGWje8r9HNH2{GjRF9 z#K5BihX;>aLbZ8IesS)@nBx9wsdbZ zJX_sTdx7XapL+*KhI@zW_N&8-pNR1r8Sd*H?lrDrpHJzeL`g1urag10J@eeNGv9fp zolMQZ0;!u}6xxT$1aBhRsTS&*MNPED2N5;v2y;B9?cU)Ln{Ca0s_QskIoNJC{f~9K zV+Rd&s@bgVu?;Dy-)*|dbeV2~xG1 zV`J4V?dHjTB%2x=n;CCDle{c>+42dSPT7`}#+_#0W_3%~KK$NGh7HMptcnLEg)AKR z&2k)(Lea7=Gjh5QDhDMbQ`;H_)LvUE z2MvoMLty0~XSp91!d$|lnKqF7TvbEV9YYCZH$G9p!kY-E~)C3+ZPWHFB8t}l@@HdH$OQfT-bV0~2)B7!{ z$RKG0B3zQoJ;aWjB%u)$03bF%u>C^R`e3p#ZCEIiWDpfH5>jHxOSa81x0nTZr|n-K zLZ8Dfa+#N#8w=w+Gu9qUJ{i%~!Bauof~)as8&7R3T%EPr0QXDX+5kKNx`o6%u?>&( zmY9!pv*1P`z1Pl zl8uyWS{Sxv&4{t)%0nKzxy``D2!ZRMEn0(gl8A#qbaQQG+cN6(egi2qig;K|{X8OU z<(L|-<(kY&)fNw_aA#Jdm66q3Gatkv$1<;&DoLwp9+pBF>)A0KitjLnIKT~Dqvm_~>ircZRSI+VHQT>x&l(sa9)y*m^y^K`PGP;nm`3MT@0VHT_Bm z@H-uN7uZ3$ug=e77d{r7f_52$idAz=deqK4{IVFK1d)KgYo~I1sQp`PEg*3%z)1BX zvI|EjNea8h#jNWK1-bA|yR$bdSkwm5@|NSio4&QG?ilxJo~7KoS+3Fuka7}{Ad-^V z52TZr`^1eZcVjkJAj+?5vnVKIJ1+VT@>vE2Y@Qy6EsG$05yG*Ny|76FY_=>HnwsSL z3^!Y9f5*tdYS>9~^Pz27j>2RkNUl^fy*WLfjNNS4R$_w|YMgkdgeDWTl2ZGsx`yVJ zM#6qX3QfWEezm2fe^apybfSKqs~B(0?iuXO?r8hv)BAO`+d>#uj#W@+X-mZ$P&3i< z96l0TB{1fp$ocdiuq*kpk|Z>xSo@G1pzPX8l1i&pd5_W#8pe#P_7+PjB1pCdf0x5$ zwt5fXtAzzZ3K(Ut%0USXcD5dWfYGs{PT~3?v#wgQVd_o4zDWnra$T7=-iVpo9im%= zU$hc9m|)&%<|vK zy>_)?x3EvQ^NsS$hlK*x+c#$vPJpi^K2!l4&cvml2t8dx*|M#&zl<+oyPN|Gj)n3r zknLyslf`2~B=9{=TFIkQkqP}h0k}zYNL%`4O-l*ms&dFTq`AT57`;52CsJd(ed5N> z+}5X9Rv2P)mKkgm#ZZMfIYtjSG@w!4a^gm~b>v2H9q$Kpijznqj}*@dq9jReksPBq z+1qU1x($T)H@DrY6D8S|Uqr{}NU3f<4YUDKc;)*~k$Y z-yI)o?oPTF;NOwFK~eD#XSv+;Gp)6yG?E^rhrtMt@`zHgn%fp*b&94q#gd&pNZXjl z(Jqbq2%^x!uOt6?wJPC_inFZN}zt^l9 z!--fX2@O=X&Wx+QPNrynfBbaJ+v!oOLm2BxauF=Fu!#cAXRovInip-tPh=cd+%6;Q z2_Lm%xP9D8s260eMIXY%4%5 zSC6Q|Rut#%@aoIUK8z+D3U3za3QiR^o%xj>J)?@uIgo*SonD@y-g!DVLyGLG(BLL3c}2na&?F2_EB>T5$JJfaQk!B_ z*zqu9c+yRY1v^C^)~-oiS&(ddn&xnWmPFTtBDrbVO^+tWjz3^*eUvr|mg!saBl>mo z3`$X8x+HVyN!pYg^uAQ715tD-G^IGjap@$CGwYSGsH7G9XW)xoC$$H_Fx3d=`T+UC z2J|fXXjt7;0|bSQgf+${61TQXqWT3Y5{<)vAcKJCc*K!KAj&|5K`(1%kdlIUk`>eR zW~^jpaoecjmAu(_&N_AobnudJ3T|(&(;}FtzRm6OcN{ZQzpWRlb?OZV zkjRnLumdtcMB>)=(3U+R*^W^Lo4@@2u1&@LeGV71!pJ~Ggwiw=x;C}j$6tgP4XZ-D zq?6E=M~wjs-5lQ{Xzc|{VcTYom1;M)n+R*-L~V~6J57ElU&BVv6Pn`DJx)v%`Ahg!g6zFLTlcOTTA9TQ9J~9>|CIGtgjimB|!!Ra9 zuh*<9vO-yfWUOPXfP;tFWc;#i!+kzhEqoLaXVsU&03_*lO@gx=NFdT)c-+NYfZVDj zRbVOJly_q0;cn0I%7|XNQ-oMZ82=n!swH*5+|C?nh)!mOL6fA=L-evdD?s^#8aYjB z0;lOIDx*0PX%_U%b|#%lN|i}5Xgg(m6Zsi&OhA^IVD5}~)ch^6b>;sLF|=Nh#H%UF({6;8>9Y z!g3{@@ePWSpR)P*M|(OZ?^#{QkUGO=$@G`}Bpx7L!OXFb zom7`aKbn!n$@50Wo3r!}rz!{KNs-U;6J^1;f*r8vNukNY0t?Rc7*=e|8~s$_VigrE znxmqQ#4OlIR+{mF>KLnKB(g)&4;U*`(K3tY7wywVcpGVcS5E+c_VJTP+q}lG8R7S8 zDIZcp)K;c??v{`9(@^Q@C5^lu?@-M%K5WlK_khIfH_TV#LIx+H8AE9R$_-r9hOM9uc^`3!gE@#xlnP2TJy=1tEDGsO^ zbhBo>g#xS^Ngssi1;b&9J6&PTI`4t zt+`;f8p*6+qEBhk&u@6gF38;Y#6M2FstxPlZhk5?=TI+-D<36W0fBsS>kz@>O! zB1@bdI{V-J+_$jhtGBF{_H5O;!gK`YG>gWGPdNbsi0fl0E0v^8#zx?X?$m z01nZh$Xc54VI}vW(<{eoiMD!piWho~`4ji9O-{wB8sScQs%%O$a``Zpf}t##7v0h#(Wb|GGLrXbT>74gxP3Mj$=XEPLu%PNee~ON8 z^prr46zOgs;n|7neI`1fTC?ey(Xm?WbSjku2%CdzC7SfV_ z%Vet#iqKIHq(q4_tt6HQcfRIx~_RiZ-F(-d>J#L?ezjfOT38lJI`VVH$^v>kz1nw3g zHbUUN7W^$m1!{HC=i#fT5tyZ#(3=M4lvuLTGRN zFqQi3GDeiTlrBqop^v;k2A+#cAAV82)InWQ02n$cQ^{L-RLXPl`5tbMmf_8LOKu9W ze4tH(ot})aKaK_9p6BIA^CpWdwq_0~%SbOn=uD3^&7aA1y_IK?*^{SI?zVS&@AG^;YCo7(W9&P)Y636>Ga<-xu>PiqIFM?UQ zQQLF;MGH;TlJG)+JToPf7rBb@8a;a-_FM%(Wwy?oJTiER#?ed)_~ki^i)ZBvS;b$Q zlHV3pJD@)O9T8vhJAy)2JpIfIkz2_cuL1kZ9ie)5`7ty_#z8x=kaODPU0Ol+hv z&-7(^)Gv?kKh9yDyblzyav?43aF+4U2D$1vbo7Ge_mqj}rPch%k!h?@P+utGnDJuS zN4+72ft2lQR^2FSi6Q;y7SR>LM>hT{g9s5CxKmT7hmjni{8ii%L9{($6njf~Uucij z7nZ?_;z_PoSa=JAdn^Uol1fD5jv{5P>l}R|>EaEqF;w|um$T0GGu!)<8f64yNFInR zU|$GBBdn~!n;uG7NEO>T6>A!Ii_E4sV?@gu7(Ht#?4JTNX=I=nG-Wx~`S{G)@lGUw zX3U_WmiYwmCsx*`tY(tDiY)kpcz`n-OwPMx z4Ii%7sd9Wu9vhoDJIiEa6KArD!g4+#z!Veq&~vUy@UeteUC+8AI8^;vXlY5R>zx%{U>l`Dve@rBJAQq+@AZc7Y<|X#5X`vD#cq~<>d%}(zr2l% zUOt_tR5jPm&sAQPU(0q?ReeUzSx!Ekquv8iMmtT*bW$h8t7795ztFXb=S$8<{TBi! zd-GUHY{bGod$2>svZN&t;v>sqV+?JorUA8NFE0qBEkkPt)vQ*-cUEWWIVD7iP^&Qn zm^#=U@o3c`;jHH$LaodlrE6>Xt9d;%=&>@7;<~!H~C*PW&g~dzO7ab7W@a*|nT=H8Zo2n{lU?l7+Te z88=Jsv*bU^!=0_MGjVfR9XS{OQiW3Wu{CR-&bIFfu546xF3wrF%&E8DbuIdywE0WO zxK^VTea$oXHZKqmJS(yE|2hD-R;FvMW?$<#F^K7SQ1PshK^^yhugcr1EPnNT*q*`8 z^@dS7^Fjcl!bZTg*lP0@9qloF67lg*6lk62hF76oAiaaOk`Zjqg7z}YJ6WX0>}mZs zMUI=ynpib`xIhLgYmr5Xj+YfF*9}>}^R#~W$Y9p*?2ulr=D+017ekZR!`m=WB zPil^sKfx1k5PJ#exm0zx!pE$oB2$c@%ztT!x_Y7bU)wrYwv}qx*V5u-k@D&qdW}DR zx^77)dv(|A~G>pyTkBLS1~dmOqR2{8kM zrFzQZis(MobC}rLQRpAVSE4Tr7!R;zJZf=mquj?74dRGpv?AO}ykidrL(w*$MiV(0 zQZ+gBcCzHDaSXhAH(#VBATd{x52tv1>s$JIkR_m$f0*v>Hu zEnh{;(PXRM)yM+_Xf}o>z^awE_oww`1$#@whaC-|F&U{*$jW-NWV2&3zY4LMw3H0~ z&RQd*>69GyBUbfcfNbV}IPBii!k}4Dj5PCnZk33IPmwS+dJ_XH@)=GiokWz&=+E=* zgW`D-Z%_BBH>RJ|hV0-7PPG??dN3I7BG^eX)EzvV%HI)YjOIcVS4U2A$d3Gq!XM*X z^Jauay!7sv0$e)#=$6VEe6P;2vSbWY>7wqR6=upa{_U0lMPr|U4lZCU!XpgW@OB^u z1|>GviGGAZ6OT1xCdfcl%mMUF4{f)#aXjcGg#y6oKdSt)RaAm#*3U#wwQE8IteB;X zX8BW0?U-~G^Joe84ARJ){n7No$9;bi?&@6k;kq*>oSJc zvA9CID${voHJDBs84*K6^?7-P38q=yVtCWbd5Q)8Ym+=mHn>7I&F2DYmM@JUi|jve zTu{S)nMVFj0OoKbXgRe;u^#8-wv$mYITNS$wc)!Q);Dw^2ieydt z2j-4@hy3*uW1XqOlRu3dJ3nsmTMbv-8^3v?7>mwy7rQ0QttN(RBU`FEP+J%k$cqHm zCmuJsO0=Ueg=$Vu-3jNxTOAAw*d#)FOOchEyMwZ_Lm{`1fETvTl&(j~fv5F&GWE4a ziCL5TF|&ne=C(lMC?Oto>TpXZO{Q$2vS}7c?@#HgdiK9i%FRZ#8>o_xnXElL*&lh! z|J0G-u+MwT(E%1;2+=#BsLUtcO_=m%)MOz02fh{eWh~?Ldf?~V6>*N+DQ{V2$E%^Z zrpA}d8u6MgzCE`kZZG8On`u{)>Ozk6^My9wuE6V8;&#fn<+9_|(ls@{6Ze^TO&8y; zdpT||3`>)R?`qw4*N)MNo3DOX;~h6`ZrreI=dL&2+?u#^`>vghOD?+j;_`Omt>Y8h zcQh`!bYtVvi!ZrsV`KZy?Yp;+?r2Q3cC<$CY(WGXB5}jS4Wm0-yZKmMi;u_M6?X7p zx(O7xnj;N9WOoyvxNGoHyIp)%ZWo`xyP4}I!kuBe9cl1F#YN#_=J}2{_)y+BcWj5U zuD;aFb}4sU!pHSw!tGGr9(MB^wQDBeu!G+yTv|~Qmm`zn2I$?u`JJ5KE#Jkj1)jQq zZ|G%y)A4NjCL8*;;Q!y>3)FY@9tubKn%-}Nk}vUnz5A0&l7`<&s(dZ*k3q{Zz9;!8 z-v)e^FD-uAz6_`@cm5S-YV)PPzX{(Ae;vLR{(K{UH22*JGy*x{~hj@nk`=Fjvha zFTVJyOXGStuHR7Iv3+8+YrJ)5YxijNZFf!V>fSxEee|}8-M-$j&DYJHzP@XG;poJ~ zuDf@%w(VYITNB%FyM1@JZDuE%yYAlUm)*K+_wC>z;k%mpN^D{<@uee1+lz?xrM{b= zU&OZ~FAB+y(cL@wN?ujRp`ojjZ4;wo9CIuRYh8S6(#~+S!Y{!V`clLSyDzaL8#%Km dH0 { + if (n <= views.length - 1 && n > 1) { + view = n; + } else { + view = null; + } + setSetting('view', parseInt(view)); + document.querySelector('span[setting="view"]').children[0].value = view ?? 0; +} + +for (const i in views) { + if (i < 5) continue; + const option = document.createElement("option"); + option.setAttribute("value", i); + option.innerText = views[i]; + document.querySelector('.setting-span[setting="view"]').querySelector("select").appendChild(option); + viewKey[i] = views[i]; +} + +const vcrFont = new FontFace("VCR", "url(mods/VCR_OSD_MONO.ttf)"); +vcrFont.load().then(font => { + console.log(font); + document.fonts.add(font); +}) + +function blending(color, color2, t = 0.5) { + const [r, g, b] = parseColor(color).replace("#", "").match(/../g).map(a => parseInt(a, 16)); + const [r2, g2, b2] = parseColor(color2).replace("#", "").match(/../g).map(a => parseInt(a, 16)); + if ([r, g, b].includes(undefined) || [r, g, b, t].includes(NaN)) console.log([r, g, b, t], parseColor(color), color); + return `#${[ + (1 - t) * r + t * r2, + (1 - t) * g + t * g2, + (1 - t) * b + t * b2 + ].map(a => Math.floor(a).toString(16).padStart(2, "0")).join("")}`; +} + +const cache = new Map(); + +function mixColors(color, color2) { + if (cache.has(`${color}_${color2}`) || cache.has(`${color2}_${color}`)) return cache.get(`${color}_${color2}`) ?? cache.get(`${color2}_${color}`); + const [r, g, b] = parseColor(color).replace("#", "").match(/../g).map(a => parseInt(a, 16)); + const [r2, g2, b2] = parseColor(color2).replace("#", "").match(/../g).map(a => parseInt(a, 16)); + const res = [ + Math.max(r, r2), + Math.max(g, g2), + Math.max(b, b2) + ]; + cache.set(`${color}_${color2}`, `#${res.map(a => (Math.floor(a) % 256).toString(16).padStart(2, "0")).join("")}`); + return `#${res.map(a => (Math.floor(a) % 256).toString(16).padStart(2, "0")).join("")}`; +} + +const parseColor = (colorString) => { + if (colorString instanceof Array) return parseColor(colorString[0]); + if (typeof colorString != "string") return "#ffffff"; + if (colorString.startsWith("rgb(")) { + const color = colorString.replace("rgb(", "").replace(")", ""); + return `#${color.split(",").map(a => parseInt(a).toString(16).length == 1 ? `0${parseInt(a).toString(16)}` : parseInt(a).toString(16)).join("")}`; + } else if (colorString.startsWith("rgba(")) { + const color = colorString.replace("rgba(", "").replace(")", ""); + return `#${color.split(",").filter((_, i) => i <= 2).map(a => parseInt(a).toString(16).length == 1 ? `0${parseInt(a).toString(16)}` : parseInt(a).toString(16)).join("")}`; + } else { + if (colorString.startsWith("#")) { + const color = colorString.slice(1); + if (color.length == 3) return `#${color.split(a => a.repeat(2)).join()}`; + else if (color.length >= 6) return `#${color.slice(0, 6)}`; + else return `#${color}`; + } + } +} + +const rgbToHsl = (r, g, b) => { + const r1 = r / 255; + const g1 = g / 255; + const b1 = b / 255; + + const cmax = Math.max(r1, g1, b1); + const cmin = Math.min(r1, g1, b1); + + const delta = cmax - cmin; + const l = (cmax + cmin) / 2; + const s = delta == 0 ? 0 : delta / (1 - Math.abs(2 * l - 1)); + let h = 0; + if (delta != 0) { + switch (cmax) { + case r1: + h = 60 * (((g1 - b1) / delta) % 6); + break; + case g1: + h = 60 * ((b1 - r1) / delta + 2); + break; + default: + h = 60 * ((r1 - g1) / delta + 4); + } + } + + return {h, s, l}; +} + +const thetaSetting = new Setting("3D View Angle (0-90)", "theta", settingType.NUMBER, false, parseFloat((Math.atan(2) * 180 / Math.PI).toPrecision(3))); + +const tab = new SettingsTab("moreViews.js"); +tab.registerSetting(thetaSetting); + +let maxDistance = -1; +const colorCache = new Map(); + +function getModeColor(color, distance = 0) { + if (!colorCache.has(view)) colorCache.set(view, new Map()); + if (view == 18) { + if (colorCache.get(view).has(color) && colorCache.get(view).get(color).has(distance)) return colorCache.get(view).get(color).get(distance); + } else if (colorCache.get(view).has(color)) return colorCache.get(view).get(color); + switch (view) { + case 6: { + const newColor = "#" + (parseInt(`0x1${parseColor(color).slice(1)}`) ^ 0xffffff).toString(16).slice(1); + colorCache.get(view).set(color, newColor); + return newColor; + } + case 7: { + const newColor = blending(pixel.color, "#000000"); + colorCache.get(view).set(color, newColor); + return newColor; + } + case 8: { + const newColor = blending(pixel.color, "#ffffff"); + colorCache.get(view).set(color, newColor); + return newColor; + } + case 9: { + const [r, g, b] = parseColor(color).slice(1).match(/.{1,2}/g).map(a => parseInt(a, 16)).slice(0, 3); + const {h, l} = rgbToHsl(r, g, b); + const newColor = `hsl(${Math.round(h)}, 0%, ${Math.round(l * 100)}%)`; + colorCache.get(view).set(color, newColor); + return newColor; + } + case 10: { + const [r, g, b] = parseColor(color).replace("#", "").match(/../g).map(a => parseInt(a, 16)); + const [r2, g2, b2] = [ + Math.min(255, (r * 0.393) + (g * 0.769) + (b * 0.189)), + Math.min(255, (r * 0.349) + (g * 0.686) + (b * 0.168)), + Math.min(255, (r * 0.272) + (g * 0.534) + (b * 0.131)) + ]; + const newColor = `#${Math.floor(r2).toString(16).padStart(2, "0")}${Math.floor(g2).toString(16).padStart(2, "0")}${Math.floor(b2).toString(16).padStart(2, "0")}`; + colorCache.get(view).set(color, newColor); + return newColor; + } + case 11: { + const [r, g, b] = parseColor(color).slice(1).match(/.{1,2}/g).map(a => parseInt(a, 16)).slice(0, 3); + const {h, s, l} = rgbToHsl(r, g, b); + const newColor = `hsl(${(Math.round(h) + 180 % 360)}, ${Math.round(s * 100)}%, ${Math.round(l * 100)}%)`; + colorCache.get(view).set(color, newColor); + return newColor; + } + case 12: { + const [r, g, b] = parseColor(color).slice(1).match(/.{1,2}/g).map(a => parseInt(a, 16)).slice(0, 3); + const {h, s, l} = rgbToHsl(r, g, b); + const newColor = `hsl(${Math.round(h)}, ${Math.round(s * 100) * 4}%, ${Math.round(l * 100)}%)`; + colorCache.get(view).set(color, newColor); + return newColor; + } + case 15: { + const [r, g, b] = parseColor(color).replace("#", "").match(/../g); + const [r2, g2, b2] = [parseInt(r, 16) * 0.75, parseInt(g, 16) * 0.75, parseInt(b, 16) * 0.75]; + const newColor = `rgb(${r2}, ${g2}, ${b2})`; + colorCache.get(view).set(color, newColor); + return newColor; + } + case 18: { + const newColor = blending(pixel.color, "#000000", (1 / maxDistance) * distance); + colorCache.get(view).has(color) + ? colorCache.get(view).get(color).set(distance, newColor) + : colorCache.get(view).set(color, new Map([[distance, newColor]])); + return newColor; + } + } + return color; +} + +settingsManager.registerTab(tab); + +runAfterLoadList.push(() => drawPixels = (function() { + const oldDrawPixels = drawPixels; + + return function(forceTick = false) { + if (view >= 5) { + if (maxDistance = -1) maxDistance = Math.sqrt((width / 2) ** 2 + (height / 2) ** 2) * 2; + + const canvas = document.getElementById("game"); + const ctx = canvas.getContext("2d"); + var newCurrentPixels = currentPixels.slice(); + var pixelsFirst = []; + var pixelsLast = []; + if (!paused || forceTick) { + shuffleArray(newCurrentPixels); + } + + for (var i = 0; i < newCurrentPixels.length; i++) { + pixel = newCurrentPixels[i]; + if (pixel.del) {continue} + if (!paused || forceTick) { + if (elements[pixel.element].tick) { + elements[pixel.element].tick(pixel); + } + if (pixel.del) {continue} + if (elements[pixel.element].behavior) { + pixelTick(pixel); + } + }; + if (pixel.con) { pixel = pixel.con } + if (elements[pixel.element].isGas || elements[pixel.element].glow) { + pixelsLast.push(pixel); + } + else { + pixelsFirst.push(pixel); + } + } + + if (hiding) { + if (ctx.globalAlpha < 1) { + ctx.globalAlpha = 1; + } + + if (elements[currentElement].maxSize < mouseSize) { + var mouseOffset = Math.trunc(elements[currentElement].maxSize/2); + } + else { + var mouseOffset = Math.trunc(mouseSize/2); + } + var topLeft = [mousePos.x-mouseOffset,mousePos.y-mouseOffset]; + var bottomRight = [mousePos.x+mouseOffset,mousePos.y+mouseOffset]; + + ctx.strokeStyle = "white"; + ctx.strokeRect(topLeft[0]*pixelSize,topLeft[1]*pixelSize,(bottomRight[0]-topLeft[0]+1)*pixelSize,(bottomRight[1]-topLeft[1]+1)*pixelSize); + + if (settings.precision) { + ctx.fillStyle = "rgba(255,255,255,0.5)"; + ctx.fillRect(mousePos.x*pixelSize,mousePos.y*pixelSize,pixelSize,pixelSize); + } + if ((!paused) || forceTick) {pixelTicks++}; + return; + } + + if (!settings["bg"]) {ctx.clearRect(0, 0, canvas.width, canvas.height)} + else { + ctx.fillStyle = settings["bg"]; + ctx.fillRect(0, 0, canvas.width, canvas.height); + } + var pixelDrawList = pixelsFirst.concat(pixelsLast); + for (var i = 0; i < pixelDrawList.length; i++) { + pixel = pixelDrawList[i]; + if (pixelMap[pixel.x][pixel.y] == undefined) {continue} + if (pixel.con) { pixel = pixel.con }; + ctx.fillStyle = getModeColor(pixel.color, view == 18 ? Math.sqrt((width / 2 - pixel.x) ** 2 + (height / 2 - pixel.y) ** 2) : 0); + // 3D VIEW + if (view == 5) { + const neighborRight = !outOfBounds(pixel.x + 1, pixel.y) && !!pixelMap[pixel.x + 1][pixel.y]; + const neighborUp = !outOfBounds(pixel.x, pixel.y - 1) && !!pixelMap[pixel.x][pixel.y - 1]; + const neighborUpRight = !outOfBounds(pixel.x + 1, pixel.y - 1) && !!pixelMap[pixel.x + 1][pixel.y - 1]; + let size = 0; + let currentY = pixel.y; + while (!outOfBounds(pixel.x, currentY) && pixelMap[pixel.x][currentY] && pixelMap[pixel.x][currentY].element == pixel.element) { + currentY++; + size++; + } + ctx.globalAlpha = 1; + ctx.fillStyle = pixel.color; + ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize); + const px = pixel.x * pixelSize; + const py = pixel.y * pixelSize; + const theta = Math.max(Math.min(thetaSetting.get(), 90), 0) * Math.PI / 180; + const a = Math.cos(theta); + const b = Math.sin(theta); + const w = pixelSize; + const px2 = px + a * w; + const py2 = py - b * w; + const parts = [[[px, py], [[px2, py2], [px + w, py2], [px + w, py]], !neighborUp], [[px + w, py + w], [[px2 + w, py2 + w], [px2 + w, py], [px + w, py]], !neighborRight], [[px + w, py], [[px + w, py2], [px2 + w, py2], [px + w, py]], !neighborUp && !neighborUpRight], [[px + w, py], [[px2 + w, py2], [px2 + w, py], [px + w, py]], !neighborRight && !neighborUpRight]] + for (const part of parts.filter(p => p[2])) { + ctx.fillStyle = blending(pixel.color, "#000000"); + ctx.beginPath(); + ctx.moveTo(...part[0]); + for (const v of part[1]) { + ctx.lineTo(...v); + } + ctx.closePath(); + ctx.fill(); + } + } else if (view == 13) { + const hue = 225 - (Math.log(pixel.start) / Math.log(pixelTicks)) * 225; + ctx.globalAlpha = 1; + ctx.fillStyle = `hsl(${Math.min(Math.round(hue), 250)}, 100%, 50%)`; + ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize); + } else if (view == 14) { + ctx.globalAlpha = 1; + ctx.fillStyle = pixel.color; + ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize); + + if (outOfBounds(pixel.x - 1, pixel.y) || !pixelMap[pixel.x - 1][pixel.y]) { + ctx.fillStyle = "#ff0000"; + ctx.globalAlpha = 0.5; + ctx.fillRect(pixel.x * pixelSize - 0.5 * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize); + } + if (outOfBounds(pixel.x + 1, pixel.y) || !pixelMap[pixel.x + 1][pixel.y]) { + ctx.fillStyle = "#00ffff"; + ctx.globalAlpha = 0.5; + ctx.fillRect(pixel.x * pixelSize + 0.5 * pixelSize, pixel.y * pixelSize, pixelSize, pixelSize); + } + } else if (view == 15) { + const [r, g, b] = parseColor(pixel.color).replace("#", "").match(/../g); + const [r2, g2, b2] = [parseInt(r, 16) * 0.75, parseInt(g, 16) * 0.75, parseInt(b, 16) * 0.75] + // scrolling effect + const offset = (pixelTicks + 6) % height >= pixel.y && (pixelTicks - 3) % height <= pixel.y + || (pixelTicks + 66) % height >= pixel.y && (pixelTicks - 57) % height <= pixel.y; + if (!pixelMap[pixel.x - 1] || !pixelMap[pixel.x - 1][pixel.y]) { + ctx.globalAlpha = 0.5; + ctx.fillStyle = `#${r.padStart(2, "0")}0000`; + ctx.fillRect(pixel.x * pixelSize - 0.75 * pixelSize - (offset ? 0.5 * pixelSize : 0) , pixel.y * pixelSize, pixelSize, pixelSize); + } + if (!pixelMap[pixel.x + 1] || !pixelMap[pixel.x + 1][pixel.y]) { + ctx.globalAlpha = 0.5; + ctx.fillStyle = `#0000${b.padStart(2, "0")}`; + ctx.fillRect(pixel.x * pixelSize + 0.75 * pixelSize - (offset ? 0.5 * pixelSize : 0), pixel.y * pixelSize, pixelSize, pixelSize); + } + ctx.globalAlpha = 1; + ctx.fillStyle = `rgb(${r2}, ${g2}, ${b2})` + ctx.fillRect(pixel.x * pixelSize - (offset ? 0.5 * pixelSize : 0), pixel.y * pixelSize, pixelSize, pixelSize); + ctx.globalAlpha = 1; + // i fucking hate it but at least it works + // and i dont feel like finding something that is fast and pretty + } else if (view == 16) { + ctx.globalAlpha = 1; + ctx.strokeStyle = pixel.color; + ctx.lineWidth = 2; + const cond1 = outOfBounds(pixel.x - 1, pixel.y) + || !pixelMap[pixel.x - 1][pixel.y] + || pixelMap[pixel.x - 1][pixel.y].element != pixel.element; + const cond2 = outOfBounds(pixel.x + 1, pixel.y) + || !pixelMap[pixel.x + 1][pixel.y] + || pixelMap[pixel.x + 1][pixel.y].element != pixel.element; + const cond3 = outOfBounds(pixel.x, pixel.y - 1) + || !pixelMap[pixel.x][pixel.y - 1] + || pixelMap[pixel.x][pixel.y - 1].element != pixel.element; + const cond4 = outOfBounds(pixel.x, pixel.y + 1) + || !pixelMap[pixel.x][pixel.y + 1] + || pixelMap[pixel.x][pixel.y + 1].element != pixel.element; + const cond5 = outOfBounds(pixel.x - 1, pixel.y - 1) + || !pixelMap[pixel.x - 1][pixel.y - 1] + || pixelMap[pixel.x - 1][pixel.y - 1].element != pixel.element; + const cond6 = outOfBounds(pixel.x + 1, pixel.y - 1) + || !pixelMap[pixel.x + 1][pixel.y - 1] + || pixelMap[pixel.x + 1][pixel.y - 1].element != pixel.element; + const cond7 = outOfBounds(pixel.x - 1, pixel.y + 1) + || !pixelMap[pixel.x - 1][pixel.y + 1] + || pixelMap[pixel.x - 1][pixel.y + 1].element != pixel.element; + const cond8 = outOfBounds(pixel.x + 1, pixel.y + 1) + || !pixelMap[pixel.x + 1][pixel.y + 1] + || pixelMap[pixel.x + 1][pixel.y + 1].element != pixel.element; + + if (cond1) { + ctx.beginPath(); + ctx.moveTo(pixel.x * pixelSize + ctx.lineWidth / 2, pixel.y * pixelSize); + ctx.lineTo(pixel.x * pixelSize + ctx.lineWidth / 2, (pixel.y + 1) * pixelSize); + ctx.stroke(); + } + if (cond2) { + ctx.beginPath(); + ctx.moveTo((pixel.x + 1) * pixelSize - ctx.lineWidth / 2, pixel.y * pixelSize); + ctx.lineTo((pixel.x + 1) * pixelSize - ctx.lineWidth / 2, (pixel.y + 1) * pixelSize); + ctx.stroke(); + } + if (cond3) { + ctx.beginPath(); + ctx.moveTo(pixel.x * pixelSize, pixel.y * pixelSize + ctx.lineWidth / 2); + ctx.lineTo((pixel.x + 1) * pixelSize, pixel.y * pixelSize + ctx.lineWidth / 2); + ctx.stroke(); + } + if (cond4) { + ctx.beginPath(); + ctx.moveTo(pixel.x * pixelSize, (pixel.y + 1) * pixelSize - ctx.lineWidth / 2); + ctx.lineTo((pixel.x + 1) * pixelSize, (pixel.y + 1) * pixelSize - ctx.lineWidth / 2); + ctx.stroke(); + } + if (!cond2 && !cond4 && cond8) ctx.fillRect((pixel.x + 1) * pixelSize - ctx.lineWidth, (pixel.y + 1) * pixelSize - ctx.lineWidth, ctx.lineWidth, ctx.lineWidth); + if (!cond2 && !cond3 && cond6) ctx.fillRect((pixel.x + 1) * pixelSize - ctx.lineWidth, pixel.y * pixelSize, ctx.lineWidth, ctx.lineWidth); + if (!cond1 && !cond3 && cond5) ctx.fillRect(pixel.x * pixelSize, pixel.y * pixelSize, ctx.lineWidth, ctx.lineWidth); + if (!cond1 && !cond4 && cond7) ctx.fillRect(pixel.x * pixelSize, (pixel.y + 1) * pixelSize - ctx.lineWidth, ctx.lineWidth, ctx.lineWidth); + } else if (view == 17) { + ctx.fillRect(pixel.x * pixelSize, (height - pixel.y) * pixelSize, pixelSize, pixelSize); + } else { + ctx.fillRect(pixel.x*pixelSize, pixel.y*pixelSize, pixelSize, pixelSize); + } + if (pixel.charge && view !== 2) { // Yellow glow on charge + if (!elements[pixel.element].colorOn) { + ctx.fillStyle = "rgba(255,255,0,0.5)"; + ctx.fillRect(pixel.x*pixelSize, pixel.y*pixelSize, pixelSize, pixelSize); + } + } + } + if (view == 15) { + // TRACK READ NOISE + for (let n = 0; n < 3; n++) { + const number = Math.floor(Math.random() * height); + ctx.globalAlpha = Math.random(); + ctx.fillStyle = "#fff"; + ctx.fillRect(0, (number + 0.5) * pixelSize, width * pixelSize, 0.2); + ctx.globalAlpha = 1; + } + const {font, textAlign} = ctx; + ctx.font = "30px VCR"; + ctx.textAlign = "start"; + ctx.fillText(paused ? "PAUSE" : "PLAY", (0.025 * width) * pixelSize, (0.025 * width) * pixelSize + 15); + if (paused) { + ctx.fillRect((0.05 * width) * pixelSize + ctx.measureText("PAUSE").width, (0.025 * width) * pixelSize - 7.5, 5, 22.5); + ctx.fillRect((0.05 * width) * pixelSize + ctx.measureText("PAUSE").width + 8, (0.025 * width) * pixelSize - 7.5, 5, 22.5); + } else { + ctx.fillStyle = "#fff"; + ctx.beginPath(); + ctx.moveTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width, (0.025 * width) * pixelSize - 7.5); + ctx.lineTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width, (0.025 * width) * pixelSize + 15); + ctx.lineTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width + 17.5, (0.025 * width) * pixelSize + 3.75); + ctx.lineTo((0.05 * width) * pixelSize + ctx.measureText("PLAY").width, (0.025 * width) * pixelSize - 7.5); + ctx.fill(); + } + const base = Math.floor(pixelTicks / tps); + const seconds = base % 60 + ""; + const minutes = Math.floor(base / 60) % 60 + ""; + const hours = Math.floor(base / 60 / 60) + ""; + ctx.textAlign = "end"; + ctx.fillText(`${hours.padStart(2, "0")}:${minutes.padStart(2, "0")}:${seconds.padStart(2, "0")}`, (0.975 * width) * pixelSize, (0.025 * width) * pixelSize + 15); + ctx.font = font; + ctx.textAlign = textAlign; + } + if (ctx.globalAlpha < 1) { + ctx.globalAlpha = 1; + } + + if (elements[currentElement].maxSize < mouseSize) { + var mouseOffset = Math.trunc(elements[currentElement].maxSize/2); + } + else { + var mouseOffset = Math.trunc(mouseSize/2); + } + var topLeft = [mousePos.x-mouseOffset,mousePos.y-mouseOffset]; + var bottomRight = [mousePos.x+mouseOffset,mousePos.y+mouseOffset]; + // Draw a square around the mouse + ctx.strokeStyle = "white"; + ctx.strokeRect(topLeft[0]*pixelSize,topLeft[1]*pixelSize,(bottomRight[0]-topLeft[0]+1)*pixelSize,(bottomRight[1]-topLeft[1]+1)*pixelSize); + // draw one transparent pixel in the center + if (settings.precision) { + ctx.fillStyle = "rgba(255,255,255,0.5)"; + ctx.fillRect(mousePos.x*pixelSize,mousePos.y*pixelSize,pixelSize,pixelSize); + } + if ((!paused) || forceTick) {pixelTicks++}; + } else oldDrawPixels.apply(this, arguments); + } +}())); +} \ No newline at end of file From ffd61ea2d36cc56de87b0f5f28d46d4c8ef54532 Mon Sep 17 00:00:00 2001 From: Alexthetransfem <124483815+theenchantedsword@users.noreply.github.com> Date: Thu, 15 Feb 2024 16:02:12 -0600 Subject: [PATCH 43/53] Create plants.js --- mods/plants.js | 1190 ++++++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 1190 insertions(+) create mode 100644 mods/plants.js diff --git a/mods/plants.js b/mods/plants.js new file mode 100644 index 00000000..dd304907 --- /dev/null +++ b/mods/plants.js @@ -0,0 +1,1190 @@ +//This mod was made by Adora the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok. +let fruits = ["plum", "peach", "pear", "orange", "apple", "cherry", "mango"]; +let vineExclude = ["tomato", "grape", "fruit_vine", "kiwi"]; +let vines = ['tomato', 'grape', 'kiwi']; +let bushes = ["blackberry", "blueberry", "raspberry"]; +let allFruits = fruits.concat(vines, bushes) +function interpolateRgb(rgb1, rgb2, ratio) { + const interpolatedRgb = { + r: Math.round(rgb1.r + (rgb2.r - rgb1.r) * ratio), + g: Math.round(rgb1.g + (rgb2.g - rgb1.g) * ratio), + b: Math.round(rgb1.b + (rgb2.b - rgb1.b) * ratio), + }; + return interpolatedRgb; +} + +elements.fruit_branch = { + color: elements.tree_branch.color, + behavior: [ + "CR:fruit_leaves,fruit_branch%2|CR:fruit_leaves,fruit_leaves,fruit_leaves,fruit_branch%2|CR:fruit_leaves,fruit_branch%2", + "XX|XX|XX", + "XX|XX|XX", + ], + tempHigh: 100, + stateHigh: "wood", + tempLow: -30, + stateLow: "wood", + category: "life", + burn: 40, + burnTime: 50, + burnInto: ["sap","ember","charcoal"], + hidden: true, + state: "solid", + density: 1500, + hardness: 0.15, + breakInto: ["sap","sawdust"], + seed: "apple_seed", + tick: function(pixel){ + for(var i = 0; i < adjacentCoords.length; i++){ + let x = pixel.x+adjacentCoords[i][0]; + let y = pixel.y+adjacentCoords[i][1]; + if(isEmpty(x, y) || outOfBounds(x, y)) { continue; } + let pixel2 = pixelMap[x][y]; + if(pixel2.element == "fruit_branch" || pixel2.element == "fruit_leaves" || pixel2.element == "wood"){ + if(pixel.fruit && !pixel2.fruit){ + pixel2.fruit = pixel.fruit; + } else if (!pixel.fruit && pixel2.fruit){ + pixel.fruit = pixel2.fruit; + } + } + } + } +} +elements.fruit_leaves = { + color: elements.plant.color, + behavior: [ + "XX|XX|XX", + "XX|XX|XX", + "XX|XX|XX", + ], + reactions: { + "vinegar": { elem1:"dead_plant", elem2:null, chance:0.035 }, + "baking_soda": { elem1:"dead_plant", elem2:null, chance:0.01 }, + "bleach": { elem1:"dead_plant", elem2:null, chance:0.05 }, + "alcohol": { elem1:"dead_plant", elem2:null, chance:0.035 } + }, + category:"life", + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -1.66, + stateLow: "frozen_plant", + burn:65, + burnTime:60, + burnInto: "dead_plant", + breakInto: "dead_plant", + state: "solid", + density: 1050, + hidden: true, + tick: function(pixel){ + if(pixelTicks == pixel.start + 1 && pixel.blooming == undefined){ + if(Math.floor(Math.random() * 3) == 2){ + pixel.blooming = true; + pixel.color = "#FFE2E2"; + } else { + pixel.blooming = false; + } + } + for(var i = 0; i < adjacentCoords.length; i++){ + let x = pixel.x+adjacentCoords[i][0]; + let y = pixel.y+adjacentCoords[i][1]; + if(isEmpty(x, y) || outOfBounds(x, y)) { continue; } + let pixel2 = pixelMap[x][y]; + if(pixel2.element == "fruit_branch" || pixel2.element == "fruit_leaves" || pixel2.element == "wood" || (elements[pixel2.element].properties && elements[pixel2.element].properties.type == "fruit")){ + if(pixel.fruit && !pixel2.fruit){ + pixel2.fruit = pixel.fruit; + } else if (!pixel.fruit && pixel2.fruit){ + pixel.fruit = pixel2.fruit; + } + } + } + if(pixel.blooming){ + if(pixelTicks > pixel.start + 150){ + if(Math.floor(Math.random() * 400) == 3){ + if(pixel.fruit){ + if(pixel.fruit == "random"){ + changePixel(pixel, fruits[Math.floor(Math.random() * fruits.length)]); + } else { + changePixel(pixel, pixel.fruit); + } + } + } + } + } + } +} + +elements.apple_seed = { + color: "#1A0E00", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves" || pixelMap[pixel.x][pixel.y+1].element == "wood"){ + pixelMap[pixel.x][pixel.y+1].fruit = "apple"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"apple" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.apple = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: "#ff0004", + category: "food", + breakInto: "juice", + breakIntoColor: "#FF4747", + isFood: true, + properties: { + fruit: "apple", + type: "fruit", + } +} +elements.pear_seed = { + color: "#1A0E00", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "pear"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"pear" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.pear = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: "#97FF43", + category: "food", + breakInto: "juice", + breakIntoColor: "#ABFF8D", + isFood: true, + properties: { + fruit: "pear", + type: "fruit", + } +} +elements.cherry_seed = { + color: "#b56233", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "cherry"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"cherry" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.cherry = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: "#750000", + category: "food", + breakInto: "juice", + breakIntoColor: "#8a0000", + isFood: true, + properties: { + fruit: "cherry", + type: "fruit", + } +} +elements.milk = { + color: "#fafafa", + behavior: behaviors.LIQUID, + onMix: function(milk1, milk2) { + if (shiftDown && Math.random() < 0.01) { + changePixel(milk1,"butter") + } + }, + reactions: { + "melted_chocolate": { elem1:"chocolate_milk", elem2:null }, + "chocolate": { elem1:"chocolate_milk", elem2:"melted_chocolate", chance:0.05 }, + "coffee_ground": { elem1:"chocolate_milk", chance:0.05 }, + "juice": { elem1:"fruit_milk", elem2:null, chance:0.05, func: function(pixel1, pixel2){ + let newrgb = interpolateRgb(getRGB('rgb(250,250,250)'), getRGB(pixel2.color), 0.25); + pixel1.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + }}, + "soda": { elem1:"pilk", elem2:null, chance:0.1 }, + "yolk": { elem1:"eggnog", elem2:null, chance:0.1 }, + "dirt": { elem1: null, elem2: "mud" }, + "sand": { elem1: null, elem2: "wet_sand" }, + "clay_soil": { elem1: null, elem2: "clay" }, + "caramel": { color1:"#C8B39A", elem2:null, chance:0.05 }, + "sugar": { elem2:null, chance:0.005}, + }, + tempLow: 0, + stateLow: "ice_cream", + stateLowColorMultiplier: [0.97,0.93,0.87], + tempHigh: 93, + stateHigh: "yogurt", + viscosity: 1.5, + category: "liquids", + state: "liquid", + density: 1036.86, + isFood: true +} +elements.cream = { + color: "#f7f7f7", + behavior: behaviors.LIQUID, + onMix: function(milk1, milk2) { + if ((shiftDown && Math.random() < 0.01) || (elements[milk2.element].id === elements.milk.id && Math.random() < 0.00025)) { + changePixel(milk1,"butter") + } + }, + reactions: { + "dirt": { elem1: null, elem2: "mud" }, + "sand": { elem1: null, elem2: "wet_sand" }, + "clay_soil": { elem1: null, elem2: "clay" }, + "melted_chocolate": { color1:"#664934", elem2:null }, + "chocolate": { color1:"#664934", elem2:"melted_chocolate", chance:0.05 }, + "juice": { elem1:"fruit_milk", elem2:null, chance:0.05, func: function(pixel1, pixel2){ + let newrgb = interpolateRgb(getRGB('rgb(250,250,250)'), getRGB(pixel2.color), 0.25); + pixel1.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + }}, + "soda": { elem1:"pilk", elem2:null, chance:0.1 }, + "yolk": { elem1:"#eggnog", elem2:null, chance:0.1 }, + "caramel": { color1:"#C8B39A", chance:0.05 }, + "sugar": { elem2:null, chance:0.005}, + }, + viscosity: 1.5, + tempHigh: 1000, + stateHigh: ["smoke","smoke","smoke","steam","steam","calcium"], + tempLow: 0, + stateLow: "ice_cream", + stateLowColorMultiplier: 0.97, + category: "liquids", + hidden: true, + isFood: true, + state: "liquid", + density: 959.97, +} +function getRGB(rgb){ + let rgb2 = rgb.replace(")", "").replace("rgb(", "").replace(/,/g, "r").split("r") + return { r: parseInt(rgb2[0]), g: parseInt(rgb2[1]), b: parseInt(rgb2[2]) }; +} +elements.peach = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: ["#ffb485", "#ffa770", "#ff7b61", "#ff512e", "#ff350d"], + category: "food", + breakInto: "juice", + breakIntoColor: "#ffa74f", + isFood: true, + properties: { + fruit: "peach", + type: "fruit", + } +} +elements.peach_seed = { + color: "#240c00", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "peach"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"peach" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.plum = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: "#1c0030", + category: "food", + breakInto: "juice", + breakIntoColor: "#d2880a", + isFood: true, + properties: { + fruit: "plum", + type: "fruit", + } +} +elements.plum_seed = { + color: "#240c00", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "plum"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"plum" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.juice.reactions.juice = { + func: function(pixel1, pixel2){ + if(pixel1.color != pixel2.color){ + if(Math.floor(Math.random() * 1000) == 1){ + let newrgb = interpolateRgb(getRGB(pixel1.color), getRGB(pixel2.color), 0.5); + pixel1.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + pixel2.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + } + } + } +} +elements.juice.onMix = function(pixel){ + let num = Math.floor(Math.random() * 4); + let x = pixel.x + adjacentCoords[num][0]; + let y = pixel.y + adjacentCoords[num][1]; + if(!isEmpty(x,y) && !outOfBounds(x,y)){ + let pixel2 = pixelMap[x][y]; + if(pixel.color != pixel2.color && pixel2.element == "juice"){ + let condition; + if(shiftDown == 0){ + condition = (Math.floor(Math.random() * 2) == 1); + } else { + condition = true; + } + if(condition){ + let newrgb = interpolateRgb(getRGB(pixel.color), getRGB(pixel2.color), 0.5); + pixel.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + pixel2.color = `rgb(${parseInt(newrgb.r)},${parseInt(newrgb.g)},${parseInt(newrgb.b)})`; + } + } + } + } +elements.vine.behavior = [["XX", "ST:vine", "XX"],["ST:vine", "XX", "ST:vine"],["XX", "ST:vine AND M1", "XX"]] +elements.apricot = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: ["#ffa100", "#FF5D00", "#FF7A00", "#FF9700"], + category: "food", + breakInto: "juice", + breakIntoColor: "#ffa836", + isFood: true, + properties: { + fruit: "apricot", + type: "fruit", + } +} +elements.apricot_seed = { + color: "#291300", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "apricot"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"apricot" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.orange = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: "#FFB400", + category: "food", + breakInto: "juice", + breakIntoColor: "#FFDB00", + isFood: true, + properties: { + fruit: "orange", + type: "fruit", + } +} +elements.orange_seed = { + color: "#291300", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "orange"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"orange" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.random_seed = { + color: "#291300", + tick: function(pixel) { + if(pixel.start == pixelTicks){ + pixel.fruit = fruits[Math.floor(Math.random() * fruits.length)]; + } + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = pixel.fruit; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.multi_seed = { + color: "#291300", + tick: function(pixel) { + pixel.fruit = fruits[Math.floor(Math.random() * fruits.length)] + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "random"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +elements.fruit_vine = { + category: "life", + color: elements.plant.color, + behavior: [["XX", "ST:fruit_vine AND ST:wood", "XX"], ["ST:fruit_vine AND ST:wood", "XX", "ST:fruit_vine AND ST:wood"], ["XX", "ST:fruit_vine AND M1 AND ST:wood", "XX"]], + properties: { + age: 0, + }, + tick: function(pixel){ + if(Math.floor(Math.random() * 100) == 1 && pixel.age > 25 && pixel.age < 500){ + for(var i = 0; i < squareCoords.length; i++){ + let x1 = pixel.x + squareCoords[i][0]; + let y1 = pixel.y + squareCoords[i][1]; + if(!isEmpty(x1,y1) && !outOfBounds(x1,y1) && !vineExclude.includes(pixelMap[x1][y1].element)){ + let randomNum = Math.floor(Math.random() * 4); + let x2 = x1 + squareCoords[randomNum][0]; + let y2 = y1 + squareCoords[randomNum][1]; + if(isEmpty(x2,y2) && !outOfBounds(x2,y2)){ + createPixel("fruit_vine", x2, y2); + pixelMap[x2][y2].fruit = pixel.fruit; + } + } + } + } + pixel.age += 1; + if(pixel.fruit){ + for(var i = 0; i < adjacentCoords.length; i++){ + let x = pixel.x + adjacentCoords[i][0]; + let y = pixel.y + adjacentCoords[i][1]; + if(isEmpty(x,y) && !outOfBounds(x,y) && Math.floor(Math.random() * 1000) == 5){ + createPixel(pixel.fruit, x, y); + } + } + } + if(!pixel.fruit){ + for(var i = 0; i < squareCoords.length; i++){ + let x = pixel.x + squareCoords[i][0]; + let y = pixel.y + squareCoords[i][1]; + if(isEmpty(x,y) || outOfBounds(x,y)){ continue; } + let pixel2 = pixelMap[x][y]; + if(pixel2.fruit){ + pixel.fruit = pixel2.fruit; + } else { continue; } + } + } + } +} +elements.grape.behavior = [["XX", "ST:fruit_vine", "XX"], ["ST:fruit_vine", "XX", "ST:fruit_vine"], ["M2", "ST:fruit_vine AND M1", "M2"]]; +elements.tomato.behavior = elements.grape.behavior; +elements.tomato_seed = { + color: "#FFFAAD", + category: "life", + behavior: behaviors.POWDER, + tick: function(pixel){ + if(pixel.age > 40){ + changePixel(pixel, "fruit_vine"); + pixel.fruit = "tomato"; + } + pixel.age += 1; + }, + properties: { + age: 0, + }, +} +elements.grape_seed = { + color: "#231A00", + category: "life", + behavior: behaviors.POWDER, + tick: function(pixel){ + if(pixel.age > 40){ + changePixel(pixel, "fruit_vine"); + pixel.fruit = "grape"; + } + pixel.age += 1; + }, + properties: { + age: 0, + }, +} +elements.kiwi = { + behavior: elements.grape.behavior, + color: "#403000", + category: "food", + breakInto: "juice", + breakIntoColor: "#21A800", + isFood: true, + properties: { + type: "fruit", + } +} +elements.kiwi_seed = { + color: "#231A00", + category: "life", + behavior: behaviors.POWDER, + tick: function(pixel){ + if(pixel.age > 40){ + changePixel(pixel, "fruit_vine"); + pixel.fruit = "kiwi"; + } + pixel.age += 1; + }, + properties: { + age: 0, + }, +} +elements.bush_base = { + color: elements.wood.color, + behavior: [ + ["CR:bush_cane%25", "XX", "CR:bush_cane%25"], + ["XX", "XX", "XX"], + ["XX", "XX", "XX"] + ], + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -40, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + tick: function(pixel){ + let caneCoords = [[-1,-1],[1,-1]]; + for(var i = 0; i < caneCoords.length; i++){ + let x = pixel.x + caneCoords[i][0]; + let y = pixel.y + caneCoords[i][1]; + if(!isEmpty(x,y) && !outOfBounds(x,y)){ + let pixel2 = pixelMap[x][y]; + if(pixel2.element == "bush_cane" && !pixel2.fruit){ + pixel2.fruit = pixel.fruit; + } + } + } + } +}; +elements.bush_cane = { + color: elements.wood.color, + tick: function(pixel){ + if(pixel.age < 200 && Math.floor(Math.random() * 40) == 1){ + if(!outOfBounds(pixel.x,pixel.y-1)){ + if(isEmpty(pixel.x,pixel.y-1)){ + createPixel("bush_cane",pixel.x,pixel.y-1); + if(pixel.fruit){ + let pixel2 = pixelMap[pixel.x][pixel.y-1]; + pixel2.fruit = pixel.fruit; + pixel2.age = pixel.age; + } + } + } + } + if(pixel.fruit && Math.floor(Math.random() * 400) == 1 && pixel.age > 200){ + for(var i = 0; i < adjacentCoords.length; i++){ + let x = pixel.x + adjacentCoords[i][0]; + let y = pixel.y + adjacentCoords[i][1]; + if(isEmpty(x,y) && !outOfBounds(x,y)){ + createPixel("fruit_leaves", x, y); + pixelMap[x][y].fruit = pixel.fruit; + pixel.blooming = trueFalse(1, 1)[Math.floor(Math.random() * 2)]; + } + } + } + pixel.age += 1; + }, + properties: { + age: 0, + }, + category: "life", + tempLow: -2, + stateLow: "frozen_plant", +} +function trueFalse(numTrue, numFalse){ + let list = []; + for(var i = 0; i < numTrue; i++){ + list.push(true); + } + for(var i = 0; i < numFalse; i++){ + list.push(false); + } + return list; +} +elements.raspberry_seed = { + color: "#ffe099", + behavior: behaviors.STURDYPOWDER, + category: "life", + properties: { + age: 0, + }, + tick: function(pixel){ + if(pixel.age > 40){ + let x1 = pixel.x - 1; + let y = pixel.y; + let x2 = pixel.x + 1; + if(isEmpty(x1,y) && !outOfBounds(x1,y)){ + createPixel("bush_base", x1, y); + pixelMap[x1][y].fruit = "raspberry"; + } + if(isEmpty(x2,y) && !outOfBounds(x2,y)){ + createPixel("bush_base", x2, y); + pixelMap[x2][y].fruit = "raspberry"; + } + if(!isEmpty(x1, y) && !isEmpty(x2, y)){ + deletePixel(pixel.x, pixel.y); + } + } + pixel.age += 1; + } +} +elements.raspberry = { + behavior: [["XX", "ST:bush_cane", "XX"],["ST:bush_cane", "XX", "ST:bush_cane"],["M2", "ST:bush_cane AND M1", "M2"]], + color: ["#b00009", "#bf000a", "#d10812", "#db1822"], + category: "food", + breakInto: "juice", + breakIntoColor: "#ff2b36", + isFood: true, + properties: { + fruit: "raspberry", + type: "fruit", + } +} +elements.blueberry_seed = { + color: "#ffe099", + behavior: behaviors.STURDYPOWDER, + category: "life", + properties: { + age: 0, + }, + tick: function(pixel){ + if(pixel.age > 40){ + let x1 = pixel.x - 1; + let y = pixel.y; + let x2 = pixel.x + 1; + if(isEmpty(x1,y) && !outOfBounds(x1,y)){ + createPixel("bush_base", x1, y); + pixelMap[x1][y].fruit = "blueberry"; + } + if(isEmpty(x2,y) && !outOfBounds(x2,y)){ + createPixel("bush_base", x2, y); + pixelMap[x2][y].fruit = "blueberry"; + } + if(!isEmpty(x1, y) && !isEmpty(x2, y)){ + deletePixel(pixel.x, pixel.y); + } + } + pixel.age += 1; + } +} +elements.blueberry = { + behavior: [["XX", "ST:bush_cane", "XX"],["ST:bush_cane", "XX", "ST:bush_cane"],["M2", "ST:bush_cane AND M1", "M2"]], + color: ["#01082b", "#060e3d", "#111b52", "#1e2866"], + category: "food", + breakInto: "juice", + breakIntoColor: "#726778", + isFood: true, + properties: { + fruit: "blueberry", + type: "fruit", + } +} +elements.blackberry_seed = { + color: "#ffe099", + behavior: behaviors.STURDYPOWDER, + category: "life", + properties: { + age: 0, + }, + tick: function(pixel){ + if(pixel.age > 40){ + let x1 = pixel.x - 1; + let y = pixel.y; + let x2 = pixel.x + 1; + if(isEmpty(x1,y) && !outOfBounds(x1,y)){ + createPixel("bush_base", x1, y); + pixelMap[x1][y].fruit = "blackberry"; + } + if(isEmpty(x2,y) && !outOfBounds(x2,y)){ + createPixel("bush_base", x2, y); + pixelMap[x2][y].fruit = "blackberry"; + } + if(!isEmpty(x1, y) && !isEmpty(x2, y)){ + deletePixel(pixel.x, pixel.y); + } + } + pixel.age += 1; + } +} +elements.blackberry = { + behavior: [["XX", "ST:bush_cane", "XX"],["ST:bush_cane", "XX", "ST:bush_cane"],["M2", "ST:bush_cane AND M1", "M2"]], + color: ["#0c0021", "#070014", "#080017", "#09001a"], + category: "food", + breakInto: "juice", + breakIntoColor: "#2e0000", + isFood: true, + properties: { + fruit: "blackberry", + type: "fruit", + } +} +elements.mango = { + behavior: [["XX", "ST:fruit_leaves AND ST:fruit_branch", "XX"],["ST:fruit_leaves AND ST:fruit_branch", "XX", "ST:fruit_leaves AND ST:fruit_branch"],["M2", "ST:fruit_leaves AND ST:fruit_branch AND M1", "M2"]], + color: ["#d63a45", "#e97341", "#9d9f3e", "#e4791b"], + category: "food", + breakInto: "juice", + breakIntoColor: "#ffa300", + isFood: true, + properties: { + fruit: "mango", + type: "fruit", + } +} +elements.mango_seed = { + color: "#240c00", + tick: function(pixel) { + if (isEmpty(pixel.x,pixel.y+1)) { + movePixel(pixel,pixel.x,pixel.y+1); + } + else { + if (Math.random() < 0.02 && pixel.age > 50 && pixel.temp < 100) { + if (!outOfBounds(pixel.x,pixel.y+1)) { + var dirtPixel = pixelMap[pixel.x][pixel.y+1]; + if (dirtPixel.element === "dirt" || dirtPixel.element === "mud" || dirtPixel.element === "sand" || dirtPixel.element === "wet_sand" || dirtPixel.element === "clay_soil" || dirtPixel.element === "mycelium") { + changePixel(dirtPixel,"root"); + } + } + if (isEmpty(pixel.x,pixel.y-1)) { + movePixel(pixel,pixel.x,pixel.y-1); + createPixel(Math.random() > 0.5 ? "wood" : "fruit_branch",pixel.x,pixel.y+1); + if (pixelMap[pixel.x][pixel.y+1].element == "fruit_branch" || pixelMap[pixel.x][pixel.y+1].element == "fruit_leaves"){ + pixelMap[pixel.x][pixel.y+1].fruit = "mango"; + } + } + } + else if (pixel.age > 1000) { + changePixel(pixel,"wood"); + } + pixel.age++; + } + doDefaults(pixel); + }, + properties: { + "age":0, + fruit:"mango" + }, + tempHigh: 100, + stateHigh: "dead_plant", + tempLow: -2, + stateLow: "frozen_plant", + burn: 65, + burnTime: 15, + category: "life", + state: "solid", + density: 1500, + cooldown: defaultCooldown, + seed: true, +}; +function conditionTrue(condition, pixel){ + let p = pixel; + let string = ""; + condition = condition.split("!OR").join("||").split("&AND").join("&&").split("\"").join("") + + condition = eval(condition); + return condition; +} +let ifCondition = ""; +let currentProp = ""; +let currentPropValue = ""; +elements.propmachine = { + name: "PropMachine", + behavior: behaviors.WALL, + category: "machines", + noMix: true, +onSelect: function(pixel) { + + let item = prompt("enter range for prop changing."); + if(/^\d+$/.test(item)){ + num4 = parseInt(item); + } else { + alert("that is not an integer."); + } + exclude2 = prompt("Enter elements to exclude, seperate them with commas. You can also enter !IF if you wish to enter conditions for it to change the property and add the exclude elements.").replace(/\s/g, ""); + if(exclude2.includes("!IF")){ + exclude2.split("!IF").join(""); + ifCondition = prompt("Enter the condition for the property to change. List of variables you can access can be found at https://5455e34a-cfe9-4576-ac9c-6e64c061433d-00-1psic9s1cgla6.kirk.replit.dev/Mods/morechemistry/conditions%20for%20if.html"); + } else { ifCondition = '1 == 1'; } + exclude2.split(","); + if(exclude2.constructor == [].constructor){ + exclude2.push("propmachine"); + } else { + exclude2 += "propmachine"; + } + var answer1 = prompt("Warning - This tool may break the simulator if used incorrectly.\n\nEnter a pixel attribute to modify:",(currentProp||undefined)); + console.log(answer1) + if (!answer1) { return } + var answer2 = prompt("Now, enter a value for "+answer1+":",(currentPropValue||undefined)); + if (!answer2) { return } + var valueL = answer2.toLowerCase(); + if (valueL === "true") { answer2 = true } + else if (valueL === "false") { answer2 = false } + else if (valueL === "null") { answer2 = null } + else if (valueL === "undefined") { answer2 = undefined } + else if (answer1 === "color" && valueL[0] === "#") { + var rgb = hexToRGB(valueL); + answer2 = "rgb("+rgb.r+","+rgb.g+","+rgb.b+")"; + } + currentProp = answer1; + currentPropValue = answer2; + console.log(answer1); + var num = parseFloat(answer2); + if (!isNaN(num)) { answer2 = num } + currentPropValue = answer2; + logMessage("Prop: "+currentProp); + logMessage("Value: "+currentPropValue); +}, + tick: function(pixel) { + if(pixel.start == pixelTicks) { + pixel.range = num4; + pixel.condition = ifCondition; + pixel.prop = currentProp; + pixel.val = currentPropValue; + } + let range = mouseRange(pixel.x, pixel.y, pixel.range); + prop({ property: pixel.prop, value: pixel.val },range, exclude2, pixel.condition); + } +} +function prop(obj, range, exclude = [], condition = ""){ + let list = []; + for (var i = 0; i < range.length; i++) { + var x = range[i][0]; + var y = range[i][1]; + if (!isEmpty(x,y,true)) { + var pixel = pixelMap[x][y]; + list.push(pixel); + } + } + for (var i = 0; i < list.length; i++) { + if (!isEmpty(list[i].x, list[i].y, true)) { + var pixel = list[i]; + if (!exclude.includes(pixel.element) && conditionTrue(condition, pixel)){ + if(/^\d+$/.test(obj.value)){ + obj.value = parseInt(obj.value); + } + if (!obj.property) { return } + if (pixel[obj.property] !== undefined && typeof pixel[obj.property] !== typeof obj.value) { + logMessage("Error: "+obj.property+" type is "+typeof pixel[obj.property]+", not "+typeof obj.value+"."); + obj.property = null; + obj.value = null; + return; + } + if (obj.property === "element") { + changePixel(pixel, obj.value); + list.splice(list.indexOf(pixel),1); + return; + } + if (obj.property === "burning" && obj.value === "true") { + pixel.burnStart = pixelTicks; + list.splice(list.indexOf(pixel),1); + return; + } + pixel[obj.property] = obj.value; + list.splice(list.indexOf(pixel),1); + } + } + } +} +elements.seed_maker = { + category: "machines", + behavior: behaviors.WALL, + tick: function(pixel){ + for(var i = 0; i < adjacentCoords.length; i++){ + let x = pixel.x + adjacentCoords[i][0]; + let y = pixel.y + adjacentCoords[i][1] + if(!isEmpty(x,y) && !outOfBounds(x,y)){ + let pixel2 = pixelMap[x][y]; + if(allFruits.includes(pixel2.element)){ + changePixel(pixel2, `${pixel2.element}_seed`) + } + } + } + } +} From 7872c7f76cc75e8b93069440507399e2b34115d8 Mon Sep 17 00:00:00 2001 From: Alexthetransfem <124483815+theenchantedsword@users.noreply.github.com> Date: Thu, 15 Feb 2024 16:03:31 -0600 Subject: [PATCH 44/53] Update morechemistry.js --- mods/morechemistry.js | 277 ++++++++++++++++++++++++++++++++---------- 1 file changed, 215 insertions(+), 62 deletions(-) diff --git a/mods/morechemistry.js b/mods/morechemistry.js index c220dfdf..bcbb9122 100644 --- a/mods/morechemistry.js +++ b/mods/morechemistry.js @@ -1,4 +1,4 @@ -//This mod was made by Alex the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok. +//This mod was made by Adora the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok. function pixelInRange(pixel, range){ let i = 0; while (i < range.length) { @@ -635,11 +635,6 @@ elements.potassiumhydroxidecrystals = { density: 2040, name: "PotassiumHydroxideCrystals", } -elements.supercooler = { - name: "SuperCooler", - category: "machines" -} -elements.supercooler.behavior = [["XX","CO:10","XX"],["CO:10","XX","CO:10"],["XX","CO:10","XX"]] elements.iron_chloride = { color: ["#010014", "#a2ff94"], reactions: { @@ -695,7 +690,7 @@ elements.kilonova = { temp: 100000000, } elements.supernova.behavior = [ ["XX", "XX", "XX"], [ "XX", "EX:80>plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,molten_iron,molten_uranium,oxygen,molten_sodium,sulfur_gas,neon,chlorine,molten_calcium,molten_nickel,molten_copper,molten_zinc,gallium_gas,hydrogen,hydrogen,hydrogen,hydrogen,helium,helium,helium AND CH:NeutronStar", "XX" ], ["XX", "XX", "XX"] ] -elements.kilonova.behavior = [ ["XX", "XX", "XX"], [ "XX", "EX:200>plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,plasma,molten_iron,molten_uranium,molten_lead,oxygen,molten_sodium,molten_gold,molten_tungsten,sulfur_gas,neon,chlorine,molten_calcium,molten_nickel,molten_copper,molten_zinc,gallium_gas,hydrogen,hydrogen,hydrogen,hydrogen,hydrogen,helium,helium,helium,helium AND CH:void", "XX" ], ["XX", "XX", "XX"] ] +elements.kilonova.behavior = [ ["XX", "XX", "XX"], [ "XX", "EX:200>plasma,plasma,plasma,plasma,plasma,plasma,molten_iron,molten_uranium,molten_lead,oxygen,molten_sodium,molten_gold,molten_tungsten,sulfur_gas,neon,chlorine,molten_calcium,molten_nickel,molten_copper,molten_zinc,gallium_gas,hydrogen,hydrogen,hydrogen,hydrogen,hydrogen,helium,helium,helium,helium AND CH:void", "XX" ], ["XX", "XX", "XX"] ] elements.NeutronStar = { behavior: [["XX", "XX", "XX"], ["CR:light", "XX", "CR:light"], ["XX", "XX", "XX"]], name: "NeutronStar", @@ -1057,52 +1052,12 @@ elements.specialmixer = { mix(range, exclude); } } + let num4 = 0; let exclude2 = []; let property1 = ""; let value2 = ""; -elements.propmachine = { - name: "PropMachine", - behavior: behaviors.WALL, - category: "machines", - noMix: true, - onSelect: function(pixel) { - let item = prompt("enter range for prop changing."); - if(/^\d+$/.test(item)){ - num4 = parseInt(item); - } else { - alert("that is not an integer."); - } - exclude2 = prompt("Enter elements to exclude, seperate them with commas.").replace(/\s/g, "").split(","); - exclude2.push("propmachine"); - var answer1 = prompt("Warning - This tool may break the simulator if used incorrectly.\n\nEnter a pixel attribute to modify:",(currentProp||undefined)); - if (!answer1) { return } - var answer2 = prompt("Now, enter a value for "+answer1+":",(currentPropValue||undefined)); - if (!answer2) { return } - var valueL = answer2.toLowerCase(); - if (valueL === "true") { answer2 = true } - else if (valueL === "false") { answer2 = false } - else if (valueL === "null") { answer2 = null } - else if (valueL === "undefined") { answer2 = undefined } - else if (answer1 === "color" && valueL[0] === "#") { - var rgb = hexToRGB(valueL); - answer2 = "rgb("+rgb.r+","+rgb.g+","+rgb.b+")"; - } - currentProp = answer1; - var num = parseFloat(answer2); - if (!isNaN(num)) { answer2 = num } - currentPropValue = answer2; - logMessage("Prop: "+currentProp); - logMessage("Value: "+currentPropValue); - }, - tick: function(pixel) { - if(pixel.start == pixelTicks) { - pixel.range = num4; - } - let range = mouseRange(pixel.x, pixel.y, pixel.range); - prop({ property: property1, value: value2 },range, exclude2); - } - } + let item = ""; elements.improvedsensor = { behavior: behaviors.WALL, @@ -1196,30 +1151,111 @@ elements.incinerator = { color: 'rgb(255, 50, 0)', noMix: true, } -function prop(obj, range, exclude = []){ +function conditionTrue(condition, pixel){ + let p = pixel; + let string = ""; + condition = condition.split("!OR").join("||").split("&AND").join("&&").split("\"").join("") + + condition = eval(condition); + return condition; +} +let ifCondition = ""; +let currentProp = ""; +let currentPropValue = ""; +elements.propmachine = { + name: "PropMachine", + behavior: behaviors.WALL, + category: "machines", + noMix: true, +onSelect: function(pixel) { + + let item = prompt("enter range for prop changing."); + if(/^\d+$/.test(item)){ + num4 = parseInt(item); + } else { + alert("that is not an integer."); + } + exclude2 = prompt("Enter elements to exclude, seperate them with commas. You can also enter !IF if you wish to enter conditions for it to change the property and add the exclude elements.").replace(/\s/g, ""); + if(exclude2.includes("!IF")){ + exclude2.split("!IF").join(""); + ifCondition = prompt("Enter the condition for the property to change. A list of variables can be seen at the bottom of the page. you cannot use \"\" but you can use `` and ''."); + } else { ifCondition = '1 == 1'; } + exclude2.split(","); + if(exclude2.constructor == [].constructor){ + exclude2.push("propmachine"); + } else { + exclude2 += "propmachine"; + } + var answer1 = prompt("Warning - This tool may break the simulator if used incorrectly.\n\nEnter a pixel attribute to modify:",(currentProp||undefined)); + console.log(answer1) + if (!answer1) { return } + var answer2 = prompt("Now, enter a value for "+answer1+":",(currentPropValue||undefined)); + if (!answer2) { return } + var valueL = answer2.toLowerCase(); + if (valueL === "true") { answer2 = true } + else if (valueL === "false") { answer2 = false } + else if (valueL === "null") { answer2 = null } + else if (valueL === "undefined") { answer2 = undefined } + else if (answer1 === "color" && valueL[0] === "#") { + var rgb = hexToRGB(valueL); + answer2 = "rgb("+rgb.r+","+rgb.g+","+rgb.b+")"; + } + currentProp = answer1; + currentPropValue = answer2; + console.log(answer1); + var num = parseFloat(answer2); + if (!isNaN(num)) { answer2 = num } + currentPropValue = answer2; + logMessage("Prop: "+currentProp); + logMessage("Value: "+currentPropValue); +}, + tick: function(pixel) { + if(pixel.start == pixelTicks) { + pixel.range = num4; + pixel.condition = ifCondition; + pixel.prop = currentProp; + pixel.val = currentPropValue; + } + let range = mouseRange(pixel.x, pixel.y, pixel.range); + prop({ property: pixel.prop, value: pixel.val },range, exclude2, pixel.condition); + } +} +function prop(obj, range, exclude = [], condition = ""){ + let list = []; for (var i = 0; i < range.length; i++) { - if (!isEmpty(range[i][0], range[i][1], true)) { - var pixel = pixelMap[range[i][0]][range[i][1]]; - if (!exclude.includes(pixel.element)){ + var x = range[i][0]; + var y = range[i][1]; + if (!isEmpty(x,y,true)) { + var pixel = pixelMap[x][y]; + list.push(pixel); + } + } + for (var i = 0; i < list.length; i++) { + if (!isEmpty(list[i].x, list[i].y, true)) { + var pixel = list[i]; + if (!exclude.includes(pixel.element) && conditionTrue(condition, pixel)){ if(/^\d+$/.test(obj.value)){ obj.value = parseInt(obj.value); } - if (!currentProp) { return } - if (pixel[currentProp] !== undefined && typeof pixel[currentProp] !== typeof currentPropValue) { - logMessage("Error: "+currentProp+" type is "+typeof pixel[currentProp]+", not "+typeof currentPropValue+"."); - currentProp = null; - currentPropValue = null; + if (!obj.property) { return } + if (pixel[obj.property] !== undefined && typeof pixel[obj.property] !== typeof obj.value) { + logMessage("Error: "+obj.property+" type is "+typeof pixel[obj.property]+", not "+typeof obj.value+"."); + obj.property = null; + obj.value = null; return; } - if (currentProp === "element") { - changePixel(pixel, currentPropValue); + if (obj.property === "element") { + changePixel(pixel, obj.value); + list.splice(list.indexOf(pixel),1); return; } - if (currentProp === "burning" && currentPropValue === "true") { + if (obj.property === "burning" && obj.value === "true") { pixel.burnStart = pixelTicks; + list.splice(list.indexOf(pixel),1); return; } - pixel[currentProp] = currentPropValue; + pixel[obj.property] = obj.value; + list.splice(list.indexOf(pixel),1); } } } @@ -1307,3 +1343,120 @@ function pull(range, pixel1, include = []){ } } } + +let prevNum; +elements.etemper = { + name: "E-Temper", + category: "machines", + conduct: 1, + insulate: true, + behavior: behaviors.WALL, + onSelect: function(pixel){ + prevNum = parseInt(prompt("Enter the temperature you want it set to.", (prevNum || undefined))); + }, + tick: function(pixel){ + if(pixel.start === pixelTicks){ + pixel.clone = `Temp: ${prevNum}`; + pixel.Temp = prevNum; + } + for (var i = 0; i < adjacentCoords.length; i++){ + let x = pixel.x + adjacentCoords[i][0]; + let y = pixel.y + adjacentCoords[i][1]; + if(outOfBounds(x,y)){ continue; } + if(isEmpty(x,y)){ continue; } + let pixel2 = pixelMap[x][y]; + + if (pixel2.temp < pixel.Temp && pixel.charge > 0 ){ + pixel2.temp += pixel.Temp / 6; + } + + } + }, +} +let prevString; +elements.sign = { + name: "Sign", + category: "machines", + onSelect: function(){ + prevString = prompt("Enter the text you want it to say.", (prevString || undefined)); + }, + tick: function(pixel){ + if(pixel.start == pixelTicks){ + pixel.clone = prevString; + } + } +} +document.body.innerHTML += ` +these are all properties of the pixel. another way to find pixel properties is using debug on a pixel, it will tell you the property and the value, like x and y, or, in plants.js, fruit. + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ Variable + + Definition +
+ p.color + + The color of the pixel. it is defined as an RGB value. +
+ p.x and p.y + + The x and y positions of the pixel. +
+ p.element + + The element of the pixel. +
+ p.clone + + Specific to cloners, specifies what the cloner clones. +
+ wc and lc + + Specific to saplings, specifies what colour the wood is (wc) and what colour the leaves are (lc). +
+ p.start + + The start tick of the pixel. +
+ p.tick + + the amount of ticks that have happened so far in the game. +
+` +document.getElementById("extraInfo").innerHTML = ` +Changelog(NEW)FeedbackWikiRedditDiscord • Install OfflineVariables

v1.9.3 • 559 elements, with 0 hidden.

©2021-2024. All Rights Reserved.

+` From 4b19b0bedf0acb8aea7bf7642f9facd557eb19a6 Mon Sep 17 00:00:00 2001 From: Alexthetransfem <124483815+theenchantedsword@users.noreply.github.com> Date: Thu, 15 Feb 2024 16:04:12 -0600 Subject: [PATCH 45/53] Update allliquids.js --- mods/allliquids.js | 37 ++++++++++++++++++++----------------- 1 file changed, 20 insertions(+), 17 deletions(-) diff --git a/mods/allliquids.js b/mods/allliquids.js index ae92e535..80a6bfd1 100644 --- a/mods/allliquids.js +++ b/mods/allliquids.js @@ -1,21 +1,24 @@ +//This mod was made by Adora the transfem, https://discord.com/users/778753696804765696 on discord and https://www.tiktok.com/@alextheagenenby?_t=8hoCVI3NRhu&_r=1 on tiktok. let liquid = [["XX", "XX", "XX"], ["M1", "XX", "M1"], ["M1", "M2", "M1"]] -for (var element in elements){ - - let a = elements[element].behavior; - console.log(a, elements[element], liquid) - if(a != undefined && typeof a != 'function'){ - let i = 0; - while (i < a.length){ - if(typeof a[i] == "string"){ - a[i] = a[i].split("|"); - i += 1; - } else { - i += 1; +runAfterLoad(function(){ + for (var element in elements){ + elements[element].noMix = false; + let a = elements[element].behavior; + console.log(a, elements[element], liquid) + if(a != undefined && typeof a != 'function'){ + let i = 0; + while (i < a.length){ + if(typeof a[i] == "string"){ + a[i] = a[i].split("|"); + i += 1; + } else { + i += 1; + } } + elements[element].behavior = [[a[0][0], a[0][1], a[0][2]], [`${a[1][0]} AND M1`, a[1][1], `${a[1][2]} AND M1`], [`${a[2][0]} AND M1`, `${a[2][1]} AND M2`, `${a[2][2]} AND M1`]]; + } else { + elements[element].behavior = liquid; } - elements[element].behavior = [[a[0][0], a[0][1], a[0][2]], [`${a[1][0]} AND M1`, a[1][1], `${a[1][2]} AND M1`], [`${a[2][0]} AND M1`, `${a[2][1]} AND M2`, `${a[2][2]} AND M1`]]; - } else { - elements[element].behavior = liquid; + } - -} +}); From aad1b147125998fc4ca1f1f35485c0bd5b18cd78 Mon Sep 17 00:00:00 2001 From: Alexthetransfem <124483815+theenchantedsword@users.noreply.github.com> Date: Thu, 15 Feb 2024 16:14:22 -0600 Subject: [PATCH 46/53] Update mod-list.html --- mod-list.html | 7 ++++--- 1 file changed, 4 insertions(+), 3 deletions(-) diff --git a/mod-list.html b/mod-list.html index ec35b37d..fb909973 100644 --- a/mod-list.html +++ b/mod-list.html @@ -117,7 +117,7 @@ Tools & Settings adjustablepixelsize.jsAllows you to set the pixelSize with a URL parameterAlice -betaworldgen.jsadds a more advanced world generation to the gameAlex +betaworldgen.jsadds a more advanced world generation to the gameAdora betterModManager.jsImprovements to the Mod Managerggod betterSettings.jsAdds additional settings and functionalityggod betterStats.jsSeparate “real” and “set” TPS, meaning you can see what the TPS actually is, instead of only seeing what it’s set tomollthecoder @@ -168,7 +168,7 @@ metals.jsAdds several metalsAlice mixture.jsAllows many chemicals to be mixedlllllllllwith10ls more_gold.jsAdds Green Goldpixelegend4 -morechemistry.jsAdds many new chemicals and compounds as well as some new machinesAlex +morechemistry.jsAdds many new chemicals and compounds as well as some new machinesAdora moreliquids.jsAdds various liquidste-agma-at nellfire.jsAdds a weird transforming flame and several rock typesAlice Neutronium Mod.jsVariety of scientific elements
ExplosionsStellarX20 @@ -235,6 +235,7 @@ nocancer2.jsRemoves cancer from the game altogether. May be incompatible with other mods that spawn cancermollthecoder nograssgrow.jsPrevents Grass from growingmollthecoder pizzasstuff.jsNew animals, foods, and plants_ilikepizza_ +plants.jsAdds a wide variety of new plants and fruitsAdora primordial_birthpool.jsA cross between Primordial Soup and Birthpool. Requires F&MAlice spring.jsMany nature elements, like sakura trees, butterflies, beehives, and moreR74n the_ground_og.jsSimplified and more stable version of the_ground.jsAlice @@ -244,7 +245,7 @@ Fun & Games all_around_fillers.jsAdds directional Filler variantsidk73248 -allliquids.jsMade all elements liquidsAlex +allliquids.jsMade all elements liquidsAdora amogus.jsAdds a small amogus structureAlice collab_mod.jsCreated by multiple people, adds random thingsmrapple, ilikepizza, stefanblox elem3.jsAdds all elements and combinations from Elemental 3 [Very Large]Sophie From 99ef7f15862f35c93c04e26f00a7716b9bdb0b2f Mon Sep 17 00:00:00 2001 From: sb <155691462+stefanblox@users.noreply.github.com> Date: Thu, 15 Feb 2024 19:50:26 -0300 Subject: [PATCH 47/53] sbstuff 2.7 unstain --- mods/sbstuff.js | 62 ++++++++++++++++++++++++++++++++++++++++++------- 1 file changed, 53 insertions(+), 9 deletions(-) diff --git a/mods/sbstuff.js b/mods/sbstuff.js index bf7f4d1e..41ee6af0 100644 --- a/mods/sbstuff.js +++ b/mods/sbstuff.js @@ -3,7 +3,7 @@ elements.cooked_rice = { tempMin: 20, stateMin: "rice", tempHigh: 500, - stateHigh: ["ash", "charcoal"], + stateHigh: "charcoal", density: 699, color: "#c2b6b6", behavior: behaviors.LIQUID, @@ -16,37 +16,39 @@ elements.cooked_rice = { elements.rice = { breakInto: "flour", - viscosity: 10000, isFood: true, density: 696, tempHigh: 232, stateHigh: "cooked_rice", color: "#c8c8c8", - behavior: behaviors.LIQUID, + behavior: behaviors.POWDER, category: "food", state: "liquid", }; elements.moth = { tempHigh: 500, - stateHigh: "ash", + stateHigh: "dead_bug", + breakInto: "dead_bug", color: "#57381a", behavior: behaviors.FLY, category: "life", - state: "solid", + state: "liquid", }; elements.cotton_candy = { isFood: true, - tempHigh: 500, - stateHigh: "ash", + tempHigh: 200, + stateHigh: "sugar", density: 1000, - color: "#b6c7e3", + color: ["#b6c7e3", "#c54b4b", "#e7769c"], + singleColor: true, behavior: behaviors.POWDER, category: "food", state: "liquid", reactions: { - "water": { elem1: "sugar", elem2: null }, + "water": { elem1: "sugar", elem2: "water" }, + "sugar_water": { elem1: "sugar", elem2:"sugar_water", chance: 10 } } }; @@ -358,6 +360,7 @@ elements.cereal = { behavior: behaviors.STURDYPOWDER, category: "food", state: "liquid", + stain: 0.005 }; elements.sushi = { @@ -1692,6 +1695,47 @@ elements.liquid_filler = { state: "liquid" }; +elements.antimony = { + color: ["#4b90b8", "#a3bfd8", "#89a0b6", "#8798a7", "#738092"], + behavior: behaviors.WALL, + category: "solids", + state: "solid", + density: 6697, + tempHigh: 630, + stateHigh: "melted_antimony", + alias: "...sb?!" +}; + +elements.melted_antimony = { + color: ["#8fb2c7", "#7494b1", "#72a1cc", "#a3aaaf", "#a4aab3"], + behavior: behaviors.LIQUID, + category: "liquids", + state: "liquid", + density: 6697, + stain: 0.1, + tempLow: -270, + stateLowName: "antimony_ice" +}; + +elements.unstain = { + color: "#729fff", + behavior: [ + "XX|XX|XX", + "XX|XX|XX", + "XX|XX|XX" + ], + stain: -1, + tool: (pixel) => { + doStaining({ + element: "unstain", + x: pixel.x, + y: pixel.y + }) + }, + category: "tools", + state: "solid", +}; + elements.incinerate.category = "tools", elements.cook.category = "tools", elements.room_temp.category = "tools", From 46f34c6e85c6d27959172722a808c7d78ca60f14 Mon Sep 17 00:00:00 2001 From: Jayd-Rubies <155784127+Jayd-Rubies@users.noreply.github.com> Date: Thu, 15 Feb 2024 17:52:06 -0500 Subject: [PATCH 48/53] jaydstuff.js release --- mods/jaydstuff.js | 286 ++++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 286 insertions(+) create mode 100644 mods/jaydstuff.js diff --git a/mods/jaydstuff.js b/mods/jaydstuff.js new file mode 100644 index 00000000..75c752bb --- /dev/null +++ b/mods/jaydstuff.js @@ -0,0 +1,286 @@ +//jaydstuff +elements.super_raincloud = { + color: "#0000ff", + behavior: [ + "XX|M1%10|XX", + "M1%5|XX|M1%5", + "CR:water%40|CR:water%40|CR:water%40", + ], + category: "gases", + state: "gas", + density: 50, +}, +elements.deuterium = { + color: "#558bcf", + behavior: behaviors.GAS, + reactions: { + "oxygen": { elem1:null, elem2:"heavy_steam", tempMin:500 }, + "tritium": { elem1:"neutron", elem2:"helium", tempMin:100000000, temp1:150000000, temp2:150000000 }, + "fire": { elem1:"explosion", chance:0.005 }, + }, + category: "gases", + burn: 100, + burnTime: 2, + burnInto: ["fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","heavy_steam"], + tempLow: -253, + stateLow: "liquid_deuterium", + state: "gas", + density: 0.180, + conduct: 0.02, + colorOn: "#d6462d" +}, +elements.liquid_deuterium = { + color: "#97afcf", + behavior: behaviors.LIQUID, + reactions: { + "liquid_oxygen": { elem1:"heavy_ice", elem2:null }, + "oxygen": { elem1:"ice", elem2:null } + }, + category: "states", + burn: 100, + burnTime: 2, + temp: -255.879, + tempHigh: -252.879, + stateHigh: "hydrogen", + tempLow: -259.2, + state: "liquid", + density: 163.83, + hidden: true +}, +elements.tritium = { + color: "#558bcf", + behavior: [ + "M2|M1 AND CR:radiation%1|M2", + "M1|XX|M1", + "M2|M1 AND CR:radiation%0.5|M2", + ], + reactions: { + "oxygen": { elem1:null, elem2:"tritiated_steam", tempMin:500 }, + "deuterium": { elem1:"neutron", elem2:"helium", tempMin:100000000, temp1:150000000, temp2:150000000 }, + "fire": { elem1:"explosion", chance:0.005 }, + }, + category: "gases", + burn: 100, + burnTime: 2, + burnInto: ["fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","fire","steam"], + tempLow: -253, + stateLow: "liquid_tritium", + state: "gas", + density: 0.269, + conduct: 0.02, + colorOn: "#d6462d" +}, +elements.liquid_tritium = { + color: "#97afcf", + behavior: [ + "XX|CR:radiation%1|XX", + "M2|XX|M2", + "M1|M1|M1", + ], + reactions: { + "liquid_oxygen": { elem1:"tritiated_ice", elem2:null }, + "oxygen": { elem1:"ice", elem2:null } + }, + category: "states", + burn: 100, + burnTime: 2, + temp: -255.879, + tempHigh: -252.879, + stateHigh: "tritium", + tempLow: -259.2, + state: "liquid", + density: 213, + hidden: true +}, +elements.heavy_water = { + color: "#2167ff", + behavior: behaviors.LIQUID, + tempHigh: 101.4, + stateHigh: "heavy_steam", + tempLow: 0, + stateLow: "heavy_ice", + category: "liquids", + heatCapacity: 4.184, + reactions: { + // electrolysis: + "aluminum": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0025 }, + "zinc": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.015 }, + "steel": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 }, + "iron": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 }, + "tin": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.01 }, + "brass": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 }, + "bronze": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 }, + "copper": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 }, + "silver": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 }, + "gold": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 }, + }, + state: "liquid", + density: 1107, + conduct: 0.02, + stain: -0.5, + extinguish: true +}, +elements.heavy_steam = { + color: "#abd6ff", + behavior: behaviors.GAS, + reactions: { + "copper": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.01 }, + "bronze": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.005 }, + "iron": { elem1:"oxygen", elem2:"rust", chance:0.005 }, + "steel": { elem1:"oxygen", elem2:"rust", chance:0.004 }, + }, + temp: 150, + tempLow: 95, + extraTempLow: { + 0: "heavy_rime" + }, + stateLow: "heavy_water", + category: "gases", + state: "gas", + density: 1, + conduct: 0.002, + stain: -0.05, + alias: "heavy water vapor", + extinguish: true +}, +elements.heavy_ice = { + color: "#b2daeb", + behavior: behaviors.WALL, + temp: -5, + tempHigh: 5, + stateHigh: "heavy_water", + category: "solids", + state: "solid", + density: 1014.202, + breakInto: "heavy_snow" +}, +elements.tritiated_water = { + color: "#2167ff", + behavior: [ + "XX|CR:radiation%1|XX", + "M2|XX|M2", + "M1|M1|M1", + ], + tempHigh: 101.4, + stateHigh: "tritiated_steam", + tempLow: 0, + stateLow: "tritiated_ice", + category: "liquids", + heatCapacity: 4.184, + reactions: { + // electrolysis: + "aluminum": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0025 }, + "zinc": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.015 }, + "steel": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 }, + "iron": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0125 }, + "tin": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.01 }, + "brass": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 }, + "bronze": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.001 }, + "copper": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 }, + "silver": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 }, + "gold": { elem1:["deuterium","deuterium","oxygen"], charged:true, chance:0.0075 }, + }, + state: "liquid", + density: 1107, + conduct: 0.02, + stain: -0.5, + extinguish: true +}, +elements.tritiated_steam = { + color: "#abd6ff", + behavior: [ + "M2|M1 AND CR:radiation%1|M2", + "M1|XX|M1", + "M2|M1 AND CR:radiation%0.5|M2", + ], + reactions: { + "copper": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.01 }, + "bronze": { elem1:"oxygen", elem2:"oxidized_copper", chance:0.005 }, + "iron": { elem1:"oxygen", elem2:"rust", chance:0.005 }, + "steel": { elem1:"oxygen", elem2:"rust", chance:0.004 }, + }, + temp: 150, + tempLow: 95, + extraTempLow: { + 0: "heavy_rime" + }, + stateLow: "tritiated_water", + category: "gases", + state: "gas", + density: 0.6, + conduct: 0.002, + stain: -0.05, + alias: "tritiated water vapor", + extinguish: true +}, +elements.tritiated_ice = { + color: "#b2daeb", + behavior: [ + "XX|CR:radiation%0.25|XX", + "CR:radiation%0.25|XX|CR:radiation%0.25", + "XX|CR:radiation%0.25|XX", + ], + temp: -5, + tempHigh: 5, + stateHigh: "tritiated_water", + category: "solids", + state: "solid", + density: 1014.202, + breakInto: "tritiated_snow" +}, +elements.fusion = { + color: "#ffffff", + tool: function(pixel) { + pixel.temp = 100000000; + pixelTempCheck(pixel) + }, + category: "tools", +}, +elements.meese = { + color: "#996515", + behavior: [ + "XX|XX|XX", + "XX|FX%0.25|M2%0.5 AND BO", + "XX|M1|XX", + ], + category: "life" +}, +elements.fluoroantimonic_acid = { + color: ["#b5cf91","#a1ff5e","#288f2a"], + behavior: [ + "XX|DB%5|XX", + "DB%5 AND M2|XX|DB%5 AND M2", + "DB%5 AND M2|DB%10 AND M1|DB%5 AND M2", + ], + ignore: ["glass","rad_glass","glass_shard","rad_shard","stained_glass","baked_clay","acid_gas","neutral_acid","copper","gold","porcelain"], + category: "liquids", + state: "liquid", + density: 2885, + hidden: true, + stain: -0.1, +}, +elements.tritium_ice = { + color: "#b5d2ff", + behavior: [ + "XX|CR:radiation%0.25|XX", + "CR:radiation%0.25|XX|CR:radiation%0.25", + "XX|CR:radiation%0.25|XX", + ], + temp: -259, + tempHigh: -256, + stateHigh: "liquid_tritium", + category: "states", + state: "solid", + density: 258, +}, +elements.unstain = { + category: "tools", + stain: -1, + tool: (pixel) => { + doStaining({ + element: "unstain", + x: pixel.x, + y: pixel.y + }) + } +}; \ No newline at end of file From ec6ddaa176156996287050918353b0ca681611aa Mon Sep 17 00:00:00 2001 From: Alexthetransfem <124483815+theenchantedsword@users.noreply.github.com> Date: Thu, 15 Feb 2024 19:00:20 -0600 Subject: [PATCH 49/53] Update plants.js --- mods/plants.js | 109 ------------------------------------------------- 1 file changed, 109 deletions(-) diff --git a/mods/plants.js b/mods/plants.js index dd304907..23a68e1b 100644 --- a/mods/plants.js +++ b/mods/plants.js @@ -1063,115 +1063,6 @@ elements.mango_seed = { cooldown: defaultCooldown, seed: true, }; -function conditionTrue(condition, pixel){ - let p = pixel; - let string = ""; - condition = condition.split("!OR").join("||").split("&AND").join("&&").split("\"").join("") - - condition = eval(condition); - return condition; -} -let ifCondition = ""; -let currentProp = ""; -let currentPropValue = ""; -elements.propmachine = { - name: "PropMachine", - behavior: behaviors.WALL, - category: "machines", - noMix: true, -onSelect: function(pixel) { - - let item = prompt("enter range for prop changing."); - if(/^\d+$/.test(item)){ - num4 = parseInt(item); - } else { - alert("that is not an integer."); - } - exclude2 = prompt("Enter elements to exclude, seperate them with commas. You can also enter !IF if you wish to enter conditions for it to change the property and add the exclude elements.").replace(/\s/g, ""); - if(exclude2.includes("!IF")){ - exclude2.split("!IF").join(""); - ifCondition = prompt("Enter the condition for the property to change. List of variables you can access can be found at https://5455e34a-cfe9-4576-ac9c-6e64c061433d-00-1psic9s1cgla6.kirk.replit.dev/Mods/morechemistry/conditions%20for%20if.html"); - } else { ifCondition = '1 == 1'; } - exclude2.split(","); - if(exclude2.constructor == [].constructor){ - exclude2.push("propmachine"); - } else { - exclude2 += "propmachine"; - } - var answer1 = prompt("Warning - This tool may break the simulator if used incorrectly.\n\nEnter a pixel attribute to modify:",(currentProp||undefined)); - console.log(answer1) - if (!answer1) { return } - var answer2 = prompt("Now, enter a value for "+answer1+":",(currentPropValue||undefined)); - if (!answer2) { return } - var valueL = answer2.toLowerCase(); - if (valueL === "true") { answer2 = true } - else if (valueL === "false") { answer2 = false } - else if (valueL === "null") { answer2 = null } - else if (valueL === "undefined") { answer2 = undefined } - else if (answer1 === "color" && valueL[0] === "#") { - var rgb = hexToRGB(valueL); - answer2 = "rgb("+rgb.r+","+rgb.g+","+rgb.b+")"; - } - currentProp = answer1; - currentPropValue = answer2; - console.log(answer1); - var num = parseFloat(answer2); - if (!isNaN(num)) { answer2 = num } - currentPropValue = answer2; - logMessage("Prop: "+currentProp); - logMessage("Value: "+currentPropValue); -}, - tick: function(pixel) { - if(pixel.start == pixelTicks) { - pixel.range = num4; - pixel.condition = ifCondition; - pixel.prop = currentProp; - pixel.val = currentPropValue; - } - let range = mouseRange(pixel.x, pixel.y, pixel.range); - prop({ property: pixel.prop, value: pixel.val },range, exclude2, pixel.condition); - } -} -function prop(obj, range, exclude = [], condition = ""){ - let list = []; - for (var i = 0; i < range.length; i++) { - var x = range[i][0]; - var y = range[i][1]; - if (!isEmpty(x,y,true)) { - var pixel = pixelMap[x][y]; - list.push(pixel); - } - } - for (var i = 0; i < list.length; i++) { - if (!isEmpty(list[i].x, list[i].y, true)) { - var pixel = list[i]; - if (!exclude.includes(pixel.element) && conditionTrue(condition, pixel)){ - if(/^\d+$/.test(obj.value)){ - obj.value = parseInt(obj.value); - } - if (!obj.property) { return } - if (pixel[obj.property] !== undefined && typeof pixel[obj.property] !== typeof obj.value) { - logMessage("Error: "+obj.property+" type is "+typeof pixel[obj.property]+", not "+typeof obj.value+"."); - obj.property = null; - obj.value = null; - return; - } - if (obj.property === "element") { - changePixel(pixel, obj.value); - list.splice(list.indexOf(pixel),1); - return; - } - if (obj.property === "burning" && obj.value === "true") { - pixel.burnStart = pixelTicks; - list.splice(list.indexOf(pixel),1); - return; - } - pixel[obj.property] = obj.value; - list.splice(list.indexOf(pixel),1); - } - } - } -} elements.seed_maker = { category: "machines", behavior: behaviors.WALL, From 881483a9da755b9cb7e9c28e5fb95b8f31cffb31 Mon Sep 17 00:00:00 2001 From: Alexthetransfem <124483815+theenchantedsword@users.noreply.github.com> Date: Thu, 15 Feb 2024 19:12:08 -0600 Subject: [PATCH 50/53] Update morechemistry.js --- mods/morechemistry.js | 140 +++++++++++++++++++++--------------------- 1 file changed, 71 insertions(+), 69 deletions(-) diff --git a/mods/morechemistry.js b/mods/morechemistry.js index bcbb9122..ef6b8dd9 100644 --- a/mods/morechemistry.js +++ b/mods/morechemistry.js @@ -1386,77 +1386,79 @@ elements.sign = { } } } -document.body.innerHTML += ` -these are all properties of the pixel. another way to find pixel properties is using debug on a pixel, it will tell you the property and the value, like x and y, or, in plants.js, fruit. - - - +runAfterLoad(function(){ + document.body.innerHTML += ` + these are all properties of the pixel. another way to find pixel properties is using debug on a pixel, it will tell you the property and the value, like x and y, or, in plants.js, fruit. +
+ + + + + + + - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -
+ Variable + + Definition +
- Variable + p.color - Definition + The color of the pixel. it is defined as an RGB value.
- p.color - - The color of the pixel. it is defined as an RGB value. -
- p.x and p.y - - The x and y positions of the pixel. -
- p.element - - The element of the pixel. -
- p.clone - - Specific to cloners, specifies what the cloner clones. -
- wc and lc - - Specific to saplings, specifies what colour the wood is (wc) and what colour the leaves are (lc). -
- p.start - - The start tick of the pixel. -
- p.tick - - the amount of ticks that have happened so far in the game. -
-` -document.getElementById("extraInfo").innerHTML = ` -Changelog(NEW)FeedbackWikiRedditDiscord • Install OfflineVariables

v1.9.3 • 559 elements, with 0 hidden.

©2021-2024. All Rights Reserved.

-` + + + p.x and p.y + + + The x and y positions of the pixel. + + + + + p.element + + + The element of the pixel. + + + + + p.clone + + + Specific to cloners, specifies what the cloner clones. + + + + + wc and lc + + + Specific to saplings, specifies what colour the wood is (wc) and what colour the leaves are (lc). + + + + + p.start + + + The start tick of the pixel. + + + + + p.tick + + + the amount of ticks that have happened so far in the game. + + + + ` + document.getElementById("extraInfo").innerHTML = ` + Changelog(NEW)FeedbackWikiRedditDiscord • Install OfflineVariables

v1.9.3 • 559 elements, with 0 hidden.

©2021-2024. All Rights Reserved.

+ ` +} From a55f376ba6523a5cf3b99735480c03756ba941cb Mon Sep 17 00:00:00 2001 From: Alexthetransfem <124483815+theenchantedsword@users.noreply.github.com> Date: Thu, 15 Feb 2024 19:32:49 -0600 Subject: [PATCH 51/53] Update morechemistry.js --- mods/morechemistry.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/mods/morechemistry.js b/mods/morechemistry.js index ef6b8dd9..3549e61b 100644 --- a/mods/morechemistry.js +++ b/mods/morechemistry.js @@ -1461,4 +1461,4 @@ runAfterLoad(function(){ document.getElementById("extraInfo").innerHTML = ` Changelog(NEW)FeedbackWikiRedditDiscord • Install OfflineVariables

v1.9.3 • 559 elements, with 0 hidden.

©2021-2024. All Rights Reserved.

` -} +}); From a644a0ce1514ca851e3f9a4ee995a5273f88d1f0 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Thu, 15 Feb 2024 21:17:25 -0500 Subject: [PATCH 52/53] . --- mods/elem3.js | 4 ++-- mods/funny_liquid.js | 6 ++++++ mods/injector.js | 2 +- mods/life_eater.js | 2 +- 4 files changed, 10 insertions(+), 4 deletions(-) diff --git a/mods/elem3.js b/mods/elem3.js index 08a385b9..95e6059d 100644 --- a/mods/elem3.js +++ b/mods/elem3.js @@ -170462,7 +170462,7 @@ elements.e15514 = { }; elements.e15515 = { - name: "Niggah", + name: "No", behavior: behaviors.LIQUID, category: "elem3", state: "liquid", @@ -218466,7 +218466,7 @@ elements.e19879 = { }; elements.e19880 = { - name: "Nigga", + name: "No", behavior: behaviors.LIQUID, category: "elem3", state: "liquid", diff --git a/mods/funny_liquid.js b/mods/funny_liquid.js index 2afaed89..821ea0bd 100644 --- a/mods/funny_liquid.js +++ b/mods/funny_liquid.js @@ -1,3 +1,8 @@ +/* +This mod has been moved. +*/ + +/* elements.cum = { name: "cum", color: "#e6e1d5", @@ -610,3 +615,4 @@ runAfterLoad(function() { ] }; }); +*/ \ No newline at end of file diff --git a/mods/injector.js b/mods/injector.js index b1697c3d..4c385004 100644 --- a/mods/injector.js +++ b/mods/injector.js @@ -4,7 +4,7 @@ var structureMod = "mods/structure_test.js"; var rbtMod = "mods/randomness_but_tick.js"; if(enabledMods.includes(libraryMod) && enabledMods.includes(structureMod) && enabledMods.includes(rbtMod)) { - var injectorPoisonCategories = ["life","auto creepers","shit","cum","food","fantastic creatures","fey","auto_fey"]; + var injectorPoisonCategories = ["life","auto creepers","food","fantastic creatures","fey","auto_fey"]; var injectorPoisonBlacklist = ["injector_poison","dead_matter","poisoned_dirt"]; var injectorPoisonWhitelist = ["blood","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"]; var injectorPoisonSubstitutions = { diff --git a/mods/life_eater.js b/mods/life_eater.js index a7b7b07c..0ca0d1b1 100644 --- a/mods/life_eater.js +++ b/mods/life_eater.js @@ -7,7 +7,7 @@ if(!enabledMods.includes(fireMod)) { alert(`The ${fireMod} mod is required and has been automatically inserted (reload for this to take effect).`); } else { - var lifeEaterCategories = ["life","auto creepers","shit","cum","food","fantastic creatures","fey","auto_fey"]; + var lifeEaterCategories = ["life","auto creepers","food","fantastic creatures","fey","auto_fey"]; var lifeEaterBlacklist = ["life_eater_virus","life_eater_slurry","life_eater_infected_dirt"]; var lifeEaterWhitelist = ["blood","poop","blood_ice","wood","wood_plank","sawdust","straw","paper","birthpool","dried_poop","gloomfly","meat_monster","rotten_ravager","bone_beast","withery","withery_plant","banana","apple","rotten_apple","apioform_player","apioform_bee","apioform","apiodiagoform","sugar_cactus","sugar_cactus_seed","flowering_sugar_cactus","tree_branch","sap","silk","red_velvet","silk_velvet","ketchup", "enchanted_ketchup", "frozen_ketchup", "poisoned_ketchup", "frozen_poisoned_ketchup", "ketchup_spout", "ketchup_cloud", "poisoned_ketchup_cloud", "ketchup_snow", "ketchup_snow_cloud", "poisoned_ketchup_snow", "poisoned_ketchup_snow_cloud", "ketchup_gas", "poisoned_ketchup_gas", "ketchup_powder", "poisoned_ketchup_powder", "eketchup_spout", "ketchup_metal", "antiketchup", "dirty_ketchup", "ketchup_gold", "molten_ketchup_metal", "ketchup_fairy", "ketchup_metal_scrap", "ketchup_gold_scrap", "molten_ketchup_gold", "mycelium","vaccine","antibody","infection","sap","caramel","molasses","melted_chocolate","soda","mustard","fry_sauce","tomato_sauce","sugary_tomato_sauce","bio_ooze","zombie_blood","feather","tooth","decayed_tooth","plaque","tartar","bacteria","replacer_bacteria","pop_rocks"]; var lifeEaterSubstitutions = { From afb4fdb21ea223954369d6c301065ad26c564310 Mon Sep 17 00:00:00 2001 From: slweeb <91897291+slweeb@users.noreply.github.com> Date: Thu, 15 Feb 2024 21:17:28 -0500 Subject: [PATCH 53/53] Update mod-list.html --- mod-list.html | 2 -- 1 file changed, 2 deletions(-) diff --git a/mod-list.html b/mod-list.html index ec35b37d..38b5a83e 100644 --- a/mod-list.html +++ b/mod-list.html @@ -249,8 +249,6 @@ collab_mod.jsCreated by multiple people, adds random thingsmrapple, ilikepizza, stefanblox elem3.jsAdds all elements and combinations from Elemental 3 [Very Large]Sophie funny elements 2022-11-15.jsAdds a few curated randomly-generated elementsAlice -funny_liquid_2.jsAdds urineAlice -funny_liquid_3.jsAdds vomitAlice funny_solid.jsAdds fecesAlice haseulite.jsAdds Loona-related materials with various propertiesAlice iean.jsAdds lean and its ingredientsAlice